Luxembourgi
| Regional Level Types | |
|---|---|
| Luxembourg | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
2,586 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Luxembourg | 76,684 (2017) |
| Esch-sur-Alzette | 28,228 (2017) |
| Dudelange | 18,013 (2017) |
| Schifflange | 8,155 (2017) |
| Bettembourg | 7,437 (2017) |
| Pétange | 7,187 (2017) |
Mindat Locality ID:
2243
Long-form identifier:
mindat:1:2:2243:2
GUID (UUID V4):
6cedb7dd-82f5-42f3-91ad-cc8e85f15340
Other Languages:
French:
Luxembourg
German:
Luxemburg
Italian:
Lussemburgo
Russian:
Люксембург
Simplified Chinese:
卢森堡
Spanish:
Luxemburgo
Afrikaans:
Luxemburg
Albanian:
Luksemburgu
Arabic:
لوكسمبورغ
Belarusian:
Люксембург
Bulgarian:
Люксембург
Catalan:
Luxemburg
Czech:
Lucembursko
Danish:
Luxembourg
Dutch:
Luxemburg
Estonian:
Luxembourg
Farsi/Persian:
لوکزامبورگ
Finnish:
Luxemburg
Galician:
Luxemburgo
Greek:
Λουξεμβούργο
Hebrew:
לוקסמבורג
Hindi:
लक्ज़मबर्ग
Hungarian:
Luxemburg
Icelandic:
Lúxemborg
Indonesian:
Luksemburg
Irish Gaelic:
Lucsamburg
Japanese:
ルクセンブルク
Korean:
룩셈부르크
Latvian:
Luksemburga
Lithuanian:
Liuksemburgas
Macedonian:
Луксембург
Norwegian:
Luxembourg
Polish:
Luksemburg
Portuguese:
Luxemburgo
Romanian:
Luxemburg
Serbian:
Луксембург
Slovak:
Luxembursko
Slovenian:
Luksemburg
Swahili:
Luxemburg
Swedish:
Luxemburg
Tagalog:
Luxembourg
Thai:
ลักเซมเบิร์ก
Turkish:
Lüksemburg
Ukrainian:
Люксембург
Vietnamese:
Luxembourg
Welsh:
Lwcsembwrg
Luxembourg is divided into 12 cantons, which are further divided into 102 communes. Twelve of the communes have city status, of which the city of Luxembourg is the largest.
The Great Duchy of Luxembourg comprises a Variscan basement, part of the Ardennes-Rhenish fold-and-thrust belt and an unconformable Mesozoic sedimentary cover representative of the eastern margin of the Paris Basin. The basement hosts several vein-type ore deposits.
NOTE: Not to be confused with the Luxembourg Province in Belgium.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities83 valid minerals. 1 (TL) - type locality of valid minerals.
* - Minerals that have never been found, but their existence is inferred in some way (e.g. from pseudomorphs)
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Antimony Formula: Sb |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Azurite ? Formula: Cu3(CO3)2(OH)2 Description:
|
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ Brandholzite Formula: MgSb2(OH)12 · 6H2O |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervantite ? Formula: Sb3+Sb5+O4 Description: See remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50 |
| ⓘ Cetineite Formula: (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: |
| ⓘ Chalcocite Formula: Cu2S Localities: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ 'Chlorite Group' Localities: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Description: Fe-variety (see http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50)
|
| ⓘ Copper Formula: Cu |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Covellite Formula: CuS |
| ⓘ Cualstibite Formula: Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: References: |
| ⓘ Delafossite ? Formula: CuFeO2 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Gahnite ? Formula: ZnAl2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Galena Formula: PbS Localities: Reported from at least 6 localities in this region. |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gibbsite ? Formula: Al(OH)3 Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Gold Formula: Au Localities: |
| ⓘ Gravegliaite Formula: Mn2+SO3 · 3H2O |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Halite Formula: NaCl Description: "Marl-like pseudomorphs". |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ 'Jet' |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: References: |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ 'Limonite' Localities: |
| ⓘ Luxembourgite (TL) Formula: AgCuPbBi4Se8 Type Locality: |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Mogánite Formula: SiO2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Peretaite Formula: Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| ⓘ Plagionite Formula: Pb5Sb8S17 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 12 localities in this region. References: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Quartz var. Carnelian Localities: Description: Listed as "cornalite". |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Eisenkiesel Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Ramsbeckite ? Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Ramsdellite Formula: Mn4+O2 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Localities: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schafarzikite Formula: Fe2+Sb3+2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed in Philippo & Hatert 2018 (p36) - analysed by Meisser (Lausanne) and By Philippo (Luxembourg) on a second sample
|
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 9 localities in this region. Description: eds and xrd analysis (see Philippo & Hatert 2018) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Colour: brown Description: Spessartine garnets - almandine
The crystals collected in the alluviums of the Wiltz at Schimpach are rhombododecahedra b1 very well crystallized, brown in color and whose size rarely exceeds 5 mm.
