Afghanistani
| Regional Level Types | |
|---|---|
| Afghanistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
652,230 km2
Neighbouring regions:
Type:
Mindat Locality ID:
14319
Long-form identifier:
mindat:1:2:14319:5
GUID (UUID V4):
98fe58c6-b9f0-458c-8640-179b746b508e
Other Languages:
Dari Persian:
افغانستان
Farsi/Persian:
افغانستان
French:
Afghanistan
German:
Afghanistan
Italian:
Afghanistan
Pashto:
افغانستان
Russian:
Афганистан
Simplified Chinese:
阿富汗
Spanish:
Afganistán
Achinese:
Afghanistan
Adyghe:
Афганистан
Afrikaans:
Afghanistan
Albanian:
Afganistani
Alemannic:
Afghanistan
Amharic:
አፍጋኒስታን
Anglo-Saxon:
Afghanistan
Arabic:
أفغانستان
Aragonese:
Afganistán
Armenian:
Աֆղանստան
Asturian:
Afganistán
Azeri:
Əfqanıstan
Bashkir:
Афғанстан
Basque:
Afganistan
Bavarian:
Afghanistan
Belarusian:
Афганістан
Belarusian (Tarashkevitsa):
Аўганістан
Bengali:
আফগানিস্তান
Bishnupriya Manipuri:
আফগানিস্তান
Bosnian:
Afganistan
Breton:
Afghanistan
Buginese:
Afghanistan
Bulgarian:
Афганистан
Burmese:
အာဖဂန်နစ္စတန်နိုင်ငံ
Catalan:
Afganistan
Cebuano:
Apganistan
Central Bikol:
Apganistan
Chamorro:
Afghanistan
Chechen:
ОвхӀан
Cherokee:
ᎠᏫᎨᏂᏍᏖᏂ
Cheyenne:
Afghanistan
Chuvash:
Афганистан
Cornish:
Afghanistan
Corsican:
Afghanistan
Crimean Tatar (Latin):
Afğanistan
Croatian:
Afganistan
Czech:
Afghánistán
Danish:
Afghanistan
Doteli:
अफगानिस्तान
Dutch:
Afghanistan
Dutch Low Saxon:
Afghanistan
Dzongkha:
ཨཕ་ག་ནིསི་ཏཱན་
Egyptian Arabic:
افغانستان
Erzya:
Афганистан Мастор
Esperanto:
Afganio
Estonian:
Afganistan
Extremaduran:
Afganistán
Faroese:
Afghanistan
Fiji Hindi:
Afghanistan
Finnish:
Afganistan
Franco-Provençal:
Afganistan
Friulian:
Afghanistan
Gagauz:
Afganistan
Galician:
Afganistán
Georgian:
ავღანეთი
Greek:
Αφγανιστάν
Greenlandic:
Afghanistan
Guarani:
Ahyganitã
Gujarati:
અફઘાનિસ્તાન
Haitian:
Afganistan
Hakka:
Afghanistan
Hausa:
Afghanistan
Hawaiian:
‘Apekanikana
Hebrew:
אפגניסטן
Hindi:
अफ़ग़ानिस्तान
Hungarian:
Afganisztán
Icelandic:
Afganistan
Ido:
Afganistan
Iloko:
Apganistan
Indonesian:
Afganistan
Ingush:
Афганистане
Interlingua:
Afghanistan
Irish Gaelic:
An Afganastáin
Jamaican Patois:
Afganistan
Japanese:
アフガニスタン
Javanese:
Afghanistan
Judaeo-Spanish:
Afganistan
Kabardian:
Афганистэн
Kabiye:
Afganistani
Kabyle:
Afɣanistan
Kalmyk:
Сарта Апганмудин Орн
Kannada:
ಅಫ್ಘಾನಿಸ್ತಾನ
Kapampangan:
Afganistan
Karachay-Balkar:
Афганистан
Karakalpak:
Afg'anstan
Kashubian:
Afganistón
Kazakh (Cyrillic Script):
Ауғанстан
Khmer:
សាធារណរដ្ឋឥស្លាមអាហ្វហ្កានីស្ថាន
Kikuyu:
Afghanistan
Kinyarwanda:
Afuganisitani
Komi:
Афганистан
Kongo:
Afghanistan
Konkani:
अफगाणिस्तान
Korean:
아프가니스탄
Kurdish (Latin Script):
Efxanistan
Kyrgyz:
Ооганстан
Latin:
Afgania
Latvian:
Afganistāna
Lezghian:
Афганистан
Ligurian:
