Washington Heights, Manhattan (New York County), New York City, New York, USAi
| Regional Level Types | |
|---|---|
| Washington Heights | - not defined - |
| Manhattan (New York County) | Borough |
| New York City | City |
| New York | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
40° 51' 0'' North , 73° 56' 8'' West
Latitude & Longitude (decimal):
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Washington Heights | 152,613 (2017) | 0.0km |
| Morris Heights | 40,982 (2017) | 1.3km |
| Inwood | 10,082 (2006) | 1.9km |
| University Heights | 27,935 (2017) | 2.5km |
| Tremont | 22,870 (2017) | 2.5km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| New York Mineralogical Club | New York, New York | 10km |
| New York Paleontological Society | NYC, New York | 14km |
| North Jersey Mineralogical Society, Inc. | Paterson, New Jersey | 21km |
| Nassau Mineral Club | Glen Cove, New York | 25km |
| Island Rockhounds Inc. | Bellmore, New York | 40km |
Mindat Locality ID:
13350
Long-form identifier:
mindat:1:2:13350:5
GUID (UUID V4):
479162fe-f661-4900-968e-24a1781a3dcd
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities29 valid minerals.
Detailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Chrysoberyl Formula: BeAl2O4 |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| β Columbite-(Fe) Formula: Fe2+Nb2O6 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| β Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Description: Gemmy material. |
| β Grossular Formula: Ca3Al2(SiO4)3 |
| β 'Gummite' |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β Ilmenite Formula: Fe2+TiO3 |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| β Microcline Formula: K(AlSi3O8) Localities: References: |
| β 'Monazite' Formula: REE(PO4) Localities: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| β Orthoclase Formula: K(AlSi3O8) Localities: |
| β 'Pinite' |
| β Quartz Formula: SiO2 Localities: Fort George (192nd Street & Audubon Avenue), Washington Heights, Manhattan (New York County), New York City, New York, USA Fort Washington Avenue & 171st Street, Washington Heights, Manhattan (New York County), New York City, New York, USA Washington Heights, Manhattan (New York County), New York City, New York, USA |
| β Quartz var. Smoky Quartz Formula: SiO2 Description: Massive, transparent smoky quartz of gem quality. Cut stones illustrated in Manchester (1931). |
| β Rutile Formula: TiO2 |
| β 'Scapolite' |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 References: |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| β 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| β Titanite Formula: CaTi(SiO4)O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Uraninite Formula: UO2 |
| β Uranophane ? Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| β Wollastonite Formula: Ca3(Si3O9) |
| β 'Xenotime' |
| β Xenotime-(Y) Formula: Y(PO4) Localities: |
| β Zircon Formula: Zr(SiO4) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| β | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 Β· 6H2O |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| β | Uranophane ? | 9.AK.15 | Ca(UO2)2(SiO3OH)2 Β· 5H2O |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| β | 'Scapolite' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Pinite' | - | |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β | 'Gummite' | - | |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Xenotime' | - | |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | β Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Albite | Na(AlSi3O8) |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Chrysoberyl | BeAl2O4 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Columbite-(Fe) | Fe2+Nb2O6 |
| O | β Grossular | Ca3Al2(SiO4)3 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Rutile | TiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Uraninite | UO2 |
| O | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | β Wollastonite | Ca3(Si3O9) |
| O | β Xenotime-(Y) | Y(PO4) |
| O | β Zircon | Zr(SiO4) |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Chrysoberyl | BeAl2O4 |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Grossular | Ca3Al2(SiO4)3 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Grossular | Ca3Al2(SiO4)3 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | β Wollastonite | Ca3(Si3O9) |
| Si | β Zircon | Zr(SiO4) |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | β Monazite | REE(PO4) |
| P | β Xenotime-(Y) | Y(PO4) |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Grossular | Ca3Al2(SiO4)3 |
| Ca | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | β Wollastonite | Ca3(Si3O9) |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Rutile | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Cu | Copper | |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Y | Yttrium | |
| Y | β Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Columbite-(Fe) | Fe2+Nb2O6 |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | β Uraninite | UO2 |
| U | β Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Washington_Heights,_Manhattan |
|---|---|
| Wikidata ID: | Q1370292 |
Localities in this Region
- New York
- New York City
- Manhattan (New York County)
- New York City
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Piedmontia DomainDomain
USA
- New York
- New York City
- Manhattan (New York County)
- Manhattan IslandIsland
- Manhattan (New York County)
- New York City
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Fort George, Washington Heights, Manhattan, New York City, New York, USA