Zoisite
A valid IMA mineral species - grandfathered
This page is currently not sponsored. Click here to sponsor this page.
About Zoisite
Formula:
(CaCa)(AlAlAl)O[Si2O7][SiO4](OH)
Colour:
Colourless, purple, greyish-white, grey, yellowish-brown, yellow, pink, green
Lustre:
Vitreous, Pearly
Hardness:
6 - 7
Specific Gravity:
3.15 - 3.36
Crystal System:
Orthorhombic
Name:
Originally named saualpite for the locality Saualpe in Carinthia, Austria, where it occurs in eclogites. The name zoisite was introduced by A.G. Werner in 1805 to honour Sigmund Zois, Baron von Edelstein (1747-1819), Austrian scholar who financed mineral-collecting expeditions. It was from Baron Zois that Werner obtained the holotype specimen from Saualpe (found by mineral dealer Simon Prešern in 1804).
Dimorph of:
Formerly assigned to the Epidote Group. Since Zoisite is the orthorhombic polymorph of Clinozoisite, zoisite is no longer considered a member of this group, according to the new nomenclature of the Epidote Supergroup (Armbruster et al., 2006; Mills et al., 2009).
The fully calcian (or Ca2) analogue of zoisite-(Pb).
The fully calcian (or Ca2) analogue of zoisite-(Pb).
Visit gemdat.org for gemological information about Zoisite.
Unique Identifiers
Mindat ID:
4430
Long-form identifier:
mindat:1:1:4430:7
GUID
(UUID V4):
(UUID V4):
bd105552-3fbc-48ef-9583-56d3ecdd9905
IMA Classification of Zoisite
Approved, 'Grandfathered' (first described prior to 1959)
IMA Formula:
Ca2Al3[Si2O7][SiO4]O(OH)
Classification of Zoisite
9.BG.10
9 : SILICATES (Germanates)
B : Sorosilicates
G : Sorosilicates with mixed SiO4 and Si2O7 groups; cations in octahedral [6] and greater coordination
9 : SILICATES (Germanates)
B : Sorosilicates
G : Sorosilicates with mixed SiO4 and Si2O7 groups; cations in octahedral [6] and greater coordination
58.2.1b.1
58 : SOROSILICATES Insular, Mixed, Single, and Larger Tetrahedral Groups
2 : Insular, Mixed, Single, and Larger Tetrahedral Groups with cations in [6] and higher coordination; single and double groups (n = 1, 2)
58 : SOROSILICATES Insular, Mixed, Single, and Larger Tetrahedral Groups
2 : Insular, Mixed, Single, and Larger Tetrahedral Groups with cations in [6] and higher coordination; single and double groups (n = 1, 2)
16.9.8
16 : Silicates Containing Aluminum and other Metals
9 : Aluminosilicates of Ca
16 : Silicates Containing Aluminum and other Metals
9 : Aluminosilicates of Ca
Mineral Symbols
As of 2021 there are now IMA–CNMNC approved mineral symbols (abbreviations) for each mineral species, useful for tables and diagrams.
Please only use the official IMA–CNMNC symbol. Older variants are listed for historical use only.
Please only use the official IMA–CNMNC symbol. Older variants are listed for historical use only.
