Chester County, Pennsylvania, USAi
| Regional Level Types | |
|---|---|
| Chester County | County |
| Pennsylvania | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| West Chester | 19,842 (2017) |
| Phoenixville | 16,658 (2017) |
| Coatesville | 13,148 (2017) |
| Downingtown | 7,946 (2017) |
| Chester Springs | 7,520 (2017) |
| Lionville | 6,189 (2017) |
Mindat Locality ID:
14692
Long-form identifier:
mindat:1:2:14692:5
GUID (UUID V4):
3af8adca-fc69-4d6e-95ba-258f684b3f92
Other Languages:
French:
comté de Chester, Pennsylvanie, États-Unis
German:
Chester County, Pennsylvania, Vereinigte Staaten
Italian:
contea di Chester, Pennsylvania, Stati Uniti d'America
Russian:
Честер, Пенсильвания, Соединённые Штаты Америки
Simplified Chinese:
切斯特縣, 宾夕法尼亚州, 美国
Spanish:
Condado de Chester, Pensilvania, Estados Unidos
Albanian:
Chester County, Pennsylvania, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة تشيستر, بنسيلفانيا, الولايات المتحدة
Armenian:
Չեստեր շրջան, Փենսիլվանիա, Ամերիկայի Միացյալ Նահանգներ
Basque:
Chester konderria , Pennsylvania
Bavarian:
Chester County, Pennsylvania, Vaoanigte Stootn
Bishnupriya Manipuri:
চেস্টার কাউন্টি, পেনসিলভানিয়া, তিলপারাষ্ট্র
Bulgarian:
Честър, Пенсилвания, Съединени американски щати
Cebuano:
Chester County, Pennsylvania
Cornish:
Konteth Chester, Pennsylvani, Statys Unys
Danish:
Chester County, Pennsylvania, USA
Dutch:
Chester County, Pennsylvania, Verenigde Staten
Esperanto:
Kantono Chester, Pensilvanio
Farsi/Persian:
شهرستان چستر، پنسیلوانیا, پنسیلوانیا, ایالات متحده آمریکا
Georgian:
ჩესტერის ოლქი, პენსილვანია, ამერიკის შეერთებული შტატები
Hebrew:
מחוז צ'סטר, פנסילבניה, ארצות הברית
Hungarian:
Chester megye, Pennsylvania, Amerikai Egyesült Államok
Irish Gaelic:
Contae Chester, Pennsylvania, Stáit Aontaithe Mheiriceá
Japanese:
チェスター郡, ペンシルベニア州, アメリカ合衆国
Latin:
Chester Comitatus, Pennsilvania, Civitates Foederatae Americae
Low Saxon/Low German:
Chester County, Pennsylvania, USA
Min Dong Chinese:
Chester Gông, Pennsylvania
Minnan / Hokkien-Taiwanese:
Chester Kūn
Northern Frisian:
Chester County PA, Pennsylvania, Feriind Stoote foon Ameerika
Norwegian:
Chester County, Pennsylvania, USA
Pennsylvania German:
Tscheschter Kaundi, Pennsilfaani, Amerikaa
Polish:
Hrabstwo Chester, Pensylwania, Stany Zjednoczone
Portuguese:
Condado de Chester, Pensilvânia, Estados Unidos
Romanian:
Comitatul Chester, Pennsylvania, Statele Unite ale Americii
Sardinian:
contea de Chester, Pennsylvania, Istados Unidos de Amèrica
Scottish Gaelic:
Chester County, Pennsylvania, Na Stàitean Aonaichte
Serbian:
Округ Честер , Пенсилванија, Сједињене Америчке Државе
Serbo-Croatian:
Chester County, Pennsylvania, Sjedinjene Američke Države
Slovenian:
okrožje Chester, Pensilvanija, Združene države Amerike
Swedish:
Chester County, Pennsylvania, USA
Turkish:
Chester County, Pensilvanya, Amerika Birleşik Devletleri
Ukrainian:
Честер, Пенсильванія, Сполучені Штати Америки
Urdu:
چیسٹر کاؤنٹی، پنسلوانیا, پنسلوانیا, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Chester, Pennsylvania, Chủng Quốc Hoa Kỳ
Waray:
Condado han Chester, Pennsylvania, Estados Unidos
Welsh:
Sir Gaer, Pennsylvania, Unol Daleithiau America
Western Punjabi:
چیسٹر کاؤنٹی, پنسلوانیا, امریکہ
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities174 valid minerals. 2 (TL) - type locality of valid minerals. 3 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA Sylmar, West Nottingham Township, Chester County, Pennsylvania, USA Osborne Hill, Birmingham Township, Chester County, Pennsylvania, USA Hopewell mine, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA |
| ⓘ Formula: (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O Locality: Malvern, Malvern Borough, Chester County, Pennsylvania, USA - erroneously reported Description: Sited reference does not include mention of an observation at this locality. No additional references have yet been located to substantiate this observation. MRH |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Corundum Hill, Unionville, Newlin Township, Chester County, Pennsylvania, USA Goat Hill Magnesia Quarries, West Nottingham Township, Chester County, Pennsylvania, USA Sylmar, West Nottingham Township, Chester County, Pennsylvania, USA Copesville, East Bradford Township, Chester County, Pennsylvania, USA Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 10 localities in this region. Habit: Long hair-like, fiberous Colour: pale to deep green Fluorescence: none Description: Tremolite, Variety Byssolite occurs in long hairlike fiberous masses, closely associated with crystalized Prehnite and Clinozoisite at this site. |
| ⓘ 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 6 localities in this region. Habit: Long hair-like, fiberous Colour: pale to deep green Fluorescence: none Description: Tremolite, Variety Byssolite occurs in long hairlike fiberous masses, closely associated with crystalized Prehnite and Clinozoisite at this site. |
| ⓘ Anatase ? Formula: TiO2 |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Warwick Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Hopewell Furnace National Historic Site, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA References: |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O Localities: References: |
| ⓘ 'Aquacreptite (of Shepard)' Formula: Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near Localities: |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Arsenopalladinite Formula: Pd8(As,Sb)3 |
| ⓘ 'Asbestos' |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Axinite-(Mn) Formula: Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: References: |
| ⓘ Baryte Formula: BaSO4 Localities: Brookdale Mine, Schuylkill Township, Chester County, Pennsylvania, USA Wheatley Mines, Schuylkill Township, Chester County, Pennsylvania, USA Phoenixville Mining District, Chester County, Pennsylvania, USA Morris Mine, Schuylkill Township, Chester County, Pennsylvania, USA Phoenixville tunnel (Conrail tunnel; Black Rock tunnel), Phoenixville, Schuylkill Township, Chester County, Pennsylvania, USA References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: References: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: References: |
| ⓘ Braggite Formula: PdPt3S4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcioancylite-(Ce) Formula: (Ce,Ca,Sr)CO3(OH,H2O) |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 18 localities in this region. References: |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ 'Chalcodite' Formula: K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite Formula: CuFeS2 with Au |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: References: |
| ⓘ Clinochlore (TL) Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 Localities: |
| ⓘ Clinochlore var. Colerainite Formula: 4MgO · Al2O3 · 2SiO2 · 5H2O Localities: References: |
| ⓘ Clinochlore var. Sheridanite Formula: (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ✪ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Habit: Prismatic, somewhat rectangular in cross section, rarely terminated Colour: greenish qrey to pale greyish brown Description: Early in the 1950's Excellent crystals were being collected in amphibolite gneiss at this location. crystals ranging from minute needles to stout prismatic crystals six inches long to one inch across. In 1960, the first accurate identification of Clinozoisite in PA was made by D. M. Lapham, PA. Geo. Survey, using specimens from this site. |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ ' Locality: General Trimble's Mine, East Whiteland Township, Chester County, Pennsylvania, USA - erroneously reported Description: See also planerite entry for this locality.
