Bacúch magnetite deposit, Bacúch, Brezno District, Banská Bystrica Region, Slovakiai
| Regional Level Types | |
|---|---|
| Bacúch magnetite deposit | - not defined - |
| Bacúch | Municipality |
| Brezno District | District |
| Banská Bystrica Region | Region |
| Slovakia | Country |
Bacúch magnetite deposit, Carpathian Mountains, Europe
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 52' 9'' North , 19° 46' 53'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mýto pod Ďumbierom | 542 (2013) | 11.1km |
| Brezno | 21,331 (2015) | 12.8km |
| Čierny Balog | 5,234 (2012) | 16.6km |
| Demänovská Dolina | 203 (2015) | 18.3km |
| Liptovský Hrádok | 7,572 (2018) | 19.4km |
Mindat Locality ID:
302289
Long-form identifier:
mindat:1:2:302289:7
GUID (UUID V4):
930e10e0-c61a-448a-aec3-5419fe0a6f2d
Name(s) in local language(s):
, Bacúch, okres Brezno, Banskobystrický kraj, Slovenská republika
Magnetite in mica schists mined for iron ore.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
21 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuth Formula: Bi |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hingganite-(Nd) Formula: Nd2◻Be2Si2O8(OH)2 |
| ⓘ Hingganite-(Y) Formula: (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' |
| ⓘ 'Limonite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Monazite-(Nd) Formula: Nd(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(Nd) | 8.AD.50 | Nd(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Hingganite-(Nd) | 9.AJ. | Nd2◻Be2Si2O8(OH)2 |
| ⓘ | Hingganite-(Y) | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hingganite-(Nd) | Nd2◻Be2Si2O8(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Be | ⓘ Hingganite-(Nd) | Nd2◻Be2Si2O8(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(Nd) | Nd(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hingganite-(Nd) | Nd2◻Be2Si2O8(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hingganite-(Nd) | Nd2◻Be2Si2O8(OH)2 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(Nd) | Nd(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Y | Yttrium | |
| Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Monazite-(Nd) | Nd(PO4) |
| Nd | ⓘ Hingganite-(Nd) | Nd2◻Be2Si2O8(OH)2 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
Other Regions, Features and Areas containing this locality
CzechoslovakiaCountry
Eurasian PlateTectonic Plate
EuropeContinent
- Carpathian MountainsMountain Range
Slovakia
- Low TatrasMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
