Kriegalp water tunnel, Chriegalp valley, Binn, Goms, Valais, Switzerlandi
| Regional Level Types | |
|---|---|
| Kriegalp water tunnel | Tunnel |
| Chriegalp valley | Valley |
| Binn | Municipality |
| Goms | District |
| Valais | Canton |
| Switzerland | Country |
Kriegalp water tunnel, Chriegalp valley, Binn Valley, Valais, Switzerland
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° North , 8° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~1km
Type:
KΓΆppen climate type:
Mindat Locality ID:
29342
Long-form identifier:
mindat:1:2:29342:7
GUID (UUID V4):
46ee0e53-929e-4461-a7b3-c8923a5e8162
Name(s) in local language(s):
Kriegalp-Wasserstollen, Kriegalptal (Chriegalptal), Binntal, Wallis (Valais), Schweiz (Suisse; Svizzera)
Minerals found in material excavated during the construction of the tunnel.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: |
| β Calcite Formula: CaCO3 References: |
| β 'Chabazite' Description: Crystals to 1 cm along the edges. |
| β 'Chlorite Group' References: |
| β Dolomite Formula: CaMg(CO3)2 References: |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| β Fluorite Formula: CaF2 References: |
| β Gypsum Formula: CaSO4 · 2H2O References: |
| β Hematite Formula: Fe2O3 References: |
| β Hematite var. Iron Rose Formula: Fe2O3 References: |
| β Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| β 'K Feldspar' References: |
| β 'K Feldspar var. Adularia' Formula: KAlSi3O8 References: |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O |
| β Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| β Pyrite Formula: FeS2 References: |
| β Quartz Formula: SiO2 References: |
| β Quartz var. Smoky Quartz Formula: SiO2 References: |
| β Rutile Formula: TiO2 References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β Scolecite Formula: CaAl2Si3O10 · 3H2O |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Hematite var. Iron Rose | 4.CB.05 | Fe2O3 |
| β | 4.CB.05 | Fe2O3 | |
| β | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| Group 9 - Silicates | |||
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Milarite | 9.CM.05 | K(β»H2O)Ca2(Be2Al)[Si12O30] |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Scolecite | 9.GA.05 | CaAl2Si3O10 Β· 3H2O |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| β | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 Β· 26H2O |
| Unclassified | |||
| β | 'Chlorite Group' | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Chabazite' | - | |
| β | 'K Feldspar' | - | |
| β | 'var. Adularia' | - | KAlSi3O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Scolecite | CaAl2Si3O10 · 3H2O |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Be | Beryllium | |
| Be | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | β Calcite | CaCO3 |
| C | β Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | β K Feldspar var. Adularia | KAlSi3O8 |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Calcite | CaCO3 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hematite | Fe2O3 |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Rutile | TiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Scolecite | CaAl2Si3O10 · 3H2O |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | β Hematite var. Iron Rose | Fe2O3 |
| F | Fluorine | |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Mg | Magnesium | |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | β K Feldspar var. Adularia | KAlSi3O8 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Scolecite | CaAl2Si3O10 · 3H2O |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | Silicon | |
| Si | β K Feldspar var. Adularia | KAlSi3O8 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Scolecite | CaAl2Si3O10 · 3H2O |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| S | Sulfur | |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Pyrite | FeS2 |
| K | Potassium | |
| K | β K Feldspar var. Adularia | KAlSi3O8 |
| K | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorite | CaF2 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | β Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ti | Titanium | |
| Ti | β Rutile | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Hematite var. Iron Rose | Fe2O3 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
- The AlpsMountain Range
Switzerland
- Valais
- Binn ValleyValley
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
