Vermiculite
A valid IMA mineral species - grandfathered
This page is currently not sponsored. Click here to sponsor this page.
About Vermiculite
Formula:
Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O
Formula previously given as (Mg,Fe,Al)3((Al,Si)4O10)(OH)2.4H2O.
As a Commodity:
Colour:
Brown, bronze-yellow
Hardness:
1½ - 2
Crystal System:
Monoclinic
Member of:
Name:
From Latin "vermiculor", breed of worms, in allusion to its peculiar exfoliation into worm-like aggregates on intense heating (for details see Krickl (2020)).
Type Locality:
Forms as an alteration product of biotite or phlogopite, by weathering or hydrothermal action. Vermiculite is mined as a natural insulation material.
The best exfoliation properties were observed not for pure vermiculite, but for intergrowths of vermiculite and other layer silicates (e.g. hydrobiotite).
Naturally expanded vermiculite can occur in volcanic rocks.
The best exfoliation properties were observed not for pure vermiculite, but for intergrowths of vermiculite and other layer silicates (e.g. hydrobiotite).
Naturally expanded vermiculite can occur in volcanic rocks.
Unique Identifiers
Mindat ID:
4170
Long-form identifier:
mindat:1:1:4170:2
GUID
(UUID V4):
(UUID V4):
965ee932-8f87-4270-911d-582f489e01d2
Classification of Vermiculite
Approved, 'Grandfathered' (first described prior to 1959)
9.EC.50
9 : SILICATES (Germanates)
E : Phyllosilicates
C : Phyllosilicates with mica sheets, composed of tetrahedral and octahedral nets
9 : SILICATES (Germanates)
E : Phyllosilicates
C : Phyllosilicates with mica sheets, composed of tetrahedral and octahedral nets
71.2.2d.3
71 : PHYLLOSILICATES Sheets of Six-Membered Rings
2 : Sheets of 6-membered rings with 2:1 layers
71 : PHYLLOSILICATES Sheets of Six-Membered Rings
2 : Sheets of 6-membered rings with 2:1 layers
16.19.22
16 : Silicates Containing Aluminum and other Metals
19 : Aluminosilicates of Fe and Mg
16 : Silicates Containing Aluminum and other Metals
19 : Aluminosilicates of Fe and Mg
Mineral Symbols
As of 2021 there are now IMA–CNMNC approved mineral symbols (abbreviations) for each mineral species, useful for tables and diagrams.
Please only use the official IMA–CNMNC symbol. Older variants are listed for historical use only.
Please only use the official IMA–CNMNC symbol. Older variants are listed for historical use only.
Symbol | Source | Reference |
---|---|---|
Vrm | IMA–CNMNC | Warr, L.N. (2021). IMA–CNMNC approved mineral symbols. Mineralogical Magazine, 85(3), 291-320. doi:10.1180/mgm.2021.43 |
Vrm | Kretz (1983) | Kretz, R. (1983) Symbols of rock-forming minerals. American Mineralogist, 68, 277–279. |
Vrm | Siivolam & Schmid (2007) | Siivolam, J. and Schmid, R. (2007) Recommendations by the IUGS Subcommission on the Systematics of Metamorphic Rocks: List of mineral abbreviations. Web-version 01.02.07. IUGS Commission on the Systematics in Petrology. download |
Vrm | Whitney & Evans (2010) | Whitney, D.L. and Evans, B.W. (2010) Abbreviations for names of rock-forming minerals. American Mineralogist, 95, 185–187 doi:10.2138/am.2010.3371 |
Vrm | The Canadian Mineralogist (2019) | The Canadian Mineralogist (2019) The Canadian Mineralogist list of symbols for rock- and ore-forming minerals (December 30, 2019). download |
Vrm | Warr (2020) | Warr, L.N. (2020) Recommended abbreviations for the names of clay minerals and associated phases. Clay Minerals, 55, 261–264 doi:10.1180/clm.2020.30 |
Physical Properties of Vermiculite
Colour:
Brown, bronze-yellow
Hardness:
1½ - 2 on Mohs scale
Optical Data of Vermiculite
Type:
Biaxial (-)
RI values:
nα = 1.525 - 1.561 nβ = 1.545 - 1.581 nγ = 1.545 - 1.581
Max Birefringence:
δ = 0.020
Image shows birefringence interference colour range (at 30µm thickness)
and does not take into account mineral colouration.
and does not take into account mineral colouration.
