Tolland County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Tolland County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
23080
Long-form identifier:
mindat:1:2:23080:8
GUID (UUID V4):
79bda260-090a-40ce-9e87-e07b08422a1a
Other Languages:
French:
ComtΓ© de Tolland, Connecticut, Γtats-Unis
German:
Tolland County, Connecticut, Vereinigte Staaten
Italian:
Contea di Tolland, Connecticut, Stati Uniti d'America
Russian:
Π’ΠΎΠ»Π»Π°Π½Π΄, ΠΠΎΠ½Π½Π΅ΠΊΡΠΈΠΊΡΡ, Π‘ΠΎΠ΅Π΄ΠΈΠ½ΡΠ½Π½ΡΠ΅ Π¨ΡΠ°ΡΡ ΠΠΌΠ΅ΡΠΈΠΊΠΈ
Simplified Chinese:
ζε
°εΏ, εΊ·δΉηε
ε·, ηΎε½
Spanish:
Condado de Tolland, Connecticut, Estados Unidos
Albanian:
Tolland County, Connecticut, Shtetet e Bashkuara tΓ« AmerikΓ«s
Arabic:
Ω
ΩΨ§Ψ·ΨΉΨ© ΨͺΩΩΨ§ΩΨ―, ΩΩΩΩΨͺΩΩΨͺ, Ψ§ΩΩΩΨ§ΩΨ§Ψͺ Ψ§ΩΩ
ΨͺΨΨ―Ψ©
Armenian:
ΤΉΥΈΥ¬Υ‘ΥΆΥ€ Υ·ΦΥ»Υ‘ΥΆ, ΤΏΥΈΥΆΥ₯Υ―ΥΏΥ«Υ―ΥΈΦΥΏ, Τ±Υ΄Υ₯ΦΥ«Υ―Υ‘Υ΅Υ« ΥΥ«Υ‘ΦΥ΅Υ‘Υ¬ ΥΥ‘Υ°Υ‘ΥΆΥ£ΥΆΥ₯Φ
Basque:
Tolland konderria, Connecticut
Bavarian:
Tolland County, Connecticut, Vaoanigte Stootn
Bishnupriya Manipuri:
ΰ¦ΰ§ΰ¦²ΰ¦²ΰ§ΰ¦―ানΰ§ΰ¦‘ ΰ¦ΰ¦Ύΰ¦ΰ¦¨ΰ§ΰ¦ΰ¦Ώ, ΰ¦ΰ¦Ύΰ¦¨ΰ§ΰ¦ΰ¦ΰ¦Ώΰ¦ΰ¦Ύΰ¦, ঀিলΰ¦ͺΰ¦Ύΰ¦°ΰ¦Ύΰ¦·ΰ§ΰ¦ΰ§ΰ¦°
Bulgarian:
Π’ΠΎΠ»ΡΠ½Π΄, ΠΡΠ½Π΅ΠΊΡΠΈΠΊΡΡ, Π‘ΡΠ΅Π΄ΠΈΠ½Π΅Π½ΠΈ Π°ΠΌΠ΅ΡΠΈΠΊΠ°Π½ΡΠΊΠΈ ΡΠ°ΡΠΈ
Cebuano:
Tolland County, Connecticut
Dutch:
Tolland County, Connecticut, Verenigde Staten
Farsi/Persian:
Ψ΄ΩΨ±Ψ³ΨͺΨ§Ω ΨͺΩΩΩΨ―Ψ Ϊ©ΩΨͺΫΪ©Ψͺ, Ϊ©ΩΨͺΫΪ©Ψͺ, Ψ§ΫΨ§ΩΨ§Ψͺ Ω
ΨͺΨΨ―Ω Ψ’Ω
Ψ±ΫΪ©Ψ§
Finnish:
Tollandin piirikunta, Connecticut, Yhdysvallat
Hungarian:
Tolland megye, Connecticut, Amerikai EgyesΓΌlt Γllamok
Irish Gaelic:
Contae Tolland, Connecticut, StΓ‘it Aontaithe MheiriceΓ‘
Japanese:
γγ©γ³γι‘, γ³γγγ«γγε·, γ’γ‘γͺγ«εθ‘ε½
Low Saxon/Low German:
Tolland County, Connecticut, USA
Min Dong Chinese:
Tolland GΓ΄ng, Connecticut
Norwegian:
Tolland County, Connecticut, USA
Polish:
Hrabstwo Tolland, Connecticut, Stany Zjednoczone
Portuguese:
Condado de Tolland, Connecticut, Estados Unidos
Romanian:
Comitatul Tolland, Connecticut, Statele Unite ale Americii
Serbian:
ΠΠΊΡΡΠ³ Π’Π°Π»Π°Π½Π΄, ΠΠΎΠ½Π΅ΠΊΡΠΈΠΊΠ°Ρ, Π‘ΡΠ΅Π΄ΠΈΡΠ΅Π½Π΅ ΠΠΌΠ΅ΡΠΈΡΠΊΠ΅ ΠΡΠΆΠ°Π²Π΅
Serbo-Croatian:
Tolland County, Connecticut, Sjedinjene AmeriΔke DrΕΎave
Swedish:
Tolland County, Connecticut, USA
Turkish:
Tolland County, Connecticut, Amerika BirleΕik Devletleri
Ukrainian:
Π’ΠΎΠ»Π»Π΅Π½Π΄, ΠΠΎΠ½Π½Π΅ΠΊΡΠΈΠΊΡΡ, Π‘ΠΏΠΎΠ»ΡΡΠ΅Π½Ρ Π¨ΡΠ°ΡΠΈ ΠΠΌΠ΅ΡΠΈΠΊΠΈ
Urdu:
ΩΉΩΩΫΩΪ Ϊ©Ψ§Ψ€ΩΩΉΫΨ Ϊ©ΩΫΪ©ΩΉΫΪ©ΩΉ, Ϊ©ΩΫΪ©ΩΉΫΪ©ΩΉ, Ψ±ΫΨ§Ψ³ΨͺΫΨ§Ψ¦Ϋ Ω
ΨͺΨΨ―Ϋ Ψ§Ω
Ψ±ΫΪ©Ψ§
Vietnamese:
QuαΊn Tolland, Connecticut, Chủng Quα»c Hoa Kα»³
Waray:
Condado han Tolland, Connecticut, Estados Unidos
Western Punjabi:
ΩΉΩΩΫΩΪ Ϊ©Ψ§Ψ€ΩΩΉΫ, Ϊ©ΩΪ©ΩΉΫΪ©ΩΉ, Ψ§Ω
Ψ±ΫΪ©Ϋ
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities48 valid minerals.
* - Minerals that have never been found, but their existence is inferred in some way (e.g. from pseudomorphs)
Detailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β Albite Formula: Na(AlSi3O8) Localities: Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Cordierite locality (Bigelow Pond), Union, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Colour: greenish Description: large plates, translucent and in some cases nearly transparent, of a greenish color |
| β Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Burgundy Hill Quarry, Tolland, Tolland County, Connecticut, USA Gerber Drive road cuts, Tolland, Tolland County, Connecticut, USA State Route 31 and Dockerel Road intersection, Tolland, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Habit: trapezohedral Colour: red to maroon Description: Pocket crystals with finely striated faces can reach over 7 cm. Compositionally zoned, with up to about 0.2 mole fraction grossular, 0.15 mole fraction pyrope, and 0.05 mole fraction spessartine - more toward the crystals' cores. |
| β 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: References: |
| β 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: capillary Colour: white Description: Scattered capillary crystals in fracture voids. |
| β Anhydrite Formula: CaSO4 Habit: tabular Description: Tabular crystals to 3 cm that were epimorphed or encrusted by drusy quartz before later naturally dissolving away leaving voids. |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: rhombohedral Description: Typical small rhombs <1 cm. Uncertain in the reference if the crystals are true ankerite under the revised definition, or ferroan dolomite, or how to distinguish them from the much more common magnesite. |
