Powys, Wales, UKi
| Regional Level Types | |
|---|---|
| Powys | County |
| Wales | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Newtown | 11,357 (2017) |
| Brecon | 8,250 (2017) |
| Welshpool | 5,948 (2017) |
| Llandrindod Wells | 5,309 (2017) |
| Knighton | 3,007 (2017) |
| Llanidloes | 2,929 (2017) |
Mindat Locality ID:
23796
Long-form identifier:
mindat:1:2:23796:2
GUID (UUID V4):
b44ab19c-6fd5-413d-99bd-e2ab18d2eade
Other/historical names associated with this locality:
Montgomeryshire
Other Languages:
French:
Powys, Pays de Galles, Royaume-Uni
German:
Powys, Wales, Vereinigtes Königreich
Italian:
Powys, Galles, Regno Unito
Russian:
Поуис, Уэльс, Великобритания
Simplified Chinese:
波伊斯, 威爾士, 英国
Spanish:
Powys, Gales, Reino Unido
Welsh:
Powys, Cymru, Y Deyrnas Unedig
Arabic:
باويس, ويلز, المملكة المتحدة
Armenian:
Պոուիս, Ուելս, Միացյալ Թագավորություն
Asturian:
Powys, Gales, Reinu Xuníu
Basque:
Powys, Gales, Erresuma Batua
Belarusian:
Повіс, Уэльс, Вялікабрытанія
Bengali:
পয়েজ, ওয়েল্স্, যুক্তরাজ্য
Breton:
Powys, Kembre, Rouantelezh-Unanet
Bulgarian:
Поуис, Уелс, Обединено кралство Великобритания и Северна Ирландия
Catalan:
Powys, Gal·les, Regne Unit
Cebuano:
Sir Powys, Wales, Hiniusang Gingharian
Cornish:
Powys, Kembra, Ruwvaneth Unys
Czech:
Powys, Wales, Spojené království
Dutch:
Powys, Wales, Verenigd Koninkrijk
Esperanto:
Powys, Kimrio, Unuiĝinta Reĝlando
Estonian:
Powys, Wales, Suurbritannia
Farsi/Persian:
پویس, ولز, بریتانیا
Finnish:
Powys, Wales, Yhdistynyt kuningaskunta
Greek:
Πόουις, Ουαλία, Ηνωμένο Βασίλειο
Gujarati:
પોવીસ, વેલ્સ, યુનાઇટેડ કિંગડમ
Hebrew:
פוויס, ויילס, הממלכה המאוחדת
Hungarian:
Powys, Wales, Egyesült Királyság
Irish Gaelic:
Powys, An Bhreatain Bheag, An Ríocht Aontaithe
Japanese:
ポーイス, ウェールズ, イギリス
Kannada:
ಪೊವಿಸ್, ವೇಲ್ಸ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
포이스, 웨일스, 영국
Latin:
Poysia, Cambria, Britanniarum regnum
Lithuanian:
Povis, Velsas, Jungtinė Karalystė
Low Saxon/Low German:
Powys, Wales, Vereenigt Königriek vun Grootbritannien un Noordirland
Manx:
Powys, Bretyn, Reeriaght Unnaneysit
Norwegian:
Powys, Wales, Storbritannia
Norwegian (Nynorsk):
Powys, Wales, Storbritannia
Polish:
Powys, Walia, Wielka Brytania
Portuguese:
Powys, País de Gales, Reino Unido
Romanian:
Powys, Țara Galilor, Regatul Unit al Marii Britanii și al Irlandei de Nord
Scots:
Powys, Wales, Unitit Kinrick
Scottish Gaelic:
Powys, A' Chuimrigh, An Rìoghachd Aonaichte
Serbo-Croatian:
Powys, Wales, Ujedinjeno Kraljevstvo
Swedish:
Powys, Wales, Storbritannien
Tamil:
பௌய்ஸ், வேல்ஸ், ஐக்கிய இராச்சியம்
Telugu:
పావేస్, వేల్స్, యునైటెడ్ కింగ్డమ్
Ukrainian:
Повіс, Уельс, Велика Британія
Urdu:
پوویس, ویلز, مملکت متحدہ
Vietnamese:
Powys, Wales, Vương quốc Liên hiệp Anh và Bắc Ireland
Following the reorganisation of 1996, the Unitary Authority of Powys was formed from the administrative county of Powys plus a small part of the administrative county of Clwyd (also once part of the traditional county of Denbighshire).