Surface Relief:
Low
Dispersion:
weak
Chemical Properties of Vermiculite
Formula:
Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O
Formula previously given as (Mg,Fe,Al)3((Al,Si)4O10)(OH)2.4H2O.
Formula previously given as (Mg,Fe,Al)3((Al,Si)4O10)(OH)2.4H2O.
IMA Formula:
Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O
Common Impurities:
Ca,Na,K
Crystallography of Vermiculite
Crystal System:
Monoclinic
Class (H-M):
2/m - Prismatic
Cell Parameters:
a = 5.24 Å, b = 9.17 Å, c = 28.6 Å
β = 94.6°
β = 94.6°
Ratio:
a:b:c = 0.571 : 1 : 3.119
Unit Cell V:
1,369.83 ų (Calculated from Unit Cell)
Z:
4
Comment:
Space group C2/m (a = 5.24(2), b = 9.17(2), c = 28.60(5) Å, beta = 94°36'(24')°, Z = 4, or space group C2/c (a = 5.349(6), b = 9.255(10), c = 28.89(2) Å, beta = 97°7'(6')°, Z = 4.
Crystal Structure
Load
Unit Cell | Unit Cell Packed
2x2x2 | 3x3x3 | 4x4x4
Unit Cell | Unit Cell Packed
2x2x2 | 3x3x3 | 4x4x4
Show
Big Balls | Small Balls | Just Balls | Spacefill
Polyhedra Off | Si Polyhedra | All Polyhedra
Remove metal-metal sticks
Big Balls | Small Balls | Just Balls | Spacefill
Polyhedra Off | Si Polyhedra | All Polyhedra
Remove metal-metal sticks
Display Options
Black Background | White Background
Perspective On | Perspective Off
2D | Stereo | Red-Blue | Red-Cyan
Black Background | White Background
Perspective On | Perspective Off
2D | Stereo | Red-Blue | Red-Cyan
View
CIF File Best | x | y | z | a | b | c
CIF File Best | x | y | z | a | b | c
Rotation
Stop | Start
Stop | Start
Labels
Console Off | On | Grey | Yellow
Console Off | On | Grey | Yellow
Data courtesy of the American Mineralogist Crystal Structure Database. Click on an AMCSD ID to view structure
ID | Species | Reference | Link | Year | Locality | Pressure (GPa) | Temp (K) |
---|---|---|---|---|---|---|---|
0000012 | Vermiculite | Gruner J W (1934) The structures of vermiculites and their collapse by dehydration American Mineralogist 19 557-575 | 1934 | Structure results from data of many samples | 0 | 293 | |
0000019 | Vermiculite | Hendricks S B, Jefferson M E (1938) Crystal structure of vermiculites and mixed vermiculite-chlorites American Mineralogist 23 851-862 | 1938 | 0 | 293 | ||
0000063 | Vermiculite | Mathieson A M, Walker G F (1954) Crystal structure of magnesium-vermiculite American Mineralogist 39 231-255 | 1954 | 0 | 293 | ||
0000122 | Vermiculite | Haase D J, Weiss E J, Steinfink H (1963) The crystal structure of a hexamethylene-diamine-vermiculite complex American Mineralogist 48 261-270 | 1963 | 0 | 293 | ||
0000150 | Vermiculite | Shirozu H, Bailey S W (1966) Crystal structure of a two-layer Mg-vermiculite American Mineralogist 51 1124-1143 | 1966 | 0 | 293 | ||
0000213 | Vermiculite | Kanamaru F, Vand V (1970) The crystal structure of a clay-organic complex of 6-amino hexanoic acid and vermiculite American Mineralogist 55 1550-1561 | 1970 | 0 | 293 | ||
0020497 | Vermiculite | Arguelles A, Leoni M, Blanco J A, Marcos C (2010) Semi-ordered crystalline structure of the Santa Olalla vermiculite inferred from X-ray powder diffraction American Mineralogist 95 126-134 | 2010 | Santa Olalla, Toledo Province, Spain | 0 | 293 | |
0012759 | Vermiculite | de la Calle C, Pezerat H, Gasperin M (1977) Problemes d'ordre-desordre dans les vermiculites structure du mineral calcique hydrate a 2 couches _cod_database_code 1001031 Journal de Physique 38 128-133 | 1977 | 0 | 293 |
CIF Raw Data - click here to close
X-Ray Powder Diffraction
Image Loading
Radiation - Copper Kα
Data courtesy of RRUFF project at University of Arizona, used with permission.