| β Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| β Anorthite Formula: Ca(Al2Si2O8) Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: anhedral Description: component of the host metagabbro, composition An70-80. |
| β Arsenopyrite Formula: FeAsS |
| βͺ Azurite Formula: Cu3(CO3)2(OH)2 Habit: Tabular to tapered groups Colour: Very dark blue Description: Mostly massive, found in massive quartz with massive chalcocite, malachite, fluorite. |
| βͺ Baryte Formula: BaSO4 Habit: massive tabular, subparallel overgrowths with curved faces, short prismatic to acicular Colour: white, creamy tan, blue, yellow, colorless Fluorescence: rarely yellow-white, or blue-green primarily under SW Description: There appear to be three generations of baryte crystallization: 1) an initial coarse-grained, tabular to massive, opaque white phase in massive quartz and fluorite, 2) a translucent, creamy tan overgrowth phase usually in subparallel orientation on the white barite in voids within the previous matrix, some from the dissolution of fluorite, and 3) a transparent, colorless to blue overgrowth phase on either phase 1 or 2 baryte crystals, or isolated. All three phases of crystals can show varying degrees of surface etching. Small tabular white crystals and yellow, transparent, acicular crystals are also known. |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Localities: Habit: tabular Colour: black Description: Mostly as a component of the host metagabbro, but also as euhedral crystals in the open veins to about 1 cm. |
| β Calcite Formula: CaCO3 Localities: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Habit: flat rhombohedra, usually in rosette aggregates Colour: white to colorless Description: As rosette aggregates to around 5 mm, a late-forming mineral usually found on top of the high P-T assemblage. |
| β 'Chabazite' Localities: Habit: rhombohedral Colour: white Description: drusy crystals on epidote in fractures in gneiss References: |
| β Chalcocite Formula: Cu2S Localities: Habit: massive Colour: black Description: Associated with massive quartz, fluorite, romanechite and copper secondary minerals. References: |
| β Chalcopyrite Formula: CuFeS2 Localities: Description: A rarer accessory mineral in the vein assemblage. |
| β 'Chlorite Group' Localities: References: |
| β Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: massive Colour: dark green Description: In matrix near hydrothermally altered fractures. |
| β 'Clinopyroxene Subgroup' Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: anhedral Colour: black Description: A component of the host metagabbro. |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Description: Small crystals and irregular grains of excellent color |
| β Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Description: Metamorphic retrograde alteration of pyroxene. |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Habit: prismatic Colour: yellow-green to dark green to black Description: drusy crystals in fractures in gneiss, crystallized in two generations, an initial one with elongated, larger and darker crystals and a second one of much finer-grained, short and lighter colored crystals. The second generation coats the first and some other minerals like quartz. |
| β Epistilbite Formula: CaAl2Si6O16 · 5H2O |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: Description: An uncommon mineral in the open vein assemblage. |
| βͺ Fluorite Formula: CaF2 Habit: cubic with tetrahexahedral overgrowths Colour: colorless, pale blue, purple, green |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: |
| β Goethite Formula: Ξ±-Fe3+O(OH) Localities: Baryte locality, Somers, Tolland County, Connecticut, USA Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA Diamond Ledge (West Stafford quartz locality; Stafford Springs quartz locality), Stafford, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: massive, earthy Colour: dark brown References: |
| β Graphite Formula: C Localities: Description: Robinson references Bruce's Mineralogy as the source. |
| β Hematite Formula: Fe2O3 Colour: red Description: earthy red massive material, dissolved in HCl with positive results for iron (as opposed to copper) |
| β 'Heulandite Subgroup' Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Colour: colorless to white Description: micro drusy crystals with epidote and zeolites in fractures in gneiss |
| β 'Hornblende' |
| β Ilmenite Formula: Fe2+TiO3 Localities: References: |
