Muzeinyi Valley, Inyl'chek Range, Issyk-Kul Region, Kyrgyzstani
| Regional Level Types | |
|---|---|
| Muzeinyi Valley | Valley |
| Inyl'chek Range | Mountain Range |
| Issyk-Kul Region | Region |
| Kyrgyzstan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude:
42° North , 77° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~191km
Locality type:
Name(s) in local language(s):
, ΠΡΡΡΠΊ-ΠΡΠ»ΡΡΠΊΠ°Ρ ΠΎΠ±Π»Π°ΡΡΡ (Π«ΡΡΠΊ-ΠΣ©Π» ΠΎΠ±Π»ΡΡΡ; Issyk-Kul'skaja oblast'; IsΔ±q-KΓΆl oblusu), ΠΡΡΠ³ΡΠ·ΡΡΠ°Π½ (ΠΠΈΡΠ³ΠΈΠ·ΠΈΡ; ΠΡΡΠ³ΡΠ· Π Π΅ΡΠΏΡΠ±Π»ΠΈΠΊΠ°ΡΡ; ΠΠΈΡΠ³ΠΈΠ·ΡΠΊΠ°Ρ Π Π΅ΡΠΏΡΠ±Π»ΠΈΠΊΠ°)
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities23 valid minerals. 2 (TL) - type locality of valid minerals.
Detailed Mineral List:
| β Alabandite Formula: MnS Reference: L.A. Pautov data |
| β Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 Reference: Pautov, L.A., Khvorov, P.V., Ignatenko, K.I. (1989) Alleganyte from rhodonite rocks of Inylchek range (the first description of alleganyte from USSR). Novye dannye o mineralah SSSR (New data on minerals of USSR), Moscow, Nauka, 162-166. |
| β Baryte Formula: BaSO4 Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Cassiterite Formula: SnO2 Reference: L.A. Pautov data |
| β Galena Formula: PbS Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
β Hejtmanite Formula: Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Helvine Formula: Be3Mn2+4(SiO4)3S Reference: L.A. Pautov data |
| β HΓΌbnerite Formula: MnWO4 Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
β Khristovite-(Ce) (TL) Formula: {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) Type Locality: Reference: Pautov, L.A., Khorov, P.V., Ignatenko, K.I., Sokolova, E.V., and Nadezhina, T.N. (1993) Khristovite-(Ce), (Ca,REE)REE(Mg,Fe)AlMnSi3O11(OH)(F,O), a new mineral of the epidote group. Zapiski Vserossiyskogo Mineralogicheskogo Obshchestva: 122(3): 103-111 (in Russian). Jambor, J.L., Puziewicz, J., Roberts, A.C. (1995) New mineral names. American Mineralogist, 80, 404-409 (405).; Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow. |
| β Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 Reference: L.A. Pautov data |
| β Manganosite Formula: MnO Reference: L.A. Pautov data |
| β Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Monazite-(Ce) Formula: Ce(PO4) Reference: L.A. Pautov data |
| β Pabstite Formula: Ba(Sn,Ti)(Si3O9) Reference: Pavel M. Kartashov data of 2014, L.A. Pautov specimen |
| β Pyrolusite Formula: Mn4+O2 Reference: L.A. Pautov data |
| β Pyrophanite Formula: Mn2+TiO3 Reference: L.A. Pautov data |
| β Quartz Formula: SiO2 Reference: L.A. Pautov data; Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Rhodochrosite Formula: MnCO3 Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Rhodonite Formula: CaMn3Mn[Si5O15] Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Scheelite Formula: Ca(WO4) Reference: L.A. Pautov data |
| β Sonolite Formula: Mn2+9(SiO4)4(OH)2 Reference: Pautov, L.A., Ignatenko, K.I., Belakovskii, D.I. (1990) New data on sonolite. Zapiski Vserossiiskogo Mineralogicheskogo Obshchestva, N3, 98-101. |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 Reference: L.A. Pautov data |
| β Tephroite Formula: Mn2+2SiO4 Reference: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow |
| β Vistepite (TL) Formula: SnMn4B2Si4O16(OH)2 Type Locality: Description: Found in rhodonite ores localized in biotite-quartz hornfels at the exocontact of the Inyl'chek Sn-bearing granite massif. Reference: Pautov, L.A., Belakovskii, D.I., Skala, R., et al. (1992) Vistepite MnSnB2Si5O20 - a new borosilicate of manganese and tin. Zapiski Vserossiiskogo Mineralogicheskogo Obshchestva, 121(4), 107-112.; Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Alabandite | 2.CD.10 | MnS |
| β | Galena | 2.CD.10 | PbS |
| Group 4 - Oxides and Hydroxides | |||
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | HΓΌbnerite | 4.DB.30 | MnWO4 |
| β | Manganosite | 4.AB.25 | MnO |
| β | Pyrolusite | 4.DB.05 | Mn4+O2 |
| β | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| β | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| β | Hejtmanite | 9.BE.55 | Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
| β | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| β | Khristovite-(Ce) (TL) | 9.BG.05 | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| β | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| β | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| β | Pabstite | 9.CA.05 | Ba(Sn,Ti)(Si3O9) |
