Mungo high mines, Shigar Valley, Shigar District, Gilgit-Baltistan, Pakistani
| Regional Level Types | |
|---|---|
| Mungo high mines | Mine Zone |
| Shigar Valley | Valley |
| Shigar District | Administrative District |
| Gilgit-Baltistan | Territory |
| Pakistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 39' 14'' North , 75° 33' 37'' East
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Skardu | 2,100 (2018) | 40.1km |
Mindat Locality ID:
2527
Long-form identifier:
mindat:1:2:2527:3
GUID (UUID V4):
2f4cb594-af32-4793-b8e2-85e54bbf4b8d
Other/historical names associated with this locality:
Munyo; Mango
Group of fertile mines in pegmatite dykes crossing gneiss well above Mungo farm 1,700 m over Shigar Valley at 4,000 m high.
Paragenesis similar to nearby Yuno high mines with which they share same pegmatite field.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| β Fluorite Formula: CaF2 |
| β Hydroxylherderite Formula: CaBe(PO4)(OH) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Tantalite-(Mn) Formula: Mn2+Ta2O6 |
| β Topaz Formula: Al2(SiO4)(F,OH)2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| Group 9 - Silicates | |||
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Hydroxylherderite | CaBe(PO4)(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Hydroxylherderite | CaBe(PO4)(OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Hydroxylherderite | CaBe(PO4)(OH) |
| O | β Tantalite-(Mn) | Mn2+Ta2O6 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Fluorite | CaF2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| P | Phosphorus | |
| P | β Hydroxylherderite | CaBe(PO4)(OH) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | β Fluorite | CaF2 |
| Ca | β Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mn | Manganese | |
| Mn | β Tantalite-(Mn) | Mn2+Ta2O6 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ta | Tantalum | |
| Ta | β Tantalite-(Mn) | Mn2+Ta2O6 |
Other Regions, Features and Areas containing this locality
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
Eurasian PlateTectonic Plate
Pakistan
- Gilgit-Baltistan
- ⭔Skardu AreaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