| β 'K Feldspar' |
| β 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| β Kyanite Formula: Al2(SiO4)O Localities: Habit: elongated bladed prisms flattened parallel to (100), solitary or in feathery aggregates Colour: colorless, gray, light to dark blue blue Description: As free standing crystals to 5 cm in the open vein assemblage - a rarity in the state, typically with ragged edges and coated/partially altered to gray-green sericite/chlorite/clay minerals, though some are well terminated. |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: References: |
| β 'Limonite' |
| βͺ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: elongated prismatic Colour: black Description: Mostly as a metamorphic retrograde alteration of pyroxene in the host metagabbro, but also as an uncommon mineral in the open vein assemblage - a rarity in the state. Crystals to 1 cm. |
| βͺ Magnesite Formula: MgCO3 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: rhombohedral Colour: tan to brown Description: Small rhombs <1 cm common, but crystals can reach several cm. Much more common than reported ankerite. Iron typically in the range of 0.05-0.30 apfu, though reportedly a few samples have outer rims grading to pure siderite. |
| βͺ Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: rhombohedral Colour: tan to light brown Description: Crystals to several cm. Much more common than reported ankerite. Iron typically in the range of 0.05-0.30 apfu, though reportedly a few samples have outer rims grading to pure siderite. |
| β Magnetite Formula: Fe2+Fe3+2O4 Localities: References: |
| β Malachite Formula: Cu2(CO3)(OH)2 Habit: radiating acicular, mossy aggregates Colour: green Description: alteration of chalcocite, typically with azurite in massive quartz and fluorite |
| β Microcline Formula: K(AlSi3O8) Localities: Habit: massive Colour: white Fluorescence: deep red Description: in pegmatites cross-cutting the gneiss within the road cuts References: |
| β Molybdenite Formula: MoS2 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: tabular, subhedral Colour: silvery gray Description: crystal 23 mm collected by Fred Schuster during construction |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Habit: pseudo-hexagonal tabular Colour: silvery to greenish Description: Crystals in the open vein assemblage to about 1 cm. |
| β 'Orthopyroxene Subgroup' Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: anhedral Description: A major component of the host metagabbro. |
| β Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Description: in a cavity with calcite |
| β Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. Habit: cubic Colour: pale brassy Description: A low-temp mineral of the open vein assemblages, typically as druses coating the earlier high P-T assemblage. Rarely as cubes typically about 1 cm, can form complex rosette aggregates to over 5 cm across and 3.5 cm thick. |
| β 'Pyroxene Group' Formula: ADSi2O6 Description: rounded grains in a calcite vein. |
| βͺ Pyrrhotite Formula: Fe1-xS Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: tabular pseudohexagonal Colour: bronzy Description: A rare accessory mineral of the open vein assemblage. Euhedral crystals to 1.5 cm very rare in Connecticut - this may be the only such locality. |
| β Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. Habit: Tessin habit, scepters, reverse scepters Colour: colorless to white, smoky Description: A very common mineral in the open vein assemblage (and an accessory in the host metagabbro). Mostly small <1-1.5 cm crystals with wide variety of complex forms, Tessin and scepters, reverse scepters and combinations. Many are doubly-terminated. Larger crystals can reach up to 7 cm and are typically Tessin habit showing the various steep positive rhombohedra, such as {20bar21}, {30bar31} and {50bar53} and their negative equivalents {03bar32}, {02bar21}, {03bar31} and {05bar53}. References: |
| β Quartz var. Amethyst Formula: SiO2 Localities: References: |
| βͺ Quartz var. Milky Quartz Formula: SiO2 Habit: stubby prismatic, complex parallel-growth, corn cob Colour: colorless to milky Description: large complex crystals to 10 cm or more, smaller crystals radially encrusted acicular laumontite creating coarse columns of crystals |