The administrative county of Powys (named after the old Welsh kingdom of Powys that occupied roughly the same area) was itself only formed during the 1974 administrative reorganisation from the traditional counties of Montgomeryshire, Radnorshire and Brecknockshire that date back to the middle ages.
Locations in this section are within the part of the current Unitary Authority of Powys that previously formed Montgomeryshire and specimens from these locations may be labelled as Powys or Montgomeryshire depending upon period that they were collected.
Locations in the part of the Unitary Authority of Powys that previously formed Radnorshire are listed seperately within that section.
Following the reorganisation of 1996, the Unitary Authority of Powys was formed from the administrative county of Powys plus a small part of the administrative county of Clwyd (also once part of the traditional county of Denbighshire).
The administrative county of Powys (named after the old Welsh kingdom of Powys that occupied roughly the same area) was itself only formed during the 1974 administrative reorganisation from the traditional counties of Montgomeryshire, Radnorshire and Brecknockshire that date back to the middle ages.
Locations in this section are within the part of the current Unitary Authority of Powys that previously formed Radnorshire and specimens from these locations may be labelled as Powys or Radnorshire depending upon period that they were collected.
Locations in the part of the Unitary Authority of Powys that previously formed Montgomeryshire are listed within that section.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities124 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Formula: Zn2(AsO4)(OH) Locality: Dolyhir Quarry, Old Radnor, Powys, Wales, UK - erroneously reported Description: Is zincolivinite |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Alstonite Formula: BaCa(CO3)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 9 localities in this region. Habit: Prismatic, blocky Colour: Colourless Description: Colourless xls to 1.5mm, associated with linarite, brochantite, susannite, lautenthalite References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 Localities: References: |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Arsentsumebite Formula: Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Bechererite Formula: Zn7Cu(OH)13[(SiO(OH)3(SO4)] Localities: Habit: Prismatic inverted cone-like Colour: Colourless to ice blue Description: Very pale blue-green, also colourless to white cone-like prismatic xls to 0.7mm forming drusy crusts to 5mm (XRD). Associated with caledonite and susannite. 1st UK occurrence. References: |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 11 localities in this region. Description: Xls to 0.5mm References: |
| ⓘ 'Calamine' |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 25 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Habit: Prismatic Colour: Light blue Description: Light blue prismatic xls to 0.5mm, associated mostly with susannite, bechererite, linarite. |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Habit: Thin platy Colour: Pale emerald green Description: Xls to 0.2mm (XRD. The only specimen is in the NHM London collection. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Description: Thin crusts of radial masses to 1cm References: |
| ⓘ Copper Formula: Cu Localities: Dylife Mine (Pen Dylife Mine; Esgairgaled Mine; Llechwedd Ddu Mine; Blaen Twymyn Mine), Dylife, Machynlleth, Powys, Wales, UK Geufron Mine, Llanidloes, Powys, Wales, UK Dolyhir Quarry, Old Radnor, Powys, Wales, UK Hafod Feddgar Mine, Llanidloes, Powys, Wales, UK Gwestyn Mine, Llanidloes, Powys, Wales, UK |
| ⓘ Corrensite Formula: (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| ⓘ Covellite Formula: CuS Localities: References: |
| ⓘ Cuprite Formula: Cu2O Localities: |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Edingtonite Formula: Ba[Al2Si3O10] · 4H2O |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Ewaldite Formula: Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| ⓘ Galena Formula: PbS Localities: Reported from at least 37 localities in this region. References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gartrellite Formula: PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ Geerite Formula: Cu8S5 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: |