This material is cuprian planerite or "half-empty" turquoise. Published analysis indicates that the vacany in the 'A' site is between 0.51-0.54 atom fraction, the balance in Cu-0.40 and Zn-0.06 to 0.09, so this is indeed planerite. |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Habit: tabular Colour: black Description: crystals weighing up to 2 kilos. |
| ⓘ Copper Formula: Cu Localities: Brookdale Mine, Schuylkill Township, Chester County, Pennsylvania, USA Wheatley Mines, Schuylkill Township, Chester County, Pennsylvania, USA Phoenixville Mining District, Chester County, Pennsylvania, USA French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Jones mine, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA References: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS Localities: References: |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Cuprite Formula: Cu2O Localities: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: References: |
| ⓘ 'Deweylite' Formula: Mg4Si3O10 · 6H2O ? Localities: References: |
| ✪ Diaspore Formula: AlO(OH) Habit: Doubly terminated crystals to 5cm Colour: honey yellow to greenish yellow |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 13 localities in this region. References: |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 Localities: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Erlichmanite Formula: OsS2 |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Elizabeth Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Keim's Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Wheatley Mines, Schuylkill Township, Chester County, Pennsylvania, USA Phoenixville Mining District, Chester County, Pennsylvania, USA |
| ⓘ 'Feldspar Group' Localities: |
| ⓘ 'Feldspar Group var. Sunstone' |
| ⓘ Ferronickelplatinum Formula: Pt2FeNi |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: References: |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O Localities: References: |
| ⓘ Fluorite Formula: CaF2 Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Brookdale Mine, Schuylkill Township, Chester County, Pennsylvania, USA Wheatley Mines, Schuylkill Township, Chester County, Pennsylvania, USA Edward's Quarry (Edward's Limestone Quarry), Newlin Township, Chester County, Pennsylvania, USA Phoenixville Mining District, Chester County, Pennsylvania, USA References: |
| ⓘ Forsterite Formula: Mg2SiO4 Localities: |
| ⓘ Gahnite Formula: ZnAl2O4 Description: Small green crystals in muscovite. Identified by E.T. Wherry |
| ⓘ Galena Formula: PbS Localities: Reported from at least 9 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Godlevskite Formula: (Ni,Fe)9S8 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Graphite Formula: C Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Benjamin Franklin Mine, Chester Springs, West Pikeland Township, Chester County, Pennsylvania, USA Hopewell Furnace National Historic Site, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Henry Pusey's quarry, Willowdale, East Marlboro Township, Chester County, Pennsylvania, USA References: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: References: |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: References: |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hollingworthite Formula: (Rh,Pt,Pd)AsS |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA Warwick Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Osborne Hill, Birmingham Township, Chester County, Pennsylvania, USA Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: References: |
| ⓘ Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| ⓘ Iridium Formula: (Ir,Os,Ru) |
| ⓘ Iron Formula: Fe |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ 'Jasper' |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Nevin's Quarry, Landenberg, London Britain Township, Chester County, Pennsylvania, USA Coatesville pegmatite locality, Coatesville, Valley Township, Chester County, Pennsylvania, USA Oxford, East Nottingham Township, Chester County, Pennsylvania, USA Kennett Square, Kennett Township, Chester County, Pennsylvania, USA References: |
| ⓘ 'K Feldspar' Localities: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kobokoboite Formula: Al6(PO4)4(OH)6 · 11H2O Description: Based on XRD analysis and matching patterns of confirmed kojojoboite/matulaite/afmite @ hellertown, PA. ref. Mineralogical Magazine vol. 76 no. 3 p.517 (2012). |
