Johnston, Providence County, Rhode Island, USAi
| Regional Level Types | |
|---|---|
| Johnston | Town |
| Providence County | County |
| Rhode Island | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Johnston is a town, incorporated in 1759.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities43 valid minerals.
Detailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Smith St. locality, Johnston, Providence County, Rhode Island, USA Brown Lime quarry, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Cleavelandite ? Formula: Na(AlSi3O8) Reference: Miller, 1972. Minerals of Rhode Island |
| β 'Allanite Group' Formula: {A12+REE3+}{M13+M23+M32+}(Si2O7)(SiO4)O(OH) Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Anatase Formula: TiO2 Reference: Rolf Luetcke |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: AmMin 11:334-340 |
| β Antigorite Formula: Mg3(Si2O5)(OH)4 |
| β Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| β Baryte Formula: BaSO4 Localities: Reference: P Cristofono collection |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: Reference: Miller, 1972. Minerals of Rhode Island |
| β Beryl Formula: Be3Al2(Si6O18) Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Calcite Formula: CaCO3 Localities: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Smith St. locality, Johnston, Providence County, Rhode Island, USA Mineral Spring Ave. locality, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Chalcopyrite Formula: CuFeS2 Localities: Reference: AmMin 11:334-340 |
| β Chalcopyrite var. Gold-bearing Chalcopyrite Formula: CuFeS2 with Au Reference: AmMin 11:334-340 |
| β 'Chlorite Group' Localities: Reference: AmMin 11:334-340 |
| β Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Angell Farm, Johnston, Providence County, Rhode Island, USA Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Hi-Lo Construction Co. Quarry, Johnston, Providence County, Rhode Island, USA Brown Lime quarry, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Reference: Museum of Natural History, Roger Williams Park, Providence, R.I. G4182 6382 |
| β 'Clinochrysotile' Reference: Michael W. Kieron coll.; Rocks & Minerals (1986) 61:264-275 |
| β Dolomite Formula: CaMg(CO3)2 Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Epidote Formula: {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) Localities: Hi-Lo Construction Co. Quarry, Johnston, Providence County, Rhode Island, USA Bear Ledge quarry (Pine Hill quarry), Graniteville, Johnston, Providence County, Rhode Island, USA Smith St. locality, Johnston, Providence County, Rhode Island, USA Mineral Spring Ave. locality, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA |
| β 'Feldspar Group' |
| β 'Feldspar Group var. Perthite' |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorite Formula: CaF2 Localities: Reference: P Cristofono collection |
| β Galena Formula: PbS Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Goethite Formula: Ξ±-Fe3+O(OH) Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Greenockite Formula: CdS Reference: Miller, 1972. Minerals of Rhode Island |
| β Hematite Formula: Fe2O3 Localities: Reference: AmMin 11:334-340 |
| β 'Hornblende' Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: AmMin 11:334-340 |
| β Ilmenite Formula: Fe2+TiO3 Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Jamesonite Formula: Pb4FeSb6S14 Reference: AmMin 11:334-340 |
| β 'K Feldspar' Formula: KAlSi3O8 |
| β 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| β 'Leucoxene' Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β 'Limonite' Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: AmMin 11:334-340 |
| β Magnetite Formula: Fe2+Fe3+2O4 Localities: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Smith St. locality, Johnston, Providence County, Rhode Island, USA Brown Lime quarry, Johnston, Providence County, Rhode Island, USA Angell Farm, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β Microcline Formula: K(AlSi3O8) |
| β Molybdenite Formula: MoS2 Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Opal Formula: SiO2 · nH2O Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Opal var. Opal-AN Formula: SiO2 · nH2O Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Orthoclase Formula: K(AlSi3O8) Reference: AmMin 11:334-340 |
| β Powellite Formula: Ca(MoO4) Reference: Miller, 1972. Minerals of Rhode Island. |
| β Pyrite Formula: FeS2 Localities: Reference: Am. Min. 11 pp. 334-340 |
| β Pyrrhotite Formula: Fe1-xS Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| β Quartz var. Amethyst Formula: SiO2 Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Quartz var. Milky Quartz Formula: SiO2 Reference: AmMin 11:334-340 |
| β Quartz var. Smoky Quartz Formula: SiO2 |
