DSS Piława Górna Quarry, Piława Górna, Dzierżoniów County, Lower Silesian Voivodeship, Polandi
Regional Level Types | |
---|---|
DSS Piława Górna Quarry | Quarry |
Piława Górna | Town |
Dzierżoniów County | County |
Lower Silesian Voivodeship | Voivodeship |
Poland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 42' 11'' North , 16° 44' 15'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Piława Górna | 6,736 (2018) | 2.2km |
Dobrocin | 800 (2010) | 4.1km |
Dzierżoniów | 34,168 (2016) | 6.7km |
Uciechów | 1,017 (2010) | 7.0km |
Niemcza | 3,110 (2010) | 7.2km |
Mindat Locality ID:
224608
Long-form identifier:
mindat:1:2:224608:9
GUID (UUID V4):
6df17723-a47d-406e-b1a4-fed1edbd6b63
Name(s) in local language(s):
Kopalnia DSS Piława Górna, Piława Górna, Powiat Dzierżoniów, Dolnośląskie (Dolny Śląsk), Polska
A migmatite-amphibolite quarry with veins of granitic pegmatites worked by the Dolnośląskie Surowce Skalne S.A Company in the eastern part of the Góry Sowie Block, ~50km southwest of Wrocław. Pegmatites reaching vertically to 30–40 m, horizontally to 80–100 m, in thickness to 4–6 m, with the tonnage
reaching 40,000–505000 tons.
Pegmatite veins: "Julianna", "TRIO", "subTRIO", "Lithium" (Nejbert et al. 2010). "Julianna", "TRIO", and "Lithium" have been mined out.
Pieczka et al. (2010) mention, i.a., Bi-and Pb- rich microlite, Y-rich betafite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities119 valid minerals. 3 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Bismuth | 1.CA.05 | Bi |
Group 2 - Sulphides and Sulfosalts | |||
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
ⓘ | Mackinawite | 2.CC.25 | FeS |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
ⓘ | Ikunolite | 2.DC.05 | Bi4S3 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
ⓘ | Marcasite | 2.EB.10a | FeS2 |
ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
ⓘ | Vikingite | 2.JB.40a | Ag5Pb8Bi13S30 |
Group 3 - Halides | |||
ⓘ | Fluorite | 3.AB.25 | CaF2 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' | 4.. | (Ta,Nb,Sn,Fe,Mn)4O8 |
ⓘ | 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
ⓘ | Bismite | 4.CB.60 | Bi2O3 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
ⓘ | Cassiterite | 4.DB.05 | SnO2 |
ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
ⓘ | 4.DB.05 | TiO2 | |
ⓘ | Calciosamarskite | 4.DB.25 | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
ⓘ | Ishikawaite | 4.DB.25 | U4+Fe2+Nb2O8 |
ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
ⓘ | Ferrowodginite | 4.DB.40 | Fe2+Sn4+Ta2O8 |
ⓘ | Wodginite | 4.DB.40 | Mn2+Sn4+Ta2O8 |
ⓘ | Fersmite | 4.DG.05 | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
ⓘ | 'Hydromicrolite' | 4.DH.15 | (H2O,◻)2Ta2(O,OH)6(H2O) |
ⓘ | Hydropyrochlore | 4.DH.15 | (H2O,◻)2Nb2(O,OH)6(H2O) |
ⓘ | Fluorcalciomicrolite | 4.DH.15 | (Ca,Na)2(Ta,Nb)2O6F |
ⓘ | Fluorcalcioroméite | 4.DH.20 | (Ca,Na,◻)2Sb5+2(O,OH)6F |
ⓘ | Uraninite | 4.DL.05 | UO2 |
ⓘ | Ferronigerite-2N1S | 4.FC.20 | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
ⓘ | Ferrihydrite | 4.FE.35 | Fe3+10O14(OH)2 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
ⓘ | Natrophilite | 8.AB.10 | NaMn2+PO4 |
ⓘ | Purpurite | 8.AB.10 | Mn3+(PO4) |
ⓘ | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
ⓘ | Pucherite | 8.AD.40 | Bi(VO4) |
ⓘ | Ximengite | 8.AD.45 | Bi(PO4) |
ⓘ | Monazite-(Nd) | 8.AD.50 | Nd(PO4) |
ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
ⓘ | Cheralite | 8.AD.50 | CaTh(PO4)2 |
ⓘ | Monazite-(Sm) | 8.AD.50 | Sm(PO4) |
ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
ⓘ | Joosteite ? | 8.BB.15 | Mn2+(Mn3+,Fe3+)(PO4)O |
ⓘ | Triploidite ? | 8.BB.15 | Mn2+2(PO4)(OH) |
ⓘ | Pieczkaite | 8.BN.05 | Mn5(PO4)3Cl |
ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
ⓘ | Serrabrancaite | 8.CB.05 | MnPO4 · H2O |
ⓘ | Hureaulite | 8.CB.10 | Mn2+5(PO3OH)2(PO4)2 · 4H2O |
ⓘ | Fairfieldite | 8.CG.05 | Ca2Mn2+(PO4)2 · 2H2O |
ⓘ | Ningyoite | 8.CJ.85 | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
ⓘ | Pararobertsite ? | 8.DH.30 | Ca2Mn3+3(PO4)3O2 · 3H2O |
ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
ⓘ | Robertsite ? | 8.DH.30 | Ca2Mn3+3(PO4)3O2 · 3H2O |
ⓘ | Lermontovite ? | 8.DN.15 | U(PO4)(OH) · H2O |
ⓘ | Vyacheslavite ? | 8.DN.20 | U(PO4)(OH) |
Group 9 - Silicates | |||
ⓘ | Eucryptite | 9.AA.05 | LiAlSiO4 |
ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
ⓘ | Liberite | 9.AA.10 | Li2BeSiO4 |
ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
ⓘ | Pilawite-(Y) (TL) | 9.AF.95 | Ca2Y2Al4(SiO4)4O2(OH)2 |
ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
ⓘ | Żabińskiite (TL) | 9.AG.15 | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
ⓘ | Vuagnatite | 9.AG.60 | CaAl(SiO4)(OH) |
ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
ⓘ | Hingganite-(Y) | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
ⓘ | Hingganite-(Ce) | 9.AJ.20 | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
ⓘ | Keiviite-(Y) | 9.BC.05 | Y2Si2O7 |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Allanite-(Y) | 9.BG.05b | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
ⓘ | Ferriallanite-(Ce) | 9.BG.05b | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
ⓘ | Beryl var. Caesium Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
ⓘ | Pezzottaite | 9.CJ.60 | Cs(Be2Li)Al2(Si6O18) |
ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Olenite | 9.CK.05 | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
ⓘ | 'Liddicoatite' | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Rossmanite | 9.CK.05 | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
ⓘ | Bohseite (TL) | 9.DF. | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
ⓘ | Hellandite-(Y) | 9.DK.20 | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Bityite | 9.EC.35 | CaLiAl2(AlBeSi2O10)(OH)2 |
ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
ⓘ | 9.FA.30 | K(AlSi3O8) | |
ⓘ | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
ⓘ | 9.FA.35 | Na(AlSi3O8) | |
ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
Unclassified | |||
ⓘ | 'Mica Group' | - | |
ⓘ | 'Samarskite Group' | - | A3+B3+C5+2O8 |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
ⓘ | 'Chabazite' | - | |
ⓘ | 'Feldspar Group' | - | |
ⓘ | 'Ferronigerite' | - | |
ⓘ | 'Roméite' | - | |
ⓘ | 'Calciomicrolite' | - | |
ⓘ | 'Lepidolite' | - | |
ⓘ | 'Monazite' | - | REE(PO4) |
ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
ⓘ | 'Betafite Group' | - | A2(Ti,Nb)2O6Z |
ⓘ | 'Xenotime' | - | |
ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
ⓘ | 'Ixolite' | - | |
ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
ⓘ | 'Fergusonite' | - | |
ⓘ | 'Gadolinite' | - | |
ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
ⓘ | 'Ranciéite-Takanelite Series' | - | |
ⓘ | 'Almandine-Spessartine Series' | - | |
ⓘ | 'Zinnwaldite' | - | |
ⓘ | 'Bismutomicrolite' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
H | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
H | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
H | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
H | ⓘ Goethite | α-Fe3+O(OH) |
H | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
H | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
H | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
H | ⓘ Hydropyrochlore | (H2O,◻)2Nb2(O,OH)6(H2O) |
H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
H | ⓘ Lermontovite | U(PO4)(OH) · H2O |
H | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
H | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
H | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
H | ⓘ Pararobertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
H | ⓘ Robertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
H | ⓘ Triploidite | Mn22+(PO4)(OH) |
H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
H | ⓘ Vuagnatite | CaAl(SiO4)(OH) |
H | ⓘ Vyacheslavite | U(PO4)(OH) |
H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
H | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Serrabrancaite | MnPO4 · H2O |
H | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
H | ⓘ Hydromicrolite | (H2O,◻)2Ta2(O,OH)6(H2O) |
H | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
H | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
H | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
Li | Lithium | |
Li | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Li | ⓘ Eucryptite | LiAlSiO4 |
Li | ⓘ Liberite | Li2BeSiO4 |
Li | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Li | ⓘ Lithiophilite | LiMn2+PO4 |
Li | ⓘ Spodumene | LiAlSi2O6 |
Li | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
Li | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
Be | Beryllium | |
Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Be | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
Be | ⓘ Beryl | Be3Al2(Si6O18) |
Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
Be | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Be | ⓘ Liberite | Li2BeSiO4 |
Be | ⓘ Phenakite | Be2SiO4 |
Be | ⓘ Beryl var. Caesium Beryl | Be3Al2(Si6O18) |
Be | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
Be | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
B | Boron | |
B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
B | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
B | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
C | Carbon | |
C | ⓘ Bismutite | (BiO)2CO3 |
O | Oxygen | |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
O | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Bismite | Bi2O3 |
O | ⓘ Bismutite | (BiO)2CO3 |
O | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
O | ⓘ Beryl | Be3Al2(Si6O18) |
O | ⓘ Cassiterite | SnO2 |
O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Eucryptite | LiAlSiO4 |
O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
O | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
O | ⓘ Fergusonite-(Y) | YNbO4 |
O | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
O | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
O | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
O | ⓘ Fluorapatite | Ca5(PO4)3F |
O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
O | ⓘ Gahnite | ZnAl2O4 |
O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
O | ⓘ Goethite | α-Fe3+O(OH) |
O | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
O | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
O | ⓘ Ilmenite | Fe2+TiO3 |
O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
O | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
O | ⓘ Hydropyrochlore | (H2O,◻)2Nb2(O,OH)6(H2O) |
O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
O | ⓘ Keiviite-(Y) | Y2Si2O7 |
O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
O | ⓘ Lermontovite | U(PO4)(OH) · H2O |
O | ⓘ Liberite | Li2BeSiO4 |
O | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Lithiophilite | LiMn2+PO4 |
O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Microcline | K(AlSi3O8) |
O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
O | ⓘ Monazite | REE(PO4) |
O | ⓘ Monazite-(Ce) | Ce(PO4) |
O | ⓘ Monazite-(Nd) | Nd(PO4) |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Natrophilite | NaMn2+PO4 |
O | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
O | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
O | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
O | ⓘ Pararobertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
O | ⓘ Phenakite | Be2SiO4 |
O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
O | ⓘ Pucherite | Bi(VO4) |
O | ⓘ Purpurite | Mn3+(PO4) |
O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
O | ⓘ Pyrophanite | Mn2+TiO3 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Robertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
O | ⓘ Rutile | TiO2 |
O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
O | ⓘ Scheelite | Ca(WO4) |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
O | ⓘ Spodumene | LiAlSi2O6 |
O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
O | ⓘ Thorite | Th(SiO4) |
O | ⓘ Titanite | CaTi(SiO4)O |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
O | ⓘ Triplite | Mn22+(PO4)F |
O | ⓘ Triploidite | Mn22+(PO4)(OH) |
O | ⓘ Uraninite | UO2 |
O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
O | ⓘ Vuagnatite | CaAl(SiO4)(OH) |
O | ⓘ Vyacheslavite | U(PO4)(OH) |
O | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
O | ⓘ Xenotime-(Y) | Y(PO4) |
O | ⓘ Ximengite | Bi(PO4) |
O | ⓘ Zircon | Zr(SiO4) |
O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
O | ⓘ Beryl var. Caesium Beryl | Be3Al2(Si6O18) |
O | ⓘ Cheralite | CaTh(PO4)2 |
O | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Serrabrancaite | MnPO4 · H2O |
O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
O | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
O | ⓘ Garnet Group | X3Z2(SiO4)3 |
O | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
O | ⓘ Monazite-(Sm) | Sm(PO4) |
O | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
O | ⓘ Joosteite | Mn2+(Mn3+,Fe3+)(PO4)O |
O | ⓘ Betafite Group | A2(Ti,Nb)2O6Z |
O | ⓘ Samarskite Group | A3+B3+C25+O8 |
O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
O | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
O | ⓘ Hydromicrolite | (H2O,◻)2Ta2(O,OH)6(H2O) |
O | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
O | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
O | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
O | ⓘ Pieczkaite | Mn5(PO4)3Cl |
O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
O | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
F | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
F | ⓘ Fluorapatite | Ca5(PO4)3F |
F | ⓘ Fluorite | CaF2 |
F | ⓘ Triplite | Mn22+(PO4)F |
F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
F | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
F | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Na | ⓘ Natrophilite | NaMn2+PO4 |
Na | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
Na | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
Na | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
Mg | Magnesium | |
Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
Al | Aluminium | |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Al | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
Al | ⓘ Beryl | Be3Al2(Si6O18) |
Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Eucryptite | LiAlSiO4 |
Al | ⓘ Gahnite | ZnAl2O4 |
Al | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
Al | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Microcline | K(AlSi3O8) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
Al | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Al | ⓘ Spodumene | LiAlSi2O6 |
Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
Al | ⓘ Vuagnatite | CaAl(SiO4)(OH) |
Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Al | ⓘ Beryl var. Caesium Beryl | Be3Al2(Si6O18) |
Al | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Al | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
Al | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
Al | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
Al | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
Al | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
Si | Silicon | |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Si | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
Si | ⓘ Beryl | Be3Al2(Si6O18) |
Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Eucryptite | LiAlSiO4 |
Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
Si | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
Si | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Si | ⓘ Keiviite-(Y) | Y2Si2O7 |
Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
Si | ⓘ Liberite | Li2BeSiO4 |
Si | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Microcline | K(AlSi3O8) |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Olenite | NaAl3Al6(Si6O18)(BO3)3O3(OH) |
Si | ⓘ Phenakite | Be2SiO4 |
Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Si | ⓘ Spodumene | LiAlSi2O6 |
Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
Si | ⓘ Thorite | Th(SiO4) |
Si | ⓘ Titanite | CaTi(SiO4)O |
Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
Si | ⓘ Vuagnatite | CaAl(SiO4)(OH) |
Si | ⓘ Zircon | Zr(SiO4) |
Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Si | ⓘ Beryl var. Caesium Beryl | Be3Al2(Si6O18) |
Si | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
Si | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
Si | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
Si | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
Si | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
Si | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
P | Phosphorus | |
P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
P | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
P | ⓘ Fluorapatite | Ca5(PO4)3F |
P | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
P | ⓘ Lermontovite | U(PO4)(OH) · H2O |
P | ⓘ Lithiophilite | LiMn2+PO4 |
P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
P | ⓘ Monazite | REE(PO4) |
P | ⓘ Monazite-(Ce) | Ce(PO4) |
P | ⓘ Monazite-(Nd) | Nd(PO4) |
P | ⓘ Natrophilite | NaMn2+PO4 |
P | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
P | ⓘ Pararobertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
P | ⓘ Purpurite | Mn3+(PO4) |
P | ⓘ Robertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
P | ⓘ Triplite | Mn22+(PO4)F |
P | ⓘ Triploidite | Mn22+(PO4)(OH) |
P | ⓘ Vyacheslavite | U(PO4)(OH) |
P | ⓘ Xenotime-(Y) | Y(PO4) |
P | ⓘ Ximengite | Bi(PO4) |
P | ⓘ Cheralite | CaTh(PO4)2 |
P | ⓘ Serrabrancaite | MnPO4 · H2O |
