Grieves Siding prospect, Zeehan mineral field, Zeehan mining district, West Coast municipality, Tasmania, Australiai
| Regional Level Types | |
|---|---|
| Grieves Siding prospect | Prospect |
| Zeehan mineral field | - not defined - |
| Zeehan mining district | Mining District |
| West Coast municipality | Municipality |
| Tasmania | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 59' 41'' South , 145° 22' 0'' East
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Zeehan | 845 (2012) | 12.6km |
| Strahan | 637 (2012) | 17.8km |
| West Strahan | 637 (2014) | 18.0km |
| Queenstown | 2,352 (2012) | 18.3km |
| Gormanston | 169 (2014) | 21.0km |
Mindat Locality ID:
132889
Long-form identifier:
mindat:1:2:132889:2
GUID (UUID V4):
c544f3f3-8f7e-4643-a0c1-dc6325ca4de5
A Pb-Zn prospect presently under intensive exploration. Galena and sphalerite are disseminated in Gordon limestone and peat, with some unusual minerals, atypical of the Zeehan field. At the foot of the Professor Range, (Grieves Siding), about 15km S of Zeehan.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
23 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Anglesite Formula: PbSO4 |
| β Anhydrite Formula: CaSO4 |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Baileychlore Formula: (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 References: |
| β Chromite Formula: Fe2+Cr3+2O4 |
| β Dolomite Formula: CaMg(CO3)2 |
| β Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 |
| β Franklinite Formula: Zn2+Fe3+2O4 |
| β Galena Formula: PbS References: |
| β Gunningite Formula: ZnSO4 · H2O |
| β Gypsum Formula: CaSO4 · 2H2O |
| β Hendricksite Formula: KZn3(Si3Al)O10(OH)2 |
| β Kaolinite Formula: Al2(Si2O5)(OH)4 |
| β Kegelite Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| β Pyrite Formula: FeS2 |
| β Quartz Formula: SiO2 |
| β Rutile Formula: TiO2 |
| β Silver Formula: Ag |
| β Sphalerite Formula: ZnS References: |
| β Sulphur Formula: S8 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Silver | 1.AA.05 | Ag |
| β | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Galena | 2.CD.10 | PbS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| β | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anhydrite | 7.AD.30 | CaSO4 |
| β | Anglesite | 7.AD.35 | PbSO4 |
| β | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| β | Gunningite | 7.CB.05 | ZnSO4 Β· H2O |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| Group 9 - Silicates | |||
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Hendricksite | 9.EC.20 | KZn3(Si3Al)O10(OH)2 |
| β | Baileychlore | 9.EC.55 | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| β | Kegelite | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| H | β Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | β Gunningite | ZnSO4 · H2O |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| C | Carbon | |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Anglesite | PbSO4 |
| O | β Anhydrite | CaSO4 |
| O | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| O | β Chromite | Fe2+Cr23+O4 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | β Franklinite | Zn2+Fe23+O4 |
| O | β Gunningite | ZnSO4 · H2O |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | β Quartz | SiO2 |
| O | β Rutile | TiO2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Al | β Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Si | β Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| P | Phosphorus | |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Anglesite | PbSO4 |
| S | β Anhydrite | CaSO4 |
| S | β Galena | PbS |
| S | β Gunningite | ZnSO4 · H2O |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | β Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| S | β Sulphur | S8 |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Anhydrite | CaSO4 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Rutile | TiO2 |
| Cr | Chromium | |
| Cr | β Chromite | Fe2+Cr23+O4 |
| Fe | Iron | |
| Fe | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Fe | β Chromite | Fe2+Cr23+O4 |
| Fe | β Franklinite | Zn2+Fe23+O4 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | β Pyrite | FeS2 |
| Zn | Zinc | |
| Zn | β Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Zn | β Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | β Franklinite | Zn2+Fe23+O4 |
| Zn | β Gunningite | ZnSO4 · H2O |
| Zn | β Hendricksite | KZn3(Si3Al)O10(OH)2 |
| Zn | β Sphalerite | ZnS |
| Ag | Silver | |
| Ag | β Silver | Ag |
| Pb | Lead | |
| Pb | β Anglesite | PbSO4 |
| Pb | β Galena | PbS |
| Pb | β Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | β Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
Geochronology
Mineralization age: Phanerozoic : 541 Β± 1.0 Ma to 0 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||||||||||||||||||||||||||||||||
| Cenozoic | |||||||||||||||||||||||||||||||||||||
| Quaternary |
| ||||||||||||||||||||||||||||||||||||
| Paleozoic | |||||||||||||||||||||||||||||||||||||
| Ordovician | |||||||||||||||||||||||||||||||||||||
| Late/Upper Ordovician |
| ||||||||||||||||||||||||||||||||||||
| Middle Ordovician |
| ||||||||||||||||||||||||||||||||||||
| Early/Lower Ordovician |
| ||||||||||||||||||||||||||||||||||||
| Cambrian |
| ||||||||||||||||||||||||||||||||||||
Other Regions, Features and Areas containing this locality
Australia
- Delamerian OrogenOrogen
- Tasmania
- Thylacine ProvinceGeologic Province
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
