Bunker Hill District (Copper Creek District), Pinal County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Bunker Hill District (Copper Creek District) | Mining District |
| Pinal County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
32° North , 111° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~95km
Type:
KΓΆppen climate type:
Mindat Locality ID:
46484
Long-form identifier:
mindat:1:2:46484:9
GUID (UUID V4):
093295b7-9a0c-4b5d-b4f2-f61b25d573f0
This district lies in eastern Pinal County and includes an area approximately 10 miles long by 4 miles wide in the northwestern portion of the Galiuro Mountains. Mining for silver occurred here as early as 1863 and the district was recorded in 1883.
The oldest rocks exposed in the Copper Creek area consist of limestone, quartzite, conglomerate, shale, and sandstone, interbedded with a complex series of andesite, rhyolite, and dacite tuffs and flows, and intruded by sills and dikes of andesite and dacite. All of these rocks are probably of Cretaceous age. They are overlain by an extensive series of basalt flows, presumably of late Cretaceous or early Tertiary age, which cap much of the Galiuro Mountains. A medium-grained rock, predominantly granodiorite, intrudes the Cretaceous (?) series. Gila conglomerate, Pliocene in age, is faulted against the Cretaceous (?) rocks near the mountain front.
Four general directions of faulting have been determined. In addition, one fault marked by considerable breccic strikes N.55ΒΊ to 60ΒΊ W.
Faults in an east-west system, striking from N.85ΒΊW. to S.85ΒΊW., and dipping from 75ΒΊS. to 75ΒΊN., are especially prominent in the southern and western portions of the area. Associated with them are the Childs-Adwinkle, American Eagle, Copper Prince, Copper Giant, Old Reliable, Globe, and numerous other breccia pipes. The faults of this system, characterized by considerable gouge, are believed to have resulted from shearing stresses. Most of the E-W faults cannot be traced for more than a few hundred feet, although one has been followed vertically for 850 feet in the Childs-Adwinkle Mine and mapped on the surface for a length of half a mile, and anothert extends westward for more than a mile from the American Eagle Mine.
A second system trend N.55ΒΊ to 60ΒΊE., range in dip between 75ΒΊSE and 75ΒΊNW, but most are almost vertical. This system is strongest in the northeastern portion of the intrusive area in vicinity of numerous breccia pipes. Outcrops resemble those of the last system but contain ore minerals more abundantly. The southwesterlt-trending Blue Bird fissure has been followed on the 525 level for 1,800 feet, and has been mapped on the surface intermittently for almost a mile.
A third system strikes N.65ΒΊ to 75ΒΊW. and dip almost vertically.
The fourth system is comprised of tight vertical faults striking N.10ΒΊW. and occur sparingly throughout the district and are present near most of the breccia pipes. Outcrops of some of the breccia pipes are aligned in this direction.
The breccia pipes are breccia bodies rudely circular to elliptical in plan and having great vertical extent. From 100 to 125 such bodies have been noted in the Copper Creek area, only a few of which are ore-bearing. They occur in string fracture zones or at intersections of fractures.
