Ishikawa District, Fukushima Prefecture, Japani
| Regional Level Types | |
|---|---|
| Ishikawa District | District |
| Fukushima Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Ishikawa | 18,817 (2017) |
Mindat Locality ID:
14965
Long-form identifier:
mindat:1:2:14965:8
GUID (UUID V4):
ffb60a62-4685-4d4d-8918-acac45203af3
Other Languages:
French:
district d'Ishikawa, Fukushima, Japon
German:
Ishikawa Bezirk, PrΓ€fektur Fukushima, Japan
Italian:
Distretto di Ishikawa, prefettura di Fukushima, Giappone
Japanese:
η³ε·ι‘, η¦ε³Άη, ζ₯ζ¬
Russian:
ΠΡΠΈΠΊΠ°Π²Π° , Π€ΡΠΊΡΡΠΈΠΌΠ°, Π―ΠΏΠΎΠ½ΠΈΡ
Simplified Chinese:
η³ε·ι‘, η¦ε²εΏ, ζ₯ζ¬
Spanish:
Distrito de Ishikawa, Prefectura de Fukushima, JapΓ³n
Arabic:
Ω
ΩΨ§Ψ·ΨΉΨ© Ψ₯ΩΨ΄ΩΩΨ§ΩΨ§, ΩΩΩΩΨ΄ΩΩ
Ψ§, Ψ§ΩΩΨ§Ψ¨Ψ§Ω
Cebuano:
Ishikawa-gun, Fukushima-ken, Hapon
Dutch:
Ishikawa, Fukushima, Japan
Korean:
μ΄μμΉ΄μκ΅°, νμΏ μλ§ν, μΌλ³Έ
Portuguese:
Distrito de Ishikawa, Fukushima , JapΓ£o
Scots:
Ishikawa Destrict, Fukushima Prefectur, Japan
Traditional Chinese:
η³ε·ι‘, η¦ε³ΆηΈ£, ζ₯ζ¬
Ukrainian:
ΠΠΎΠ²ΡΡ ΠΡΡΠΊΠ°Π²Π°, ΠΡΠ΅ΡΠ΅ΠΊΡΡΡΠ° Π€ΡΠΊΡΡΡΠΌΠ°, Π―ΠΏΠΎΠ½ΡΡ
Numerous pegmatite lenses in granite and granitic gneiss, worked commercially for feldspars for the ceramic industry. (Minerals listed here are all from the Ishikawa District, but not necessarily from pegmatite parageneses.)
The "Ishikawa District" (or "Ishikawa pegmatite district") is a large area of granitic pegmatites, many of them enriched in REE and Y, scattered over Ishikawa town and surrounding areas of Ishikawa-gun and neighboring regions of the Abukuma plateau. As it is very roughly conterminous with Ishikawa-gun (county), most Ishikawa pegmatite district mineral will be found here.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities42 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| β | Bismuth | 1.CA.05 | Bi |
| Group 4 - Oxides and Hydroxides | |||
| β | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Corundum | 4.CB.05 | Al2O3 |
| β | SillΓ©nite | 4.CB.70 | Bi12SiO20 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | var. Rose Quartz | 4.DA.05 | SiO2 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | Ishikawaite (TL) | 4.DB.25 | U4+Fe2+Nb2O8 |
| β | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| β | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| β | Pucherite | 8.AD.40 | Bi(VO4) |
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| β | Brockite | 8.CJ.45 | (Ca,Th,Ce)PO4 Β· H2O |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Thorite var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Thorite | 9.AD.30 | Th(SiO4) |
| β | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Uedaite-(Ce) | 9.BG.05 | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| β | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| β | ThalΓ©nite-(Y) | 9.BJ.20 | Y3Si3O10F |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Sekaninaite | 9.CJ.10 | (Fe,Mg)2Al3(AlSi5O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Tetraferriannite | 9.EC.20 | KFe2+3(Si3Fe3+)O10(OH)2 |
| β | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Xenotime' | - | |
| β | 'Feldspar Group' | - | |
| β | 'Mica Group var. Lepidomelane' | - | |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'K Feldspar' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Fergusonite' | - | |
| β | 'Pyralspite' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | β Annite | KFe32+(AlSi3O10)(OH)2 |
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| H | β Hydroxylherderite | CaBe(PO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal | SiO2 · nH2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Tetraferriannite | KFe32+(Si3Fe3+)O10(OH)2 |
| H | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Chrysoberyl | BeAl2O4 |
| Be | β Hydroxylherderite | CaBe(PO4)(OH) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Beyerite | Ca(BiO)2(CO3)2 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | β Andalusite | Al2(SiO4)O |
| O | β Annite | KFe32+(AlSi3O10)(OH)2 |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Beyerite | Ca(BiO)2(CO3)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Chrysoberyl | BeAl2O4 |
| O | β Corundum | Al2O3 |
| O | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | β Fergusonite-(Y) | YNbO4 |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Gahnite | ZnAl2O4 |
