StraΓburg, Sankt Veit an der Glan District, Carinthia, Austriai
| Regional Level Types | |
|---|---|
| StraΓburg | Municipality |
| Sankt Veit an der Glan District | District |
| Carinthia | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Locality type:
Largest Settlements:
| Place | Population |
|---|---|
| StraΓburg-Stadt | 1,255 (2018) |
Other Languages:
French:
StraΓburg, District de Sankt Veit an der Glan, Carinthie, Autriche
German:
StraΓburg, Bezirk Sankt Veit an der Glan, KΓ€rnten, Γsterreich
Italian:
StraΓburg, distretto di Sankt Veit an der Glan, Carinzia, Austria
Russian:
Π¨ΡΡΠ°ΡΠ±ΡΡΠ³, Π‘Π°Π½ΠΊΡ-Π€Π°ΠΉΡ-Π°Π½-Π΄Π΅Ρ-ΠΠ»Π°Π½, ΠΠ°ΡΠΈΠ½ΡΠΈΡ, ΠΠ²ΡΡΡΠΈΡ
Spanish:
StraΓburg, Distrito de Sankt Veit an der Glan, Estado de Carintia, Austria
Bulgarian:
Π©ΡΠ°ΡΠ±ΡΡΠ³, ΠΠ°ΡΠΈΠ½ΡΠΈΡ, ΠΠ²ΡΡΡΠΈΡ
Cebuano:
StraΓburg , Politischer Bezirk Sankt Veit an der Glan, KΓ€rnten, Awstriya
Dutch:
StraΓburg, Sankt Veit an der Glan, KarinthiΓ«, Oostenrijk
Esperanto:
StraΓburg , Distrikto Sankt Veit an der Glan, Karintio, AΕstrio
Farsi/Persian:
Ψ§Ψ΄ΨͺΨ±Ψ§Ψ³Ψ¨ΩΨ±Ϊ―, ΩΨ§ΨΫΩ Ψ²ΩΪ©Ψͺ ΩΨ§ΫΨͺ Ψ’Ω Ψ―Ψ± Ϊ―ΩΨ§Ω, Ϊ©Ψ±ΩΨͺΩ, Ψ§ΨͺΨ±ΫΨ΄
Hungarian:
StraΓburg, Sankt Veit an der Glan-i jΓ‘rΓ‘s, Karintia, Ausztria
Japanese:
γ·γ₯γγ©γΌγΉγγ«γ― , γΆγ³γ―γγ»γγ‘γ€γγ»γ’γ³γ»γγ’γ»γ°γ©γ³ι‘, γ±γ«γ³γγ³ε·, γͺγΌγΉγγͺγ’
Kazakh (Cyrillic Script):
Π¨ΡΡΠ°ΡΠ±ΡΡΠ³, ΠΡΡΡΡΠΈΡ
Polish:
StraΓburg, Powiat Sankt Veit an der Glan, Karyntia, Austria
Portuguese:
StraΓburg, Sankt Veit an der Glan, CarΓntia, Γustria
Romanian:
StraΓburg, Districtul Sankt Veit an der Glan, Carintia, Austria
Serbo-Croatian:
StraΓburg, Sankt Veit an der Glan, KoruΕ‘ka, Austrija
Slovak:
StraΓburg, Sankt Veit an der Glan, KorutΓ‘nsko, RakΓΊsko
Slovenian:
StraΓburg, Ε entvid ob Glini, KoroΕ‘ka, Avstrija
Swedish:
Strassburg, Sankt Veit an der Glan, KΓ€rnten, Γsterrike
Uzbek (Latin Script):
StraΓburg, Avstriya
Vietnamese:
StraΓburg, Sankt Veit an der Glan, KΓ€rnten, Γo
VolapΓΌk:
StraΓburg, LΓΆsterΓ€n
Waray:
StraΓburg, Sankt Veit an der Glan, Carinthia, Austrya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities36 valid minerals.