| ⓘ Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Caleb Cope's Lime Quarry, East Bradford Township, Chester County, Pennsylvania, USA R. Baily's Quarry, Unionville, West Marlboro Township, Chester County, Pennsylvania, USA Copesville, East Bradford Township, Chester County, Pennsylvania, USA Chadds Ford, Birmingham Township, Chester County, Pennsylvania, USA References: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Laurite Formula: RuS2 |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Description: Occurs as plary hexagonal crystals |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Localities: |
| ⓘ 'Limonite' Localities: Reported from at least 12 localities in this region. Habit: Pseudomorph after cubic Pyrite Colour: Brown to reddish brown, submetalic luster Description: One of several primary localities in Pennsylvania for the occurrance of Limonite pseudomorphs after cubic pyrite. Specimens tend to cubic form without notable abboration/distortions. Frequently sharp, with good pseudo crystal edging. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: |
| ⓘ Magnesite Formula: MgCO3 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Majakite Formula: PdNiAs |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Malanite Formula: Cu1+(Ir3+Pt4+)S4 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Localities: Reported from at least 7 localities in this region. |
| ⓘ Formula: (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O Locality: General Trimble's Mine, East Whiteland Township, Chester County, Pennsylvania, USA - erroneously reported Description: Based on XRD analysis and matching patterns of confirmed kojojoboite/matulaite/afmite @ hellertown, PA. ref. Mineralogical Magazine vol. 76 no. 3 p.517 (2012). |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Mendipite Formula: Pb3Cl2O2 |
| ⓘ Menshikovite Formula: Pd3Ni2As3 |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Chester County Poorhouse Quarry, West Bradford Township, Chester County, Pennsylvania, USA Coatesville pegmatite locality, Coatesville, Valley Township, Chester County, Pennsylvania, USA Phoenixville Mining District, Chester County, Pennsylvania, USA Henry Pusey's quarry, Willowdale, East Marlboro Township, Chester County, Pennsylvania, USA References: |
| ⓘ Microcline var. Chesterlite Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: |
| ⓘ Molybdenite Formula: MoS2 Localities: |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Mullite Formula: Al4+2xSi2-2xO10-x |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 15 localities in this region. References: |
| ⓘ Muscovite var. Damourite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Naldrettite Formula: Pd2Sb |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Oldhamite Formula: (Ca,Mg)S |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Omeiite Formula: (Os,Ru)As2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 9 localities in this region. |
| ⓘ Palladium ? Formula: (Pd,Pt) |
| ⓘ Palladoarsenide Formula: Pd2As |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Nevin's Quarry, Landenberg, London Britain Township, Chester County, Pennsylvania, USA Kennett Square, Kennett Township, Chester County, Pennsylvania, USA Jones mine, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Henry Pusey's quarry, Willowdale, East Marlboro Township, Chester County, Pennsylvania, USA Brinton's Quarry, Westtown Township, Chester County, Pennsylvania, USA ? (more information) |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Planerite Formula: Al6(PO4)2(PO3OH)2(OH)8 · 4H2O Description: Was originally reported to be coeruleolactite.
Cuprian planerite or "half-empty" turquoise. Published analysis indicates that the vacany in the 'A' site is between 0.51-0.54 atom fraction, the balance in Cu-0.40 and Zn-0.06 to 0.09, so this is indeed planerite. |
| ⓘ Platinum Formula: Pt |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Pyrite var. Cobalt-bearing Pyrite Formula: (Fe,Co)S2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 10 localities in this region. Habit: Hexigonal Prisms, cavernous barrel shaped with sheath termination, botryoidal globular or reniform masses Colour: Light yellowish green, brilliant green, to dark olive green with resinous luster Fluorescence: none Description: It occurs in beautiful groups of various shades of green at the Wheatley mines, crystals of considerable size, some to half an inch in diameter have been recovered. Large quantites of the Pyromorphite had been smelted durring the opperaton of the Mines. These mines have been closed for many Years now, Yet the dumps are still regulary sifted through by collectors, and ocasionally reasonably good specimens are still to be found, especially for Micromounts.