| β Scheelite Formula: Ca(WO4) Reference: P. Cristofono collection; Rocks & Minerals (1986) 61:264-275 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Museum of Natural History, Roger Williams Park, Providence, R.I. G4139 3384 |
| β Siderite Formula: FeCO3 Localities: Reference: Am. Min. 11 pp. 334-340 |
| β Sphalerite Formula: ZnS Localities: Reference: Miller, 1972. Minerals of Rhode Island |
| β Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| β Talc Formula: Mg3Si4O10(OH)2 Localities: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Brown Lime quarry, Johnston, Providence County, Rhode Island, USA Jenkins Lime quarry, Johnston, Providence County, Rhode Island, USA Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Reference: Am. Min. 11 pp. 334-340 |
| β Talc var. Steatite Formula: Mg3(Si4O10)(OH)2 Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Reference: AmMin 11:334-340 |
| β Titanite Formula: CaTi(SiO4)O Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Titanite var. Keilhauite Formula: (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
| β Tremolite Formula: ◻{Ca2}{Mg5}(Si8O22)(OH)2 Localities: Reference: Am. Min. 11 pp. 334-340 |
| β 'Wolframite Group' Reference: Michael W. Kieron coll. |
| β Zircon Formula: Zr(SiO4) Reference: George, Gilbert (1972). Latest Finds at Rhode Island Road Cuts(Micromounters of New England no. 17, Feb. 1972). |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | var. Gold-bearing Chalcopyrite | 2.CB.10a | CuFeS2 with Au |
| β | Galena | 2.CD.10 | PbS |
| β | Greenockite | 2.CB.45 | CdS |
| β | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| β | Molybdenite | 2.EA.30 | MoS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Sphalerite | 2.CB.05a | ZnS |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Anatase | 4.DD.05 | TiO2 |
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Opal | 4.DA.10 | SiO2 Β· nH2O |
| β | var. Opal-AN | 4.DA.10 | SiO2 Β· nH2O |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Amethyst | 4.DA.05 | SiO2 |
| β | var. Milky Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Baryte | 7.AD.35 | BaSO4 |
| β | Powellite | 7.GA.05 | Ca(MoO4) |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | var. Cleavelandite ? | 9.FA.35 | Na(AlSi3O8) |
| β | Anthophyllite | 9.DD.05 | β»{Mg2}{Mg5}(Si8O22)(OH)2 |
| β | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| β | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| β | 'Clinochrysotile' | 9.ED. | |
| β | Epidote | 9.BG.05a | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| β | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| β | var. Steatite | 9.EC.05 | Mg3(Si4O10)(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | var. Keilhauite | 9.AG.15 | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| β | Tremolite | 9.DE.10 | β»{Ca2}{Mg5}(Si8O22)(OH)2 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Allanite Group' | - | {A12+REE3+}{M13+M23+M32+}(Si2O7)(SiO4)O(OH) |
| β | 'Chlorite Group' | - | |
| β | 'Feldspar Group' | - | |
| β | 'var. Perthite' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Hornblende' | - | |
| β | 'K Feldspar' | - | KAlSi3O8 |
| β | 'var. Adularia' | - | KAlSi3O8 |
| β | 'Leucoxene' | - | |
| β | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | β Talc | Mg3Si4O10(OH)2 |
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | β Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| H | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| H | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | β Staurolite | Fe22+Al9Si4O23(OH) |
| H | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | β Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| H | β Antigorite | Mg3(Si2O5)(OH)4 |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Opal var. Opal-AN | SiO2 · nH2O |
| H | β Allanite Group | {A12+REE3+}{M13+M23+M32+}(Si2O7)(SiO4)O(OH) |
| H | β Opal | SiO2 · nH2O |
| Be | Beryllium | |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Dolomite | CaMg(CO3)2 |
| C | β Siderite | FeCO3 |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | β Calcite | CaCO3 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | β Talc | Mg3Si4O10(OH)2 |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | β Dolomite | CaMg(CO3)2 |
| O | β Siderite | FeCO3 |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Calcite | CaCO3 |
| O | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| O | β K Feldspar var. Adularia | KAlSi3O8 |
| O | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Staurolite | Fe22+Al9Si4O23(OH) |
| O | β Microcline | K(AlSi3O8) |
| O | β Albite | Na(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz var. Milky Quartz | SiO2 |
| O | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | β Hematite | Fe2O3 |