Detailed Mineral List:
| β Anglesite Formula: PbSO4 Localities: Reference: A.Pichler (2003) |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| β Arsenopyrite Formula: FeAsS Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Azurite Formula: Cu3(CO3)2(OH)2 Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Baryte Formula: BaSO4 Localities: Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
| β Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 Reference: A.Pichler (2003) |
| β 'Bindheimite' Formula: Pb2Sb2O6O Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Boulangerite Formula: Pb5Sb4S11 Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Bournonite Formula: PbCuSbS3 Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Calcite Formula: CaCO3 Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Cerussite Formula: PbCO3 Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Chalcanthite Formula: CuSO4 · 5H2O Localities: Reference: H. Meixner: Der Karinthin 74:226-231 (1976) |
| β Chalcopyrite Formula: CuFeS2 Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unteraich (Moschitzberg), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Covellite Formula: CuS Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Cuprite Formula: Cu2O Locality: Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: Pichler (2003) |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: H. Meixner: Der Karinthin 40:83-89 (1960) |
| β Galena Formula: PbS Localities: Reported from at least 6 localities in this region. Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Reference: H. Meixner: Der Karinthin 40:83-89 (1960) |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: Reference: H. Meixner: Carinthia II 163./83.:112-113 (1973) |
| β Greenockite Formula: CdS Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| β Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unterfarcha, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Lepidocrocite Formula: γ-Fe3+O(OH) Localities: Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
| β 'Limonite' Localities: Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
| β Linarite Formula: PbCu(SO4)(OH)2 Reference: - Puttner, M. (1987): Mineralien von St. Martin am Silberberg (KΓ€rnten) und SekundΓ€rbildungen in SchlackenhohlrΓ€umen. β Carinthia II, Klagenfurt, 177./97.: 149-157. |
| β Malachite Formula: Cu2(CO3)(OH)2 Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unteraich (Moschitzberg), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Mimetite Formula: Pb5(AsO4)3Cl Reference: A.Pichler (2003) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: H. Meixner: Der Karinthin 40:83-89 (1960) |
| β 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Reference: H. Meixner: Der Karinthin 40:83-89 (1960) |
| β Pyrite Formula: FeS2 Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach - Unteraich area, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unterfarcha, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unteraich (Moschitzberg), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
| β 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
β Pyromorphite Formula: Pb5(PO4)3Cl Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Malbitsch (Molbitsch), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unteraich (Moschitzberg), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: G. Niedermayr, I. Praetzel: Mineralien KΓ€rntens, 1995 |
| β Pyrrhotite Formula: Fe1-xS Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| β Quartz var. Rock Crystal Formula: SiO2 Localities: Reference: A.Pichler (2003) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: H. Meixner: Der Karinthin 40:83-89 (1960) |
| β Siderite Formula: FeCO3 Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unteraich (Moschitzberg), Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Smithsonite Formula: ZnCO3 Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Sphalerite Formula: ZnS Localities: Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Unterfarcha, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Mellach, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Wildbacher, Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Sulphur Formula: S8 Reference: Pichler (2003) |
| β 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| β 'Wad' Localities: Reference: http://www.indra-g.at/Datenbanken/Literaturnachweise/Lit.nachw.htm |
| β Wulfenite Formula: Pb(MoO4) Reference: A.Pichler (2003) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| β | Bournonite | 2.GA.50 | PbCuSbS3 |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Covellite | 2.CA.05a | CuS |
| β | Galena | 2.CD.10 | PbS |
| β | Greenockite | 2.CB.45 | CdS |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| β | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| β | Cuprite | 4.AA.10 | Cu2O |
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Lepidocrocite | 4.FE.15 | Ξ³-Fe3+O(OH) |
| β | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| β | 'var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Rock Crystal | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| β | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Siderite | 5.AB.05 | FeCO3 |
