Yarra Ranges Shire, Victoria, Australiai
| Regional Level Types | |
|---|---|
| Yarra Ranges Shire | Shire |
| Victoria | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Lilydale | 15,649 (2015) |
| Kilsyth | 10,043 (2015) |
| Mount Evelyn | 9,100 (2015) |
| Chirnside Park | 9,092 (2015) |
| Healesville | 7,098 (2013) |
| Upwey | 6,760 (2015) |
Mindat Locality ID:
225847
Long-form identifier:
mindat:1:2:225847:1
GUID (UUID V4):
4350f1bc-8cb8-43b0-804d-59bd1c3cb161
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities32 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Arsenopyrite Formula: FeAsS |
| β Azurite Formula: Cu3(CO3)2(OH)2 |
| β Baryte Formula: BaSO4 |
| β Berthierite Formula: FeSb2S4 |
| β Calcite Formula: CaCO3 |
| β Cassiterite Formula: SnO2 |
| β Cerussite Formula: PbCO3 |
| β Cervantite Formula: Sb3+Sb5+O4 |
| β 'Chabazite' |
| β Chalcopyrite Formula: CuFeS2 |
| β Descloizite Formula: PbZn(VO4)(OH) |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Galena Formula: PbS |
| β Gold Formula: Au Localities: |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Opal Formula: SiO2 · nH2O |
| β Opal var. Opal-AN Formula: SiO2 · nH2O |
| β Orthoclase Formula: K(AlSi3O8) |
| β Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl |
| β Pyrite Formula: FeS2 |
| β Pyrrhotite Formula: Fe1-xS |
| β Quartz Formula: SiO2 Localities: Reported from at least 7 localities in this region. |
| β Quartz var. Smoky Quartz Formula: SiO2 |
| β Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Scolecite ? Formula: CaAl2Si3O10 · 3H2O |
| β Senarmontite Formula: Sb2O3 |
| β Smithsonite Formula: ZnCO3 |
| β Sphalerite Formula: ZnS |
| β Spinel Formula: MgAl2O4 |
| β Spinel var. Pleonaste Formula: (Mg,Fe)Al2O4 |
| β Stellerite Formula: Ca4(Si28Al8)O72 · 28H2O |
| β 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| β Stibnite Formula: Sb2S3 Localities: References: |
| β Tripuhyite Formula: Fe3+Sb5+O4 |
| β Valentinite Formula: Sb2O3 |
| β 'Wolframite Group' |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Galena | 2.CD.10 | PbS |
| β | Stibnite | 2.DB.05 | Sb2S3 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Berthierite | 2.HA.20 | FeSb2S4 |
| Group 4 - Oxides and Hydroxides | |||
| β | Spinel var. Pleonaste | 4.BB.05 | (Mg,Fe)Al2O4 |
| β | 4.BB.05 | MgAl2O4 | |
| β | Senarmontite | 4.CB.50 | Sb2O3 |
| β | Valentinite | 4.CB.55 | Sb2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| β | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| β | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| β | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Smithsonite | 5.AB.05 | ZnCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Scolecite ? | 9.GA.05 | CaAl2Si3O10 Β· 3H2O |
| β | Stellerite | 9.GE.15 | Ca4(Si28Al8)O72 Β· 28H2O |
| Unclassified | |||
| β | 'Chabazite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Descloizite | PbZn(VO4)(OH) |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Scolecite | CaAl2Si3O10 · 3H2O |
| H | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | β Stibiconite | Sb3+Sb25+O6(OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Calcite | CaCO3 |
| C | β Cerussite | PbCO3 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | β Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Baryte | BaSO4 |
| O | β Calcite | CaCO3 |
| O | β Cassiterite | SnO2 |
| O | β Cerussite | PbCO3 |
| O | β Cervantite | Sb3+Sb5+O4 |
| O | β Descloizite | PbZn(VO4)(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Scolecite | CaAl2Si3O10 · 3H2O |
| O | β Senarmontite | Sb2O3 |
| O | β Smithsonite | ZnCO3 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spinel | MgAl2O4 |
| O | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | β Stibiconite | Sb3+Sb25+O6(OH) |
| O | β Tripuhyite | Fe3+Sb5+O4 |
| O | β Valentinite | Sb2O3 |
| O | β Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| O | β Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Spinel | MgAl2O4 |
| Mg | β Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Al | Aluminium | |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Scolecite | CaAl2Si3O10 · 3H2O |
| Al | β Spinel | MgAl2O4 |
| Al | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | β Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Si | Silicon | |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Scolecite | CaAl2Si3O10 · 3H2O |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Baryte | BaSO4 |
| S | β Berthierite | FeSb2S4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Galena | PbS |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| S | β Stibnite | Sb2S3 |
| Cl | Chlorine | |
| Cl | β Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | β Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | β Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| V | Vanadium | |
| V | β Descloizite | PbZn(VO4)(OH) |
| Fe | Iron | |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Berthierite | FeSb2S4 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Tripuhyite | Fe3+Sb5+O4 |
| Fe | β Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | β Descloizite | PbZn(VO4)(OH) |
| Zn | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | β Smithsonite | ZnCO3 |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | β Berthierite | FeSb2S4 |
| Sb | β Cervantite | Sb3+Sb5+O4 |
| Sb | β Senarmontite | Sb2O3 |
| Sb | β Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | β Stibnite | Sb2S3 |
| Sb | β Tripuhyite | Fe3+Sb5+O4 |
| Sb | β Valentinite | Sb2O3 |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| Au | Gold | |
| Au | β Gold | Au |
| Pb | Lead | |
| Pb | β Cerussite | PbCO3 |
| Pb | β Descloizite | PbZn(VO4)(OH) |
| Pb | β Galena | PbS |
| Pb | β Phosphohedyphane | Ca2Pb3(PO4)3Cl |
Fossils
There are 10 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 80 | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 56.0 Ma (Paleocene) | ||||||||||||||||||
| Oldest Fossil Listed | 419 Ma (Silurian) | ||||||||||||||||||
| Stratigraphic Units |
| ||||||||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||||||||
| Fossil Localities | Click to show 10 fossil localities |
Localities in this Region
- Victoria
- Victoria
Other Regions, Features and Areas that Intersect
Australia
- Great Dividing RangeMountain Range
- Lachlan OrogenOrogen
- Melbourne-Mathinna ZoneZone (Tectonic)
- Victoria
- Selwyn ProvinceGeologic Province
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Hoddles Creek, Yarra Ranges Shire, Victoria, Australia