Redhawk Resources is the current owner of many of the mining claims in the Copper Creek District. In speaking to the mine geologist in Feb 2016, Redhawk Resources may consider requests to collect in the area if given advanced notice and information about those who will be collecting. Collecting without permission may be considered as trespassing.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities67 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Gold | 1.AA.05 | Au |
| β | Silver | 1.AA.05 | Ag |
| β | Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Djurleite | 2.BA.05 | Cu31S16 |
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Acanthite | 2.BA.35 | Ag2S |
| β | Stromeyerite | 2.BA.40 | AgCuS |
| β | Covellite | 2.CA.05a | CuS |
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Galena | 2.CD.10 | PbS |
| β | Molybdenite var. Rhenium-bearing Molybdenite | 2.EA.30 | (Mo,Re)S2 |
| β | 2.EA.30 | MoS2 | |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| β | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| β | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| β | Chlorargyrite | 3.AA.15 | AgCl |
| β | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| β | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 Β· 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| β | Cuprite | 4.AA.10 | Cu2O |
| β | Tenorite | 4.AB.10 | CuO |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | var. Specularite | 4.CB.05 | Fe2O3 |
| β | Quartz var. Rock Crystal | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Opal var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | 4.DA.10 | SiO2 Β· nH2O | |
| β | Pyrolusite | 4.DB.05 | Mn4+O2 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| β | Manganite | 4.FD.15 | Mn3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Anhydrite | 7.AD.30 | CaSO4 |
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Anglesite | 7.AD.35 | PbSO4 |
| β | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| β | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| β | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| β | Chalcanthite | 7.CB.20 | CuSO4 Β· 5H2O |
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| β | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 Β· 3H2O |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| β | Wulfenite | 7.GA.05 | Pb(MoO4) |
| β | Powellite | 7.GA.05 | Ca(MoO4) |
| β | Lindgrenite | 7.GB.05 | Cu3(MoO4)2(OH)2 |
| β | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 Β· nH2O |
| β | Markascherite (TL) | 7.GB.70 | Cu3(MoO4)(OH)4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| β | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| β | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| β | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| β | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| β | VΓ©signiΓ©ite | 8.BH.45 | BaCu3(VO4)2(OH)2 |
| β | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| β | Corkite | 8.BL.05 | PbFe3(PO4)(SO4)(OH)6 |
| β | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| Group 9 - Silicates | |||
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Ajoite | 9.EA.70 | (K,Na)Cu7AlSi9O24(OH)6 Β· 3H2O |
| β | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 Β· nH2O |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 Β· 2.5-3H2O |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Scolecite | 9.GA.05 | CaAl2Si3O10 Β· 3H2O |
| Unclassified | |||
| β | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] Β· nH2O |
| β | 'Erionite Subgroup' | - | M2[Al4Si14O36] Β· 15H2O |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Manganese Oxides' | - | |
| β | 'Copper Stain' | - | |
| β | 'Chabazite' | - | |
| β | 'Psilomelane' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Wad' | - | |
| β | 'Limonite' | - | |
| β | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] Β· nH2O |
| β | 'LΓ©vyne' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| H | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | β Antlerite | Cu3(SO4)(OH)4 |
| H | β Atacamite | Cu2(OH)3Cl |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Brochantite | Cu4(SO4)(OH)6 |
| H | β Chalcanthite | CuSO4 · 5H2O |
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Conichalcite | CaCu(AsO4)(OH) |
| H | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| H | β Descloizite | PbZn(VO4)(OH) |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| H | β Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Jarosite | KFe33+(SO4)2(OH)6 |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Libethenite | Cu2(PO4)(OH) |
| H | β Lindgrenite | Cu3(MoO4)2(OH)2 |
| H | β Manganite | Mn3+O(OH) |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | β Olivenite | Cu2(AsO4)(OH) |
| H | β Opal | SiO2 · nH2O |
