Incline Village, Washoe County, Nevada, USAi
| Regional Level Types | |
|---|---|
| Incline Village | Village |
| Washoe County | County |
| Nevada | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° 14' 58'' North , 119° 57' 9'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Incline Village | 8,777 (2011) | 1.8km |
| Crystal Bay | 305 (2011) | 5.1km |
| Kings Beach | 3,796 (2011) | 6.5km |
| Tahoe Vista | 1,433 (2011) | 8.5km |
| Carnelian Bay | 524 (2011) | 11.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Great Basin Gem & Mineral Club | Carson City, Nevada | 18km |
| High Desert Rockers | Carson City, Nevada | 18km |
| Comstock Gold Prospectors | Reno, Nevada | 33km |
| Reno Gem and Mineral Society | Reno, Nevada | 33km |
Mindat Locality ID:
61933
Long-form identifier:
mindat:1:2:61933:3
GUID (UUID V4):
b2cc541d-64bf-4a1a-8f57-0b295d044132
Pegmatites
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Goethite Formula: Ξ±-Fe3+O(OH) |
| β Hematite Formula: Fe2O3 |
| β 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Microcline Formula: K(AlSi3O8) |
| β Mottramite Formula: PbCu(VO4)(OH) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Description: Also as pseudomorphs after schorl. |
| β Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 Description: Crystals to 58cm. |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O Habit: Crystals to 3 cm. Fourlings. Colour: Golden-yellow |
| β Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Ferro-hornblende | 9.DE.10 | β»Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Mottramite | PbCu(VO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Hematite | Fe2O3 |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Mottramite | PbCu(VO4)(OH) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Zircon | Zr(SiO4) |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | β Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | β Mottramite | PbCu(VO4)(OH) |
| Fe | Iron | |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Mottramite | PbCu(VO4)(OH) |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Pb | Lead | |
| Pb | β Mottramite | PbCu(VO4)(OH) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Incline Village, Washoe County, Nevada, USA