| β Quartz var. Rose Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 Localities: Habit: scepters, reverse scepters, Tessin habit Colour: smoky Description: A common mineral in the open vein assemblage. Mostly small <1-1.5 cm crystals with wide variety of complex forms, Tessin and scepters, reverse scepters and combinations. Many are doubly-terminated. Larger crystals can reach up to 7 cm and are typically Tessin habit showing the various steep positive rhombohedra, such as {20bar21}, {30bar31} and {50bar53} and their negative equivalents {03bar32}, {02bar21}, {03bar31} and {05bar53}. |
| β RomanΓ¨chite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Habit: botryoidal Colour: very dark brown to black Description: As masses with conchoidal fracture and black streak in quartz with azurite and malachite. Analyzed 2016 by Peter Cristofono and Tom Mortimer using EDS. Closest other analytical possibility is hollandite, which has a slightly higher Ba:Mn ratio, and doesn't match the physical properties of this material as well as romanechite does. |
| β Rutile Formula: TiO2 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: elongated, striated prisms. Colour: red Description: An accessory mineral in the open vein assemblage, as microcrystals. |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| β Siderite Formula: FeCO3 Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: rhombohedral Description: As outer rims of a few analyzed magnesite crystals. |
| β Sillimanite Formula: Al2(SiO4)O Localities: Habit: elongated prisms Colour: brown Description: Crystals to 7 cm in subparallel alignment in quartz-rich segregations, just like at Chester, Norwich and Willimantic - all from exposures of the Tatnic Hill Formation. References: |
| β 'Soapstone' |
| β Sphalerite Formula: ZnS Habit: rounded grains Colour: yellow Description: mm-scale rounded, clear grains with chalcocite in albite/quartz/muscovite. Sulfide grains are embedded in the silicates suggesting the former are primary. |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: Reported from at least 7 localities in this region. Habit: prismatic, twinned Colour: dark brown Description: "in large crystals, often forming the cross" References: |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Habit: platy Description: drusy crystals with epidote and zeolites in fractures in gneiss References: |
| β Talc Formula: Mg3Si4O10(OH)2 |
| β Titanite Formula: CaTi(SiO4)O Localities: Colour: light brown Description: A rare accessory mineral in the open vein assemblage. References: |
| βͺ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Locality: Becker Quarry (Becker's Quarry), West Willington, Willington, Tolland County, Connecticut, USA Habit: trigonal elongated, striated prisms with rhombhedral terminations Colour: black Description: very sharp, lustrous pocket crystals to several cms. Species likely schorl or perhaps dravite. |
| β Zircon Formula: Zr(SiO4) Localities: Description: A rare accessory mineral in the open vein assemblage. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Sphalerite | 2.CB.05a | ZnS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Amethyst | 4.DA.05 | SiO2 |
| β | var. Milky Quartz | 4.DA.05 | SiO2 |
| β | var. Rose Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | RomanΓ¨chite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Magnesite | 5.AB.05 | MgCO3 |
| β | var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anhydrite ? | 7.AD.30 | CaSO4 |
| β | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| β | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Cummingtonite | 9.DE.05 | β»{Mg2}{Mg5}(Si8O22)(OH)2 |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Epistilbite | 9.GD.45 | CaAl2Si6O16 Β· 5H2O |
| β | Kyanite | 9.AF.15 | Al2(SiO4)O |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| β | Magnesio-hornblende | 9.DE.10 | β»Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Chabazite' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Clinopyroxene Subgroup' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Heulandite Subgroup' | - | |
| β | 'Hornblende' | - | |
| β | 'K Feldspar' | - | |
| β | 'var. Adularia' | - | KAlSi3O8 |
| β | 'Limonite' | - | |
| β | 'Orthopyroxene Subgroup' | - | |
| β | 'Pyroxene Group' | - | ADSi2O6 |
| β | 'Soapstone' | - | |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | β Epistilbite | CaAl2Si6O16 · 5H2O |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Prehnite | Ca2Al2Si3O10(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β RomanΓ¨chite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | β Annite | KFe32+(AlSi3O10)(OH)2 |