Afghanistan
Limburgian:
Afghanistan
Lingala:
Afganistáni
Lithuanian:
Afganistanas
Livvi-Karelian:
Afganistuanu
Lojban:
afyganisTAN
Lombard:
Afghanistan
Low Saxon/Low German:
Afghanistan
Lower Sorbian:
Afghanistan
Luri:
ٱفغانستان
Luxembourgish:
Afghanistan
Macedonian:
Авганистан
Maithili:
अफगानिस्तान
Malagasy:
Afganistana
Malay:
Afghanistan
Malayalam:
അഫ്ഗാനിസ്താൻ
Maltese:
Afganistan
Manx:
Yn Afghanistaan
Maori:
Āwhekenetāna
Marathi:
अफगाणिस्तान
Mazanderani:
افغانستان
Meadow Mari:
Афганистан
Min Dong Chinese:
Afghanistan
Minangkabau:
Afganistan
Mingrelian:
ავღანეთი
Mirandese:
Afeganistan
Moksha:
Афганистан
Mongolian:
Афганистан
Nahuatl:
Afganistan
Nauruan:
Apeganitan
Nepali:
अफगानिस्तान
Newar / Nepal Bhasa:
अफगानिस्तान
Northern Frisian:
Afghanistan
Northern Sami:
Afganistan
Norwegian:
Afghanistan
Norwegian (Nynorsk):
Afghanistan
Novial:
Afganistan
Occitan:
Afganistan
Odia:
ଆଫଗାନିସ୍ତାନ
Ossetian:
Афгъанистан
Pali:
अफगानस्थान
Pangasinan:
Afghanistan
Papiamento:
Afganistán
Pennsylvania German:
Afganischtaan
Piedmontese:
Afgànistan
Polish:
Afganistan
Portuguese:
Afeganistão
Punjabi:
ਅਫ਼ਗ਼ਾਨਿਸਤਾਨ
Quechua:
Afgansuyu
Ripuarian:
Afghanistan
Romanian:
Afganistan
Romansh:
Afganistan
Russia Buriat:
Афганистан
Rusyn:
Афґаністан
Samoan:
Afakanisitana
Samogitian:
Afganėstans
Sanskrit:
अफगानिस्थानम्
Saterland Frisian:
Afghanistan
Scots:
Afghanistan
Scottish Gaelic:
Afganastan
Serbian:
Авганистан
Serbo-Croatian:
Afganistan
Shona:
Afghanistan
Sicilian:
Afganistàn
Silesian:
Afganistan
Sindhi:
افغانستان
Sinhalese:
ඇෆ්ගනිස්ථානය
Slovak:
Afganistan
Slovenian:
Afganistan
Somali:
Afgaanistan
South Azerbaijani:
افغانیستان
Sundanese:
Apganistan
Swahili:
Afghanistan
Swati:
I-Afugani
Swedish:
Afghanistan
Tagalog:
Afghanistan
Tajik (Cyrillic Script):
Афғонистон
Tamil:
ஆப்கானித்தான்
Tatar:
Әфганстан
Telugu:
ఆఫ్ఘనిస్తాన్
Tetum:
Afeganistaun
Thai:
ประเทศอัฟกานิสถาน
Tibetan (Standard):
ཨ་ཧྥུའུ་རྒན་སི་ཐན།
Tok Pisin:
Afghanistan
Traditional Chinese:
阿富汗
Tsonga:
Afghanistan
Tumbuka:
Afghanistan
Turkish:
Afganistan
Turkmen:
Owganystan
Udmurt:
Афганистан
Ukrainian:
Афганістан
Upper Sorbian:
Afghanistan
Urdu:
افغانستان
Uyghur:
ئافغانىستان
Uzbek (Latin Script):
Afgʻoniston
Venetian:
Afganistan
Veps:
Afganistan
Vietnamese:
Afghanistan
Volapük:
Lafganistän
Waray:
Afganistan
Welsh:
Affganistan
West Flemish:
Afghanistan
West Frisian:
Afganistan
Western Punjabi:
افغانستان
Wolof:
Afganistaan
Wu Chinese:
阿富汗
Yakut:
Афганистаан
Yiddish:
אפגאניסטאן
Yoruba:
Afghanístàn
Zazaki:
Efğanıstan
Zeelandic:
Afghanistan
Zhuang:
Afghanistan
Zulu:
I-Afganistani
Afghanistan has a complex geology - the oldest rocks are Archean, succeeded by rocks from the Proterozoic and every Phanerozoic system up to the present day.