Powder Diffraction Data:
d-spacing | Intensity |
---|---|
14.15 Å | (10) |
4.57 Å | (6) |
2.615 Å | (5) |
2.570 Å | (5) |
2.525 Å | (4.5) |
2.380-2.365 Å | (3.5b) |
1.528 Å | (7) |
Geological Environment
Paragenetic Mode(s):
Paragenetic Mode | Earliest Age (Ga) |
---|---|
Stage 2: Planetesimal differentiation and alteration | 4.566-4.550 |
6 : Secondary asteroid phases | 4.566-4.560 |
Stage 3b: Earth’s earliest hydrosphere | >4.45 |
16 : Low-𝑇 aqueous alteration of Hadean subaerial lithologies (see also #23) | |
Near-surface Processes | |
22 : Hydration and low-𝑇 subsurface aqueous alteration (see also #23) | |
Stage 4b: Highly evolved igneous rocks | >3.0 |
36 : Carbonatites, kimberlites, and related igneous rocks | |
Stage 5: Initiation of plate tectonics | <3.5-2.5 |
40 : Regional metamorphism (greenschist, amphibolite, granulite facies) | |
Stage 10a: Neoproterozoic oxygenation/terrestrial biosphere | <0.6 |
48 : Soil leaching zone minerals | <0.6 |
Type Occurrence of Vermiculite
Synonyms of Vermiculite
Other Language Names for Vermiculite
Varieties of Vermiculite
Batavite | An iron-rich variety of vermiculite. Originally reported from Kropfmühl Mine, Kropfmühl, Kropfmühl - Untergriesbach District, Hauzenberg, Bavarian Forest, Lower Bavaria, Bavaria, Germany. |
Copper Vermiculite | A cuprian variety of Vermiculite. |
Eastonite (of Hamilton) | A silver-white vermiculite. |
Lucasite (of Chatard) | A chromian Vermiculite |
Vaalite | A variety of Vermiculite that was originally described from Vaal river, South Africa. |
Relationship of Vermiculite to other Species
Member of:
Other Members of this group:
Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
Ferrosaponite | Ca0.3(Fe2+,Mg,Fe3+)3((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
Hectorite | Na0.3(Mg,Li)3(Si4O10)(F,OH)2 | Mon. 2/m : B2/m |
Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
Pimelite | Ni3Si4O10(OH)2 · 4H2O | Hex. |
Saliotite | (Li,Na)Al3(AlSi3O10)(OH)5 | Mon. 2/m : B2/m |
Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O | Mon. |
Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 | Mon. |
Swinefordite | Li(Al,Li,Mg)3((Si,Al)4O10)2(OH,F)4 · nH2O | Mon. 2/m : B2/m |
Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O | Mon. |
Zincsilite | Zn3Si4O10(OH)2 · 4H2O (?) | Mon. |
Common Associates
Associated Minerals Based on Photo Data:
4 photos of Vermiculite associated with Stellerite | Ca4(Si28Al8)O72 · 28H2O |
4 photos of Vermiculite associated with Phlogopite | KMg3(AlSi3O10)(OH)2 |
4 photos of Vermiculite associated with Fergusonite-(Ce) | CeNbO4 · 0.3H2O |
3 photos of Vermiculite associated with Fluorapatite | Ca5(PO4)3F |
3 photos of Vermiculite associated with Goethite | α-Fe3+O(OH) |
3 photos of Vermiculite associated with Anatase | TiO2 |
