Poproč, Košice-okolie District, Košice Region, Slovakiai
| Regional Level Types | |
|---|---|
| Poproč | Municipality |
| Košice-okolie District | District |
| Košice Region | Region |
| Slovakia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
126390
Long-form identifier:
mindat:1:2:126390:2
GUID (UUID V4):
22c794f3-2dd1-483d-afac-4ac4bf5b239f
Other Languages:
French:
Poproč , Košice-okolie, Košice, Slovaquie
German:
Poproč , Okres Košice-okolie, Košický kraj, Slowakei
Italian:
Poproč , distretto di Košice-okolie, regione di Košice, Slovacchia
Spanish:
Poproč , Distrito de Košice–okolie, Región de Košice, Eslovaquia
Basque:
Poproč , Košice-okolie barrutia, Košice eskualdea, Eslovakia
Catalan:
Poproč , districte de Košice-okolie, Regió de Košice, Eslovàquia
Czech:
Poproč , okres Košice-okolí, Košický kraj, Slovensko
Dutch:
Poproč , Okres Košice-okolie, Košice, Slowakije
Esperanto:
Poproč , Distrikto Košice-ĉirkaŭaĵo, Regiono Košice, Slovakio
Hungarian:
Jászómindszent, Kassa-környéki járás, Kassa megye, Szlovákia
Malay:
Poproč, Daerah Košice-okolie, Daerah Košice, Slovakia
Polish:
Poproč , Powiat Koszyce-okolice, Kraj koszycki, Słowacja
Portuguese:
Poproč , Košice–okolie, Košice, Eslováquia
Romanian:
Poproč, Košice-okolie, Košice, Slovacia
Serbian:
Попроч , Округ Кошице-околина, Кошички крај, Словачка
Slovak:
Poproč, Košice-okolie , Košický kraj, Slovensko
Ukrainian:
Попроч , Кошице-околіє, Кошицький край, Словаччина
Waray:
Poproč, Košice-okolie, Košice, Eslovakya
Abandoned Sb deposit.
Active in the second half of the 20th century.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities60 valid minerals.
Detailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Mercury | 1.AD.05 | Hg |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | 'Plumosite' | 2.. | |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Mercury-bearing Tetrahedrite' | 2.GB.05 | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Mushketovite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | 4.CB.05 | Fe2O3 | |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | 5.AB.10 | CaMg(CO3)2 | |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Slavíkite | 7.DF.30 | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Clinochlore var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Fe | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Nickeline | NiAs |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Nickeline | NiAs |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Mercury | Hg |
| Hg | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Popro%C4%8D,_Ko%C5%A1ice-okolie_District |
|---|---|
| Wikidata ID: | Q1088580 |
Localities in this Region
- Košice Region
- Košice-okolie District
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Europe
- Carpathian MountainsMountain Range
Slovakia
- Gemeric UnitGeologic Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Fortuna and Rúfus Mine, Poproč, Košice-okolie District, Košice Region, Slovakia