| H | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Scolecite | CaAl2Si3O10 · 3H2O |
| H | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β VΓ©signiΓ©ite | BaCu3(VO4)2(OH)2 |
| H | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Markascherite | Cu3(MoO4)(OH)4 |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Calcite | CaCO3 |
| C | β Cerussite | PbCO3 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| C | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| O | β Albite | Na(AlSi3O8) |
| O | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | β Anglesite | PbSO4 |
| O | β Anhydrite | CaSO4 |
| O | β Antlerite | Cu3(SO4)(OH)4 |
| O | β Atacamite | Cu2(OH)3Cl |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Baryte | BaSO4 |
| O | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Brochantite | Cu4(SO4)(OH)6 |
| O | β Calcite | CaCO3 |
| O | β Cerussite | PbCO3 |
| O | β Chalcanthite | CuSO4 · 5H2O |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Conichalcite | CaCu(AsO4)(OH) |
| O | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| O | β Cuprite | Cu2O |
| O | β Descloizite | PbZn(VO4)(OH) |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| O | β Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Hematite | Fe2O3 |
| O | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Jarosite | KFe33+(SO4)2(OH)6 |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Libethenite | Cu2(PO4)(OH) |
| O | β Lindgrenite | Cu3(MoO4)2(OH)2 |
| O | β Manganite | Mn3+O(OH) |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | β Olivenite | Cu2(AsO4)(OH) |
| O | β Opal | SiO2 · nH2O |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | β Powellite | Ca(MoO4) |
| O | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | β Pyrolusite | Mn4+O2 |
| O | β Pyromorphite | Pb5(PO4)3Cl |
| O | β Quartz | SiO2 |
| O | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | β Rutile | TiO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Scolecite | CaAl2Si3O10 · 3H2O |
| O | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | β Tenorite | CuO |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β VΓ©signiΓ©ite | BaCu3(VO4)2(OH)2 |
| O | β Wulfenite | Pb(MoO4) |
| O | β Hematite var. Specularite | Fe2O3 |
| O | β Quartz var. Rock Crystal | SiO2 |
| O | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Markascherite | Cu3(MoO4)(OH)4 |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| Al | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Scolecite | CaAl2Si3O10 · 3H2O |
| Al | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| Si | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | β Opal | SiO2 · nH2O |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Scolecite | CaAl2Si3O10 · 3H2O |
| Si | β Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | β Quartz var. Rock Crystal | SiO2 |
| Si | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| P | β Libethenite | Cu2(PO4)(OH) |
| P | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | β Pyromorphite | Pb5(PO4)3Cl |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Acanthite | Ag2S |
| S | β Anglesite | PbSO4 |
| S | β Anhydrite | CaSO4 |
| S | β Antlerite | Cu3(SO4)(OH)4 |
| S | β Baryte | BaSO4 |
| S | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | β Bornite | Cu5FeS4 |
| S | β Brochantite | Cu4(SO4)(OH)6 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcanthite | CuSO4 · 5H2O |
| S | β Chalcocite | Cu2S |
| S | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| S | β Covellite | CuS |
| S | β Djurleite | Cu31S16 |
| S | β Enargite | Cu3AsS4 |
| S | β Galena | PbS |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Jarosite | KFe33+(SO4)2(OH)6 |
| S | β Molybdenite | MoS2 |
| S | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | β Pyrite | FeS2 |
| S | β Sphalerite | ZnS |
| S | β Stromeyerite | AgCuS |
| S | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | β Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Cl | Chlorine | |
| Cl | β Atacamite | Cu2(OH)3Cl |
| Cl | β Chlorargyrite | AgCl |
| Cl | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | β Pyromorphite | Pb5(PO4)3Cl |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | β Jarosite | KFe33+(SO4)2(OH)6 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Anhydrite | CaSO4 |
| Ca | β Calcite | CaCO3 |
| Ca | β Conichalcite | CaCu(AsO4)(OH) |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | β Powellite | Ca(MoO4) |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Rutile | TiO2 |
| V | Vanadium | |
| V | β Descloizite | PbZn(VO4)(OH) |
| V | β VΓ©signiΓ©ite | BaCu3(VO4)2(OH)2 |
| Mn | Manganese | |
| Mn | β Manganite | Mn3+O(OH) |
| Mn | β Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Fe | β Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | β Hematite | Fe2O3 |