Symbol | Source | Reference |
---|---|---|
Zo | IMA–CNMNC | Warr, L.N. (2021). IMA–CNMNC approved mineral symbols. Mineralogical Magazine, 85(3), 291-320. doi:10.1180/mgm.2021.43 |
Zo | Kretz (1983) | Kretz, R. (1983) Symbols of rock-forming minerals. American Mineralogist, 68, 277–279. |
Zo | Siivolam & Schmid (2007) | Siivolam, J. and Schmid, R. (2007) Recommendations by the IUGS Subcommission on the Systematics of Metamorphic Rocks: List of mineral abbreviations. Web-version 01.02.07. IUGS Commission on the Systematics in Petrology. download |
Zo | Whitney & Evans (2010) | Whitney, D.L. and Evans, B.W. (2010) Abbreviations for names of rock-forming minerals. American Mineralogist, 95, 185–187 doi:10.2138/am.2010.3371 |
Zo | The Canadian Mineralogist (2019) | The Canadian Mineralogist (2019) The Canadian Mineralogist list of symbols for rock- and ore-forming minerals (December 30, 2019). download |
Pronunciation of Zoisite
Pronunciation:
Play | Recorded by | Country |
---|---|---|
Jolyon Ralph | United Kingdom | |
Jolyon Ralph | United Kingdom |
Physical Properties of Zoisite
Vitreous, Pearly
Transparency:
Transparent, Translucent
Comment:
Pearly on cleavage {010}
Colour:
Colourless, purple, greyish-white, grey, yellowish-brown, yellow, pink, green
Streak:
White
Hardness:
6 - 7 on Mohs scale
Tenacity:
Brittle
Cleavage:
Perfect
Perfect on {010}
Imperfect on {100}
Perfect on {010}
Imperfect on {100}
Fracture:
Irregular/Uneven, Conchoidal
Density:
3.15 - 3.36 g/cm3 (Measured) 3.35 g/cm3 (Calculated)
Optical Data of Zoisite
Type:
Biaxial (+)
RI values:
nα = 1.696 - 1.700 nβ = 1.696 - 1.702 nγ = 1.702 - 1.718
Max Birefringence:
δ = 0.006 - 0.018
Image shows birefringence interference colour range (at 30µm thickness)
and does not take into account mineral colouration.
and does not take into account mineral colouration.
Surface Relief:
High
Dispersion:
relatively strong
Pleochroism:
Visible
Comments:
X= pale pink to red violet
Y= nearly colourless to bright pink or deep blue
Z= pale yellow to yellow-green
Y= nearly colourless to bright pink or deep blue
Z= pale yellow to yellow-green
Chemistry of Zoisite
Mindat Formula:
(CaCa)(AlAlAl)O[Si2O7][SiO4](OH)
Common Impurities:
Fe,Mn,Mg,Cr,Ti,Ca,Na,V,Sr,H2O
Chemical Analysis
Oxide wt%:
1 | |
---|---|
SiO2 | 40.1 % |
Al2O3 | 31.9 % |
Mn2O3 | 0.1 % |
Fe2O3 | 2.7 % |
CaO | 23.3 % |
H2O | 1.9 % |
Total: | 100 % |
Sample references:
ID | Locality | Reference | Notes |
---|---|---|---|
1 | Mjønes Tunnel, Åstfjorden, Snillfjord, Orkland, Trøndelag, Norway | St | Pink zoisite, PXRD + SEM/EDS |
Crystallography of Zoisite
Crystal System:
Orthorhombic
Class (H-M):
mmm (2/m 2/m 2/m) - Dipyramidal
Space Group:
Pnma
Cell Parameters:
a = 16.19 Å, b = 5.54 Å, c = 10.03 Å
Ratio:
a:b:c = 2.922 : 1 : 1.81
Unit Cell V:
899.62 ų (Calculated from Unit Cell)
Z:
4
Morphology:
Prismatic crystals, columnar to compact, massive
Crystallographic forms of Zoisite
Crystal Atlas:
Image Loading
Click on an icon to view
3d models and HTML5 code kindly provided by
www.smorf.nl.