| β | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| β | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| β | Vistepite (TL) | 9.BD.25 | SnMn4B2Si4O16(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| H | β Vistepite | SnMn4B2Si4O16(OH)2 |
| H | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| H | β Sonolite | Mn92+(SiO4)4(OH)2 |
| H | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Be | Beryllium | |
| Be | β Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | β Vistepite | SnMn4B2Si4O16(OH)2 |
| C | Carbon | |
| C | β Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| O | β Vistepite | SnMn4B2Si4O16(OH)2 |
| O | β Rhodonite | CaMn3Mn[Si5O15] |
| O | β Tephroite | Mn22+SiO4 |
| O | β Rhodochrosite | MnCO3 |
| O | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | β Baryte | BaSO4 |
| O | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| O | β HΓΌbnerite | MnWO4 |
| O | β Sonolite | Mn92+(SiO4)4(OH)2 |
| O | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | β Manganosite | MnO |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Pyrophanite | Mn2+TiO3 |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Quartz | SiO2 |
| O | β Pyrolusite | Mn4+O2 |
| O | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | β Cassiterite | SnO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Helvine | Be3Mn42+(SiO4)3S |
| O | β Pabstite | Ba(Sn,Ti)(Si3O9) |
| F | Fluorine | |
| F | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| F | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Mg | Magnesium | |
| Mg | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Mg | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | Aluminium | |
| Al | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Al | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | Silicon | |
| Si | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Si | β Vistepite | SnMn4B2Si4O16(OH)2 |
| Si | β Rhodonite | CaMn3Mn[Si5O15] |
| Si | β Tephroite | Mn22+SiO4 |
| Si | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | β Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Quartz | SiO2 |
| Si | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | β Helvine | Be3Mn42+(SiO4)3S |
| Si | β Pabstite | Ba(Sn,Ti)(Si3O9) |
| P | Phosphorus | |
| P | β Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | β Baryte | BaSO4 |
| S | β Alabandite | MnS |
| S | β Helvine | Be3Mn42+(SiO4)3S |
| S | β Galena | PbS |
| K | Potassium | |
| K | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Ca | β Rhodonite | CaMn3Mn[Si5O15] |
| Ca | β Scheelite | Ca(WO4) |
| Ti | Titanium | |
| Ti | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | β Pyrophanite | Mn2+TiO3 |
| Ti | β Pabstite | Ba(Sn,Ti)(Si3O9) |
| Mn | Manganese | |
| Mn | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Mn | β Vistepite | SnMn4B2Si4O16(OH)2 |
| Mn | β Rhodonite | CaMn3Mn[Si5O15] |
| Mn | β Tephroite | Mn22+SiO4 |
| Mn | β Rhodochrosite | MnCO3 |
| Mn | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Mn | β HΓΌbnerite | MnWO4 |
| Mn | β Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | β Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | β Alabandite | MnS |
| Mn | β Manganosite | MnO |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Mn | β Pyrophanite | Mn2+TiO3 |
| Mn | β Pyrolusite | Mn4+O2 |
| Mn | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mn | β Helvine | Be3Mn42+(SiO4)3S |
| Sn | Tin | |
| Sn | β Vistepite | SnMn4B2Si4O16(OH)2 |
| Sn | β Cassiterite | SnO2 |
| Sn | β Pabstite | Ba(Sn,Ti)(Si3O9) |
| Ba | Barium | |
| Ba | β Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | β Baryte | BaSO4 |
| Ba | β Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | β Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | β Pabstite | Ba(Sn,Ti)(Si3O9) |
| Ce | Cerium | |
| Ce | β Khristovite-(Ce) | {CaCe}{MgAlMn2+}(Si2O7)(SiO4)F(OH) |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | β HΓΌbnerite | MnWO4 |
| W | β Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | β Galena | PbS |
Localities in this Region
- Issyk-Kul Region
- Inyl'chek Range
- Muzeinyi Valley
- Inyl'chek Range
Other Regions, Features and Areas containing this locality
AsiaContinent
- Tian ShanGroup of Mountain Ranges
Eurasian PlateTectonic Plate
Soviet Union (1922-1991)Country
TurkestanArea
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Rhodonite occurrence, Muzeinyi Valley, Inyl'chek Range, Issyk-Kul Region, Kyrgyzstan