The country also has a long and complicated tectonic history, partly related to its position at the western end of the Himalaya.
Historical mining concentrated mostly on precious stone production, with some of the oldest known mines in the world believed to have been established in Afghanistan to produce lapis lazuli for the Egyptian Pharaohs.
Exploration in the 1960s and 70s resulted in the discovery of metallic mineral resources, including copper, iron and gold, and non-metallic minerals, including halite, talc, and mica.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities194 valid minerals. 2 (TL) - type locality of valid minerals. 4 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: References: |
| ⓘ Afghanite (TL) Formula: (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 Localities: Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Badakhshan, Afghanistan Robate Payan, Kuran wa Munjan District, Badakhshan, Afghanistan Sar-e-Sang River, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Dar-e-Zu mine, Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Habit: terminated hexagonal prisms Colour: colourless, white, blue grey, blue Fluorescence: yellow. orange in LW References: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 73 localities in this region. |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) Localities: Reported from at least 20 localities in this region. References: |
| ⓘ Albite var. Low Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ 'Alkali amphibole' |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Alum Group' Formula: XAl(SO4)2 · 12H2O |
| ⓘ Amblygonite Formula: LiAl(PO4)F Localities: |
| ⓘ 'Amblygonite-Montebrasite Series' |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 References: |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Andradite var. Demantoid Formula: Ca3Fe3+2(SiO4)3 Localities: Description: Some specimens of pale green garnets from Ghazni Province have been sold as demantoid. Demantoid is a varietal name given to dark emerald green garnet, though. Unfortunately, there is no varietal name for light green andradite excepting the yellowish green topazolite. References: |
| ⓘ 'Andradite-Grossular Series' Localities: References: |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 Localities: Ruhabad Mine, Kandahar District, Kandahar, Afghanistan Malik Dukan Mine, Dishu District, Helmand, Afghanistan Tashkurghan Mine, Khulm District, Balkh, Afghanistan Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Unnamed meta-evaporite occurrence, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Ankerite var. Manganese-bearing Ankerite Formula: Ca(Fe2+,Mn,Mg)(CO3)2 |
| ⓘ Formula: Ca(Al2Si2O8) Locality: Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan - erroneously reported |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Asbestos' Localities: Reported from at least 20 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 30 localities in this region. |
| ⓘ 'Barkevikite' |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 23 localities in this region. |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F Localities: |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Localities: References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 67 localities in this region. Habit: Tabular hexagons Colour: blue to colourless Description: These were analysed by Federico Pezzotta in Milan and offered for sale by Rob Lavinsky:http://www.irocks.com/galleries/arkenstone-fine-minerals-vorobeyevite-rosterite-gilgit-pakistan. These are Cs rich beryls. References: |
| ⓘ Beryl var. Alkali-beryl Formula: Be3Al2(Si6O18) Localities: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Localities: Reported from at least 7 localities in this region. |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) Localities: Reported from at least 14 localities in this region. |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) Localities: References: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) Locality: Kunar, Afghanistan |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) Localities: Reported from at least 6 localities in this region. |
| ⓘ Beryllonite Formula: NaBePO4 Localities: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Boracite Formula: Mg3(B7O13)Cl |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 33 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Burbankite Formula: (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 40 localities in this region. |
| ⓘ Calcite var. Iceland Spar Formula: CaCO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Calkinsite-(Ce) Formula: (Ce,La)2(CO3)3 · 4H2O |
| ⓘ Cancrinite Formula: (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O Locality: Badakhshan, Afghanistan |
| ⓘ Carbocernaite Formula: (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 89 localities in this region. |
| ⓘ Celestine Formula: SrSO4 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Cerussite Formula: PbCO3 Localities: Syaghar Sn occurrence, Muqur District, Ghazni, Afghanistan Asad Kalay Zn-Pb-Cd deposit, Khakrez District, Kandahar, Afghanistan Darra-i-Nur Mine, Shah Wali Kot District, Kandahar, Afghanistan Pudar Cu-Bi occurrence, Adraskan District, Herat, Afghanistan Panjsher Valley slag deposits, Khenj District, Panjshir, Afghanistan |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 25 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 162 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ 'Childrenite-Eosphorite Series' |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 Description: Microprobed fragment: (Fe2+1.55Mg0.43Mn0.02)Σ=2(Al3.93Fe3+0.07)Σ=4Si2.00O10(OH)4 References: |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Localities: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Chrysoberyl Formula: BeAl2O4 Locality: Kokcha Valley, Badakhshan, Afghanistan |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 14 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cinnabar Formula: HgS Localities: Reported from at least 27 localities in this region. |
| ⓘ 'Clay minerals' Localities: Reported from at least 21 localities in this region. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 Localities: References: |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Kokcha Valley, Badakhshan, Afghanistan |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Reported from at least 6 localities in this region. |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ 'Columbite-Tantalite' Localities: Reported from at least 25 localities in this region. |
| ⓘ Colusite Formula: Cu13VAs3S16 Localities: Habit: Tetrahedra Colour: Bronze grey Fluorescence: none Description: Identified by Chris Stanley at the British museum.