3 photos of Vermiculite associated with Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
2 photos of Vermiculite associated with Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
2 photos of Vermiculite associated with Hessite | Ag2Te |
2 photos of Vermiculite associated with Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
Related Minerals - Strunz-mindat Grouping
9.EC. | Balestraite | KLi2V5+Si4O12 | Mon. 2 : B2 |
9.EC. | Meifuite | KFe6(Si7Al)O19(OH)4Cl2 | Tric. 1 : P1 |
9.EC.05 | Minnesotaite | Fe2+3Si4O10(OH)2 | Tric. 1 : P1 |
9.EC.05 | Talc | Mg3Si4O10(OH)2 | Tric. 1 : P1 |
9.EC.05 | Willemseite | Ni3Si4O10(OH)2 | Mon. |
9.EC.9.EC. | Voloshinite | Rb(LiAl1.5◻0.5)(Al0.5Si3.5)O10F2 | Mon. 2/m : B2/b |
9.EC.10 | Ferripyrophyllite | Fe3+Si2O5(OH) | Mon. 2/m |
9.EC.10 | Pyrophyllite | Al2Si4O10(OH)2 | Tric. 1 |
9.EC.10 | Luanshiweiite | KLiAl1.5(Si3.5Al0.5)O10(OH)2 | Mon. 2/m : B2/b |
9.EC.10 | Fluorluanshiweiite | KLiAl1.5(Si3.5Al0.5)O10F2 | Mon. 2/m : B2/m |
9.EC.10 | Manganiceladonite | K(MgMn3+◻)(Si4O10)(OH)2 | Mon. |
9.EC.10 | Garmite | CsLiMg2(Si4O10)F2 | Mon. |
9.EC.10 | Gorbunovite | CsLi2(Ti,Fe)Si4O10(F,OH,O)2 | Mon. |
9.EC.15 | Boromuscovite | KAl2(BSi3O10)(OH)2 | Mon. 2/m |
9.EC.15 | Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.15 | Chernykhite | (Ba,Na)(V3+,Al,Mg)2((Si,Al)4O10)(OH)2 | Mon. |
9.EC.15 | Montdorite | (K,Na)2(Fe2+,Mn2+,Mg)5(Si4O10)2(OH,F)4 | Mon. 2/m : B2/m |
9.EC.15 | Muscovite | KAl2(AlSi3O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.15 | Nanpingite | CsAl2(AlSi3O10)(OH,F)2 | Mon. 2/m : B2/b |
9.EC.15 | Paragonite | NaAl2(AlSi3O10)(OH)2 | Mon. |
9.EC.15 | Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.15 | Tobelite | (NH4,K)Al2(AlSi3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.15 | Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.15 | Chromphyllite | K(Cr,Al)2(AlSi3O10)(OH,F)2 | Mon. 2/m : B2/b |
9.EC.15 | Ferroaluminoceladonite | K(Fe2+Al◻)(Si4O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.15 | Ferroceladonite | K(Fe2+Fe3+◻)(Si4O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.15 | Chromceladonite | K(MgCr◻)(Si4O10)(OH)2 | Mon. 2 : B2 |
9.EC.15 | Tainiolite | KLiMg2(Si4O10)F2 | Mon. 2/m : B2/m |
9.EC.15 | Ganterite | (Ba,Na,K)(Al,Mg)2(AlSi3O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.15 | UM1988-22-SiO:AlCaFFeHKLiMg | KLiMgAl2Si3O10F2 | Mon. |
9.EC.15 | Kreiterite | CsLi2Fe3+(Si4O10)F2 | Mon. |
9.EC.20 | Annite | KFe2+3(AlSi3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Ephesite | NaLiAl2(Al2Si2O10)(OH)2 | Tric. 1 : P1 |
9.EC.20 | Hendricksite | KZn3(Si3Al)O10(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Masutomilite | (K,Rb)(Li,Mn3+,Al)3(AlSi3O10)(F,OH)2 | Mon. 2 : B2 |
9.EC.20 | Norrishite | KLiMn3+2(Si4O10)O2 | Mon. 2/m : B2/m |
