Washington, Litchfield County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Washington | Town |
| Litchfield County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 37' 44'' North , 73° 18' 36'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Mindat Locality ID:
155728
Long-form identifier:
mindat:1:2:155728:5
GUID (UUID V4):
aa55b47f-da13-47a8-b062-aa7fbd86f78f
Washington is a town incorporated in 1779 from lands carved from the adjacent towns of Woodbury, Litchfield, Kent and New Milford. It is named after George Washington.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities23 valid minerals.
Detailed Mineral List:
| β Albite Formula: Na(AlSi3O8) Localities: Habit: blocky, subhedral Colour: white Description: Crystals along the quartz/schist contact. References: |
| β Andalusite Formula: Al2(SiO4)O Localities: Habit: elongated with square cross-sections Colour: gray-brown Description: Crystals in quartz to 6 cm. May be pseudomorphed by fine-grained mica/kyanite. |
| β Annite Formula: KFe2+3(AlSi3O10)(OH)2 Habit: tabular grains Colour: black Description: Mostly as grains in schist and gneiss, coarser grains found along contacts with quartz masses and in pegmatite. References: Moritz, Harold (n.d.) Personal Communication.Identified by Harold Moritz: Visual Identification |
| β 'Asbestos' |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: anhedral grains in the host schist |
| β Calcite Formula: CaCO3 Description: Gangue host in a hydrothermal vein "At a new locality near Juddβs Bridge" discovered by Januzzi circa 1959, with quartz, galena, sphalerite, pyrrhotite, pyrite. |
| β Chalcopyrite Formula: CuFeS2 |
| β 'Chlorite Group' Habit: granular Colour: dark green Description: As fine-grained masses along the quartz/schist contact. |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Habit: fine anhedral grains Colour: dark green Description: Forms fine-grained masses at the contact between the quartz mass and the host schist. |
| β Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 Habit: fine anhedral grains Colour: dark green Description: Forms fine-grained masses at the contact between the quartz mass and the host schist. |
| β Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Habit: elongated Colour: gray-brown Description: A couple of shattered crystals visible in-situ along the top quartz/amphibolite contact about 8 cm long. |
| β Corundum ? Formula: Al2O3 Description: Januzzi (1959) states "Corundum has been reported from the Juddβs Bridge kyanite locality at Washington, Connecticut, or in the near vicinity by J. D. Dana." Dana's System of Mineralogy only references the town, not the specific locality, which does not appear in print until Schairer, 1931. All references after Januzzi (1959) provide no confirmation, but merely repeat his list of minerals or paraphrase the quoted text. |
| β Fluorapatite Formula: Ca5(PO4)3F Localities: Colour: pale to medium green Description: "Crude, pale green crystals and masses occur in quartz", Januzzi, 1959. References: |
| β Galena Formula: PbS Description: "rich masses" in a hydrothermal vein "At a new locality near Juddβs Bridge" discovered by Januzzi circa 1959, with calcite, quartz, sphalerite, pyrrhotite, pyrite. |
| β Greenockite Formula: CdS Description: "One specimen of this mineral found in western Connecticut occurred as an alteration of sphalerite at the new locality discovered by the author at Juddβs Bridge" (Januzzi 1959). With calcite, quartz, galena, pyrite, pyrrhotite in a hydrothermal vein. |
| β Ilmenite Formula: Fe2+TiO3 Localities: Habit: tabular Colour: black Description: "commonly associated with kyanite at Juddβs Bridge.", Januzzi, 1959. References: |
| β Kyanite Formula: Al2(SiO4)O Localities: Habit: elongated, flattened prisms and subparallel aggregates Colour: blue Description: As beautiful blue, bladed crystals and crystal aggregates in milky quartz veins and in host schist associated with ilmenite, staurolite, apatite, and damourite plus the host schist's rock-forming minerals. Blades can be singles or in subparallel aggregates, reaching about 15 cm long and 2-3 cm wide. References: |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Damourite Formula: KAl2(AlSi3O10)(OH)2 Habit: anhedral scales, pseudomorphs after kyanite Description: "as pearly scales in quartz and as more compact talc-like masses that are apparently pseudomorphs after kyanite", Januzzi, 1959. |
| β Pyrite Formula: FeS2 Description: In a hydrothermal vein "At a new locality near Juddβs Bridge" discovered by Januzzi circa 1959, with calcite, quartz, sphalerite, pyrrhotite, galena. |
| β Pyrrhotite Formula: Fe1-xS Description: "At a new locality near Juddβs Bridge the author found small pyrrhotite crystals that showed a wide range of crystal forms. It was associated with other sulfides such as pyrite, sphalerite, galena and with quartz and calcite." |
| β Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| β Rutile Formula: TiO2 Localities: Habit: reticulated acicular crystals Colour: red-brown Description: Approx. 1 cm tabular, reticulated aggregates, possibly pseudomorphic after ilmenite. References: Hrold Moritz field observationsIdentified by Harold Moritz: Visual Identification |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β Sphalerite Formula: ZnS Description: In a hydrothermal vein "At a new locality near Juddβs Bridge" discovered by Januzzi circa 1959, with calcite, quartz, galena, pyrrhotite, pyrite. |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) Habit: prismatic Colour: dark brown Description: Prismatic crystals to 4 cm in host schist (hiding under lumps in the foliation), but typically partially altered to chlorite and mica and so do not make good specimens. |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Greenockite | 2.CB.45 | CdS |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Galena | 2.CD.10 | PbS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Corundum ? | 4.CB.05 | Al2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Kyanite | 9.AF.15 | Al2(SiO4)O |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
| β | Muscovite var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| β | Clinochlore var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| β | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Asbestos' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Annite | KFe32+(AlSi3O10)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | β Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Andalusite | Al2(SiO4)O |
| O | β Annite | KFe32+(AlSi3O10)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Calcite | CaCO3 |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Corundum | Al2O3 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Kyanite | Al2(SiO4)O |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | β Rutile | TiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Corundum | Al2O3 |
| Al | β Kyanite | Al2(SiO4)O |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Kyanite | Al2(SiO4)O |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | β Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | β Chalcopyrite | CuFeS2 |
| S | β Galena | PbS |
| S | β Greenockite | CdS |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Sphalerite | ZnS |
| K | Potassium | |
| K | β Annite | KFe32+(AlSi3O10)(OH)2 |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Rutile | TiO2 |
| Fe | Iron | |
| Fe | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| Cd | Cadmium | |
| Cd | β Greenockite | CdS |
| Pb | Lead | |
| Pb | β Galena | PbS |
Localities in this Region
- Connecticut
- Litchfield County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Washington, Litchfield County, Connecticut, USA