P | ⓘ Monazite-(Sm) | Sm(PO4) |
P | ⓘ Joosteite | Mn2+(Mn3+,Fe3+)(PO4)O |
P | ⓘ Pieczkaite | Mn5(PO4)3Cl |
S | Sulfur | |
S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
S | ⓘ Arsenopyrite | FeAsS |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Bismuthinite | Bi2S3 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Galena | PbS |
S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
S | ⓘ Ikunolite | Bi4S3 |
S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
S | ⓘ Mackinawite | FeS |
S | ⓘ Marcasite | FeS2 |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Pyrrhotite | Fe1-xS |
S | ⓘ Sphalerite | ZnS |
S | ⓘ Vikingite | Ag5Pb8Bi13S30 |
Cl | Chlorine | |
Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
Cl | ⓘ Pieczkaite | Mn5(PO4)3Cl |
K | Potassium | |
K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
K | ⓘ Microcline | K(AlSi3O8) |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Ca | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Ca | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
Ca | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
Ca | ⓘ Fluorite | CaF2 |
Ca | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
Ca | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
Ca | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
Ca | ⓘ Pararobertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
Ca | ⓘ Robertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
Ca | ⓘ Scheelite | Ca(WO4) |
Ca | ⓘ Titanite | CaTi(SiO4)O |
Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Ca | ⓘ Vuagnatite | CaAl(SiO4)(OH) |
Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Ca | ⓘ Cheralite | CaTh(PO4)2 |
Ca | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
Ca | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
Ca | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
Ca | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
Ca | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
Ca | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Ti | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ti | ⓘ Ilmenite | Fe2+TiO3 |
Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
Ti | ⓘ Pyrophanite | Mn2+TiO3 |
Ti | ⓘ Rutile | TiO2 |
Ti | ⓘ Titanite | CaTi(SiO4)O |
Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Ti | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Ti | ⓘ Betafite Group | A2(Ti,Nb)2O6Z |
V | Vanadium | |
V | ⓘ Pucherite | Bi(VO4) |
Mn | Manganese | |
Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
Mn | ⓘ Fairfieldite | Ca2Mn2+(PO4)2 · 2H2O |
Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
Mn | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
Mn | ⓘ Lithiophilite | LiMn2+PO4 |
Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
Mn | ⓘ Natrophilite | NaMn2+PO4 |
Mn | ⓘ Pararobertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
Mn | ⓘ Purpurite | Mn3+(PO4) |
Mn | ⓘ Pyrophanite | Mn2+TiO3 |
Mn | ⓘ Robertsite | Ca2Mn33+(PO4)3O2 · 3H2O |
Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Mn | ⓘ Triplite | Mn22+(PO4)F |
Mn | ⓘ Triploidite | Mn22+(PO4)(OH) |
Mn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
Mn | ⓘ Serrabrancaite | MnPO4 · H2O |
Mn | ⓘ Joosteite | Mn2+(Mn3+,Fe3+)(PO4)O |
Mn | ⓘ Pieczkaite | Mn5(PO4)3Cl |
Fe | Iron | |
Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
Fe | ⓘ Arsenopyrite | FeAsS |
Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
Fe | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
Fe | ⓘ Goethite | α-Fe3+O(OH) |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Fe | ⓘ Ilmenite | Fe2+TiO3 |
Fe | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
Fe | ⓘ Mackinawite | FeS |
Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Marcasite | FeS2 |
Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
Fe | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Pyrrhotite | Fe1-xS |
Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
Fe | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Fe | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Joosteite | Mn2+(Mn3+,Fe3+)(PO4)O |
Cu | Copper | |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Zn | Zinc | |
Zn | ⓘ Gahnite | ZnAl2O4 |
Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
Zn | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
Zn | ⓘ Sphalerite | ZnS |
As | Arsenic | |
As | ⓘ Arsenopyrite | FeAsS |
Y | Yttrium | |
