Lagorai Group, Trento Province (Trentino), Trentino-Alto Adige (Trentino-South Tyrol), Italyi
| Regional Level Types | |
|---|---|
| Lagorai Group | Mountain Range |
| Trento Province (Trentino) | Autonomous Province |
| Trentino-Alto Adige (Trentino-South Tyrol) | Autonomous Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° North , 11° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~70km
Type:
KΓΆppen climate type:
Mindat Locality ID:
130821
Long-form identifier:
mindat:1:2:130821:4
GUID (UUID V4):
95d6dc8f-1a57-441c-85aa-0fc51892694a
Name(s) in local language(s):
Gruppo del Lagorai, Trento, Trentino-Alto Adige, Italia
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals.
Detailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Pericline Formula: Na(AlSi3O8) |
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| β Anatase Formula: TiO2 |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Bavenite ? Formula: Ca4Be2Al2Si9O26(OH)2 |
| β Brookite Formula: TiO2 |
| β Calcite Formula: CaCO3 |
| β 'Chabazite' |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' Localities: |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β Fayalite Formula: Fe2+2SiO4 |
| β Fluorite Formula: CaF2 |
| β Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| β Kaolinite Formula: Al2(Si2O5)(OH)4 |
| β 'Monazite' Formula: REE(PO4) |
| β Opal Formula: SiO2 · nH2O |
| β Orthoclase Formula: K(AlSi3O8) |
| β Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| β Pyrite Formula: FeS2 |
| β Quartz Formula: SiO2 Localities: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O |
| β Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| β Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Anatase | 4.DD.05 | TiO2 |
| β | Brookite | 4.DD.10 | TiO2 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Pericline | 9.FA.35 | Na(AlSi3O8) |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Bavenite ? | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| β | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 Β· H2O |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Chabazite' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Opal | SiO2 · nH2O |
| H | β Prehnite | Ca2Al2Si3O10(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | Beryllium | |
| Be | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Albite var. Pericline | Na(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Albite | Na(AlSi3O8) |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | β Anatase | TiO2 |
| O | β Brookite | TiO2 |
| O | β Calcite | CaCO3 |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Fayalite | Fe22+SiO4 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Opal | SiO2 · nH2O |
| O | β Prehnite | Ca2Al2Si3O10(OH)2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Monazite | REE(PO4) |
| O | β Titanite | CaTi(SiO4)O |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| F | Fluorine | |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Albite var. Pericline | Na(AlSi3O8) |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Albite var. Pericline | Na(AlSi3O8) |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | Silicon | |
| Si | β Albite var. Pericline | Na(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Fayalite | Fe22+SiO4 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Opal | SiO2 · nH2O |
| Si | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Zircon | Zr(SiO4) |
| Si | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| P | Phosphorus | |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | β Monazite | REE(PO4) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Chalcopyrite | CuFeS2 |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Calcite | CaCO3 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorite | CaF2 |
| Ca | β Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | β Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ti | Titanium | |
| Ti | β Anatase | TiO2 |
| Ti | β Brookite | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | β Pyrite | FeS2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Fayalite | Fe22+SiO4 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | β Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| U | Uranium | |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Localities in this Region
- Trentino-Alto Adige (Trentino-South Tyrol)
- Trento Province (Trentino)
- Castello Tesino
- Telve
- Trento Province (Trentino)
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Cima D'Asta-Campo Regana, Castello Tesino, Trento Province, Trentino-Alto Adige, Italy