West Paris, Oxford County, Maine, USAi
| Regional Level Types | |
|---|---|
| West Paris | Town |
| Oxford County | County |
| Maine | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| West Paris | 1,790 (2017) |
Mindat Locality ID:
24086
Long-form identifier:
mindat:1:2:24086:9
GUID (UUID V4):
a84eb8ed-7949-41cd-8696-323bc361fb64
Formerly a part of Paris, West Paris was incorporated as a town in 1957.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities26 valid minerals. 2 erroneous literature entries.
Detailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| β | Spinel ? | 4.BB.05 | MgAl2O4 |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Quartz var. Rose Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Samarskite-(Y) ? | 4.DB.25 | YFe3+Nb2O8 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 Β· 8H2O |
| β | Perhamite | 8.DO.20 | Ca3Al7.7Si3P4O23.5(OH)14.1 Β· 8H2O |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| β | Cookeite | 9.EC.55 | (LiAl4β»)[AlSi3O10](OH)8 |
| β | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | 9.FA.35 | Na(AlSi3O8) | |
| β | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) Β· 2H2O |
| Unclassified | |||
| β | 'Limonite' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Lepidolite' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Tourmaline var. Achroite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| β | 'Manganese Oxides var. Manganese Dendrites' | - | |
| β | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Annite | KFe32+(AlSi3O10)(OH)2 |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Hydroxylherderite | CaBe(PO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| H | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Li | Lithium | |
| Li | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Chrysoberyl | BeAl2O4 |
| Be | β Hydroxylherderite | CaBe(PO4)(OH) |
| B | Boron | |
| B | β Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Graphite | C |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Annite | KFe32+(AlSi3O10)(OH)2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | β Chrysoberyl | BeAl2O4 |
| O | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gahnite | ZnAl2O4 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Hydroxylherderite | CaBe(PO4)(OH) |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| O | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | β Quartz | SiO2 |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Samarskite-(Y) | YFe3+Nb2O8 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spinel | MgAl2O4 |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | β Chrysoberyl | BeAl2O4 |
| Al | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Al | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spinel | MgAl2O4 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | β Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Si | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Hydroxylherderite | CaBe(PO4)(OH) |
| P | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| P | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| S | Sulfur | |
| S | β Chalcopyrite | CuFeS2 |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | β Annite | KFe32+(AlSi3O10)(OH)2 |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | β Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | Iron | |
| Fe | β Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Cu | Copper | |
| Cu | β Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Y | Yttrium | |
| Y | β Samarskite-(Y) | YFe3+Nb2O8 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Samarskite-(Y) | YFe3+Nb2O8 |
| Cs | Caesium | |
| Cs | β Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Maine
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
West Paris, Oxford County, Maine, USA