Y | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Y | ⓘ Fergusonite-(Y) | YNbO4 |
Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
Y | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Y | ⓘ Keiviite-(Y) | Y2Si2O7 |
Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
Y | ⓘ Xenotime-(Y) | Y(PO4) |
Y | ⓘ Pilawite-(Y) | Ca2Y2Al4(SiO4)4O2(OH)2 |
Zr | Zirconium | |
Zr | ⓘ Zircon | Zr(SiO4) |
Nb | Niobium | |
Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Nb | ⓘ Fergusonite-(Y) | YNbO4 |
Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
Nb | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
Nb | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
Nb | ⓘ Hydropyrochlore | (H2O,◻)2Nb2(O,OH)6(H2O) |
Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Nb | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Nb | ⓘ Betafite Group | A2(Ti,Nb)2O6Z |
Nb | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
Nb | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
Ag | Silver | |
Ag | ⓘ Vikingite | Ag5Pb8Bi13S30 |
Sn | Tin | |
Sn | ⓘ Cassiterite | SnO2 |
Sn | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
Sn | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
Sn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
Sb | Antimony | |
Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
Sb | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
Cs | Caesium | |
Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Cs | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Ce | Cerium | |
Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Ce | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ce | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Ce | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Ce | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
Nd | Neodymium | |
Nd | ⓘ Monazite-(Nd) | Nd(PO4) |
Sm | Samarium | |
Sm | ⓘ Monazite-(Sm) | Sm(PO4) |
Ta | Tantalum | |
Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
Ta | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
Ta | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Ta | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
Ta | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Ta | ⓘ Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
Ta | ⓘ Hydromicrolite | (H2O,◻)2Ta2(O,OH)6(H2O) |
Ta | ⓘ Żabińskiite | Ca[Al0.5(Ta,Nb)0.5)](SiO4)O |
W | Tungsten | |
W | ⓘ Scheelite | Ca(WO4) |
Pb | Lead | |
Pb | ⓘ Galena | PbS |
Pb | ⓘ Vikingite | Ag5Pb8Bi13S30 |
Bi | Bismuth | |
Bi | ⓘ Bismite | Bi2O3 |
Bi | ⓘ Bismuth | Bi |
Bi | ⓘ Bismuthinite | Bi2S3 |
Bi | ⓘ Bismutite | (BiO)2CO3 |
Bi | ⓘ Ikunolite | Bi4S3 |
Bi | ⓘ Pucherite | Bi(VO4) |
Bi | ⓘ Vikingite | Ag5Pb8Bi13S30 |
Bi | ⓘ Ximengite | Bi(PO4) |
Th | Thorium | |
Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Th | ⓘ Thorite | Th(SiO4) |
Th | ⓘ Cheralite | CaTh(PO4)2 |
U | Uranium | |
U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
U | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
U | ⓘ Lermontovite | U(PO4)(OH) · H2O |
U | ⓘ Ningyoite | (U,Ca,Ce)2(PO4)2 · 1-2H2O |
U | ⓘ Uraninite | UO2 |
U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
U | ⓘ Vyacheslavite | U(PO4)(OH) |
U | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
Localities in this Region
- Lower Silesian Voivodeship
- Dzierżoniów County
- Piława Górna
- DSS Piława Górna Quarry
- Piława Górna
- Dzierżoniów County
Other Regions, Features and Areas containing this locality
Czech Republic/Germany/Poland
- ⭔SilesiaRegion
Czech Republic/Poland
- Central SudetesMountain Range
Eurasian PlateTectonic Plate
EuropeContinent
- Bohemian Massif
- SudetesMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Pieczka, Adam, Hawthorne, Frank C., Cooper, Mark A., Szełęg, Eligiusz, Szuszkiewicz, Adam, Turniak, Krzysztof, Nejbert, Krzysztof, Ilnicki, Sławomir (2015) Pilawite-(Y), Ca2(Y,Yb)2[Al4(SiO4)4O2(OH)2], a new mineral from the Piława Górna granitic pegmatite, southwestern Poland: mineralogical data, crystal structure and association. Mineralogical Magazine, 79 (5) 1143-1157 doi:10.1180/minmag.2015.079.5.09
Szełęg, E., Zuzens, B., Hawthorne, F. C., Pieczka, A., Szuszkiewicz, A., Turniak, K., Nejbert, K., Ilnicki, S. S., Friis, H., Makovicky, E., Weller, M. T., Lemée-Cailleau, M.-H. (2017) Bohseite, ideally Ca4Be4Si9O24(OH)4, from the Piława Górna quarry, the Góry Sowie Block, SW Poland. Mineralogical Magazine, 81 (1) 35-46 doi:10.1180/minmag.2016.080.066