This low Sn colusite is similar to Italian material from Carrara References: |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 Locality: Laghman, Afghanistan |
| ⓘ Copper Formula: Cu Localities: Reported from at least 6 localities in this region. |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Corundum Formula: Al2O3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Corundum var. Ruby Formula: Al2O3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Corundum var. Sapphire Formula: Al2O3 Localities: |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 27 localities in this region. |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 6 localities in this region. |
| ✪ Danburite Formula: CaB2Si2O8 Locality: Kokcha Valley, Badakhshan, Afghanistan |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 16 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Habit: trigonal prism Colour: blue Description: Ian Nicastro notes at https://www.mindat.org/forum.php?read,105,414229,414229,page=1#msg-414229 that "Dravite and Dravite-Uvite attributed to Koksha Valley are likely from Hazrat Saeed specifically, since multiple specimens attributed to Koksha Valley have turned up with both sapphire and blue dravite in the same mica matrix. And Hazrat Saeed appears to be the only Sapphire source in Koksha Valley." |
| ⓘ 'Dravite-Uvite Series' Habit: trigonal prism Colour: blue and green Description: Ian Nicastro notes at https://www.mindat.org/forum.php?read,105,414229,414229,page=1#msg-414229 that "Dravite and Dravite-Uvite attributed to Koksha Valley are likely from Hazrat Saeed specifically, since multiple specimens attributed to Koksha Valley have turned up with both sapphire and blue dravite in the same mica matrix. And Hazrat Saeed appears to be the only Sapphire source in Koksha Valley." |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O Localities: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Fayalite Formula: Fe2+2SiO4 |
| ⓘ 'Fayalite-Forsterite Series' Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Feldspar Group' Localities: References: |
| ⓘ 'Feldspathoid' |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 8 localities in this region. |
| ⓘ Fluor-dravite ? Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3F Locality: Kokcha Valley, Badakhshan, Afghanistan Description: Analyses by several different researchers (see discussion of the deep blue "fluor-dravite" composition at https://www.mindat.org/mesg-506047.html ) suggest little F is present in these samples, and so the tourmalines fall along the dravite/oxy-dravite/uvite nomenclature boundaries. Specific references with compositional data include: https://www.gia.edu/doc/Gems-Gemology-Winter-2016v4.pdf and https://www.rockptx.com/fkm-251-to-fkm-275/#FKM-268 . |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Fluornatromicrolite Formula: (Na1.5Bi0.5)Ta2O6F Localities: References: |
| ✪ Fluoro-richterite Formula: {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 Habit: Prismatic xls to a few cm Colour: white Fluorescence: none Description: A translucent white 'richterite' with purple hackmanite under Raman analysis gave a tiny Hydroxyl peak characteristic of Fluorine replacement making the 'richterite', fluororichterite |
| ⓘ 'Fluor-uvite-Uvite Series' Localities: References: |
| ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Forsterite Formula: Mg2SiO4 Localities: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 86 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 32 localities in this region. |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: References: |
| ⓘ Gold Formula: Au Localities: Reported from at least 53 localities in this region. |
| ⓘ Gonnardite Formula: (Na,Ca)2(Si,Al)5O10 · 3H2O Habit: Pseudomorphing Hauyne dodecs Colour: white Fluorescence: White in LW, MW & SW UV Description: This was initially called plagioclase, confirmed by EDS. The EDS pattern has the same 1:1 ratio of Al: Si as plagioclase and sodalite group minerals. Gonnardite can have this same EDS. The PXRD of Gonnardite is attached to the Marialite specimen it came from. |
| ⓘ Graphite Formula: C Localities: Reported from at least 8 localities in this region. |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: References: |
| ⓘ Grossular var. Hessonite Formula: Ca3Al2(SiO4)3 Locality: Ghazni, Afghanistan |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 30 localities in this region. |