| ⓘ Greenockite Formula: CdS Localities: Description: Thin smears to afew mm References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O Localities: References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Craig Rhiwarth Mine (Ochrycraig; North Llangynog), Llangynog, Powys, Wales, UK Dylife Mine (Pen Dylife Mine; Esgairgaled Mine; Llechwedd Ddu Mine; Blaen Twymyn Mine), Dylife, Machynlleth, Powys, Wales, UK Llangynog Mine, Llangynog, Powys, Wales, UK Nant-y-Car Mine, Rhayader, Powys, Wales, UK Cwm Orog Mine, Llangynog, Powys, Wales, UK |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Habit: Prismatic Colour: White-creamy Description: Creamy to white prismatic xls to 0.7mm (XRD) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: |
| ⓘ Lanarkite Formula: Pb2(SO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Dylife Mine (Pen Dylife Mine; Esgairgaled Mine; Llechwedd Ddu Mine; Blaen Twymyn Mine), Dylife, Machynlleth, Powys, Wales, UK Llangynog Mine, Llangynog, Powys, Wales, UK Geufron Mine, Llanidloes, Powys, Wales, UK Dolyhir Quarry, Old Radnor, Powys, Wales, UK Craig Rhiwarth Mine (Ochrycraig; North Llangynog), Llangynog, Powys, Wales, UK Habit: Pseudohexagonal, pseudo-octahedral, blocy Colour: Deep blue geen Description: Deep blue green xls to 0.6mm, associated with brochantite, linarite, lautenthalite, chalcophyllite. |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ✪ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O Habit: Bladed Colour: Emerald green Description: Xls to 0.7mm (XRD) |
| ⓘ Lead Formula: Pb Localities: |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) |
| ⓘ 'Limonite' Localities: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 13 localities in this region. Habit: Bladed, tabular, block Colour: Azure blue Description: Xls to 1.2mm, associated with most othere supergene species. |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 18 localities in this region. Description: Xl sprays to 4mm |
| ⓘ Marcasite Formula: FeS2 Localities: References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Locality: Dyfngwm mine, Penegoes, Powys, Wales, UK |
| ⓘ Namuwite Formula: Zn4(SO4)(OH)6 · 4H2O Localities: Habit: Platy pseudohexagonal Colour: Very pale blueish green Description: Crystal druses to afew mm (XRD). |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Orpiment ? Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Otavite Formula: CdCO3 |
| ⓘ Paralstonite Formula: BaCa(CO3)2 |
| ⓘ Pararealgar ? Formula: As4S4 |
| ⓘ Plagionite Formula: Pb5Sb8S17 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 19 localities in this region. References: |
| ⓘ Pyrolusite Formula: Mn4+O2 Locality: Esgair Geulan, Pennant, Powys, Wales, UK |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 14 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 41 localities in this region. References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: References: |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ramsbeckite Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O Localities: Habit: Rounded rhombic Colour: Emerald green Description: Crystals to 0.7mm. |
| ⓘ Realgar Formula: As4S4 |
| ✪ Redgillite Formula: Cu6(SO4)(OH)10 · H2O Habit: Lath like Colour: Green, nickle green |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: Description: Balls to 1mm References: |
| ⓘ Roxbyite Formula: Cu9S5 |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Schmiederite Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: Solid solution with linarite, some tests on linarite indecates a high Se content |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O Localities: Habit: Rossets Colour: Light blue, light blue green Description: Crystal groups covering areas to 1cm |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O Habit: Lath like Colour: Light sky blue Description: Crystals covering area to 3cms |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Silver Formula: Ag Locality: Van Mine, Llanidloes, Powys, Wales, UK |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Craig Rhiwarth Mine (Ochrycraig; North