Shet, Karaganda Region, Kazakhstani
| Regional Level Types | |
|---|---|
| Shet | District |
| Karaganda Region | Region |
| Kazakhstan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Mindat Locality ID:
302648
Long-form identifier:
mindat:1:2:302648:2
GUID (UUID V4):
07a2b178-256d-4289-97f3-aa33a100aa90
Other Languages:
French:
District de Chet, Région de Karaganda (Oblys de Karaganda), Kazakhstan
Italian:
Distretto di Šet, Regione di Karaganda, Kazakistan
Kazakh (Cyrillic Script):
Шет ауданы, Қарағанды облысы, Қазақстан
Russian:
Шетский район, Карагандинская область, Казахстан
Belarusian:
Шэцкі раён, Карагандзінская вобласць, Казахстан
Bulgarian:
Шетски район, Карагандинска област, Казахстан
Danish:
Shet Distrikt, Karagandy Region, Kasakhstan
Dutch:
Shet District, Oblast Qarağandı, Kazachstan
Greek:
Επαρχία Σετ, Περιφέρεια Καραγκάντα, Καζακστάν
Macedonian:
Шет, Карагандинска област, Казахстан
Malay:
Daerah Shet, Wilayah Karagandy, Kazakhstan
Ukrainian:
Шетський район, Карагандинська область, Казахстан
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities107 valid minerals. 3 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Aikinite Formula: PbCuBiS3 Localities: References: |
| ⓘ 'Aikinite-Bismuthinite Series' |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: References: |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Anglesite Formula: PbSO4 Localities: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| ⓘ Barstowite Formula: Pb4Cl6(CO3) · H2O |
| ⓘ Baryte Formula: BaSO4 Localities: |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Localities: |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ Bilibinskite Formula: PbCu2Au3Te2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: |
| ⓘ Bismuth Formula: Bi Localities: Akchatau Mine, Akshatau (Aqshatau), Shet, Karaganda Region, Kazakhstan Upper Kayrakty W-Mo-Bi deposit (Verkhnee-Kayrakty), Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan Kayrakty Pb-Zn Mine, Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan Severnyi-Katpar W-Mo-Bi deposit, Agadyr, Shet, Karaganda Region, Kazakhstan |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Akchatau Mine, Akshatau (Aqshatau), Shet, Karaganda Region, Kazakhstan Upper Kayrakty W-Mo-Bi deposit (Verkhnee-Kayrakty), Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan Kayrakty Pb-Zn Mine, Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan Nura-Taldy W deposit, Shet, Karaganda Region, Kazakhstan |
| ⓘ Bornite Formula: Cu5FeS4 Localities: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brockite Formula: (Ca,Th,Ce)PO4 · H2O |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Chlorite Group' Localities: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Creedite Formula: Ca3SO4Al2F8(OH)2 · 2H2O Localities: |
| ⓘ Cuprite Formula: Cu2O Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ 'Feldspar Group' Localities: |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Localities: |
| ⓘ Ferripyrophyllite Formula: Fe3+Si2O5(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 8 localities in this region. Colour: Pale rose; pale blue References: |
| ⓘ Friedrichite Formula: Pb5Cu5Bi7S18 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 6 localities in this region. |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ Gladite Formula: PbCuBi5S9 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: |
| ⓘ Gold Formula: Au Localities: |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hammarite Formula: Pb2Cu2Bi4S9 |
| ⓘ Hematite Formula: Fe2O3 Localities: Akkuduk occurrence (White Well), Mointy Railway Station, Moyynty, Shet, Karaganda Region, Kazakhstan U-Mo occurrence, Shunak Mountains, Mointy Railway Station, Moyynty, Shet, Karaganda Region, Kazakhstan Almaly Mine, Shet, Karaganda Region, Kazakhstan Saryshagan Cu deposit, Shet, Karaganda Region, Kazakhstan |
| ⓘ 'Hornblende' |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) |
| ⓘ Hydrokenoelsmoreite var. Ferritungstite |
| ⓘ Iriginite Formula: (UO2)Mo2O7 · 3H2O |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: |
| ⓘ Jordisite Formula: MoS2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' Localities: |
| ⓘ Krupkaite Formula: PbCuBi3S6 |
| ⓘ 'Limonite' Localities: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lindströmite Formula: Pb3Cu3Bi7S15 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melkovite (TL) Formula: [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe3+3O36(OH)] Type Locality: |