Toggle
Edge Lines | Miller Indices | Axes
Transparency
Opaque | Translucent | Transparent
View
Along a-axis | Along b-axis | Along c-axis | Start rotation | Stop rotation
Toggle
Edge Lines | Miller Indices | Axes
Transparency
Opaque | Translucent | Transparent
View
Along a-axis | Along b-axis | Along c-axis | Start rotation | Stop rotation
Crystal Structure
Load
Unit Cell | Unit Cell Packed
2x2x2 | 3x3x3 | 4x4x4
Unit Cell | Unit Cell Packed
2x2x2 | 3x3x3 | 4x4x4
Show
Big Balls | Small Balls | Just Balls | Spacefill
Polyhedra Off | Si Polyhedra | All Polyhedra
Remove metal-metal sticks
Big Balls | Small Balls | Just Balls | Spacefill
Polyhedra Off | Si Polyhedra | All Polyhedra
Remove metal-metal sticks
Display Options
Black Background | White Background
Perspective On | Perspective Off
2D | Stereo | Red-Blue | Red-Cyan
Black Background | White Background
Perspective On | Perspective Off
2D | Stereo | Red-Blue | Red-Cyan
View
CIF File Best | x | y | z | a | b | c
CIF File Best | x | y | z | a | b | c
Rotation
Stop | Start
Stop | Start
Labels
Console Off | On | Grey | Yellow
Console Off | On | Grey | Yellow
Data courtesy of the American Mineralogist Crystal Structure Database. Click on an AMCSD ID to view structure
ID | Species | Reference | Link | Year | Locality | Pressure (GPa) | Temp (K) |
---|---|---|---|---|---|---|---|
0000184 | Zoisite | Dollase W A (1968) Refinement and comparison of the structures of zoisite and clinozoisite American Mineralogist 53 1882-1898 | 1968 | 0 | 293 | ||
0001859 | Zoisite | Comodi P, Zanazzi P F (1997) The pressure behavior of clinozoisite and zoisite: An X-ray diffraction study American Mineralogist 82 61-68 | 1997 | 0.0001 | 293 | ||
0002855 | Zoisite | Liebscher A, Gottschalk M, Franz G (2002) The substitution Fe-Al and the isosymmetric displacive phase transition in synthetic zoisite: A powder X-ray and infrared spectroscopic study American Mineralogist 87 909-921 | 2002 | 0 | 293 | ||
0002856 | Zoisite | Liebscher A, Gottschalk M, Franz G (2002) The substitution Fe-Al and the isosymmetric displacive phase transition in synthetic zoisite: A powder X-ray and infrared spectroscopic study American Mineralogist 87 909-921 | 2002 | 0 | 293 | ||
0002857 | Zoisite | Liebscher A, Gottschalk M, Franz G (2002) The substitution Fe-Al and the isosymmetric displacive phase transition in synthetic zoisite: A powder X-ray and infrared spectroscopic study American Mineralogist 87 909-921 | 2002 | 0 | 293 | ||
0002858 | Zoisite | Liebscher A, Gottschalk M, Franz G (2002) The substitution Fe-Al and the isosymmetric displacive phase transition in synthetic zoisite: A powder X-ray and infrared spectroscopic study American Mineralogist 87 909-921 | 2002 | 0 | 293 | ||
0002859 | Zoisite | Liebscher A, Gottschalk M, Franz G (2002) The substitution Fe-Al and the isosymmetric displacive phase transition in synthetic zoisite: A powder X-ray and infrared spectroscopic study American Mineralogist 87 909-921 | 2002 | 0 | 293 | ||
0004382 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004383 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004384 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004385 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004386 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004387 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004388 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004389 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004390 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004391 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004392 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004393 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004394 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004395 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004396 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0004397 | Zoisite | Dorsam G, Liebscher A, Franz G, Gottschalk M (2007) Crystal chemistry of synthetic Ca2Al3Si3O12OH - Sr2Al3Si3O12OH solid solution series of zoisite and clinozoisite American Mineralogist 92 1133-1147 | 2007 | synthetic | 0 | 293 | |
0019070 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 0.0001 | 293 | |
0019071 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 7.766 | 293 | |
0019072 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 5.145 | 293 | |
0019073 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 1.144 | 293 | |
0019074 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 2.945 | 293 | |
0019075 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 4.025 | 293 | |
0019076 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 5.533 | 293 | |
0019077 | Zoisite | Alvaro M, Angel R J, Camara F (2012) High-pressure behavior of zoisite American Mineralogist 97 1165-1176 | 2012 | Merelani Hills, Tanzania | 6.511 | 293 |
CIF Raw Data - click here to close
X-Ray Powder Diffraction
Image Loading
Radiation - Copper Kα
Data courtesy of RRUFF project at University of Arizona, used with permission.
