Kragerø, Telemark, Norwayi
| Regional Level Types | |
|---|---|
| Kragerø | Municipality |
| Telemark | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
2487
Long-form identifier:
mindat:1:2:2487:0
GUID (UUID V4):
001b0fd2-2d81-44d0-aaa7-b850207fd1b9
Other Languages:
French:
Kragerø, Telemark, Norvège
German:
Kragerø, Telemark, Norwegen
Italian:
Kragerø, Telemark, Norvegia
Norwegian:
Kragerø, Telemark, Norge
Russian:
Крагерё, Телемарк, Норвегия
Simplified Chinese:
克拉格勒, 泰勒马克, 挪威
Spanish:
Kragerø, Telemark, Noruega
Afrikaans:
Kragerø, Noorweë
Albanian:
Kragerø, Telemark, Norvegjia
Arabic:
كراغرو, تلمارك, النرويج
Aragonese:
Kragerø, Noruega
Armenian:
Կրագերյո, Նորվեգիա
Asturian:
Kragerø, Telemark, Noruega
Bashkir:
Крагерё, Норвегия
Basque:
Kragerø, Telemark, Norvegia
Bavarian:
Kragerø, Norwegn
Belarusian:
Крагерэ, Тэлемарк, Нарвегія
Bishnupriya Manipuri:
ক্রাগেরা, টেলেমার্ক, নরৱে
Breton:
Kragerø, Telemark, Norvegia
Bulgarian:
Крагерьо, Телемарк, Норвегия
Catalan:
Kragerø, Telemark, Noruega
Cebuano:
Kragerø , Telemark fylke, Norway
Corsican:
Kragerø, Nurvegia
Croatian:
Kragerø, Telemark, Norveška
Czech:
Kragerø, Telemark, Norsko
Danish:
Kragerø, Telemark, Norge
Dutch:
Kragerø, Telemark, Noorwegen
Dutch Low Saxon:
Kragerø, Noorwegen
Esperanto:
Kragerø, Telemark, Norvegio
Estonian:
Kragerø vald, Telemark, Norra
Farsi/Persian:
کراگرا, تلمارک, نروژ
Finnish:
Kragerø, Telemarkin lääni, Norja
Franco-Provençal:
Kragerø, Norvèg·e
Friulian:
Kragerø, Norvegje
Galician:
Kragerø, Noruega
Hungarian:
Kragerø, Telemark megye, Norvégia
Icelandic:
Kragerø, Þelamörk, Noregur
Ido:
Kragerø, Norvegia
Indonesian:
Kragerø, Telemark, Norwegia
Interlingua:
Kragerø, Norvegia
Interlingue:
Kragerø, Norvegia
Irish Gaelic:
Kragerø, An Iorua
Japanese:
クラーゲレー, テレマルク県, ノルウェー
Kongo:
Kragerø, Norge
Korean:
크라게뢰, 텔레마르크주, 노르웨이
Latin:
Kragerø, Telemark, Norvegia
Ligurian:
Kragerø, Nòrvexa
Limburgian:
Kragerø, Telemark, Noorwege
Low Saxon/Low German:
Kommun Kragerø, Amt Telemark, Norwegen
Luxembourgish:
Kragerø, Norwegen
Malagasy:
Kragerø, Norvezy
Malay:
Kragerø, Norway
Minangkabau:
Kragerø, Norwegia
Minnan / Hokkien-Taiwanese:
Kragerø, Telemark, Lo̍k-ui
Narom:
Kragerø, Norouague
Neapolitan:
Kragerø, Norvegia
Northern Sami:
Kragerø, Telemárkku fylka, Norga
Norwegian (Nynorsk):
Kragerø kommune, Telemark fylke, Noreg
Occitan:
Kragerø, Telemark, Norvègia
Picard:
Kragerø, Norvège
Piedmontese:
Kragerø, Norvegia
Polish:
Kragerø, Telemark, Norwegia
Portuguese:
Kragerø, Telemark, Noruega
Romanian:
Kragerø, Telemark, Norvegia
Romansh:
Kragerø, Norvegia
Sardinian:
Kragerø, Norvegia
Scots:
Kragerø, Telemark, Norawa
Scottish Gaelic:
Kragerø, Nirribhidh
Sicilian:
Kragerø, Nurveggia
Slovak:
Kragerø, Telemark, Nórsko
Slovenian:
Kragerø, Telemark, Norveška
Swahili:
Kragerø, Norwei
Swedish:
Kragerø, Telemark, Norge
Tamil:
கிரகேரோ, டெலிமார்க், நோர்வே
Turkish:
Kragerø, Telemark, Norveç
Ukrainian:
Крагере, Телемарк, Норвегія
Venetian:
Kragerø, Norveja
Vietnamese:
Kragerø, Telemark, Na Uy
Volapük:
Kragerø, Norgän
Walloon:
Kragerø, Norvedje
Waray:
Kragerø, Telemark, Noruega
Welsh:
Kragerø, Norwy
West Flemish:
Kragerø, Nôorweegn
Wolof:
Kragerø, Noorwees
Zulu:
Kragerø, INoki
Kragerø (Norwegian pronunciation: [ˈkrɑ̀ːɡərœ]) is a town and municipality in Telemark county, Norway. It is part of the traditional regions of Grenland and the smaller Vestmar. The administrative centre of the municipality is the town of Kragerø. The city of Kragerø lies furthest south in the county of Telemark. Villages in Kragerø include Helle, Vadfoss, Kil, and Portør.
