Roche, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Roche | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Roche | 2,517 (2017) |
Mindat Locality ID:
19251
Long-form identifier:
mindat:1:2:19251:7
GUID (UUID V4):
44ad1ab3-4d4f-4ef1-bfc1-f9a1a2305313
Other Languages:
Cornish:
Tregarrek, Kernow, Pow Sows, Ruwvaneth Unys
French:
Roche, Cornouailles, Angleterre, Royaume-Uni
German:
Roche , Cornwall, England, Vereinigtes Königreich
Russian:
Роуч, Корнуолл, Англия, Великобритания
Spanish:
Roche, Cornualles, Inglaterra, Reino Unido
Basque:
Roche , Kornualles, Ingalaterra, Erresuma Batua
Bengali:
রোচ, কর্নওয়াল, ইংল্যান্ড, যুক্তরাজ্য
Cebuano:
Roche , Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
Roche, Cornwall, Engeland, Verenigd Koninkrijk
Gujarati:
રોશ, કોર્નવોલ, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Japanese:
ローシェ, コーンウォール, イングランド, イギリス
Kannada:
ರೋಚೆ, ಕಾರ್ನ್ವಾಲ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
로슈, 콘월주, 잉글랜드, 영국
Lithuanian:
Ročė, Kornvalis, Anglija, Jungtinė Karalystė
Polish:
Roche , Kornwalia, Anglia, Wielka Brytania
Portuguese:
Roche, Cornualha, Inglaterra, Reino Unido
Swedish:
Roche, Cornwall, England, Storbritannien
Tamil:
ரோசே, கோர்ன்வால், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
రోచే, కార్న్వాల్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Urdu:
روچی, کورنوال, انگلستان, مملکت متحدہ
Welsh:
Roche, Cernyw, Lloegr, Y Deyrnas Unedig
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ 'Feldspar Group' |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Hematite Formula: Fe2O3 Localities: |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ 'Limonite' Localities: Colbiggan Mine, Roche, Cornwall, England, UK Pits Mingle Iron Mine (Dyehouse Mine; Trerank Mine), Trezaise (Tresayes), Roche, Cornwall, England, UK Tower Consols (Magnetic Iron Mine; incl. Wheal Click), Trezaise (Tresayes), Roche, Cornwall, England, UK Coldvreath Mine (Killivreath Mine), Coldvreath, Roche, Cornwall, England, UK |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ 'Manganese Oxides' |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ 'Pinite' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ 'Wolframite Group' |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| P | Phosphorus | |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| As | Arsenic | |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| U | Uranium | |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Roche,_Cornwall |
|---|---|
| Wikidata ID: | Q2160232 |
| GeoNames ID: | 7294443 |
Localities in this Region
- England
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- St Austell Mining DistrictMining District
- West Clifford United MinesGroup of Mines
- Withiel United Mines (Withiel Iron Mine; Wheal Vyvyan United)Group of Mines
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Roche Rock, Trezaise, Roche, Cornwall, England, UK