They are called "pyrenite type". This type of garnets described by de Bethune (1977) has inclusions accumulated along the edges of the rhombododecahedron during its growth betraying its metamorphic origin. The garnet is thus cut by inclusion planes revealing in section the axes of symmetry 3 or 4 of the crystal.
Garnetiferous phyllades were described in Bastogne by Stainier (1907), these can be observed in the various active quarries of this locality.
The garnets found in the Wiltz at Schimpach were analyzed by electron microprobe at the Catholic University of Louvain. The analyzes make it possible to specify the variety of garnets: 40% spessartine, 35% almandine and 25% grossular.
A sample, from Benonchamps, was analyzed with the Schimpach samples. The analyzes of this one are very close to Schimpach garnets. It can therefore be assumed that this location is one of the potential sources of Wiltz garnets in Schimpach.
The minerals accompanying this type of rock have been described by Billiet and van den Driessche (1937). These are the following minerals: ilmenite, zircon, sphene, clinozoisite, tourmaline and apatite. Some of these minerals accompany garnets in our panning, they could come from the same source. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Sulphur Formula: S8 |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed by eds, wds and xrd analysis in Philippo & Hatert 2018
|
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ 'Wad' |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Luxembourgite (TL) | 2.HB.20e | AgCuPbBi4Se8 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Cetineite | 2.MA.05 | (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Group 3 - Halides | |||
| ⓘ | Halite ? | 3.AA.20 | NaCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Delafossite ? | 4.AB.15 | CuFeO2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite ? | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | 4.CB.05 | Fe2O3 | |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Eisenkiesel | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Mogánite | 4.DA.20 | SiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Cervantite ? | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Cualstibite | 4.FB.10 | Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite ? | 4.FE.10 | Al(OH)3 |
| ⓘ | Brandholzite | 4.FH.05 | MgSb2(OH)12 · 6H2O |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Schafarzikite | 4.JA.20 | Fe2+Sb3+2O4 |
| ⓘ | Gravegliaite | 4.JE.05 | Mn2+SO3 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite ? | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Ramsbeckite ? | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Peretaite | 7.DF.45 | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Wad' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Jet' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Delafossite | CuFeO2 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mogánite | SiO2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| O | ⓘ Quartz var. Eisenkiesel | SiO2 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Mogánite | SiO2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Quartz var. Eisenkiesel | SiO2 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Delafossite | CuFeO2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ni | Nickel | |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Delafossite | CuFeO2 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Se | Selenium | |
| Se | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Sb | Antimony | |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Bi | Bismuth | |
| Bi | ⓘ Luxembourgite | AgCuPbBi4Se8 |
Fossils
There are 29 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 489 |
|---|---|
| Youngest Fossil Listed | 109 Ma (Early/Lower Cretaceous) |
| Oldest Fossil Listed | 419 Ma (Silurian) |
| Stratigraphic Units | Click here to view 9 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 29 fossil localities |
- Canton Luxembourg
- Early Jurassic🐚 Feidt Quarry
- Early Jurassic🐚 Hespérange
- Jurassic🐚 Hutberg Site
- Early Jurassic🐚 Kopstal
- Early/Lower Cretaceous🐚 Louppy-Villotte
- Early Jurassic🐚 Luxguard quarry
- Early Jurassic🐚 Mamer
- Carboniferous🐚 Namurian Basinal benthic community
- Middle Jurassic🐚 Patch Reef
- Early Jurassic🐚 Reckingerwald quarry
- Early Jurassic🐚 Schouweiler
- Early Jurassic🐚 Steinfort
- Canton Wiltz
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Luxembourg |
|---|---|
| Wikidata ID: | Q32 |
| GeoNames ID: | 2960313 |
Localities in this Region
- Canton Luxembourg
- ⭔Canton Mersch
- ⭔Canton Redange
- ⭔Canton Remich
- ⭔Canton Vianden
- ⭔Canton Wiltz
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Europe
- Ardennes MountainsMountain Range
- Rhenish MassifMassif
Germany
- Hunsrück mountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2019) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) NEWSLETTER 49. European Journal of Mineralogy, 31 (3) 653-658 doi:10.1127/ejm/2019/0031-2861
www.land.lu (2019) https://www.land.lu/page/article/487/335487/FRE/index.html?fbclid=IwAR07rawzH4aoG4HMn41ZHNW9cCDTAikRDYRnY6ljRWN1wrwHSDv_x86xPHc
Marignac, Christian, Cathelineau, Michel, Belcourt, Olivier, Philippo, Simon (2023) Cu and Pb–Zn–Ba deposits in the Great Duchy of Luxembourg: role of brines penetrating the basement and place in the post-Variscan tectonic history of Western Europe. International Journal of Earth Sciences, 112 (6) Springer Science and Business Media LLC. 1771-1801 doi:10.1007/s00531-023-02325-2
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Luxembourg