Giftkuppe, Omaruru Constituency, Erongo Region, Namibiai
| Regional Level Types | |
|---|---|
| Giftkuppe | Hill |
| Omaruru Constituency | Constituency |
| Erongo Region | Region |
| Namibia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
21° 41' 8'' South , 15° 56' 38'' East
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Mindat Locality ID:
126694
Long-form identifier:
mindat:1:2:126694:1
GUID (UUID V4):
b3eb9190-aea4-4bb5-a9c5-987500d701b4
A small hill known as Giftkuppe straddles the boundary between Erongo Ost (East) 82 and Kanona Ost 81 farms.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Reference: Min Rec (2006) 37:361-470 |
| β Anatase Formula: TiO2 Reference: Bezing, L. von., Bode, R., and Jahn, S., (2008) Namibia Minerals and Localities. Edition Schloss Freudenstein, Bode Verlag GmbH, Haltern, (in English) |
| β Chalcopyrite Formula: CuFeS2 Reference: Min Rec (2006) 37:361-470 |
| β Marcasite Formula: FeS2 Reference: Min Rec (2006) 37:361-470 |
| β Microcline Formula: K(AlSi3O8) Reference: Min Rec (2006) 37:361-470 |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: Min Rec (2006) 37:361-470 |
| β Pyrite Formula: FeS2 Reference: Min Rec (2006) 37:361-470 |
| β Pyrrhotite Formula: Fe1-xS Reference: Min Rec (2006) 37:361-470 |
| β Quartz Formula: SiO2 Reference: Min Rec (2006) 37:361-470 |
| β Rutile Formula: TiO2 Reference: Min Rec (2006) 37:361-470; Werner & Marianne Teich collection |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Min Rec (2006) 37:361-470 |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Reference: Bezing, L. von., Bode, R., and Jahn, S., (2008) Namibia Minerals and Localities. Edition Schloss Freudenstein, Bode Verlag GmbH, Haltern, (in English) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Marcasite | 2.EB.10a | FeS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| Group 4 - Oxides and Hydroxides | |||
| β | Anatase | 4.DD.05 | TiO2 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Rutile | TiO2 |
| O | β Quartz | SiO2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Microcline | K(AlSi3O8) |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Anatase | TiO2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Microcline | K(AlSi3O8) |
| Si | Silicon | |
| Si | β Quartz | SiO2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Marcasite | FeS2 |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ti | Titanium | |
| Ti | β Rutile | TiO2 |
| Ti | β Anatase | TiO2 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Marcasite | FeS2 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
References
Sort by
Year (asc) Year (desc) Author (A-Z) Author (Z-A)von Bezing, L., Bode, R., Jahn, S., (2008) Namibia Minerals and Localities. Edition Schloss Freudenstein, Bode Verlag GmbH, Haltern, (in English).
Other Regions, Features and Areas containing this locality
African PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Giftkuppe, Omaruru Constituency, Erongo Region, Namibia