| O | β Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| O | β Antigorite | Mg3(Si2O5)(OH)4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Powellite | Ca(MoO4) |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Baryte | BaSO4 |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Opal var. Opal-AN | SiO2 · nH2O |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Allanite Group | {A12+REE3+}{M13+M23+M32+}(Si2O7)(SiO4)O(OH) |
| O | β Zircon | Zr(SiO4) |
| O | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β K Feldspar | KAlSi3O8 |
| O | β Opal | SiO2 · nH2O |
| O | β Titanite | CaTi(SiO4)O |
| O | β Anatase | TiO2 |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | β Talc | Mg3Si4O10(OH)2 |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | β Dolomite | CaMg(CO3)2 |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Mg | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | β Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Mg | β Antigorite | Mg3(Si2O5)(OH)4 |
| Al | Aluminium | |
| Al | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Al | β K Feldspar var. Adularia | KAlSi3O8 |
| Al | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | β Staurolite | Fe22+Al9Si4O23(OH) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β K Feldspar | KAlSi3O8 |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | β Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | β Talc | Mg3Si4O10(OH)2 |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | β Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Si | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Si | β K Feldspar var. Adularia | KAlSi3O8 |
| Si | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | β Staurolite | Fe22+Al9Si4O23(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz var. Milky Quartz | SiO2 |
| Si | β Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | β Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Si | β Antigorite | Mg3(Si2O5)(OH)4 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Opal var. Opal-AN | SiO2 · nH2O |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Allanite Group | {A12+REE3+}{M13+M23+M32+}(Si2O7)(SiO4)O(OH) |
| Si | β Zircon | Zr(SiO4) |
| Si | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β K Feldspar | KAlSi3O8 |
| Si | β Opal | SiO2 · nH2O |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| S | β Jamesonite | Pb4FeSb6S14 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Sphalerite | ZnS |
| S | β Greenockite | CdS |
| S | β Baryte | BaSO4 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Galena | PbS |
| S | β Molybdenite | MoS2 |
| K | Potassium | |
| K | β K Feldspar var. Adularia | KAlSi3O8 |
| K | β Microcline | K(AlSi3O8) |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β K Feldspar | KAlSi3O8 |
| Ca | Calcium | |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | β Dolomite | CaMg(CO3)2 |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Tremolite | ◻{Ca2}{Mg5}(Si8O22)(OH)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Ca | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Powellite | Ca(MoO4) |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Fluorite | CaF2 |
| Ca | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ca | β Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Anatase | TiO2 |
| Fe | Iron | |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | β Siderite | FeCO3 |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Epidote | {Ca2}{Al2Fe3+}(Si2O7)(SiO4)O(OH) |
| Fe | β Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | β Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | β Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Fe | β Jamesonite | Pb4FeSb6S14 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Hematite | Fe2O3 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Cu | Copper | |
| Cu | β Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | β Sphalerite | ZnS |
| Y | Yttrium | |
| Y | β Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | β Powellite | Ca(MoO4) |
| Mo | β Molybdenite | MoS2 |
| Cd | Cadmium | |
| Cd | β Greenockite | CdS |
| Sb | Antimony | |
| Sb | β Jamesonite | Pb4FeSb6S14 |
| Ba | Barium | |
| Ba | β Baryte | BaSO4 |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | β Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Pb | Lead | |
| Pb | β Jamesonite | Pb4FeSb6S14 |
| Pb | β Galena | PbS |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Johnston,_Rhode_Island |
|---|---|
| Wikidata ID: | Q368233 |
| GeoNames ID: | 5222928 |
Localities in this Region
- Rhode Island
- Rhode Island
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Carolinia DomainDomain
- Narragansett BasinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Hipses Rock, Johnston, Providence County, Rhode Island, USA