The London-based newspaper, The Independent, published an article on Kragerø stating that “When Norwegians want to get away from it all they head for Kragerø. Forests, fjords, and islands await them at the place where Edvard Munch found peace and relaxation.” The population of Kragerø quadruples during its summer months due to high tourism.
The municipality (originally the town of Kragerø) is named after the island of Kragerø (Old Norse: Krákarey) since the town was built on the island and mainland near it. The first element is kráka which means “crow”. The last element is ey which means “island”. The Norwegian spelling would have a k instead of the g, but Kragerø uses the Danish form of the name, established in the 17th century.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities110 valid minerals. 2 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Aeschynite-(Y) Formula: (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 26 localities in this region. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) Localities: |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ 'Alkali Feldspar' Localities: |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| ⓘ 'Almandine-Pyrope Series' |
| ⓘ 'Amphibole Asbestos' Locality: Studsdalen, Kragerø, Telemark, Norway |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 Localities: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 16 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS Description: Weibye (1848) mentions arsenopyrite from an undisclosed locality 3/4 miles east of Kragerø |
| ⓘ 'Asbestos' Localities: |
| ⓘ 'Aspasiolite' |
| ⓘ Babingtonite Formula: Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ Bazzite Formula: Be3Sc2(Si6O18) |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 9 localities in this region. Habit: Long thin flakes Colour: black Description: partly altered to chlorite in the fringes |
| ⓘ Bismuthinite Formula: Bi2S3 Description: Vogt mention an old find of bismuthinite togheter with "copper-nickel", chalcopyrite and bornite from one of the Langøy mines. |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brugnatellite Formula: Mg6Fe3+(CO3)(OH)13 · 4H2O Locality: Sannidal, Kragerø, Telemark, Norway |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Caysichite-(Y) Formula: (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| ⓘ 'Chabazite' |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ Chernovite-(Y) Formula: Y(AsO4) |
| ⓘ Chlorapatite (TL) Formula: Ca5(PO4)3Cl Type Locality: Kragerø, Telemark, Norway Description: Analysis in Rammelsberg (cited after Völker) shows 4.10 wt % Cl References: |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| ⓘ 'Coal blend' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Some of the poor developed columbites embedded in red felspar has been shown to be intermediate between columbite-(Fe) and columbite-(Mn) in composition |
| ⓘ Formula: Mn2+Nb2O6 Locality: Tangen Feldspar Mine, Kragerø, Telemark, Norway - erroneously reported Description: Newer SEM/EDS analysis done on these has showed them to be columbite-(Fe). (Selbekk et al 2008) |
| ⓘ Copper Formula: Cu |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: Colour: black |
| ⓘ Danburite Formula: CaB2Si2O8 Description: 2 specimens in the collection of the Mineralogisk-Geologisk Museum in Oslo, collected by Peder Tangen during 1906-1908. There are some uncertainty of the right locality of the specimens, Oftedal (1963) concludes that Tangen is the most probably one |
| ⓘ 'Davidite' Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) Localities: Description: Kvamsdal (2001) reports a find of dumorterite in a small pegmatite on one (unnamed by him) of the island around Kragerø |
| ⓘ Enstatite Formula: Mg2Si2O6 Localities: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ 'Euxenite Group' |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Localities: |
| ⓘ 'Feldspar Group var. Sunstone' Localities: |
| ⓘ 'Fergusonite' Localities: |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: References: Larsen, Knut Edvard (2008) Lindvikskollen- Kalstadgangen, Kragerø, en klassisk norsk granittpegmatitt [Lindvikskollen- Kalstadgangen, Kragerø, a classic Norwegian granite pegmatite]. Norsk Bergverksmuseum Skrift 38, 37-44 Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ 'Gadolinite' Localities: Colour: brown Description: A calsium-rich gadolinite. The spacing are slightly larger than ordinary gadolinite. Oftedal postulated that Ca probably occupy a large number of the Fe positions in the structure |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: |
| ⓘ Gersdorffite Formula: NiAsS Localities: |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au Localities: Description: One sample in collection of the Natural History Museum, Oslo labelled "Stabbestad Farm, Skåtøy". Stabbestad is not located at Skåtøy (an island)but at the mainland just opposite Skåtøy |