see: http://www.mindat.org/photo-180503.html References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Elizabeth Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Keim's Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Hopewell mine, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Hopewell Furnace National Historic Site, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA References: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 42 localities in this region. References: |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Brinton's Quarry, Westtown Township, Chester County, Pennsylvania, USA Pocopson, Pocopson Township, Chester County, Pennsylvania, USA Painter Farm, Pocopson, Birmingham Township, Chester County, Pennsylvania, USA Parkesburg Quartz Occurence, Parkesburg, Sadsbury Township, Chester County, Pennsylvania, USA East Bradford Township, Chester County, Pennsylvania, USA References: |
| ⓘ Quartz var. Blue Quartz Formula: SiO2 Localities: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: |
| ⓘ Quartz var. Prase Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA Coatesville pegmatite locality, Coatesville, Valley Township, Chester County, Pennsylvania, USA Oxford, East Nottingham Township, Chester County, Pennsylvania, USA Osborne Hill, Birmingham Township, Chester County, Pennsylvania, USA Parkesburg Quartz Occurence, Parkesburg, Sadsbury Township, Chester County, Pennsylvania, USA |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: References: |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Ruarsite Formula: (Ru,Os)AsS |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 10 localities in this region. Habit: tetragonal usually conststing of several prisms , frequently in double "geniculated" twins Colour: Reddish Brown, inclining to red Description: the finest locality for Rutile in PA, where crystals up to a pound in weight were found (19th century). Large twined crystals were found elsewhere in the soils throughout this 7 mile long region, along the Sadsbury township area. |
| ⓘ 'Scapolite' Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Scapolite var. Wernerite' Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ 'Serpentine Subgroup var. Marmolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn Localities: References: |
| ⓘ 'Serpentine Subgroup var. Picrolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ Shandite Formula: Ni3Pb2S2 |
| ⓘ Siderite Formula: FeCO3 Localities: Elizabeth Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Keim's Mine, French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Doe Run Quarries, West Marlboro Township, Chester County, Pennsylvania, USA French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Silver Formula: Ag Localities: References: |
| ⓘ Smithsonite Formula: ZnCO3 Localities: |
| ⓘ Sobolevskite Formula: PdBi |
| ⓘ Sperrylite Formula: PtAs2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ 'Spinel Subgroup' Formula: A2+D3+2O4 |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: References: |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O Localities: Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA Hopewell mine, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA ? (more information) |
| ⓘ Sudburyite Formula: PdSb |
| ⓘ Sulphur Formula: S8 Localities: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Telluropalladinite Formula: Pd9Te4 |
| ⓘ Tetraferroplatinum Formula: PtFe |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O |
| ⓘ 'Thomsonite Subgroup' |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA Nevin's Quarry, Landenberg, London Britain Township, Chester County, Pennsylvania, USA Osborne Hill, Birmingham Township, Chester County, Pennsylvania, USA French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Burnett's Quarry, Pennsbury Township, Chester County, Pennsylvania, USA |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 7 localities in this region. Colour: Brown & yellow. References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 11 localities in this region. Habit: Long hair-like, fiberous Colour: pale to deep green Description: Tremolite, Variety Byssolite occurs in long hairlike fiberous masses, closely associated with crystalized Prehnite and Clinozoisite at this site. |
| ⓘ Tulameenite Formula: Pt2CuFe |
| ⓘ Ungavaite Formula: Pd4Sb3 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: References: |