Powder Diffraction Data:
d-spacing | Intensity |
---|---|
2.693 Å | (100) |
2.874 Å | (65) |
4.03 Å | (50) |
8.09 Å | (40) |
2.019 Å | (35) |
1.601 Å | (35) |
5.01 Å | (30) |
Geological Environment
Paragenetic Mode(s):
Paragenetic Mode | Earliest Age (Ga) |
---|---|
Stage 3b: Earth’s earliest hydrosphere | >4.45 |
16 : Low-? aqueous alteration of Hadean subaerial lithologies (see also #23) | |
High-? alteration and/or metamorphism | |
31 : Thermally altered carbonate, phosphate, and iron formations | |
Stage 5: Initiation of plate tectonics | <3.5-2.5 |
39 : High-? metamorphism (blueschist, eclogite, ultrahigh ? facies) | |
40 : Regional metamorphism (greenschist, amphibolite, granulite facies) | |
41 : Mantle metasomatism |
Geological Setting:
Medium grade regionally metamorphosed rocks, eclogites, blueschist facies metamorphic rocks.
Type Occurrence of Zoisite
Geological Setting of Type Material:
Pegmatite in eclogite
Synonyms of Zoisite
Other Language Names for Zoisite
Varieties of Zoisite
Chrome-Zoisite | A Cr-bearing variety of Zoisite. |
Pseudozoisite | A zoisite with anomalous optical properties. |
Tanzanite | A gem variety of zoisite with a blue to blue-violet colour. The colour is due to the incorporation of trace amounts of vanadium cations (V4+ absorption band increased at 380 nm, V3+ absorption band at 350 nm decreased with heating). Note that a signifi... |
Thulite | A pink variety of zoisite, frequently manganian, i.e. containing trivalent Mn (not manganoan, which refers to divalent Mn). Originally described from Kleppan, Sauland, Hjartdal, Telemark, Norway. NOTE: "Thulite" from granite pegmatites and some metamorp... |
Common Associates
Associated Minerals Based on Photo Data:
73 photos of Zoisite associated with Ruby | Al2O3 |
57 photos of Zoisite associated with Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
20 photos of Zoisite associated with Quartz | SiO2 |
16 photos of Zoisite associated with Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
14 photos of Zoisite associated with Corundum | Al2O3 |
14 photos of Zoisite associated with Graphite | C |
14 photos of Zoisite associated with Calcite | CaCO3 |
8 photos of Zoisite associated with Diopside | CaMgSi2O6 |
7 photos of Zoisite associated with Muscovite | KAl2(AlSi3O10)(OH)2 |
7 photos of Zoisite associated with Prehnite | Ca2Al2Si3O10(OH)2 |
Related Minerals - Strunz-mindat Grouping
9.BG. | Shuiskite-(Cr) | Ca2Cr3+Cr3+2[Si2O6OH][SiO4](OH)2O |
9.BG. | Alnaperbøeite-(Ce) | Ca(Ce2.5Na0.5)(AlAl2Al)[Si2O7][SiO4]3O(OH)2 |
9.BG. | Magnesiovesuvianite | Ca19MgAl4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
9.BG. | Alumovesuvianite | Ca19AlAl4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
9.BG. | Zoisite-(Pb) | (CaPb)(AlAlAl)O[Si2O7][SiO4](OH) |
9.BG. | Vielleaureite-(Ce) | (Mn2+Ce)(MgAlMn2+)F[Si2O7][SiO4](OH) |
9.BG. | Heflikite | (CaCa)(AlAlSc)O[Si2O7][SiO4](OH) |
9.BG.05b | Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05a | Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
9.BG.05b | Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
9.BG.05 | Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
9.BG.05a | Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
9.BG.05a | Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
9.BG.05 | Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
9.BG.05a | Mukhinite | (CaCa)(AlAlV3+)O[Si2O7][SiO4](OH) |
9.BG.05a | Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
9.BG.05 | Piemontite-(Sr) | (CaSr)(AlAlMn3+)O[Si2O7][SiO4](OH) |
9.BG.05b | Manganiandrosite-(La) | (Mn2+La)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Tweddillite | (CaSr)(Mn3+AlMn3+)O[Si2O7][SiO4](OH) |
9.BG.05b | Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Niigataite | (CaSr)(AlAlAl)O[Si2O7][SiO4](OH) |
9.BG.05 | Manganiandrosite-(Ce) | (Mn2+Ce)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Dissakisite-(La) | (CaLa)(AlAlMg)O[Si2O7][SiO4](OH) |
