Great Consolidated Mines, Clifford Amalgamated Mines, St Day, Gwennap, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Great Consolidated Mines | Group of Mines |
| Clifford Amalgamated Mines | Group of Mines |
| St Day | Village |
| Gwennap | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 14' 8'' North , 5° 9' 51'' West
Latitude & Longitude (decimal):
Type:
Group of Mines
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| St. Day | 700 (2011) | 1.6km |
| Chacewater | 1,226 (2017) | 2.4km |
| Perranwell | 1,207 (2017) | 4.0km |
| Redruth | 42,690 (2017) | 4.3km |
| Ponsanooth | 967 (2017) | 4.4km |
Mindat Locality ID:
38626
Long-form identifier:
mindat:1:2:38626:8
GUID (UUID V4):
ffd1e323-8db3-4283-be92-23076ec7b4d8
This group of mines was formed in 1780, by amalgamation of West Wheal Virgin, Wheal Virgin, East Wheal Virgin, Wheal Lovelace, Wheal Girl, Wheal Fortune and Cusvey.
The sett is an elongated stretch of land, about 600 yards wide from north to south and more than 2,000 yards long.
To the north, it is bound by the stream that flows eastwards between Carharrack and St Day and joins the Carnon river at Hale Mills.
To the south, it is adjoined by the United Mines.
The western boundary is about 300 yards west of the road leading from Todpool to Sunny Corner, and the eastern boundary is marked by the Carnon river.
Within the sett, the mines were arranged from west to east in the order given above.
The individual boundaries, however, are not always clear today.
The lodes were predominantly copper lodes, consisting of primary and secondary copper ores with pyrite in a gangue of quartz and clay.
They generally trend NE to ENE, as do the elvan dykes within the sett, and crop out within a transverse distance of 500 yards.
The most important lodes, from north to south, were Taylor's lode, Deebles lode and Virgin lode (Fortune lode).
They dip northwards, following the dykes, but there are numerous minor lodes branching from their hangingwalls which dip southwards and cut the dykes at acute angles.
In the eastern part of the sett, the lodes show comb structures with open cavities; they are disordered near crosscourses and usually thin where passing through the dykes.
In 1861, the Great Consolidated Mines were combined with United Mines under the name Clifford Amalgamated Mines.
The group lies within the parish of Gwennap.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities28 valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Galena | 2.CD.10 | PbS |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Arsenopyrite | 2.EB.20 | FeAsS |
| β | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Cuprite | 4.AA.10 | Cu2O |
| β | var. Chalcotrichite | 4.AA.10 | Cu2O |
| β | Tenorite | 4.AB.10 | CuO |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Rock Crystal | 4.DA.05 | SiO2 |
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Chalcanthite | 7.CB.20 | CuSO4 Β· 5H2O |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| β | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| β | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| β | Scorodite | 8.CD.10 | Fe3+AsO4 Β· 2H2O |
| Group 9 - Silicates | |||
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'Feldspar Group' | - | |
| β | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Chalcanthite | CuSO4 · 5H2O |
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Libethenite | Cu2(PO4)(OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Olivenite | Cu2(AsO4)(OH) |
| H | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Scorodite | Fe3+AsO4 · 2H2O |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Baryte | BaSO4 |
| O | β Cassiterite | SnO2 |
| O | β Chalcanthite | CuSO4 · 5H2O |
| O | β Cuprite var. Chalcotrichite | Cu2O |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Cuprite | Cu2O |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Libethenite | Cu2(PO4)(OH) |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Olivenite | Cu2(AsO4)(OH) |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Scorodite | Fe3+AsO4 · 2H2O |
| O | β Tenorite | CuO |
| O | β Uraninite | UO2 |
| O | β Quartz var. Rock Crystal | SiO2 |
| F | Fluorine | |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Al | Aluminium | |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Rock Crystal | SiO2 |
| P | Phosphorus | |
| P | β Libethenite | Cu2(PO4)(OH) |
| P | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| S | Sulfur | |
| S | β Arsenopyrite | FeAsS |
| S | β Baryte | BaSO4 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcanthite | CuSO4 · 5H2O |
| S | β Chalcocite | Cu2S |
| S | β Galena | PbS |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Molybdenite | MoS2 |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| S | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| K | Potassium | |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Fluorite | CaF2 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Arsenopyrite | FeAsS |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Scorodite | Fe3+AsO4 · 2H2O |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcanthite | CuSO4 · 5H2O |
| Cu | β Chalcocite | Cu2S |
| Cu | β Cuprite var. Chalcotrichite | Cu2O |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Cuprite | Cu2O |
| Cu | β Copper | Cu |
| Cu | β Libethenite | Cu2(PO4)(OH) |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Olivenite | Cu2(AsO4)(OH) |
| Cu | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | β Tenorite | CuO |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Arsenopyrite | FeAsS |
| As | β Olivenite | Cu2(AsO4)(OH) |
| As | β Scorodite | Fe3+AsO4 · 2H2O |
| As | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| Pb | Lead | |
| Pb | β Galena | PbS |
| U | Uranium | |
| U | β Uraninite | UO2 |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Localities in this Region
- England
- Cornwall
- Gwennap
- St Day
- Clifford Amalgamated Mines
- Great Consolidated Mines
- Clifford Amalgamated Mines
- St Day
- Gwennap
- Cornwall
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
EuropeContinent
UK
- England
- Cornwall
- Camborne-Redruth and St Day Mining DistrictMining District
- Gwennap
- St DayVillage
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
