Somero, Southwest Finland, Finlandi
| Regional Level Types | |
|---|---|
| Somero | Municipality |
| Southwest Finland | Region |
| Finland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Somero | 9,840 (2014) |
Mindat Locality ID:
233841
Long-form identifier:
1:2:233841:8
GUID (UUID V4):
72ccff6e-6913-4480-96d7-51135c502a78
Other Languages:
Finnish:
Somero, Varsinais-Suomen maakunta, Suomi
French:
Somero, Finlande propre, Finlande
German:
Somero, Varsinais-Suomi, Finnland
Italian:
Somero, Varsinais-Suomi, Finlandia
Russian:
Π‘ΠΎΠΌΠ΅ΡΠΎ, ΠΠ°ΡΡΠΈΠ½Π°ΠΉΡ-Π‘ΡΠΎΠΌΠΈ, Π€ΠΈΠ½Π»ΡΠ½Π΄ΠΈΡ
Simplified Chinese:
η΄’ζ’
ηΎ
, θ₯Ώεθ¬θε, θ¬ε
°
Swedish:
Somero, Egentliga Finland, Finland
Albanian:
Somero, Finlanda JugperΓ«ndimore, Finlanda
Asturian:
Somero, Finlandia del Sudoeste, Finlandia
Belarusian:
Π‘ΠΎΠΌΠ΅ΡΠ°, ΠΠ°ΡΠ΄Π½ΡΠ²Π°-ΠΠ°Ρ
ΠΎΠ΄Π½ΡΡ Π€ΡΠ½Π»ΡΠ½Π΄ΡΡ, Π€ΡΠ½Π»ΡΠ½Π΄ΡΡ
Cebuano:
Somero, Varsinais-Suomi, Finlandia
Dutch:
Somero, Varsinais-Suomi, Finland
Esperanto:
Somero, Origina Finnlando, Finnlando
Estonian:
Somero linn, PΓ€ris-Soome, Soome
Farsi/Persian:
Ψ³ΩΩ
Ψ±Ω, Ψ¬ΩΩΨ¨ ΨΊΨ±Ψ¨ ΩΩΩΨ§ΩΨ―, ΩΩΩΨ§ΩΨ―
Galician:
Somero, Finlandia Propia, Finlandia
Hill Mari:
Π‘ΠΎΠΌΠ΅ΡΠΎ, Π€ΠΈΠ½Π»ΡΠ½Π΄ΠΈ
Komi-Permyak:
Π‘ΠΎΠΌΠ΅ΡΠΎ, ΠΠ°ΡΡΠΈΠ½Π°ΠΉΡ Π‘ΡΠΎΠΌΠΈ, Π‘ΡΠΎΠΌΠΈ
Latin:
Somero, Finnia Propria, Finnia
Northern Sami:
Somero, Varsinais-Suoma eanangoddi, Suopma
Norwegian:
Somero, Egentliga Finland, Finland
Polish:
Somero, Finlandia PoΕudniowo-Zachodnia, Finlandia
Romanian:
Somero, Finlanda Propriu-ZisΔ, Finlanda
Scots:
Somero, Finland Proper, Finland
Serbo-Croatian:
Somero, Prava Finska, Finska
Slovak:
Somero, Varsinais-Suomi, FΓnsko
Traditional Chinese:
η΄’ζ’
ηΎ
, θ¬θ
Turkish:
Somero, GΓΌneybatΔ± Finlandiya, Finlandiya
Ukrainian:
Π‘ΠΎΠΌΠ΅ΡΠΎ, ΠΡΠ²Π΄Π΅Π½Π½ΠΎ-ΠΠ°Ρ
ΡΠ΄Π½Π° Π€ΡΠ½Π»ΡΠ½Π΄ΡΡ, Π€ΡΠ½Π»ΡΠ½Π΄ΡΡ
Vietnamese:
Somero, Finland Proper, PhαΊ§n Lan
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities52 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Localities: Reference: H-J Wilke (1976) Mineralfundstellen, Band 4, Skandinavien |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Alluaudite Formula: (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368 |
| β Analcime Formula: Na(AlSi2O6) · H2O Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Antimony Formula: Sb Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Arsenopyrite Formula: FeAsS Localities: Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Aurostibite Formula: AuSb2 Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 Reference: Ilkka Mikkola collection |
| β Beryl Formula: Be3Al2(Si6O18) Localities: Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295)
|
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Reference: Geological Survey of Finland Mineral Deposit ReportΒ Tupala 19.02.2018 |
| β Bismuth Formula: Bi Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Breithauptite Formula: NiSb Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Calcite Formula: CaCO3 Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Calcite var. Cobalt-bearing Calcite Formula: (Ca,Co)CO3 Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Cassiterite Formula: SnO2 Localities: Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368 |
| β Cassiterite var. Ainalite Formula: SnO2 Reference: NordenskiΓΆld, A. E. (1863): Om tantalitartade mineralier frΓ₯n nejden af Torro, Γfversigt af Kongliga Vetenskaps-Akademiens FΓΆrhandlingar, 20, 443-453 [Geol. FΓΆren. FΓΆrh. (1941) 63, 295-299;] |
| β Chalcopyrite Formula: CuFeS2 Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Clinosafflorite Formula: CoAs2 Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Reference: H-J Wilke (1976) Mineralfundstellen, Band 4, Skandinavien |
| β Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 Localities: Reference: Ilkka Mikkola collection |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Reference: Geological Survey of Finland Mineral Deposit ReportΒ Tupala 19.02.2018 |