| H | β Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| B | Boron | |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Magnesite | MgCO3 |
| C | β Calcite | CaCO3 |
| C | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Graphite | C |
| C | β Siderite | FeCO3 |
| O | Oxygen | |
| O | β Quartz | SiO2 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Quartz var. Milky Quartz | SiO2 |
| O | β Magnesite | MgCO3 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Calcite | CaCO3 |
| O | β Kyanite | Al2(SiO4)O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | β Baryte | BaSO4 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Sillimanite | Al2(SiO4)O |
| O | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Epistilbite | CaAl2Si6O16 · 5H2O |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Titanite | CaTi(SiO4)O |
| O | β Quartz var. Amethyst | SiO2 |
| O | β K Feldspar var. Adularia | KAlSi3O8 |
| O | β Pyroxene Group | ADSi2O6 |
| O | β Prehnite | Ca2Al2Si3O10(OH)2 |
| O | β Rutile | TiO2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β RomanΓ¨chite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | β Siderite | FeCO3 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Zircon | Zr(SiO4) |
| O | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | β Annite | KFe32+(AlSi3O10)(OH)2 |
| O | β Microcline | K(AlSi3O8) |
| O | β Hematite | Fe2O3 |
| O | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Anorthite | Ca(Al2Si2O8) |
| O | β Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Anhydrite | CaSO4 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | β Fluorite | CaF2 |
| F | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Mg | Magnesium | |
| Mg | β Magnesite | MgCO3 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Kyanite | Al2(SiO4)O |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Sillimanite | Al2(SiO4)O |
| Al | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | β Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β K Feldspar var. Adularia | KAlSi3O8 |
| Al | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Anorthite | Ca(Al2Si2O8) |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Quartz var. Milky Quartz | SiO2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Kyanite | Al2(SiO4)O |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Sillimanite | Al2(SiO4)O |
| Si | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | β Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β K Feldspar var. Adularia | KAlSi3O8 |
| Si | β Pyroxene Group | ADSi2O6 |
| Si | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Anorthite | Ca(Al2Si2O8) |
| Si | β Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | β Pyrrhotite | Fe1-xS |
| S | β Baryte | BaSO4 |
| S | β Pyrite | FeS2 |
| S | β Molybdenite | MoS2 |
| S | β Arsenopyrite | FeAsS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcocite | Cu2S |
| S | β Sphalerite | ZnS |
| S | β Anhydrite | CaSO4 |
| Cl | Chlorine | |
| Cl | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β K Feldspar var. Adularia | KAlSi3O8 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Annite | KFe32+(AlSi3O10)(OH)2 |
| K | β Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorite | CaF2 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Anorthite | Ca(Al2Si2O8) |
| Ca | β Anhydrite | CaSO4 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Rutile | TiO2 |
| Ti | β Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Mn | Manganese | |
| Mn | β RomanΓ¨chite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | β Pyrite | FeS2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Siderite | FeCO3 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | β Hematite | Fe2O3 |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcocite | Cu2S |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| Ba | β RomanΓ¨chite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 191 Ma (Early Jurassic) | ||||||
| Oldest Fossil Listed | 201 Ma (Early Jurassic) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Tolland_County,_Connecticut |
|---|---|
| Wikidata ID: | Q54246 |
| GeoNames ID: | 4844275 |
Localities in this Region
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Diamond Ledge, Stafford, Tolland County, Connecticut, USA