9.BG.05 | Vanadoandrosite-(Ce) | (Mn2+Ce)(V3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Uedaite-(Ce) | (Mn2+Ce)(AlAlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05a | Epidote-(Sr) | (CaSr)(AlAlFe3+)O[Si2O7][SiO4](OH) |
9.BG.05b | Allanite-(Nd) | (CaNd)(AlAlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
9.BG.05b | Unnamed (Mn3+-analogue of Ferriakasakaite-(Ce)) | (CaCe)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Ferriallanite-(La) | (CaLa)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Åskagenite-(Nd) | (Mn2+Nd)(AlAlFe3+)O[Si2O7][SiO4]O |
9.BG.05 | Piemontite-(Pb) | (CaPb)(AlAlMn3+)O[Si2O7][SiO4](OH) |
9.BG.05b | Vanadoallanite-(La) | (CaLa)(V3+AlFe2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Ferriandrosite-(La) | (Mn2+La)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05 | Androsite-(Ce) | (Mn2+Ce)(AlAlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05a v | Unnamed (Ga-analogue of Epidote) | (CaCa)(AlAlGa3+)O[Si2O7][SiO4](OH) |
9.BG.05b | UM1989-32-SiO:AlCaFeHREE | (Ca0.5◻0.5REE)(AlAlFe3+)O[Si2O7][SiO4](OH) |
9.BG.05b | Manganiakasakaite-(La) | (CaLa)(Mn3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.05b | Ferriakasakaite-(Ce) | (CaCe)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.9.BG. | Ferriakasakaite-(La) | (CaLa)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.9.BG. | Ferriandrosite-(Ce) | (Mn2+Ce)(Fe3+AlMn2+)O[Si2O7][SiO4](OH) |
9.BG.9.BG | Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
9.BG.15 | Macfallite | Ca2Mn3+3(SiO4)(Si2O7)(OH)3 |
9.BG.15 | Sursassite | Mn2+2Al3(SiO4)(Si2O7)(OH)3 |
9.BG.20 | Julgoldite-(Fe2+) | Ca2Fe2+Fe3+2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Okhotskite | Ca2Mn2+Mn3+2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Pumpellyite-(Fe3+) | Ca2Fe3+Al2[Si2O6OH][SiO4](OH)2O |
9.BG.20 | Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Pumpellyite-(Mn2+) | Ca2Mn2+Al2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Shuiskite-(Mg) | Ca2MgCr3+2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.20 | Julgoldite-(Fe3+) | Ca2Fe3+Fe3+2[Si2O6OH][SiO4](OH)2O |
9.BG.20 | Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
9.BG.20 | Poppiite | Ca2V3+V3+2[Si2O6OH][SiO4](OH)2O |
9.BG.20 | Julgoldite-(Mg) | Ca2MgFe3+2[Si2O6OH][SiO4](OH)2(OH) |
9.BG.25 | Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
9.BG.25 | Wayneburnhamite | Pb9Ca6(Si2O7)3(SiO4)3 |
9.BG.30 | Rustumite | Ca10(Si2O7)2(SiO4)(OH)2Cl2 |
9.BG.35 | Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
9.BG.35 | Wiluite | Ca19MgAl4(Al,Mg)8(B,◻)4◻[Si2O7]4[(SiO4)10]O(O,OH)9 |
9.BG.35 | Manganvesuvianite | Ca19Mn3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
9.BG.35 | Fluorvesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(F,OH)9 |
9.BG.35 | Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
9.BG.35 | Hongheite | Ca19Fe2+Al4(Fe3+,Mg)8(◻4)B[Si2O7]4[(SiO4)10]O(OH,O)9 |
9.BG.35 | Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
9.BG.35 | Manaevite-(Ce) | (Ca13Ce4[H2O]2)Mg(Al3Mg)(Mg3Ti3Fe3+2)(◻4)◻[Si2O7]4[(SiO4)8(H4O4)2]O(OH)9 |
9.BG.40 | Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
9.BG.45 | Dellaite | Ca6Si3O11(OH)2 |
9.BG.50 | Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
9.BG.50 | Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
9.BG.50 | Ferriperbøeite-(La) | CaLa3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
9.BG.50 | Perbøeite-(La) | CaLa3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
9.BG.55 | Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
9.BG.60 | Radekškodaite-(La) | (CaLa5)(Al4Fe2+)[Si2O7][SiO4]5O(OH)3 |
9.BG.60 | Radekškodaite-(Ce) | (CaCe5)(Al4Fe2+)[Si2O7][SiO4]5O(OH)3 |
Other Information
Health Risks:
No information on health risks for this material has been entered into the database. You should always treat mineral specimens with care.