| ⓘ 'Melnikovite' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Akchatau Mine, Akshatau (Aqshatau), Shet, Karaganda Region, Kazakhstan Almaly Mine, Shet, Karaganda Region, Kazakhstan Saryshagan Cu deposit, Shet, Karaganda Region, Kazakhstan Kayrakty Pb-Zn Mine, Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan Upper Kayrakty W-Mo-Bi deposit (Verkhnee-Kayrakty), Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pekoite Formula: PbCuBi11S18 |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Localities: References: |
| ⓘ Posnjakite (TL) Formula: Cu4(SO4)(OH)6 · H2O Type Locality: |
| ⓘ Powellite Formula: Ca(MoO4) Localities: |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: References: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: References: |
| ⓘ Rockbridgeite Formula: Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Saryarkite-(Y) (TL) Formula: Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O Type Locality: |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Akchatau Mine, Akshatau (Aqshatau), Shet, Karaganda Region, Kazakhstan Nura-Taldy W deposit, Shet, Karaganda Region, Kazakhstan Severnyi-Katpar W-Mo-Bi deposit, Agadyr, Shet, Karaganda Region, Kazakhstan Upper Kayrakty W-Mo-Bi deposit (Verkhnee-Kayrakty), Kayrakty (Kairakty), Shet, Karaganda Region, Kazakhstan |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Silver Formula: Ag |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: References: |
| ⓘ 'Tennantite-Tetrahedrite Series' Localities: |
| ⓘ Tenorite Formula: CuO |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Ferrithorite Formula: (Th,Fe3+)[Si(O,OH)4] |
| ⓘ Thortveitite Formula: Sc2Si2O7 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Tungstite Formula: WO3 · H2O Localities: |
| ⓘ 'Unnamed (Hydrous Zr Molybdate)' Formula: Zr-Mo-O-OH |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ 'Wad' |
| ⓘ Wittichenite Formula: Cu3BiS3 Localities: |
| ⓘ 'Wolframite Group' Localities: |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) Localities: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Bilibinskite | 2.BA.80 | PbCu2Au3Te2 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Friedrichite | 2.HB.05a | Pb5Cu5Bi7S18 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Galenobismutite | 2.JC.25e | PbBi2S4 |
| ⓘ | Gladite | 2.HB.05a | PbCuBi5S9 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Hammarite | 2.HB.05a | Pb2Cu2Bi4S9 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Jordisite | 2.EA.30 | MoS2 |
| ⓘ | Krupkaite | 2.HB.05a | PbCuBi3S6 |
| ⓘ | Lindströmite | 2.HB.05a | Pb3Cu3Bi7S15 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pekoite | 2.HB.05a | PbCuBi11S18 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| Group 3 - Halides | |||
| ⓘ | Barstowite | 3.DC.95 | Pb4Cl6(CO3) · H2O |
| ⓘ | Creedite | 3.CG.15 | Ca3SO4Al2F8(OH)2 · 2H2O |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Hydrokenoelsmoreite | 4.DH.15 | ◻2W2O6(H2O) |
| ⓘ | var. Ferritungstite | 4.DH.15 | ◻2W2O6(H2O) |
| ⓘ | Iriginite | 4.GB.60 | (UO2)Mo2O7 · 3H2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Posnjakite (TL) | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Brockite | 8.CJ.45 | (Ca,Th,Ce)PO4 · H2O |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Melkovite (TL) | 8.DM.15 | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe3+3O36(OH)] |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Rockbridgeite | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Saryarkite-(Y) (TL) | 8.DO.25 | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Ferripyrophyllite | 9.EC.10 | Fe3+Si2O5(OH) |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | var. Ferrithorite | 9.AD.30 | (Th,Fe3+)[Si(O,OH)4] |
| ⓘ | Thortveitite | 9.BC.05 | Sc2Si2O7 |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Aikinite-Bismuthinite Series' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Hornblende' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Unnamed (Hydrous Zr Molybdate)' | - | Zr-Mo-O-OH |