| β Diopside Formula: CaMgSi2O6 Reference: Geological Survey of Finland Mineral Deposit ReportΒ Tupala 19.02.2018 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368 |
| β Fluorapatite Formula: Ca5(PO4)3F Reference: Ilkka Mikkola collection |
| β Galena Formula: PbS Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Geocronite Formula: Pb14Sb6S23 Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β 'Gigantolite' Reference: H-J Wilke (1976) Mineralfundstellen, Band 4, Skandinavien |
| β Gold Formula: Au Localities: Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Gudmundite Formula: FeSbS Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Hedleyite Formula: Bi7Te3 Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Hessite Formula: Ag2Te Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Hydroxylherderite Formula: CaBe(PO4)(OH) Reference: Ilkka Mikkola collection |
| β Ilmenite Formula: Fe2+TiO3 Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Jordanite Formula: Pb14As6S23 Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β JosΓ©ite-B Formula: Bi4Te2S Localities: Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β 'K Feldspar' Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β 'K Feldspar var. Adularia' Formula: KAlSi3O8 Reference: Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Laumontite Formula: CaAl2Si4O12 · 4H2O Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368 |
| β 'Lepidolite' Localities: Reference: NordenskiΓΆld, A. E. (1863): Om tantalitartade mineralier frΓ₯n nejden af Torro, Γfversigt af Kongliga Vetenskaps-Akademiens FΓΆrhandlingar, 20, 443-453 |
| β LΓΆllingite Formula: FeAs2 Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Magnetite Formula: Fe2+Fe3+2O4 Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Maldonite Formula: Au2Bi Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β 'Mica Group' Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295) |
| β Microcline Formula: K(AlSi3O8) Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295)
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Petalite Formula: LiAl(Si4O10) Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295)
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295)
; Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Pyrite Formula: FeS2 Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Pyrrhotite Formula: Fe1-xS Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Quartz Formula: SiO2 Localities: Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, (p.295)
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Rubicline Formula: Rb(AlSi3O8) Reference: Teertstra, D. K. ; CernΓ½, P. & Hawthorne, C. 1998. Rubidium-rich feldspars and associated minerals from the LuolamΓ€ki pegmatite, Somero, Finland. Bulletin of the Geological Society of Finland 70, 1-2, 43-49.
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Rutile Formula: TiO2 Localities: Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, 370 pp |
| β Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, 370 pp |
| β Rutile var. StrΓΌverite Formula: (Ti,Ta,Fe)O2 Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, 370 pp |
| β Safflorite Formula: (Co,Ni,Fe)As2 Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Samarskite-(Y) Formula: YFe3+Nb2O8 Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, 370 pp |
| β Scheelite Formula: Ca(WO4) Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Teerstra, D.K., Lahti, S., Alviola, R. & ΔernΓ½, P. (1993): Pollucite and its alteration in Finnish Pegmatites. Geological Survey of Finland Bulletin. 368
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β Silver Formula: Ag Reference: Geological Survey of Finland Mineral Deposit ReportΒ Tupala 19.02.2018 |
| β Sphalerite Formula: ZnS Localities: Reference: KΓ€rkkΓ€inen, N., Koistinen, E. & Jokinen, T. 2007. TutkimustyΓΆselostus malmitutkimuksista
Tammelan kunnan Riukan, kaivosrek.nro 7483/1, ja Pursion, kaivosrek.nro 7482/1, valtauksilla.