| ⓘ Graphite Formula: C Localities: |
| ⓘ Hellandite-(Y) (TL) Formula: (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 Type Locality: |
| ⓘ 'Hellandite-(Yb)' ? Formula: (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 Description: First classified as Hellandite-(Yb), then Hellandite-(Y).
Modern and more complete analyses are needed to correctly name the samples. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 13 localities in this region. Description: Hematite is common, but the exceptional xls. found in this mine are rare. |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Description: With a narrow zone of heulandite-K (nordrum et al. 2003) |
| ⓘ Heulandite-K Formula: (K,Ca,Na)5(Si27Al9)O72 · 26H2O Description: a calcian heulandite -K, present as a narrow zone in 2 analyzed heulandite-Ca crystals (Nordrum et al. 2003) |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: Habit: tabular, 1mm large Colour: colourless |
| ⓘ Hingganite-(Y) Formula: (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 Habit: as 2-3mm large irregular masses Colour: greyish green |
| ⓘ Hingganite-(Yb) Formula: (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 Description: As a chalc-like pseudomorphic columnar mineral, up to 3 cm , in pure quartz. The pseudomorphose after an unknown mineral consist of hingganite-(Yb) (confirmed by XRD), and the materiale is often contaminated by small amounts of kainosite-(Y). The total REE is dominated by Yb and Y. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hydrotalcite Formula: Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) Localities: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kainosite-(Y) Formula: Ca2(Y,Ce)2(Si4O12)(CO3) · H2O Localities: References: |
| ⓘ Kamphaugite-(Y) Formula: Ca(Y,REE)(CO3)2(OH) · H2O Description: As well-crystallized rosettes in cracks along quartz and feldspar. |
| ⓘ 'K Feldspar' Localities: Reported from at least 8 localities in this region. References: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kornerupine Formula: Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ 'Lithian Muscovite' Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Lokkaite-(Y) Formula: Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| ⓘ Mackinawite Formula: FeS Description: Found in polished ore; as thin plates or lamellaes in grains of chalcopyrite |
| ⓘ Magnesiodumortierite Formula: Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 17 localities in this region. Habit: nodular masses |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ 'Mica Group' Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 10 localities in this region. Habit: large crystals including Carlsbad twins Colour: greenish to reddish to buff Description: Common as component of the graphic granite. Perthitic. It has been found as welldeveloped crytsals embedded in quartz. |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: References: Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 14 localities in this region. Description: found in plagioclase |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Habit: acicular in radiating rosettes < 1 cm in diameter Colour: chalky pink |
| ⓘ Nickeline Formula: NiAs Localities: Description: In the collection of Mineralogical Museum of Oslo there is a sample of nickeline labelled "Grev Wedels Mine, 11/12 1844". |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ 'Orthopyroxene Subgroup' Description: 'Olivine-hypersthene' meteorite (original classification) w. hypersthene a slightly dated term for a variety of orthopyroxene. |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Localities: |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 Description: Found as nice honey-yellow crystals to 2mm thick and 2-3mm long. |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Phenakite Formula: Be2SiO4 Localities: Habit: elongated prismatic Colour: colorless, white Description: Phenakite occure as crystals in quartz or albite. References: Hintze, C. (1897) X. Ueber krystallisirten Phenakit aus Schlesien. Zeitschrift für Kristallographie - Crystalline Materials, 28 (1) 174-176 doi:10.1524/zkri.1897.28.1.174p.176 Bäckström, Helge (1898) Fenakit från Kragerö. Geologiska Föreningen i Stockholm Förhandlingar, 20 (5) 295-303 doi:10.1080/11035899809453991 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ 'Pinite' |
| ⓘ 'Pinite var. Polychroilite' |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 11 localities in this region. |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: |
| ⓘ Pumpellyite-(Mg) Formula: Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Localities: Habit: {111},{110}, masses Colour: Greenish-black, Brownish-yellow Description: Ti-rich (to 35% TiO2).