| ⓘ Vavřínite ? Formula: Ni2SbTe2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O Localities: Habit: Play crystals with pseudo-hexagonal outline Colour: Dark Greenish-brown Fluorescence: none Description: old varietal name 'Jeffersite'. Named after famed Chester Co. collector William Jefferies, whose collection formed the core of the Carnegie Museum collection. The occurrence from this locale was later determined to be Vermiculite and this new species was invalidated . |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: References: |
| ⓘ Vincentite Formula: Pd3As |
| ⓘ Vysotskite Formula: PdS |
| ⓘ 'Wad' |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ Wheatleyite (TL) Formula: Na2Cu(C2O4)2 · 2H2O Localities: |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Wurtzite Formula: (Zn,Fe)S Localities: |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? |
| ⓘ Zircon Formula: Zr(SiO4) Localities: French Creek Mines, Saint Peters, Warwick Township, Chester County, Pennsylvania, USA Benjamin Franklin Mine, Chester Springs, West Pikeland Township, Chester County, Pennsylvania, USA Willowdale, East Goshen Township, Chester County, Pennsylvania, USA Elk Creek pegmatite, Elk Township, Chester County, Pennsylvania, USA Hopewell Furnace National Historic Site, Hopewell Mines, Warwick (Saint Marys), Warwick Township, Chester County, Pennsylvania, USA References: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Iron | 1.AE.05 | Fe |
| ⓘ | Palladium ? | 1.AF.10 | (Pd,Pt) |
| ⓘ | Platinum | 1.AF.10 | Pt |
| ⓘ | Iridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | Tetraferroplatinum | 1.AG.40 | PtFe |
| ⓘ | Tulameenite | 1.AG.40 | Pt2CuFe |
| ⓘ | Ferronickelplatinum | 1.AG.40 | Pt2FeNi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Vincentite | 2.AC.05b | Pd3As |
| ⓘ | Arsenopalladinite | 2.AC.10c | Pd8(As,Sb)3 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Menshikovite | 2.AC.20c | Pd3Ni2As3 |
| ⓘ | Palladoarsenide | 2.AC.25a | Pd2As |
| ⓘ | Naldrettite | 2.AC.25d | Pd2Sb |
| ⓘ | Majakite | 2.AC.25e | PdNiAs |
| ⓘ | Ungavaite | 2.AC.35b | Pd4Sb3 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Godlevskite | 2.BB.15 | (Ni,Fe)9S8 |
| ⓘ | Telluropalladinite | 2.BC.30 | Pd9Te4 |
| ⓘ | Shandite | 2.BE.15 | Ni3Pb2S2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite var. Gold-bearing Chalcopyrite | 2.CB.10a | CuFeS2 with Au |
| ⓘ | 2.CB.10a | CuFeS2 | |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Sudburyite | 2.CC.05 | PdSb |
| ⓘ | Sobolevskite | 2.CC.05 | PdBi |
| ⓘ | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Vavřínite ? | 2.CC.30 | Ni2SbTe2 |
| ⓘ | Vysotskite | 2.CC.35a | PdS |
| ⓘ | Braggite | 2.CC.35a | PdPt3S4 |
| ⓘ | Oldhamite | 2.CD.10 | (Ca,Mg)S |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Malanite | 2.DA.05 | Cu1+(Ir3+Pt4+)S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Erlichmanite | 2.EB.05a | OsS2 |
| ⓘ | Pyrite var. Cobalt-bearing Pyrite | 2.EB.05a | (Fe,Co)S2 |
| ⓘ | Laurite | 2.EB.05a | RuS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Omeiite | 2.EB.15a | (Os,Ru)As2 |
| ⓘ | Ruarsite | 2.EB.20 | (Ru,Os)AsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| ⓘ | Hollingworthite | 2.EB.25 | (Rh,Pt,Pd)AsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Mendipite | 3.DC.70 | Pb3Cl2O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase ? | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Akaganeite ? | 4.DK.05 | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 · 4H2O ? |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| ⓘ | Calcioancylite-(Ce) | 5.DC.05 | (Ce,Ca,Sr)CO3(OH,H2O) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Planerite | 8.DD.15 | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| ⓘ | 'Coeruleolactite' ? | 8.DD.15 | |
| ⓘ | Kobokoboite | 8.DD.25 | Al6(PO4)4(OH)6 · 11H2O |
| ⓘ | Matulaite ? | 8.DK.30 | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Thorite var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Mullite | 9.AF.20 | Al4+2xSi2-2xO10-x |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Axinite-(Mn) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore var. Sheridanite | 9.EC.55 | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ | (TL) | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | var. Colerainite | 9.EC.55 | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | 'Chalcodite' | 9.EG.40 | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| ⓘ | Microcline var. Chesterlite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ | 'Aquacreptite (of Shepard)' | 9.HC.25 | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| Group 10 - Organic Compounds | |||