9.EC.20 | Phlogopite | KMg3(AlSi3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Polylithionite | KLi2Al(Si4O10)(F,OH)2 | Mon. 2/m : B2/b |
9.EC.20 | Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.20 | Siderophyllite | KFe2+2Al(Al2Si2O10)(OH)2 | Mon. |
9.EC.20 | Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 | Mon. 2/m : B2/m |
9.EC.20 | Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 | Mon. 2/m : B2/m |
9.EC.20 | Wonesite | (Na,K)(Mg,Fe,Al)6((Al,Si)4O10)2(OH,F)4 | Mon. 2/m : B2/m |
9.EC.20 | Eastonite | KMg2Al(Al2Si2O10)(OH)2 | Mon. |
9.EC.20 | Tetraferriannite | KFe2+3(Si3Fe3+)O10(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 | Mon. 2/m : B2/b |
9.EC.20 | Fluorannite | KFe2+3(Si3Al)O10F2 | Mon. 2/m : B2/m |
9.EC.20 | Shirokshinite | K(NaMg2)(Si4O10)F2 | Mon. 2/m : B2/m |
9.EC.20 | Shirozulite | KMn2+3(Si3Al)O10(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Sokolovaite | CsLi2Al(Si4O10)F2 | Mon. |
9.EC.20 | Aspidolite | NaMg3(AlSi3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Fluorophlogopite | KMg3(Si3Al)O10F2 | Mon. 2/m : B2/m |
9.EC.20 | UM2004-49-SiO:AlCsFHKLi | (Cs,K)(Al,Li)2.6((Si,Al)4O10)(F,OH)2 | |
9.EC.20 | Suhailite | (NH4)Fe2+3(AlSi3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.20 | Yangzhumingite | KMg2.5(Si4O10)F2 | Mon. 2/m : B2/m |
9.EC.20 | Orlovite | KLi2Ti(Si4O10)OF | Mon. 2 : B2 |
9.EC.20 | Oxyphlogopite | K(Mg,Ti,Fe)3[(Si,Al)4O10](O,F)2 | Mon. 2/m : B2/m |
9.EC.20 | Chloroferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(Cl,OH,F)2 | |
9.EC.22 | Pimelite | Ni3Si4O10(OH)2 · 4H2O | Hex. |
9.EC.30 | Chlorophaeite | (Ca,Mg,Fe)2Fe2Si4O13 · 10H2O | |
9.EC.30 | Margarite | CaAl2(Al2Si2O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.35 | Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 | Mon. 2/m : B2/b |
9.EC.35 | Bityite | CaLiAl2(AlBeSi2O10)(OH)2 | Mon. 2/m : B2/b |
9.EC.35 | Clintonite | CaAlMg2(SiAl3O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.35 | Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 | Mon. 2/m : B2/m |
9.EC.35 | Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 | Mon. 2/m : B2/m |
9.EC.35 | Oxykinoshitalite | (Ba,K)(Mg,Ti,Fe3+,Fe2+)3((Si,Al)4O10)(O,OH,F)2 | Mon. 2/m : B2/m |
9.EC.35 | Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 | Mon. 2/m : B2/m |
9.EC.40 | Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
9.EC.40 | Kurumsakite | (Zn,Ni,Cu)8Al8V5+2Si5O35 · 27H2O (?) | Orth. |
9.EC.40 | Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
9.EC.40 | Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O | Mon. 2/m : B2/m |
9.EC.40 | Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
9.EC.40 | Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O | Mon. |
9.EC.45 | Hectorite | Na0.3(Mg,Li)3(Si4O10)(F,OH)2 | Mon. 2/m : B2/m |
9.EC.45 | Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O | Mon. |
