Hilfe Gottes Mine, Stammelbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germanyi
| Regional Level Types | |
|---|---|
| Hilfe Gottes Mine | Mine |
| Stammelbach valley | Valley |
| Schiltach | Town |
| Rottweil | District |
| Freiburg Region | Region |
| Baden-Württemberg | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 16' 3'' North , 8° 19' 18'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Schiltach | 4,025 (2013) | 2.8km |
| Lauterbach/Schwarzwald | 3,193 (2016) | 4.5km |
| Aichhalden | 4,184 (2017) | 6.0km |
| Schenkenzell | 1,822 (2017) | 6.2km |
| Schramberg | 18,565 (2013) | 6.8km |
Mindat Locality ID:
5696
Long-form identifier:
mindat:1:2:5696:3
GUID (UUID V4):
5cfdc10b-4944-4a86-abc3-d7472c91338d
Other Languages:
German:
Grube Hilfe Gottes, Stammelbachtal, Schiltach, Rottweil, Regierungsbezirk Freiburg, Baden-Württemberg, Deutschland
Quartz vein with Bi-Co-Cu mineralizations and minor uranium ores, hosted by granite. The Mine was worked for cobalt ores from 1772 to 1780. Old dumps located in the Stammelbach valley, 3 km SW of Schiltach.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Aragonite Formula: CaCO3 References: |
| ⓘ Arsenic Formula: As References: |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O References: |
| ⓘ Arsenolite Formula: As2O3 References: |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O References: |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O References: |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ Bismite Formula: Bi2O3 References: |
| ⓘ Bismuth Formula: Bi References: |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ 'Chlorite Group' References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Coffinite Formula: U(SiO4) · nH2O References: |
| ⓘ Copper Formula: Cu References: |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Emplectite Formula: CuBiS2 References: |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O References: |
| ⓘ Hydronováčekite Formula: Mg(UO2)2(AsO4)2 · 12H2O References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O References: |
| ⓘ 'Limonite' References: |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ Metaheinrichite Formula: Ba(UO2)2(AsO4)2 · 8H2O References: |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O References: |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O References: |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O References: |
| ⓘ Proustite Formula: Ag3AsS3 References: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Realgar Formula: As4S4 References: |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Skutterudite Formula: CoAs3 References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S References: |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ 'Wad' References: |
| ⓘ Walpurgite Formula: (BiO)4(UO2)(AsO4)2 · 2H2O References: |
| ⓘ Wittichenite Formula: Cu3BiS3 References: |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Arsenic | 1.CA.05 | As |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Walpurgite | 8.EA.05 | (BiO)4(UO2)(AsO4)2 · 2H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Hydronováčekite | 8.EB.05 | Mg(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metaheinrichite | 8.EB.10 | Ba(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Fe | Iron | |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Ag | Silver | |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | Antimony | |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