Zoisite in petrology
An essential component of rock names highlighted in red, an accessory component in rock names highlighted in green.
Internet Links for Zoisite
mindat.org URL:
https://www.mindat.org/min-4430.html
Please feel free to link to this page.
Please feel free to link to this page.
Search Engines:
External Links:
Mineral Dealers:
References for Zoisite
Reference List:
Pawley, A. R., Redfern, Simon A. T., Holland, T. J. B. (1996) Volume behavior of hydrous minerals at high pressure and temperature; I, Thermal expansion of lawsonite, zoisite, clinozoisite, and diaspore. American Mineralogist, 81 (3). 335-340 doi:10.2138/am-1996-3-407
Armbruster, Thomas, Bonazzi, Paola, Akasaka, Masahide, Bermanec, Vladimir, Chopin, Christian, Gieré, Reto, Heuss-Assbichler, Soraya, Liebscher, Axel, Menchetti, Silvio, Pan, Yuanming, Pasero, Marco (2006) Recommended nomenclature of epidote-group minerals. European Journal of Mineralogy, 18 (5). 551-567 doi:10.1127/0935-1221/2006/0018-0551
Localities for Zoisite
Locality List
- This locality has map coordinates listed.
- This locality has estimated coordinates.
ⓘ - Click for references and further information on this occurrence.
? - Indicates mineral may be doubtful at this locality.
- Good crystals or important locality for species.
- World class for species or very significant.
(TL) - Type Locality for a valid mineral species.
(FRL) - First Recorded Locality for everything else (eg varieties).
Struck out - Mineral was erroneously reported from this locality.
Faded * - Never found at this locality but inferred to have existed at some point in the past (e.g. from pseudomorphs).
All localities listed without proper references should be considered as questionable.
All localities listed without proper references should be considered as questionable.
Afghanistan | |
Antarctica | |
| |
| |
Atlantic Ocean | |
| |
Australia | |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Austria | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
Belgium | |
| |
| |
Brazil | |
| |
| |
| |
| |
Bulgaria | |
| |
Canada | |
| |
| |
| |
| |
| personal correspondence with Giles Peatfield (see notes in description)Identification: Visual Identification |
| personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
Chile | |
| |
| |
| |
| |
China | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Colombia | |
| |
Czech Republic | |
| |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Czech Republic/Poland | |
[var: Thulite] | |
Ecuador | |
| |
| |
Egypt | |
| |
| |
| Fahmy, Wael, El-Desoky, Hatem M., Elyaseer, Mahmoud H., Ayonta Kenne, Patrick, Shirazi, Aref, Hezarkhani, Ardeshir, Shirazy, Adel, El-Awny, Hamada, Abdel-Rahman, Ahmed M., Khalil, Ahmed E., Eraky, Ahmed, Pour, Amin Beiranvand (2023) Remote Sensing, Petrological and Geochemical Data for Lithological Mapping in Wadi Kid, Southeast Sinai, Egypt. Minerals, 13 (9) doi:10.3390/min13091160 |
Finland | |
| [var: Thulite] |
| |
| |
| |
| |
France | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Germany | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Greece | |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
Greenland | |
| |
| |
| |
| |
Guatemala | |
| |
Hungary | |
| |
| |
| |
| |
| |
India | |
| |
| |
| |
| |
| |
| |
| |
Iran | |
| |
| |
Ireland | |
| |
Italy | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| [var: Thulite] |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
Jamaica | |
| |
Japan | |
| |
| |
| |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| [var: Thulite] |
Kazakhstan | |
| |
| |
| |
| |
| |
Kenya | |
| |
Madagascar | |
| [var: Thulite] |
| |
Mexico | |
| |
| |
| |
| |
| |
| |
Myanmar | |
| |
Namibia | |
| |
Nazca Plate | |
New Zealand | |
| |
| [var: Thulite] |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
North Korea | |