| ⓘ 'Hackmanite' Formula: Na8Al6Si6O24(Cl2,S) Localities: Habit: Crude to sharp dodecahedra with trapezohedral modifications Colour: clear, white, grey, green, lilac, purple Fluorescence: In Long Wave UV: yellow orange, pink, white Description: These are some of the best Hackmanites ever found and show a variety of optical properties, such as darkening in the dark after bleaching in Yellow light, Reversible Photochromism (tenebrescence)with UV irradiation and yellow light. The grey sodalites contain significant K. References: |
| ⓘ Halite Formula: NaCl Localities: Reported from at least 20 localities in this region. |
| ⓘ Hambergite Formula: Be2(BO3)(OH) Localities: |
| ⓘ Haüyne Formula: Na3Ca(Si3Al3)O12(SO4) Localities: Reported from at least 6 localities in this region. Habit: Large dodecahedra to several cm Colour: Dark blue , blue, dark green, light green Fluorescence: Orangey brown in long-wave UV light. Description: The blue haüyne has a cell edge of 9.08 A (Fernando Camera, priv. comm. 2013) and the green one 9.05 A (Fernando Camera, priv. comm. 2010). Both have similar modulated structures.
A few dozen specimens of green haüyne were recovered. Dudley Blauwet (2008) has photos of the material in situ. Fewer darker green haüynes later emerged.
PXRD at the Royal Ontario museum gave Lazurite-C with gypsum for the early green material (Malcolm Back, priv. comm. 2009). Fernando Camara (2010) found it has a cubic cell edge of 9.05 A and a 45 A modulated structure.
A Raman analysis at the University of Arizona gave both haüyne and lazurite for the blue hauyne.
The problem is that no natural sulfide-dominant lazurite has ever been observed. Such material can be synthesized but is unstable. All 'lazurite' specimens is actually sulfate-dominant haüyne. The specious argument to call some PXRD-analyse samples lazurite stems from the observation that sulfide is smaller than sulfate and so haüynes with small unit cells should have more sulfide, but there is never enough to be sulfide dominant. Furthemore, contents of impurity elements such a K influence the cell parameter. |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 71 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ 'Hydrogoethite' Formula: 3Fe2O3 · 4H2O |
| ⓘ Hydroxylclinohumite Formula: Mg9(SiO4)4(OH)2 Localities: Habit: monoblinic prisms Colour: dark red Fluorescence: none Description: This material started life as erroneously labelled 'Chondrodite', then analysed as 'Clinohumite' more careful analysis http://rruff.info/hydroxylclinohumite/display=default/ gives Hydroxylclinohumite |
| ⓘ Hydroxylherderite Formula: CaBe(PO4)(OH) Localities: References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Bihsud District, Nangarhar, Afghanistan Dordang pegmatite field, Markazi Bihsud District, Wardak, Afghanistan Jawhar Cu deposit, Mohammad Agha District, Logar, Afghanistan Dara Alasang Cu-polymetallic deposit, Tala Wa Barfak District, Baghlan, Afghanistan Kandahar (Afghanistan) meteorite, Kandahar District, Kandahar, Afghanistan References: |
| ⓘ 'Indicolite' Formula: A(D3)G6(T6O18)(BO3)3X3Z Localities: References: |
| ⓘ Iron Formula: Fe |
| ⓘ Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Ishikawaite Formula: U4+Fe2+Nb2O8 Locality: Kunar, Afghanistan |
| ⓘ Isocubanite Formula: CuFe2S3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'K Feldspar' Localities: References: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Locality: Spin Ghar range, Nangarhar, Afghanistan |
| ⓘ Khanneshite (TL) Formula: (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 Type Locality: Description: In fine-grained carbonatite. |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Lazurite Formula: Na7Ca(Al6Si6O24)(SO4)(S3) · H2O Localities: Reported from at least 6 localities in this region. Habit: Rhombic dodecahedrons modified with cube and octahedral forms Colour: Ultramarine to midnight blue Fluorescence: none, Description: Since all 'lazurites' are sulfide rich hauynes, we restrict the name Lazurite to the blue mineral in Lapis Lazuli, which is opaque, non fluorescent, ultramarine to midnight blue with a bright blue streak |
| ⓘ 'Lepidolite' Localities: Reported from at least 14 localities in this region. |
| ⓘ Leucite Formula: K(AlSi2O6) Localities: |
| ⓘ 'Leucite phonolite' |
| ⓘ 'Limonite' Localities: Reported from at least 41 localities in this region. References: |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 Localities: |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 Localities: |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnesite Formula: MgCO3 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 73 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 91 localities in this region. |