9.EC.45 | Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
9.EC.45 | Spadaite | MgSiO2(OH)2 · H2O (?) | |
9.EC.45 | Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 | Mon. |
9.EC.45 | Swinefordite | Li(Al,Li,Mg)3((Si,Al)4O10)2(OH,F)4 · nH2O | Mon. 2/m : B2/m |
9.EC.45 | Zincsilite | Zn3Si4O10(OH)2 · 4H2O (?) | Mon. |
9.EC.45 | Ferrosaponite | Ca0.3(Fe2+,Mg,Fe3+)3((Si,Al)4O10)(OH)2 · 4H2O | Mon. |
9.EC.45 | Hanjiangite | Ba2CaV3+Al(H2AlSi3O12)(CO3)2F | Mon. 2 : B2 |
9.EC.52 | Tarasovite | near NaKAl11Si13O40(OH)9 · 3H2O | |
9.EC.55 | Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 | Tric. 1 |
9.EC.55 | Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 | Mon. 2/m : B2/m |
9.EC.55 | Clinochlore | Mg5Al(AlSi3O10)(OH)8 | Mon. 2/m : B2/m |
9.EC.55 | Cookeite | (LiAl4◻)[AlSi3O10](OH)8 | Mon. 2/m |
9.EC.55 | Franklinfurnaceite | Ca2Fe3+Mn2+3Mn3+(Zn2Si2O10)(OH)8 | Mon. 2 : B2 |
9.EC.55 | Gonyerite | (Mn2+,Mg)5Fe3+(Fe3+Si3O10)(OH)8 | Orth. |
9.EC.55 | Nimite | (Ni,Mg,Al)6((Si,Al)4O10)(OH)8 | Mon. 2/m : B2/m |
9.EC.55 | Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 | |
9.EC.55 | Pennantite | Mn2+5Al(AlSi3O10)(OH)8 | Tric. |
9.EC.55 | Sudoite | Mg2Al3(Si3Al)O10)(OH)8 | Mon. 2/m : B2/m |
9.EC.55 | Donbassite | Al4.33(Si3Al)O10(OH)8 | Mon. 2 : B2 |
9.EC.55 | Glagolevite | Na(Mg,Al)6(AlSi3O10)(OH,O)8 | Tric. 1 : P1 |
9.EC.55 | Borocookeite | (LiAl4◻)[BSi3O10](OH)8 | Mon. m : Bb |
9.EC.60 | Aliettite | Ca0.2Mg6((Si,Al)8O20)(OH)4 · 4H2O | Mon. |
9.EC.60 | Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O | Orth. |
9.EC.60 | Dozyite | Mg7Al2(Al2Si4O15)(OH)12 | Mon. |
9.EC.60 | Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O | Mon. 2/m : B2/m |
9.EC.60 | Karpinskite | (Ni,Mg)2Si2O5(OH)2 (?) | Mon. |
9.EC.60 | Kulkeite | Mg8Al(AlSi7O20)(OH)10 | Mon. |
9.EC.60 | Lunijianlaite | Li0.7Al6.2(AlSi7O20)(OH,O)10 | Mon. |
9.EC.60 | Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O | Mon. |
9.EC.60 | Saliotite | (Li,Na)Al3(AlSi3O10)(OH)5 | Mon. 2/m : B2/m |
9.EC.60 | Tosudite | Na0.5(Al,Mg)6((Si,Al)8O18)(OH)12 · 5H2O | Mon. 2 : B2 |
9.EC.60 | Brinrobertsite | Na0.3Al4(Si4O10)2(OH)4 · 3.5 H2O | Mon. |
9.EC.65 | Macaulayite | (Fe,Al)24Si4O43(OH)2 | Mon. |
9.EC.70 | Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 | Trig. 3m (3 2/m) : P3 1m |
9.EC.75 | Ferrisurite | (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O | Mon. |
9.EC.75 | Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 | Mon. 2 : P21 |
9.EC.75 | Niksergievite | (Ba,Ca)2Al3(AlSi3O10)(CO3)(OH)6 · nH2O | Mon. |
9.EC.80 | Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 | Mon. |
Other Information
Health Risks:
No information on health risks for this material has been entered into the database. You should always treat mineral specimens with care.