| ⓘ | 'Wad' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| H | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| H | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Iriginite | (UO2)Mo2O7 · 3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Barstowite | Pb4Cl6(CO3) · H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| H | ⓘ Unnamed (Hydrous Zr Molybdate) | Zr-Mo-O-OH |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Barstowite | Pb4Cl6(CO3) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| O | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| O | ⓘ Thortveitite | Sc2Si2O7 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Iriginite | (UO2)Mo2O7 · 3H2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Barstowite | Pb4Cl6(CO3) · H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| O | ⓘ Unnamed (Hydrous Zr Molybdate) | Zr-Mo-O-OH |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Opal | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | Aluminium | |
| Al | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | Silicon | |
| Si | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| Si | ⓘ Thortveitite | Sc2Si2O7 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Opal | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| P | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| P | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| S | Sulfur | |
| S | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Lindströmite | Pb3Cu3Bi7S15 |
| S | ⓘ Pekoite | PbCuBi11S18 |
| S | ⓘ Krupkaite | PbCuBi3S6 |
| S | ⓘ Gladite | PbCuBi5S9 |
| S | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| S | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jordisite | MoS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Cl | Chlorine | |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Barstowite | Pb4Cl6(CO3) · H2O |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| Ca | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Creedite | Ca3SO4Al2F8(OH)2 · 2H2O |
| Ca | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Sc | Scandium | |
| Sc | ⓘ Thortveitite | Sc2Si2O7 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Cu | Copper | |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Lindströmite | Pb3Cu3Bi7S15 |
| Cu | ⓘ Pekoite | PbCuBi11S18 |
| Cu | ⓘ Krupkaite | PbCuBi3S6 |
| Cu | ⓘ Gladite | PbCuBi5S9 |
| Cu | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Cu | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Bilibinskite | PbCu2Au3Te2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Smithsonite | ZnCO3 |
| As | Arsenic | |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Unnamed (Hydrous Zr Molybdate) | Zr-Mo-O-OH |
| Mo | Molybdenum | |
| Mo | ⓘ Melkovite | [Ca2(H2O)15Ca(H2O)6][Mo8P2Fe33+O36(OH)] |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Iriginite | (UO2)Mo2O7 · 3H2O |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Jordisite | MoS2 |
| Mo | ⓘ Unnamed (Hydrous Zr Molybdate) | Zr-Mo-O-OH |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Te | Tellurium | |
| Te | ⓘ Bilibinskite | PbCu2Au3Te2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Bilibinskite | PbCu2Au3Te2 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Lindströmite | Pb3Cu3Bi7S15 |
| Pb | ⓘ Pekoite | PbCuBi11S18 |
| Pb | ⓘ Krupkaite | PbCuBi3S6 |
| Pb | ⓘ Gladite | PbCuBi5S9 |
| Pb | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Pb | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Barstowite | Pb4Cl6(CO3) · H2O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Bilibinskite | PbCu2Au3Te2 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Lindströmite | Pb3Cu3Bi7S15 |
| Bi | ⓘ Pekoite | PbCuBi11S18 |
| Bi | ⓘ Krupkaite | PbCuBi3S6 |
| Bi | ⓘ Gladite | PbCuBi5S9 |
| Bi | ⓘ Hammarite | Pb2Cu2Bi4S9 |
| Bi | ⓘ Friedrichite | Pb5Cu5Bi7S18 |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Th | Thorium | |
| Th | ⓘ Saryarkite-(Y) | Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7 · 6H2O |
| Th | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Th | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Iriginite | (UO2)Mo2O7 · 3H2O |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Geochronology
Mineralization age: Paleozoic : 300.5 Ma to 289.8 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Permian | |||||||
| Cisuralian |
| ||||||
| Carboniferous | |||||||
| Pennsylvanian |
| ||||||
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 2 |
|---|---|
| Youngest Fossil Listed | 365 Ma (Late/Upper Devonian) |
| Oldest Fossil Listed | 371 Ma (Late/Upper Devonian) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Shet_District |
|---|---|
| Wikidata ID: | Q2726493 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Kazakhstan
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Akchatau Mine, Akshatau, Shet, Karaganda Region, Kazakhstan