| ⓘ | Wheatleyite (TL) | 10.AB.30 | Na2Cu(C2O4)2 · 2H2O |
| Unclassified | |||
| ⓘ | 'Deweylite' | - | Mg4Si3O10 · 6H2O ? |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Serpentine Subgroup var. Picrolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Serpentine Subgroup var. Marmolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | 'Spinel Subgroup' | - | A2+D3+2O4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Deweylite | Mg4Si3O10 · 6H2O ? |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Wheatleyite | Na2Cu(C2O4)2 · 2H2O |
| H | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Clinochlore var. Colerainite | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| H | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| H | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Wheatleyite | Na2Cu(C2O4)2 · 2H2O |
| C | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Deweylite | Mg4Si3O10 · 6H2O ? |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| O | ⓘ Mendipite | Pb3Cl2O2 |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Wheatleyite | Na2Cu(C2O4)2 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Clinochlore var. Colerainite | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| O | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| O | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| O | ⓘ Microcline var. Chesterlite | K(AlSi3O8) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Spinel Subgroup | A2+D23+O4 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Wheatleyite | Na2Cu(C2O4)2 · 2H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Deweylite | Mg4Si3O10 · 6H2O ? |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Oldhamite | (Ca,Mg)S |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Clinochlore var. Colerainite | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| Mg | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Clinochlore var. Colerainite | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Al | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| Al | ⓘ Microcline var. Chesterlite | K(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Deweylite | Mg4Si3O10 · 6H2O ? |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Mullite | Al4+2xSi2-2xO10-x |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Clinochlore var. Colerainite | 4MgO · Al2O3 · 2SiO2 · 5H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| Si | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Si | ⓘ Microcline var. Chesterlite | K(AlSi3O8) |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Planerite | Al6(PO4)2(PO3OH)2(OH)8 · 4H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Braggite | PdPt3S4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Erlichmanite | OsS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Godlevskite | (Ni,Fe)9S8 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| S | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Laurite | RuS2 |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Malanite | Cu1+(Ir3+Pt4+)S4 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Oldhamite | (Ca,Mg)S |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ruarsite | (Ru,Os)AsS |
| S | ⓘ Shandite | Ni3Pb2S2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Vysotskite | PdS |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| S | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Cl | Chlorine | |
| Cl | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Mendipite | Pb3Cl2O2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| K | ⓘ Microcline var. Chesterlite | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Oldhamite | (Ca,Mg)S |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mn | Manganese | |
| Mn | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Aquacreptite (of Shepard) | Mg4Fe2Si6O19 · 8H2O with some Al2O3, or near |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferronickelplatinum | Pt2FeNi |
| Fe | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Tetraferroplatinum | PtFe |
| Fe | ⓘ Tulameenite | Pt2CuFe |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Fe | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Ni | Nickel | |
| Ni | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Ni | ⓘ Ferronickelplatinum | Pt2FeNi |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Majakite | PdNiAs |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Shandite | Ni3Pb2S2 |