| β | Smithsonite | 5.AB.05 | ZnCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anglesite | 7.AD.35 | PbSO4 |
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Chalcanthite | 7.CB.20 | CuSO4 Β· 5H2O |
| β | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| β | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| β | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| β | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 Β· H2O |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Limonite' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Wad' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Lepidocrocite | γ-Fe3+O(OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Chalcanthite | CuSO4 · 5H2O |
| H | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | β Hydrozincite | Zn5(CO3)2(OH)6 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Linarite | PbCu(SO4)(OH)2 |
| H | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Cerussite | PbCO3 |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | β Calcite | CaCO3 |
| C | β Siderite | FeCO3 |
| C | β Hydrozincite | Zn5(CO3)2(OH)6 |
| C | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | β Pyromorphite | Pb5(PO4)3Cl |
| O | β Bindheimite | Pb2Sb2O6O |
| O | β Lepidocrocite | γ-Fe3+O(OH) |
| O | β Baryte | BaSO4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Cerussite | PbCO3 |
| O | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Calcite | CaCO3 |
| O | β Siderite | FeCO3 |
| O | β Chalcanthite | CuSO4 · 5H2O |
| O | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | β Hydrozincite | Zn5(CO3)2(OH)6 |
| O | β Quartz | SiO2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Smithsonite | ZnCO3 |
| O | β Linarite | PbCu(SO4)(OH)2 |
| O | β Quartz var. Rock Crystal | SiO2 |
| O | β Wulfenite | Pb(MoO4) |
| O | β Anglesite | PbSO4 |
| O | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | β Mimetite | Pb5(AsO4)3Cl |
| O | β Cuprite | Cu2O |
| O | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| F | Fluorine | |
| F | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Na | Sodium | |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | β Quartz | SiO2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Quartz var. Rock Crystal | SiO2 |
| P | Phosphorus | |
| P | β Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | β Bournonite | PbCuSbS3 |
| S | β Baryte | BaSO4 |
| S | β Pyrite | FeS2 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcanthite | CuSO4 · 5H2O |
| S | β Galena | PbS |
| S | β Greenockite | CdS |
| S | β Sphalerite | ZnS |
| S | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | β Arsenopyrite | FeAsS |
| S | β Boulangerite | Pb5Sb4S11 |
| S | β Covellite | CuS |
| S | β Pyrrhotite | Fe1-xS |
| S | β Linarite | PbCu(SO4)(OH)2 |
| S | β Anglesite | PbSO4 |
| S | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | β Sulphur | S8 |
| Cl | Chlorine | |
| Cl | β Pyromorphite | Pb5(PO4)3Cl |
| Cl | β Mimetite | Pb5(AsO4)3Cl |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Fe | Iron | |
| Fe | β Lepidocrocite | γ-Fe3+O(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Siderite | FeCO3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Cu | Copper | |
| Cu | β Bournonite | PbCuSbS3 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcanthite | CuSO4 · 5H2O |
| Cu | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Covellite | CuS |
| Cu | β Linarite | PbCu(SO4)(OH)2 |
| Cu | β Cuprite | Cu2O |
| Zn | Zinc | |
| Zn | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | β Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | β Sphalerite | ZnS |
| Zn | β Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | β Smithsonite | ZnCO3 |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | β Mimetite | Pb5(AsO4)3Cl |
| Nb | Niobium | |
| Nb | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nb | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| Mo | Molybdenum | |
| Mo | β Wulfenite | Pb(MoO4) |
| Cd | Cadmium | |
| Cd | β Greenockite | CdS |
| Sb | Antimony | |
| Sb | β Bindheimite | Pb2Sb2O6O |
| Sb | β Bournonite | PbCuSbS3 |
| Sb | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | β Boulangerite | Pb5Sb4S11 |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | Tantalum | |
| Ta | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Pb | Lead | |
| Pb | β Pyromorphite | Pb5(PO4)3Cl |
| Pb | β Bindheimite | Pb2Sb2O6O |
| Pb | β Bournonite | PbCuSbS3 |
| Pb | β Cerussite | PbCO3 |
| Pb | β Galena | PbS |
| Pb | β Boulangerite | Pb5Sb4S11 |
| Pb | β Linarite | PbCu(SO4)(OH)2 |
| Pb | β Wulfenite | Pb(MoO4) |
| Pb | β Anglesite | PbSO4 |
| Pb | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | β Mimetite | Pb5(AsO4)3Cl |
| U | Uranium | |
| U | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Stra%C3%9Fburg,_Austria |
|---|---|
| Wikidata ID: | Q660945 |
| GeoNames ID: | 7872775 |
Localities in this Region
- Carinthia
- Sankt Veit an der Glan District
Other Regions, Features and Areas that Intersect
Austria
- Carinthia
- Gurk valleyValley
- Gurktal AlpsMountain Range
Eurasian PlateTectonic Plate
Europe
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Wildbachgraben, StraΓburg, Sankt Veit an der Glan District, Carinthia, Austria