Llangynog), Llangynog, Powys, Wales, UK Pen-y-Clun mine, Llanidloes, Powys, Wales, UK Llangynog Mine, Llangynog, Powys, Wales, UK Dolyhir Quarry, Old Radnor, Powys, Wales, UK Dylife Mine (Pen Dylife Mine; Esgairgaled Mine; Llechwedd Ddu Mine; Blaen Twymyn Mine), Dylife, Machynlleth, Powys, Wales, UK |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 33 localities in this region. References: |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Steverustite Formula: Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| ⓘ Sulphur Formula: S8 Localities: Description: Xls to 1.5mm References: |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Habit: Blocky-prismatic Colour: Colourless, creamy-white, tinted blue, green, yellow Description: Colourless to creamy, and tinted blue, green or yellowish platy and prismatic xls to 0.7mm (XRD). References: |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Tučekite Formula: Ni9Sb2S8 |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Witherite Formula: BaCO3 Localities: Reported from at least 11 localities in this region. References: |
| ✪ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Habit: Bladed, tabular Colour: Greenish-blue Description: Blue green to deep blue green tabular xls to 1mm. Associated with langite, brochantite, linarite, susannite, lautenthalite. |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Xanthoconite Formula: Ag3AsS3 |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zincolivenite Formula: CuZn(AsO4)(OH) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Lead | 1.AA.05 | Pb |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Roxbyite | 2.BA.05 | Cu9S5 |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Geerite | 2.BA.05 | Cu8S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Tučekite | 2.BB.10 | Ni9Sb2S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Pararealgar ? | 2.FA.15b | As4S4 |
| ⓘ | Orpiment ? | 2.FA.30 | As2S3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Otavite | 5.AB.05 | CdCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Alstonite | 5.AB.35 | BaCa(CO3)2 |
| ⓘ | Paralstonite | 5.AB.40 | BaCa(CO3)2 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Ewaldite | 5.CC.05 | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Namuwite | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Bechererite | 7.DD.55 | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ | Ramsbeckite | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Steverustite | 7.JA.10 | Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Adamite ? | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Zincolivenite | 8.BB.30 | CuZn(AsO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Arsentsumebite | 8.BG.05 | Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Gartrellite | 8.CG.20 | PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Corrensite | 9.EC.60 | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Edingtonite | 9.GA.15 | Ba[Al2Si3O10] · 4H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| H | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| H | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| C | Carbon | |
| C | ⓘ Alstonite | BaCa(CO3)2 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Paralstonite | BaCa(CO3)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Witherite | BaCO3 |
| O | Oxygen | |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alstonite | BaCa(CO3)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| O | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Paralstonite | BaCa(CO3)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| O | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geerite | Cu8S5 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pararealgar | As4S4 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Roxbyite | Cu9S5 |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tučekite | Ni9Sb2S8 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Alstonite | BaCa(CO3)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Paralstonite | BaCa(CO3)2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | Nickel | |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Tučekite | Ni9Sb2S8 |
| Cu | Copper | |
