Stainz, Deutschlandsberg District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Stainz | Municipality |
| Deutschlandsberg District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Mindat Locality ID:
215855
Long-form identifier:
mindat:1:2:215855:9
GUID (UUID V4):
6585c813-bb03-4f69-ba0c-2701978e65da
Other Languages:
French:
Stainz, District de Deutschlandsberg, Styrie, Autriche
German:
Stainz, Bezirk Deutschlandsberg, Steiermark, Γsterreich
Italian:
Stainz, distretto di Deutschlandsberg, Stiria, Austria
Russian:
Π¨ΡΠ°ΠΉΠ½Ρ, ΠΠΎΠΉΡΠ»Π°Π½Π΄ΡΠ±Π΅ΡΠ³, Π¨ΡΠΈΡΠΈΡ, ΠΠ²ΡΡΡΠΈΡ
Simplified Chinese:
ζ½ζ³°ε θ¨, εΎ·ζεΏε
°θ¨θ΄ζ ΌεΏ, ζ½ζ³°ηΎι¦¬ε
ε·, ε₯₯ε°ε©
Spanish:
Stainz, Distrito de Deutschlandsberg, Estado de Estiria, Austria
Czech:
Stainz, Okres Deutschlandsberg, Ε tΓ½rsko, Rakousko
Danish:
Stainz, Steiermark, Γstrig
Dutch:
Stainz, Deutschlandsberg, Stiermarken, Oostenrijk
Esperanto:
Stainz, Distrikto Deutschlandsberg, Stirio, AΕstrio
Farsi/Persian:
Ψ§Ψ΄ΨͺΨ§ΫΩΨͺΨ³, Ψ―ΩΫΪΩΩΨ―Ψ³Ψ¨Ψ±Ϊ―, Ψ§Ψ΄ΨͺΨ§ΫΨ±Ω
Ψ§Ψ±Ϊ©, Ψ§ΨͺΨ±ΫΨ΄
Hungarian:
Stainz, Deutschlandsbergi jΓ‘rΓ‘s, StΓ‘jerorszΓ‘g, Ausztria
Kazakh (Cyrillic Script):
Π¨ΡΠ°ΠΉΠ½Ρ, ΠΡΡΡΡΠΈΡ
Norwegian (Nynorsk):
Stainz, Distriktet Deutschlandsberg, Steiermark, Austerrike
Polish:
Stainz, Powiat Deutschlandsberg, Styria, Austria
Slovak:
Stainz, Deutschlandsberg, Ε tajersko, RakΓΊsko
Slovenian:
Ε Δavnica, Ε tajerska, Avstrija
Swedish:
Stainz, Deutschlandsberg, Steiermark, Γsterrike
Uzbek (Latin Script):
Stainz, Deutschlandsberg, Avstriya
Vietnamese:
Stainz, Deutschlandsberg, Steiermark, Γo
VolapΓΌk:
Stainz, LΓΆsterΓ€n
Waray:
Stainz, Deutschlandsberg, Styria, Austrya
NOTE on the mineral list: The moldavite found here actually is part of the normal moldavite strewn field; it was transported (traded?) to Stainz by prehistoric humans. Compare also the moldavite from the Gudenus Cave.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities23 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Localities: |
| β Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| β Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β Diopside Formula: CaMgSi2O6 |
| β Epsomite Formula: MgSO4 · 7H2O |
| β 'Feldspar Group' |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 |
| β Grossular Formula: Ca3Al2(SiO4)3 |
| β Gypsum Formula: CaSO4 · 2H2O |
| β Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| β 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| β 'Hornblende' |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O |
| β Microcline Formula: K(AlSi3O8) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| β Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| β Pyrite Formula: FeS2 Localities: References: |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 Localities: References: |
| β Rutile Formula: TiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Stellerite Formula: Ca4(Si28Al8)O72 · 28H2O |
| β Titanite Formula: CaTi(SiO4)O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Zircon Formula: Zr(SiO4) Localities: |
| β Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Epsomite | 7.CB.40 | MgSO4 Β· 7H2O |
| β | Pickeringite | 7.CB.85 | MgAl2(SO4)4 Β· 22H2O |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| Group 9 - Silicates | |||
| β | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| β | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 Β· 12H2O |
| β | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 Β· 26H2O |
| β | Stellerite | 9.GE.15 | Ca4(Si28Al8)O72 Β· 28H2O |
| Unclassified | |||
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Hornblende' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'Feldspar Group' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Epsomite | MgSO4 · 7H2O |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Diopside | CaMgSi2O6 |
| O | β Epsomite | MgSO4 · 7H2O |
| O | β Grossular | Ca3Al2(SiO4)3 |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | β Quartz | SiO2 |
| O | β Rutile | TiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Zircon | Zr(SiO4) |
| O | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Epsomite | MgSO4 · 7H2O |
| Mg | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Grossular | Ca3Al2(SiO4)3 |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Grossular | Ca3Al2(SiO4)3 |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Epsomite | MgSO4 · 7H2O |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | Calcium | |
| Ca | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Grossular | Ca3Al2(SiO4)3 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Rutile | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 15 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 11.6 Ma (Miocene) | ||||||
| Oldest Fossil Listed | 16.0 Ma (Miocene) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Stainz |
|---|---|
| Wikidata ID: | Q685128 |
| GeoNames ID: | 7872275 |
Localities in this Region
- Styria
- Deutschlandsberg District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Stainz, Deutschlandsberg District, Styria, Austria