| Ni | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Ni | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | ⓘ Menshikovite | Pd3Ni2As3 |
| Ni | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | ⓘ Vavřínite | Ni2SbTe2 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Malanite | Cu1+(Ir3+Pt4+)S4 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Tulameenite | Pt2CuFe |
| Cu | ⓘ Wheatleyite | Na2Cu(C2O4)2 · 2H2O |
| Cu | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Zn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| As | Arsenic | |
| As | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| As | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | ⓘ Majakite | PdNiAs |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Omeiite | (Os,Ru)As2 |
| As | ⓘ Palladoarsenide | Pd2As |
| As | ⓘ Ruarsite | (Ru,Os)AsS |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Vincentite | Pd3As |
| As | ⓘ Menshikovite | Pd3Ni2As3 |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ru | Ruthenium | |
| Ru | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ru | ⓘ Iridium | (Ir,Os,Ru) |
| Ru | ⓘ Laurite | RuS2 |
| Ru | ⓘ Omeiite | (Os,Ru)As2 |
| Ru | ⓘ Ruarsite | (Ru,Os)AsS |
| Rh | Rhodium | |
| Rh | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Rh | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pd | Palladium | |
| Pd | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| Pd | ⓘ Braggite | PdPt3S4 |
| Pd | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pd | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | ⓘ Majakite | PdNiAs |
| Pd | ⓘ Palladium | (Pd,Pt) |
| Pd | ⓘ Palladoarsenide | Pd2As |
| Pd | ⓘ Sobolevskite | PdBi |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Pd | ⓘ Sudburyite | PdSb |
| Pd | ⓘ Telluropalladinite | Pd9Te4 |
| Pd | ⓘ Vincentite | Pd3As |
| Pd | ⓘ Vysotskite | PdS |
| Pd | ⓘ Menshikovite | Pd3Ni2As3 |
| Pd | ⓘ Naldrettite | Pd2Sb |
| Pd | ⓘ Ungavaite | Pd4Sb3 |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sb | Antimony | |
| Sb | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Sudburyite | PdSb |
| Sb | ⓘ Naldrettite | Pd2Sb |
| Sb | ⓘ Ungavaite | Pd4Sb3 |
| Sb | ⓘ Vavřínite | Ni2SbTe2 |
| Te | Tellurium | |
| Te | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Telluropalladinite | Pd9Te4 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Vavřínite | Ni2SbTe2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Os | Osmium | |
| Os | ⓘ Erlichmanite | OsS2 |
| Os | ⓘ Iridium | (Ir,Os,Ru) |
| Os | ⓘ Omeiite | (Os,Ru)As2 |
| Os | ⓘ Ruarsite | (Ru,Os)AsS |
| Ir | Iridium | |
| Ir | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ir | ⓘ Iridium | (Ir,Os,Ru) |
| Ir | ⓘ Malanite | Cu1+(Ir3+Pt4+)S4 |
| Pt | Platinum | |
| Pt | ⓘ Braggite | PdPt3S4 |
| Pt | ⓘ Ferronickelplatinum | Pt2FeNi |
| Pt | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pt | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | ⓘ Malanite | Cu1+(Ir3+Pt4+)S4 |
| Pt | ⓘ Palladium | (Pd,Pt) |
| Pt | ⓘ Platinum | Pt |
| Pt | ⓘ Sperrylite | PtAs2 |
| Pt | ⓘ Tetraferroplatinum | PtFe |
| Pt | ⓘ Tulameenite | Pt2CuFe |
| Au | Gold | |
| Au | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mendipite | Pb3Cl2O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Shandite | Ni3Pb2S2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Bi | Bismuth | |
| Bi | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | ⓘ Sobolevskite | PdBi |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 209 Ma (Late/Upper Triassic) | ||||||
| Oldest Fossil Listed | 228 Ma (Late/Upper Triassic) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Chester_County,_Pennsylvania |
|---|---|
| Wikidata ID: | Q27840 |
| GeoNames ID: | 5184079 |
Localities in this Region
- Pennsylvania
- Chester County
- ⭔Birmingham Township
- ⭔Charlestown Township
- ⭔East Bradford Township
- ⭔East Caln Township
- ⭔East Goshen Township
- ⭔East Marlboro Township
- ⭔East Nottingham Township
- ⭔East Whiteland Township
- ⭔Elk Township
- ⭔Kennett Township
- ⭔London Britain Township
- ⭔Malvern Borough
- ⭔Newlin Township
- ⭔Oxford
- ⭔Pennsbury Township
- ⭔Pocopson Township
- ⭔Sadsbury Township
- Chester County
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Laurentides DomainDomain
- Piedmontia DomainDomain
USA
- Pennsylvania
- Chester County
- Phoenixville Mining DistrictMining District
- Chester County
- State Line Chromite Mining DistrictMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Keystone Trap Rock Quarry, Cornog, Wallace Township, Chester County, Pennsylvania, USA