Elverdton-Mt Desmond Copper Mines, Ravensthorpe Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Elverdton-Mt Desmond Copper Mines | Group of Mines |
| Ravensthorpe Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 39' 38'' South , 120° 0' 10'' East
Latitude & Longitude (decimal):
Type:
Group of Mines
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Ravensthorpe | 1,101 (2012) | 9.5km |
| Hopetoun | 584 (2014) | 34.2km |
Mindat Locality ID:
238884
Long-form identifier:
mindat:1:2:238884:0
GUID (UUID V4):
de10dd8a-22b4-48d5-b7d1-ae009c2da596
Located 12 kilometres south of Ravensthorpe. The Elverdton Mine poppet head and creamy green mullock pile can be seen east of the Ravensthorpe-Hopetoun Road. The Elverdton Mine sits at the southern end of the deposit, with a series of shallow pits following the vein north-east for about 500 metres. A gravel road to a scenic lookout intersects the vein halfway, and the diggings north of the road are considered the Mt Desmond Mine, and south of the road Elverdton.
Surface mining started here around 1900. The Elverdton Mine was operating between 1956-1972. A small potash operation for farm fertilizer continues, but beyond this mining ceased in 1972. There is much rubbish around the mine, and the mullock heap is busily eroding into a nearby stream. Azurite and malachite is common in the Mt Desmond section, while malachite only is common in the Elverdton section.
The mine occupies a north to north north-west trending, east dipping shear zone. This contains biotite granodiorite, plagioclase-hornblende-chlorite-quartz, metadolerite, metabasalt, quartz-plagioclase-biotite-chlorite-hornblende schist. Primary ore pyrrhotite, chalcopyrite, magnetite, rare ilmenite in quartz and trace galena. The oxidised zone is down to 26.5 metres contains malachite, azurite, covellite (and rare un-named silver-bismuth-tellurides (?) Marston 1979). This mineralised zone is 2-18 metres wide as irregular shoots in minor faults.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
17 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Andalusite Formula: Al2(SiO4)O |
| β Azurite Formula: Cu3(CO3)2(OH)2 References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β Chalcocite Formula: Cu2S |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' |
| β Covellite Formula: CuS |
| β Cuprite Formula: Cu2O References: |
| β Erythrite Formula: Co3(AsO4)2 · 8H2O |
| β 'Feldspar Group' |
| β Galena Formula: PbS |
| β 'Hornblende' |
| β Ilmenite Formula: Fe2+TiO3 |
| β 'Lepidolite' References: |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Malachite Formula: Cu2(CO3)(OH)2 References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β 'Psilomelane' |
| β Pyrite Formula: FeS2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 |
| β Rutile Formula: TiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Covellite | 2.CA.05a | CuS |
| β | Galena | 2.CD.10 | PbS |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| Group 4 - Oxides and Hydroxides | |||
| β | Cuprite | 4.AA.10 | Cu2O |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Erythrite | 8.CE.40 | Co3(AsO4)2 Β· 8H2O |
| Group 9 - Silicates | |||
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Chlorite Group' | - | |
| β | 'Feldspar Group' | - | |
| β | 'Hornblende' | - | |
| β | 'Lepidolite' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Psilomelane' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Erythrite | Co3(AsO4)2 · 8H2O |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Cuprite | Cu2O |
| O | β Quartz | SiO2 |
| O | β Erythrite | Co3(AsO4)2 · 8H2O |
| O | β Rutile | TiO2 |
| O | β Andalusite | Al2(SiO4)O |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Ilmenite | Fe2+TiO3 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | Aluminium | |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Quartz | SiO2 |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Covellite | CuS |
| S | β Chalcocite | Cu2S |
| S | β Galena | PbS |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | β Rutile | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Fe | Iron | |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Co | Cobalt | |
| Co | β Erythrite | Co3(AsO4)2 · 8H2O |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Cuprite | Cu2O |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Covellite | CuS |
| Cu | β Chalcocite | Cu2S |
| As | Arsenic | |
| As | β Erythrite | Co3(AsO4)2 · 8H2O |
| Pb | Lead | |
| Pb | β Galena | PbS |
Other Regions, Features and Areas containing this locality
Australia
- Central Australian ElementCraton
- Western Australia
- Albany-Fraser OrogenOrogen
- Northern ForelandOrogen
- Ravensthorpe Nickel Metallogenic ProvinceGeologic Province
- Yilgarn CratonCraton
- Albany-Fraser OrogenOrogen
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Elverdton-Mt Desmond Copper Mines, Ravensthorpe Shire, Western Australia, Australia