|
| ⓘ 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) Localities: Habit: {111},{110}, masses Colour: Greenish-black, Brownish-yellow Description: Ti-rich (to 35% TiO2).
|
| ⓘ 'Pyrochlore Supergroup var. Tangenite' Formula: A2-mD2X6-wZ1-n |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 41 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Retgersite Formula: NiSO4 · 6H2O |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 18 localities in this region. |
| ⓘ 'Scapolite' Localities: Habit: prismatic, lustrous < 3 cm long Description: One crystal found in 1953 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 Localities: |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Habit: sheaflike aggregates and individual xls flattened parallell to 010 Colour: Red & colorless |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Sylvite Formula: KCl Description: As 10-100 µm large perfect cubes in inclusions in phenakite. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ Tengerite-(Y) ? Formula: Y2(CO3)3 · 2-3H2O Localities: Description: Identified before tengerite-(Y) was redefined. |
| ⓘ Thorianite Formula: ThO2 Description: O'Nions & Baadsgaard (1971) report finding inclusions of thorianite in a zircon from the southern part of Levang-granite, without giving further locality data or data about quality and quantity. |
| ⓘ Thorite Formula: Th(SiO4) Localities: Kragerø, Telemark, Norway Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway Tangen Feldspar Mine, Kragerø, Telemark, Norway Lindvikskollen Quarry, Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway Kalstadgangen, Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway Description: Uran-thorite. |
| ⓘ Thorite var. Orangite Formula: Th(SiO4) Localities: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 14 localities in this region. |
| ⓘ Titanite var. Yttrium-bearing Titanite Formula: (Ca,Y)TiSiO5 Localities: Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway Tangen Feldspar Mine, Kragerø, Telemark, Norway Sjåen feldspar Mine, Sjåen, Kragerø, Telemark, Norway Lindvikskollen Quarry, Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway Lindvikskollen titanite occurrence, Kragerø, Telemark, Norway Description: large crystals up to 3-4 kg has been found |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 10 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| ⓘ Troilite Formula: FeS |
| ⓘ Uraninite Formula: UO2 Localities: |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ 'Xenotime' |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Sylvite | 3.AA.20 | KCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) ? | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Aeschynite-(Y) | 4.DF.05 | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Tengerite-(Y) ? | 5.CC.10 | Y2(CO3)3 · 2-3H2O |
| ⓘ | Lokkaite-(Y) | 5.CC.15 | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| ⓘ | Brugnatellite | 5.DA.45 | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| ⓘ | Hydrotalcite | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Kamphaugite-(Y) | 5.DC.10 | Ca(Y,REE)(CO3)2(OH) · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Chernovite-(Y) | 8.AD.35 | Y(AsO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Chlorapatite (TL) | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | 9.AD.30 | Zr(SiO4) | |
| ⓘ | Thorite var. Orangite | 9.AD.30 | Th(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite var. Yttrium-bearing Titanite | 9.AG.15 | (Ca,Y)TiSiO5 |
| ⓘ | 9.AG.15 | CaTi(SiO4)O | |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Magnesiodumortierite | 9.AJ.10 | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Hingganite-(Y) | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Hingganite-(Yb) | 9.AJ.20 | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Bazzite | 9.CJ.05 | Be3Sc2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Caysichite-(Y) | 9.DJ.15 | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| ⓘ | Babingtonite | 9.DK.05 | Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ | Hellandite-(Y) (TL) | 9.DK.20 | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ | 'Hellandite-(Yb)' ? | 9.DK.20 | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Heulandite-K | 9.GE.05 | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'var. Polychroilite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Pyrochlore Supergroup var. Tangenite' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Lithian Muscovite' | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Amphibole Asbestos' | - | |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Davidite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Aspasiolite' | - | |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Almandine-Pyrope Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Euxenite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| H | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| H | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| H | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| H | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Be | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| C | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| C | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| O | ⓘ Bazzite | Be3Sc2(Si6O18) |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| O | ⓘ Chernovite-(Y) | Y(AsO4) |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| O | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| O | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| O | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Thorite var. Orangite | Th(SiO4) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Al | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Si | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Si | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Thorite var. Orangite | Th(SiO4) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Troilite | FeS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| K | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Ca | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ca | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Sc | Scandium | |
| Sc | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ti | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Siegenite | CoNi2S4 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Chernovite-(Y) | Y(AsO4) |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Nickeline | NiAs |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Y | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| Y | ⓘ Chernovite-(Y) | Y(AsO4) |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Y | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| Y | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Y | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Y | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Y | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Y | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Nb | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Nd | Neodymium | |
| Nd | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Gd | Gadolinium | |
| Gd | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Dy | Dysprosium | |
| Dy | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Er | Erbium | |
| Er | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| Yb | Ytterbium | |
| Yb | ⓘ Caysichite-(Y) | (Ca,Yb,Er)4Y4(Si8O20)(CO3)6(OH) · 7H2O |
| Yb | ⓘ Hingganite-(Yb) | (Yb,Y,REE)2◻Be2[SiO4]2(OH)2 |
| Yb | ⓘ Hellandite-(Yb) | (Ca,Y)4(Yb,Y)2(Al,Fe3+,Ti4+)(Be,Li)2[B4Si4O22](O,F,OH)2 |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Th | Thorium | |
| Th | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Orangite | Th(SiO4) |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Krager%C3%B8 |
|---|---|
| Wikidata ID: | Q2372 |
| GeoNames ID: | 3149409 |
Localities in this Region
- Telemark
- Kragerø
- Åtangen
- Bekkedalen
- Blankenberg II
- Bonustomta
- Frydensborg
- Fugleheia
- Gofjell
- Gofjell Mine
- Hullerøya
- Kalstad
- Kammerfoss area
- Kragerø Archipelago
- Lervik Feldspar Prospect
- Lindvikskollen-Kalstadgangen pegmatite
- Kragerø
- Telemark
- Kragerø
- Lindvikskollen-Kalstadgangen pegmatite
- Lindvikskollen Rutile Mine
- Lindvikskollen titanite occurrence
- Magnesiodumortierite occurrence
- Mian
- Miantjenn ("West of Kammerfoss River")
- Østland
- Rekevika rutile prospect
- Roadcut Fv 38
- ⭔Sannidal
- Sjåen
- Soppekilen
- Stabbestad
- Steinsund
- ⭔Stråholmen
- Studsdalen
- Tangen Feldspar Mine
- Tevannsbrønnen
- Tyskerporten
- Valberg
- Våsjø
- Kragerø
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Weibye, Paul Christian (1848) Beiträge zur topograpischen Mineralogie Norwegens. Archiv für Mineralogie, Geognosie, Bergbau und Hüttenkunde, 22. 465-544pp.506-525 - On minerals in Kragerø
Hamberg, Axel (1886) Anatas och titanit på rutil från apatitförekomsten vid Kragerö. Geologiska Föreningen i Stockholm Förhandlingar, 8 (6) 475-476 doi:10.1080/11035898609442429
Schaller, W.T. (1910) Barbierite, a monoclinic soda feldspar. American Journal of Science: Series 4(30): 358-359 [description of a now discredited mineral from Kragerø]. https://zenodo.org/record/1518939#.Y8h0QHbMKUkDescription of a now discredited mineral from Kragero
Washington, H. S., Merwin, H. E. (1923) Note on enstatite, hypersthene and actinolite. American Mineralogist, 8 (4) 63-66 with an analysis of actinolite from Kragerø
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Lindvikskollen Quarry, Lindvikskollen-Kalstadgangen pegmatite, Kragerø, Telemark, Norway