| |
North Macedonia | |
| |
Norway | |
| [var: Thulite] |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| [var: Thulite] |
| |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
| Kullerud, Kåre, Nasipuri, Pritam, Ravna, Erling J. K., Selbekk, Rune S. (2012) Formation of corundum megacrysts during H2O-saturated incongruent melting of feldspar: P–T pseudosection-based modelling from the Skattøra migmatite complex, North Norwegian Caledonides. Contributions to Mineralogy and Petrology, 164 (4). 627-641 doi:10.1007/s00410-012-0765-1 |
Janák, Marian, Uher, Pavel, Ravna, Erling Krogh, Kullerud, Kåre, Vrabec, Mirijam (2015) Chromium-rich kyanite, magnesiostaurolite and corundum in ultrahigh-pressure eclogites (examples from Pohorje Mountains, Slovenia and Tromsø Nappe, Norway). European Journal of Mineralogy, 27 (3). 377-392 doi:10.1127/ejm/2015/0027-2436 | |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| [var: Thulite] |
[var: Thulite] | |
| |
| [var: Thulite] |
[var: Thulite] | |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
Oman | |
| |
| |
Pacific Ocean | |
| |
| [var: Thulite] |
Pakistan | |
| |
| |
| |
| |
| |
Paraguay | |
| |
Peru | |
| |
Poland | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
Portugal | |
| |
| |
Romania | |
| |
| |
Russia | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Slovakia | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Slovenia | |
| |
Janák, Marian, Uher, Pavel, Ravna, Erling Krogh, Kullerud, Kåre, Vrabec, Mirijam (2015) Chromium-rich kyanite, magnesiostaurolite and corundum in ultrahigh-pressure eclogites (examples from Pohorje Mountains, Slovenia and Tromsø Nappe, Norway). European Journal of Mineralogy, 27 (3). 377-392 doi:10.1127/ejm/2015/0027-2436 | |
South Africa | |
| |
| |
| |
| |
| |
| |
| |
South Korea | |
| |
| |
Spain | |
| [var: Thulite] |
| |
| |
| |
| |
Sudan | |
| |
Sweden | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
Switzerland | |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
Taiwan | |
| |
| |
Tanzania | |
[var: Tanzanite] | |
| |
| [var: Tanzanite] |
[var: Tanzanite] | |
[var: Tanzanite] | |
[var: Tanzanite] | |
[var: Tanzanite] | |
[var: Tanzanite] | |
[var: Tanzanite] | |
| |
| [var: Tanzanite] |
Thailand | |
| |
Turkey | |
| |
Uganda | |
| |
UK | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
Ukraine | |
| |
USA | |
| |
| |
| |
| |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| [var: Thulite] |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| [var: Thulite] |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| |
| |
| |
[var: Thulite] | |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
[var: Thulite] | |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
| |
| [var: Thulite] |
| [var: Thulite] |
| [var: Thulite] |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
[var: Thulite] | |
| [var: Thulite] |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| |
| |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
[var: Thulite] | |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| [var: Thulite] |
[var: Thulite] | |
| [var: Thulite] |
[var: Thulite] | |
| |
| |
| |
| [var: Thulite] |
| |
| |
| |
| |
| |
[var: Thulite] | |
| |
| [var: Thulite] |
| |
| |
| [var: Thulite] |
| |
| |
Zambia | |
| |
Zimbabwe | |
| |
| |
| |
|
Quick NavTopAbout ZoisiteUnique IdentifiersIMA Classification Classification Mineral SymbolsPronunciation Physical Properties Optical Data Chemistry Chemical AnalysisCrystallography Crystallographic forms Crystal StructureX-Ray Powder DiffractionGeological EnvironmentType Occurrence SynonymsOther LanguagesVarietiesCommon AssociatesStrunz-MindatOther InformationZoisite in petrologyInternet Links References Localities Locality List
Merelani Hills, Lelatema Mountains, Simanjiro District, Manyara Region, Tanzania