| O | β Hydroxylherderite | CaBe(PO4)(OH) |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Ishikawaite | U4+Fe2+Nb2O8 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pucherite | Bi(VO4) |
| O | β Quartz | SiO2 |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Samarskite-(Y) | YFe3+Nb2O8 |
| O | β Corundum var. Sapphire | Al2O3 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| O | β Sillimanite | Al2(SiO4)O |
| O | β SillΓ©nite | Bi12SiO20 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β ThalΓ©nite-(Y) | Y3Si3O10F |
| O | β Thorite | Th(SiO4) |
| O | β Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Uraninite | UO2 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Xenotime-(Y) | Y(PO4) |
| O | β Zircon | Zr(SiO4) |
| O | β Tetraferriannite | KFe32+(Si3Fe3+)O10(OH)2 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β ThalΓ©nite-(Y) | Y3Si3O10F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Chrysoberyl | BeAl2O4 |
| Al | β Corundum | Al2O3 |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Corundum var. Sapphire | Al2O3 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Al | β Sillimanite | Al2(SiO4)O |
| Al | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Si | β Sillimanite | Al2(SiO4)O |
| Si | β SillΓ©nite | Bi12SiO20 |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β ThalΓ©nite-(Y) | Y3Si3O10F |
| Si | β Thorite | Th(SiO4) |
| Si | β Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Tetraferriannite | KFe32+(Si3Fe3+)O10(OH)2 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| P | β Hydroxylherderite | CaBe(PO4)(OH) |
| P | β Monazite | REE(PO4) |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Xenotime-(Y) | Y(PO4) |
| K | Potassium | |
| K | β Annite | KFe32+(AlSi3O10)(OH)2 |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Tetraferriannite | KFe32+(Si3Fe3+)O10(OH)2 |
| Ca | Calcium | |
| Ca | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Beyerite | Ca(BiO)2(CO3)2 |
| Ca | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ca | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | β Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | β Ilmenite | Fe2+TiO3 |
| V | Vanadium | |
| V | β Pucherite | Bi(VO4) |
| Mn | Manganese | |
| Mn | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | Iron | |
| Fe | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Ishikawaite | U4+Fe2+Nb2O8 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Fe | β Tetraferriannite | KFe32+(Si3Fe3+)O10(OH)2 |
| Fe | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Cu | Copper | |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Y | Yttrium | |
| Y | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | β Fergusonite-(Y) | YNbO4 |
| Y | β Samarskite-(Y) | YFe3+Nb2O8 |
| Y | β ThalΓ©nite-(Y) | Y3Si3O10F |
| Y | β Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | β Fergusonite-(Y) | YNbO4 |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | β Ishikawaite | U4+Fe2+Nb2O8 |
| Nb | β Samarskite-(Y) | YFe3+Nb2O8 |
| Ce | Cerium | |
| Ce | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ce | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Ce | β Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ta | Tantalum | |
| Ta | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Au | Gold | |
| Au | β Gold | Au |
| Bi | Bismuth | |
| Bi | β Beyerite | Ca(BiO)2(CO3)2 |
| Bi | β Bismuth | Bi |
| Bi | β Pucherite | Bi(VO4) |
| Bi | β SillΓ©nite | Bi12SiO20 |
| Th | Thorium | |
| Th | β Brockite | (Ca,Th,Ce)PO4 · H2O |
| Th | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | β Thorite | Th(SiO4) |
| Th | β Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | β Ishikawaite | U4+Fe2+Nb2O8 |
| U | β Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Uraninite | UO2 |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Ishikawa_District,_Fukushima |
|---|---|
| Wikidata ID: | Q1155869 |
| GeoNames ID: | 7451502 |
Localities in this Region
- Fukushima Prefecture
- Fukushima Prefecture
- Ishikawa District
- Ishikawa town (Ishikawa-machi)
- ?Tamagawa
- Ushiroda pegmatite
- Ishikawa District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Ishikawa District, Fukushima Prefecture, Japan