Geological Survey of Finland, Report M06/2024/2007/10/69. |
| β Spodumene Formula: LiAlSi2O6 Localities: Reference: H-J Wilke (1976) Mineralfundstellen, Band 4, Skandinavien
Teertstra, D. K., Cerny, P., & Hawthorne, F. C. (1998). Rubidium-rich feldspars and associated minerals from the Luolamaeki pegmatite, Somero, Finland. Bulletin-Geological Society of Finland, 70, 43-49. |
| β 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Reference: Wilke, H.-J. (1976): Mineral-Fundstellen Band 4: Skandinavien. Chr. Weise Verlag, MΓΌnchen, 370 pp |
| β 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Reference: Geological Survey of Finland Mineral Deposit ReportΒ Tupala 19.02.2018 |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reference: H-J Wilke (1976) Mineralfundstellen, Band 4, Skandinavien |
| β Ullmannite Formula: NiSbS Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
| β Uraninite Formula: UO2 Reference: Hannu SeppΓ€nen (1991) Raportti Uraanitutkimuksista Someron Kopilassa Vuosina 1988 - 1990. GTK M 19/2014/-91/1/60 http://tupa.gtk.fi/raportti/arkisto/m19_2024_91_1_60.pdf |
| β Willyamite Formula: CoSbS Reference: Eilu, P. (2003). Exploration for orogenic gold deposits. Fennoscandian Exploration and Mining 2003. Rovaniemi, Finland |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Antimony | 1.CA.05 | Sb |
| β | Bismuth | 1.CA.05 | Bi |
| β | Gold | 1.AA.05 | Au |
| β | Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | Aurostibite | 2.EB.05a | AuSb2 |
| β | Breithauptite | 2.CC.05 | NiSb |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Clinosafflorite | 2.EB.15a | CoAs2 |
| β | Galena | 2.CD.10 | PbS |
| β | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| β | Gudmundite | 2.EB.20 | FeSbS |
| β | Hedleyite | 2.DC.05 | Bi7Te3 |
| β | Hessite | 2.BA.60 | Ag2Te |
| β | Jordanite | 2.JB.30a | Pb14As6S23 |
| β | JosΓ©ite-B | 2.DC.05 | Bi4Te2S |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| β | Maldonite | 2.AA.40 | Au2Bi |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| β | Ullmannite | 2.EB.25 | NiSbS |
| β | Willyamite | 2.EB.25 | CoSbS |
| Group 4 - Oxides and Hydroxides | |||
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | var. Ainalite | 4.DB.05 | SnO2 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| β | var. StrΓΌverite | 4.DB.05 | (Ti,Ta,Fe)O2 |
| β | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | var. Cobalt-bearing Calcite | 5.AB.05 | (Ca,Co)CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| Group 9 - Silicates | |||
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | Analcime | 9.GB.05 | Na(AlSi2O6) Β· H2O |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Cookeite | 9.EC.55 | (LiAl4β»)[AlSi3O10](OH)8 |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Diopside | 9.DA.15 | CaMgSi2O6 |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Laumontite | 9.GB.10 | CaAl2Si4O12 Β· 4H2O |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Petalite | 9.EF.05 | LiAl(Si4O10) |
| β | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) Β· 2H2O |
| β | Rubicline | 9.FA.30 | Rb(AlSi3O8) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Gigantolite' | - | |
| β | 'K Feldspar' | - | |
| β | 'var. Adularia' | - | KAlSi3O8 |
| β | 'Lepidolite' | - | |
| β | 'Mica Group' | - | |
| β | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | β Analcime | Na(AlSi2O6) · H2O |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Laumontite | CaAl2Si4O12 · 4H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | β Hydroxylherderite | CaBe(PO4)(OH) |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | β Petalite | LiAl(Si4O10) |
| Li | β Spodumene | LiAlSi2O6 |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Hydroxylherderite | CaBe(PO4)(OH) |
| B | Boron | |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Cassiterite var. Ainalite | SnO2 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Albite | Na(AlSi3O8) |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Petalite | LiAl(Si4O10) |
| O | β Quartz | SiO2 |
| O | β Spodumene | LiAlSi2O6 |
| O | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | β Samarskite-(Y) | YFe3+Nb2O8 |
| O | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | β Rutile var. StrΓΌverite | (Ti,Ta,Fe)O2 |
| O | β Scheelite | Ca(WO4) |
| O | β Analcime | Na(AlSi2O6) · H2O |
| O | β Cassiterite | SnO2 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Laumontite | CaAl2Si4O12 · 4H2O |
| O | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Microcline | K(AlSi3O8) |
| O | β Rubicline | Rb(AlSi3O8) |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | β Hydroxylherderite | CaBe(PO4)(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Rutile | TiO2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Diopside | CaMgSi2O6 |
