Phippsburg, Sagadahoc County, Maine, USAi
| Regional Level Types | |
|---|---|
| Phippsburg | Town |
| Sagadahoc County | County |
| Maine | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Phippsburg | 2,190 (2017) |
Mindat Locality ID:
23756
Long-form identifier:
mindat:1:2:23756:4
GUID (UUID V4):
0b3aa6a4-7d3f-4b68-9d8c-f1cfa0166d6c
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities33 valid minerals. 1 erroneous literature entry.
Detailed Mineral List:
| β Formula: NaFe3+Si2O6 Description: No location given and no specimens known. References: |
| β Albite Formula: Na(AlSi3O8) Localities: References: |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| β Andalusite Formula: Al2(SiO4)O |
| β Anorthite Formula: Ca(Al2Si2O8) |
| β Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 8 localities in this region. |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 References: |
| β Beryl var. Heliodor Formula: Be3Al2(Si6O18) Localities: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: |
| β Calcite Formula: CaCO3 Localities: |
| β Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Description: Clinozoisite from this locality was mistakenly called axinite and is an error which has been continuously reported since the 1890's. |
| β Columbite-(Fe) Formula: Fe2+Nb2O6 |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| β Diopside Formula: CaMgSi2O6 Localities: References: |
| β 'Feldspar Group' |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: |
| β Galena Formula: PbS |
| β Grossular Formula: Ca3Al2(SiO4)3 Localities: Basin Quarry, Phippsburg, Sagadahoc County, Maine, USA Basin Vesuvianite locality, Phippsburg, Sagadahoc County, Maine, USA Colby Farm Lime-Marble quarry, Phippsburg, Sagadahoc County, Maine, USA Herbert Haven Prospect, Phippsburg, Sagadahoc County, Maine, USA Poison Ivy Locality, Basin Quarry, Phippsburg, Sagadahoc County, Maine, USA References: |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β Ilmenite Formula: Fe2+TiO3 Localities: |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O Description: Found in veins in gneiss. Chemical analyses by Dufrenoy (1835). Reported by Jackson (1837) that it was near The Basin Locality. |
| β Lazulite Formula: MgAl2(PO4)2(OH)2 |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Meionite Formula: Ca4Al6Si6O24CO3 |
| β Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| β 'Mica Group' |
| β Microcline Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 9 localities in this region. |
| β Pargasite ? Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Description: This amphibole has never been chemically analyzed and the name pargasite was used in the early to mid-nineteenth century as the species always found in skarns. |
| β Pyrite Formula: FeS2 Localities: References: |
| β Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. References: |
| β Quartz var. Amethyst Formula: SiO2 Localities: Description: Observed poor amethyst is fomed in zones with smoky quartz. References: |
| β Quartz var. Chalcedony Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| β 'Scapolite' |
| β Scheelite Formula: Ca(WO4) |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| β Sillimanite Formula: Al2(SiO4)O Localities: Description: Sillimanite schist. |
| β Sphalerite Formula: ZnS |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O Localities: References: |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β Uraninite ? Formula: UO2 |
| β Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| β Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Galena | 2.CD.10 | PbS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | var. Chalcedony | 4.DA.05 | SiO2 |
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| β | Uraninite ? | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 Β· 8H2O |
| Group 9 - Silicates | |||
| β | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(β»4)β»[Si2O7]4[(SiO4)10]O(OH)9 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Aegirine ? | 9.DA.25 | NaFe3+Si2O6 |
| β | Pargasite ? | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| β | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| Unclassified | |||
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Feldspar Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Mica Group' | - | |
| β | 'Scapolite' | - | |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Lazulite | MgAl2(PO4)2(OH)2 |
| H | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| C | β Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | β Aegirine | NaFe3+Si2O6 |
| O | β Albite | Na(AlSi3O8) |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Andalusite | Al2(SiO4)O |
| O | β Anorthite | Ca(Al2Si2O8) |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Quartz var. Chalcedony | SiO2 |
| O | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Diopside | CaMgSi2O6 |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Grossular | Ca3Al2(SiO4)3 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Lazulite | MgAl2(PO4)2(OH)2 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Meionite | Ca4Al6Si6O24CO3 |
| O | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | β Quartz | SiO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Sillimanite | Al2(SiO4)O |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Uraninite | UO2 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Na | Sodium | |
| Na | β Aegirine | NaFe3+Si2O6 |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Meionite | Ca4Al6Si6O24CO3 |
| Na | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Diopside | CaMgSi2O6 |
| Mg | β Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Anorthite | Ca(Al2Si2O8) |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Grossular | Ca3Al2(SiO4)3 |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Lazulite | MgAl2(PO4)2(OH)2 |
| Al | β Meionite | Ca4Al6Si6O24CO3 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Sillimanite | Al2(SiO4)O |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | β Aegirine | NaFe3+Si2O6 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Anorthite | Ca(Al2Si2O8) |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Quartz var. Chalcedony | SiO2 |
| Si | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Diopside | CaMgSi2O6 |
| Si | β Grossular | Ca3Al2(SiO4)3 |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Meionite | Ca4Al6Si6O24CO3 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Sillimanite | Al2(SiO4)O |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | β Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Lazulite | MgAl2(PO4)2(OH)2 |
| P | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | β Galena | PbS |
| S | β Meionite | Ca4Al6Si6O24CO3 |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | β Meionite | Ca4Al6Si6O24CO3 |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Anorthite | Ca(Al2Si2O8) |
| Ca | β Calcite | CaCO3 |
| Ca | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Grossular | Ca3Al2(SiO4)3 |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Meionite | Ca4Al6Si6O24CO3 |
| Ca | β Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Aegirine | NaFe3+Si2O6 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Cu | Copper | |
| Cu | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| Nb | Niobium | |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | β Galena | PbS |
| U | Uranium | |
| U | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Uraninite | UO2 |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Maine
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fuller Mountain Quarry, Phippsburg, Sagadahoc County, Maine, USA