Stratford, Coos County, New Hampshire, USAi
| Regional Level Types | |
|---|---|
| Stratford | - not defined - |
| Coos County | County |
| New Hampshire | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° 39' 15'' North , 71° 33' 30'' West
Latitude & Longitude (decimal):
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Stratford | 1,003 (2017) | 0.3km |
| Maidstone | 203 (2017) | 1.2km |
| Groveton | 1,118 (2017) | 7.2km |
| Guildhall | 256 (2017) | 9.9km |
| Northumberland | 2,597 (2017) | 10.1km |
Mindat Locality ID:
24581
Long-form identifier:
mindat:1:2:24581:9
GUID (UUID V4):
b608eb0f-aefa-4c05-b9e9-a288f251bee1
Stratford is a town, incorporated in 1773.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities17 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Localities: References: |
| β Astrophyllite Formula: K2NaFe2+7Ti2Si8O26(OH)4F Localities: References: |
| β Beryl Formula: Be3Al2(Si6O18) Localities: References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Localities: References: |
| β Fluorite Formula: CaF2 References: |
| β Goethite Formula: Ξ±-Fe3+O(OH) References: |
| β Hematite Formula: Fe2O3 Localities: References: |
| β Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: References: |
| β Microcline Formula: K(AlSi3O8) Localities: References: |
| β Molybdenite Formula: MoS2 References: |
| β 'Monazite' Formula: REE(PO4) Localities: References: |
| β Monazite-(Ce) Formula: Ce(PO4) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| β Phenakite Formula: Be2SiO4 Localities: References: |
| β Quartz Formula: SiO2 Localities: References: |
| β Quartz var. Amethyst Formula: SiO2 Localities: References: |
| β Quartz var. Citrine Formula: SiO2 Localities: |
| β Quartz var. Smoky Quartz Formula: SiO2 Localities: References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Siderite Formula: FeCO3 Localities: References: |
| β Topaz Formula: Al2(SiO4)(F,OH)2 Localities: References: |
| β 'Zinnwaldite' Localities: References: |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Molybdenite | 2.EA.30 | MoS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Amethyst | 4.DA.05 | SiO2 |
| β | var. Citrine | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2Si8O26(OH)4F |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Phenakite | 9.AA.05 | Be2SiO4 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Zinnwaldite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Phenakite | Be2SiO4 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Quartz | SiO2 |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Microcline | K(AlSi3O8) |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Hematite | Fe2O3 |
| O | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Monazite | REE(PO4) |
| O | β Phenakite | Be2SiO4 |
| O | β Quartz var. Citrine | SiO2 |
| O | β Siderite | FeCO3 |
| O | β Zircon | Zr(SiO4) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Phenakite | Be2SiO4 |
| Si | β Quartz var. Citrine | SiO2 |
| Si | β Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Monazite | REE(PO4) |
| S | Sulfur | |
| S | β Molybdenite | MoS2 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Ca | Calcium | |
| Ca | β Fluorite | CaF2 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Fe | Iron | |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Astrophyllite | K2NaFe72+Ti2Si8O26(OH)4F |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Siderite | FeCO3 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
Localities in this Region
- New Hampshire
- Coos County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
South Percy Peak locality, Stratford, Coos County, New Hampshire, USA