| Fe | β Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | β Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Hematite var. Specularite | Fe2O3 |
| Cu | Copper | |
| Cu | β Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Cu | β Antlerite | Cu3(SO4)(OH)4 |
| Cu | β Atacamite | Cu2(OH)3Cl |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Bornite | Cu5FeS4 |
| Cu | β Brochantite | Cu4(SO4)(OH)6 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcanthite | CuSO4 · 5H2O |
| Cu | β Chalcocite | Cu2S |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Conichalcite | CaCu(AsO4)(OH) |
| Cu | β Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | β Covellite | CuS |
| Cu | β Cuprite | Cu2O |
| Cu | β Copper | Cu |
| Cu | β Djurleite | Cu31S16 |
| Cu | β Enargite | Cu3AsS4 |
| Cu | β Libethenite | Cu2(PO4)(OH) |
| Cu | β Lindgrenite | Cu3(MoO4)2(OH)2 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Olivenite | Cu2(AsO4)(OH) |
| Cu | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | β Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | β Stromeyerite | AgCuS |
| Cu | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | β Tenorite | CuO |
| Cu | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | β VΓ©signiΓ©ite | BaCu3(VO4)2(OH)2 |
| Cu | β Markascherite | Cu3(MoO4)(OH)4 |
| Zn | Zinc | |
| Zn | β Descloizite | PbZn(VO4)(OH) |
| Zn | β Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | β Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | β Sphalerite | ZnS |
| As | Arsenic | |
| As | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | β Conichalcite | CaCu(AsO4)(OH) |
| As | β Enargite | Cu3AsS4 |
| As | β Olivenite | Cu2(AsO4)(OH) |
| As | β Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | β Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | β Lindgrenite | Cu3(MoO4)2(OH)2 |
| Mo | β Molybdenite | MoS2 |
| Mo | β Powellite | Ca(MoO4) |
| Mo | β Wulfenite | Pb(MoO4) |
| Mo | β Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Mo | β Markascherite | Cu3(MoO4)(OH)4 |
| Ag | Silver | |
| Ag | β Acanthite | Ag2S |
| Ag | β Chlorargyrite | AgCl |
| Ag | β Silver | Ag |
| Ag | β Stromeyerite | AgCuS |
| Sb | Antimony | |
| Sb | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| Ba | β VΓ©signiΓ©ite | BaCu3(VO4)2(OH)2 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Re | Rhenium | |
| Re | β Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Au | Gold | |
| Au | β Gold | Au |
| Pb | Lead | |
| Pb | β Anglesite | PbSO4 |
| Pb | β Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | β Cerussite | PbCO3 |
| Pb | β Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Pb | β Descloizite | PbZn(VO4)(OH) |
| Pb | β Galena | PbS |
| Pb | β Pyromorphite | Pb5(PO4)3Cl |
| Pb | β Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Geochronology
Mineralization age: Paleocene : 61 Ma to 60.4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Localities in this Region
- Arizona
- Pinal County
- Bunker Hill District (Copper Creek District)
- Copper Creek (Copper Creek Canyon)
- Adwinkle & Longstreet claims
- American Eagle Mine (American Eagle Basin)
- Blue Bird Mine (Bluebird Mine; Zilla Mine; Twin-S Mine; Cumberland Mine; Thornewood Mine; Blue Bird Silver Mining Co. property)
- Childs-Adwinkle Mine (Childs and Altwilkle Mine; Childs-Aldwinkle Mine)
- Copper Creek
- Copper Creek Road
- Copper Giant Mine
- Copper Prince Mine (Arizona Moly Corp. property; Copper Giant Mine; Copper Creek project; Patented claims MS 2620)
- Fortuna Copper Mine
- Gamblers Tunnel
- Glory Hole Mine (Globe Mine; Patented claims MS 2620)
- Mammoth Breccia Pipe
- Old Reliable Mine (Reliable Mine; Calumet Mine; Clark-Scanlon group; Copper Creek Mining Co. property)
- Unnamed copper prospect (1)
- Unnamed copper prospect (10)
- Unnamed copper prospect (2)
- Unnamed copper prospect (3)
- Unnamed copper prospect (4)
- Unnamed copper prospect (42)
- Unnamed copper prospect (43)
- Unnamed copper prospect (44)
- Unnamed copper prospect (45)
- Unnamed copper prospect (46)
- Copper Creek (Copper Creek Canyon)
- Bunker Hill District (Copper Creek District)
- Pinal County
- Arizona
- Pinal County
- Bunker Hill District (Copper Creek District)
- Copper Creek (Copper Creek Canyon)
- ⭔Hat Top Mountain area
- Mercer Ranch area
- Red Bird Mine
- San Francisco No. 1 claim
- ⭔Sombrero Butte area
- ⭔Sombrero Butte peak area
- Superior claim (MS 3118 claim)
- Table Mountain
- ⭔Table Mountain area
- Bunker Hill District (Copper Creek District)
- Pinal County
Other Regions, Features and Areas containing this locality
Mexico
- Sierra Madre OccidentalMountain Range
North America
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
USA
- Arizona
- Galiuro MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Old Reliable Mine, Copper Creek, Bunker Hill District, Pinal County, Arizona, USA