| O | β Uraninite | UO2 |
| O | β K Feldspar var. Adularia | KAlSi3O8 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| O | β Calcite | CaCO3 |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | β Analcime | Na(AlSi2O6) · H2O |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Diopside | CaMgSi2O6 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Petalite | LiAl(Si4O10) |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Analcime | Na(AlSi2O6) · H2O |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Laumontite | CaAl2Si4O12 · 4H2O |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Rubicline | Rb(AlSi3O8) |
| Al | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β K Feldspar var. Adularia | KAlSi3O8 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Petalite | LiAl(Si4O10) |
| Si | β Quartz | SiO2 |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Analcime | Na(AlSi2O6) · H2O |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Laumontite | CaAl2Si4O12 · 4H2O |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Rubicline | Rb(AlSi3O8) |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Diopside | CaMgSi2O6 |
| Si | β K Feldspar var. Adularia | KAlSi3O8 |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | β Hydroxylherderite | CaBe(PO4)(OH) |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Galena | PbS |
| S | β Arsenopyrite | FeAsS |
| S | β Gudmundite | FeSbS |
| S | β Willyamite | CoSbS |
| S | β Jordanite | Pb14As6S23 |
| S | β JosΓ©ite-B | Bi4Te2S |
| S | β Geocronite | Pb14Sb6S23 |
| S | β Ullmannite | NiSbS |
| S | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | β K Feldspar var. Adularia | KAlSi3O8 |
| Ca | Calcium | |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Ca | β Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Diopside | CaMgSi2O6 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| Ca | β Calcite | CaCO3 |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | β Rutile var. StrΓΌverite | (Ti,Ta,Fe)O2 |
| Ti | β Rutile | TiO2 |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mn | Manganese | |
| Mn | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | Iron | |
| Fe | β Pyrite | FeS2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | β Rutile var. StrΓΌverite | (Ti,Ta,Fe)O2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Gudmundite | FeSbS |
| Fe | β Safflorite | (Co,Ni,Fe)As2 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Co | Cobalt | |
| Co | β Willyamite | CoSbS |
| Co | β Clinosafflorite | CoAs2 |
| Co | β Safflorite | (Co,Ni,Fe)As2 |
| Co | β Calcite var. Cobalt-bearing Calcite | (Ca,Co)CO3 |
| Ni | Nickel | |
| Ni | β Breithauptite | NiSb |
| Ni | β Safflorite | (Co,Ni,Fe)As2 |
| Ni | β Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β LΓΆllingite | FeAs2 |
| As | β Arsenopyrite | FeAsS |
| As | β Jordanite | Pb14As6S23 |
| As | β Clinosafflorite | CoAs2 |
| As | β Safflorite | (Co,Ni,Fe)As2 |
| Rb | Rubidium | |
| Rb | β Rubicline | Rb(AlSi3O8) |
| Y | Yttrium | |
| Y | β Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | Niobium | |
| Nb | β Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | β Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ag | Silver | |
| Ag | β Silver | Ag |
| Ag | β Hessite | Ag2Te |
| Sn | Tin | |
| Sn | β Cassiterite var. Ainalite | SnO2 |
| Sn | β Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | β Aurostibite | AuSb2 |
| Sb | β Antimony | Sb |
| Sb | β Gudmundite | FeSbS |
| Sb | β Willyamite | CoSbS |
| Sb | β Breithauptite | NiSb |
| Sb | β Geocronite | Pb14Sb6S23 |
| Sb | β Ullmannite | NiSbS |
| Sb | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | β Hedleyite | Bi7Te3 |
| Te | β Hessite | Ag2Te |
| Te | β JosΓ©ite-B | Bi4Te2S |
| Cs | Caesium | |
| Cs | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ta | Tantalum | |
| Ta | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | β Rutile var. StrΓΌverite | (Ti,Ta,Fe)O2 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | β Gold | Au |
| Au | β Maldonite | Au2Bi |
| Au | β Aurostibite | AuSb2 |
| Pb | Lead | |
| Pb | β Galena | PbS |
| Pb | β Jordanite | Pb14As6S23 |
| Pb | β Geocronite | Pb14Sb6S23 |
| Bi | Bismuth | |
| Bi | β Hedleyite | Bi7Te3 |
| Bi | β Bismuth | Bi |
| Bi | β Maldonite | Au2Bi |
| Bi | β JosΓ©ite-B | Bi4Te2S |
| U | Uranium | |
| U | β Uraninite | UO2 |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Somero |
|---|---|
| Wikidata ID: | Q939727 |
| GeoNames ID: | 636345 |
Localities in this Region
- Southwest Finland
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Penikoja, Somero, Southwest Finland, Finland