Internet Links for Vermiculite
mindat.org URL:
https://www.mindat.org/min-4170.html
Please feel free to link to this page.
Please feel free to link to this page.
Search Engines:
External Links:
Mineral Dealers:
References for Vermiculite
Reference List:
Localities for Vermiculite
Locality List
- This locality has map coordinates listed.
- This locality has estimated coordinates.
ⓘ - Click for references and further information on this occurrence.
? - Indicates mineral may be doubtful at this locality.
- Good crystals or important locality for species.
- World class for species or very significant.
(TL) - Type Locality for a valid mineral species.
(FRL) - First Recorded Locality for everything else (eg varieties).
Struck out - Mineral was erroneously reported from this locality.
Faded * - Never found at this locality but inferred to have existed at some point in the past (e.g. from pseudomorphs).
All localities listed without proper references should be considered as questionable.
All localities listed without proper references should be considered as questionable.
Algeria | |
| |
Antarctica | |
| |
| |
Arctic Ocean | |
| |
Argentina | |
| |
| |
Australia | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Austria | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Belgium | |
| |
Bolivia | |
| |
Brazil | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Bulgaria | |
| |
| |
| |
Burundi | |
| |
Canada | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Cape Verde | |
| |
Chile | |
| |
China | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Colombia | |
| |
Costa Rica | |
| |
Czech Republic | |
| |
| |
| |
Dominican Republic | |
| |
DR Congo | |
| |
Egypt | |
| |
El Salvador | |
| |
Ethiopia | |
| |
Finland | |
| |
| |
| |
| |
France | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Germany | |
| [var: Batavite] |
| |
| |
| |
| |
| |
| |
Greece | |
| |
| |
Greenland | |
| |
Grenada | |
Hungary | |
| |
| |
| |
| |
| |
India | |
| |
| |
| |
| |
Indian Ocean | |
| |
Indonesia | |
| |
| |
| |
Iran | |
Ireland | |
| |
Italy | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Japan | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Kazakhstan | |
| |
Libya | |
| |
Madagascar | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Malawi | |
| |
Mauritania | |
| |
Mexico | |
| |
| |
| |
Namibia | |
| |
| |
New Zealand | |
| |
Nicaragua | |
| |
Norway | |
| |
| |
| |
| |
| |
| |
Pakistan | |
| |
Papua New Guinea | |
| |
Paraguay | |
| |
Peru | |
| |
Poland | |
| |
| |
| |
| |
| |
| |
Portugal | |
| |
Romania | |
| |
| |
| |
| |
| |
Russia | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Slovakia | |
| |
| |
South Africa | |
| |
| |
| |
| |
[var: Vaalite] | |
South Korea | |
| |
Spain | |
| |
| |
| |
| |
| |
| |
| |
Sweden | |
| |
| |
| |
| |
Switzerland | |
| |
| |
| |
| |
| |
Taiwan | |
Tanzania | |
| |
| |
| |
| |
Turkey | |
| |
| |
Uganda | |
| |
| |
UK | |
| |
| |
| |
Ukraine | |
| |
USA | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Vietnam | |
| |
Zimbabwe | |
| |
Quick NavTopAbout VermiculiteUnique IdentifiersClassification Mineral SymbolsPhysical Properties Optical Data Chemical Properties Crystallography Crystal StructureX-Ray Powder DiffractionGeological EnvironmentType Occurrence SynonymsOther LanguagesVarietiesRelationshipsCommon AssociatesStrunz-MindatOther InformationInternet Links References Localities Locality List
Brinton's Quarry, Westtown Township, Chester County, Pennsylvania, USA