| Cu | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Cu | ⓘ Geerite | Cu8S5 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Roxbyite | Cu9S5 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Cu | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararealgar | As4S4 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Y | Yttrium | |
| Y | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Otavite | CdCO3 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Tučekite | Ni9Sb2S8 |
| Ba | Barium | |
| Ba | ⓘ Alstonite | BaCa(CO3)2 |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Ba | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Paralstonite | BaCa(CO3)2 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Ewaldite | Ba(Na,Ca,Y,Ce,K)(CO3)2 · 2.6H2O |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
Fossils
There are 47 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1842 |
|---|---|
| Youngest Fossil Listed | 315 Ma (Carboniferous) |
| Oldest Fossil Listed | 501 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 27 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 47 fossil localities |
- Wales
- Powys
- Late/Upper Ordovician🐚 Allt Fawr Wood
- Paleozoic🐚 4 miles SE of Llanfyllin
- Late/Upper Ordovician🐚 Aber Marchnant
- Silurian🐚 acinaces-magnus Zones
- Middle Ordovician🐚 Afon Camnant
- Late/Upper Ordovician🐚 Berwyn Hills
- Early/Lower Devonian🐚 Brecon Beacons Quarry
- Middle Ordovician🐚 Brithdir
- Middle Ordovician🐚 Camnant Brook section
- Middle Ordovician🐚 Camnant Ravine Section
- Silurian🐚 Capel Horeb quarry
- Late/Upper Ordovician🐚 crags in wood behind Goetre
- Paleozoic🐚 Ffridd Mathrafal
- Late/Upper Ordovician🐚 Gaerfawr
- Late/Upper Ordovician🐚 Gallt-yr-Anker
- Silurian🐚 Garth
- Silurian🐚 Gwernyfed
- Middle Ordovician🐚 Llandegley Rocks
- Silurian🐚 Llandysilio 7001a
- Ordovician🐚 Llanfawr Quarry
- Powys
- Wales
- Powys
- Ordovician🐚 Llanfawr Quarry 1
- Late/Upper Ordovician🐚 Meifod
- Silurian🐚 Middle Elton Beds
- Late/Upper Ordovician🐚 old quarry 400 m E of an ancient hillfort at Bryngwyn Hill
- Late/Upper Ordovician🐚 old quarry by cottage 60 m NW of Fron-y-Fele
- Middle Ordovician🐚 Old Tile Quarries at Gilwern Hill
- Late/Upper Ordovician🐚 Pont Aber Derfel
- Paleozoic🐚 Pont-ar-Dulas
- Late/Upper Ordovician🐚 quarry SW of Gaerfawr Hill
- Cambrian🐚 Revision Belt
- Late/Upper Ordovician🐚 Rhiw March
- Silurian🐚 SB50
- Silurian🐚 SB501
- Paleozoic🐚 SB54
- Middle Ordovician🐚 SW ridge of Llandegley Rocks
- Late/Upper Ordovician🐚 Trawsnant
- Early/Lower Devonian🐚 Tredomen
- Silurian🐚 Upper Elton Beds
- Middle Ordovician🐚 Upper Llanvirn Series sandstones near Howey Brook
- Silurian🐚 WB01
- Late/Upper Ordovician🐚 West Berwyns Hirnantian fauna
- Paleozoic🐚 Wye Valley
- Carboniferous🐚 Yniscedwyn Colliery
- Carboniferous🐚 Ystradgynlais colliery
- Powys
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Powys |
|---|---|
| Wikidata ID: | Q156150 |
| GeoNames ID: | 2639944 |
Localities in this Region
- Wales
- Powys
- Abercrave Colliery
- Blaencwm c Colliery
- Bryn-henllys Colliery
- Bryn-y-groes Colliery
- Bryn Varteg Colliery
- Brynant Varteg Colliery
- Brynhenllis Colliery
- Builth Wells
- Carreghofa
- Cwmphill Colliery
- Diamond Colliery
- Farteg Colliery
- Felin-fach (Felinfach)
- Folly Park Colliery
- Gilfach d Colliery
- Glynllech a Colliery
- Glynllech b Colliery
- Gurnos Colliery
- Gwaun-Clawdd Colliery
- Hafren Forest
- Hendreladis Colliery
- International a Colliery
- ⭔Llandrindod Wells
- Howey
- Llangurig
- Llangynog
- Llanidloes
- ⭔Machynlleth
- Powys
- Wales
- Powys
- Machynlleth
- New Palleg Colliery
- New Yniscu Colliery
- New Yniscu No.2 Colliery
- Old Radnor
- Palleg Colliery
- Pant Mawr Colliery
- Penegoes
- Pennant
- Penwyllt Stone Quarry
- ⭔Penybentfawr
- ⭔Rhayader
- Rhiw goch Colliery
- Rhiw Nant
- Unidentified small quarry in NW of Ogof Ffynnon Ddu Nature Reserve
- Unidentified small quarry N of Fan Bwlch Chwyth
- Upper Varteg Colliery
- Uwch y Garreg
- Varteg Colliery
- Walton
- Waunlwydd Colliery
- Wern Quarry
- Wernplemys Colliery
- Powys
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- Wales
- Bannau Brycheiniog National Park (Brecon Beacons National Park)National Park
- Cambrian MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Penycrocben, Penegoes, Powys, Wales, UK