| ⓘ Manganosite Formula: MnO |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Localities: Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Pitwak Mine, Sar-e-Sang River, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Sar-e-Sang River, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Dar-e-Zu mine, Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Unnamed meta-evaporite occurrence, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Habit: Simple tetragonal prism with pyramid and pinacoid Colour: Colourless transparent Fluorescence: pale yellow Description: A 7 cm crystal frozen in calcite was found on "the back side of the mountain containing Ladjuar Medan." (Dudley Blauwet private communication) References: |
| ⓘ 'Mckelveyite' |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Localities: References: |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 47 localities in this region. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Localities: |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Monticellite Formula: CaMgSiO4 Localities: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 56 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Locality: Panjshir, Afghanistan |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Hajigak baryte deposit, Hisa-i-Awali Bihsud District, Wardak, Afghanistan Jare Choqur Pb-Zn occurrence, Chaghcharan District, Ghor, Afghanistan Zerak Fe deposit, Hisa-i-Awali Bihsud District, Wardak, Afghanistan Hajigak Fe-Pb-Ag deposit, Hisa-i-Awali Bihsud District, Wardak, Afghanistan Zarkashan Au-Cu deposit, Muqur District, Ghazni, Afghanistan |
| ⓘ Nanpingite Formula: CsAl2(AlSi3O10)(OH,F)2 |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) Localities: Habit: Hexagonal prisms with small pyramids and large pinacoid Colour: grey white Fluorescence: none Description: The electric blue colour is from Nosean flecks in a clear sodalite coating the large nephelines References: |
| ⓘ Nosean Formula: Na8(Al6Si6O24)(SO4) · H2O Localities: Habit: Exsolution specs. Colour: electric blue Fluorescence: none Description: The x-rays suggest Nosean, Lazurite or Hauyne, but EDS shows the blue specs to be nosean (contains no Ca like Lazurite or Hauyne) These 0.1 micron specs are at the current limit of single xl XRD. The nosean is exsolved from a 100 micron layer of clear sodalite. This exsolution has been observed in synthetic materials (Van Peteghen et al 1963). This clear sodalite coats and is not in epitaxi with cm sized greasy grey nepheline xls. |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ Opal Formula: SiO2 · nH2O Localities: |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Habit: Excellent sharp scapolite xls altered to a cherty looking orthoclase Colour: off white with iron staining Description: Orthoclase (PXRD confirmed) pseudomorphs after excellent scapolite xls. The blue in these xls is either sodalite or lazurite References: |
| ⓘ 'Orthopyroxene Subgroup' |
| ✪ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Habit: Terminated prisms to several cm Colour: Brown Fluorescence: none Description: Frank Hawthorne identified this pargasite. Green "colour change lazurites" (green Hauyne) being replaced by zeolite occur with large pargasite xls. Thus the pargasite has been assigned to this locality. |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Penfieldite Formula: Pb2Cl3(OH) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: |
| ⓘ Petalite Formula: LiAl(Si4O10) Localities: |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Pezzottaite Formula: Cs(Be2Li)Al2(Si6O18) Localities: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Localities: Reported from at least 15 localities in this region. |
| ⓘ Potassic-fluoro-richterite ? Formula: {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 Description: A Rob Lavisnky specimen from "Kokcha Valley". Work done on these amphoiboles indicates that they are K and F rich richterites, but generally not meeting the criteria for potassic-richterite, fluoro-richterite or ptassic-fluoro-richterite. This does not preclude the occurrence of potassic-fluoro-richterite at Sar-e Sang. |
| ⓘ 'Psilomelane' |
| ⓘ Formula: Cu1.1Fe1.2S2 Locality: Khyber Limestone, Haska Meyna District, Nangarhar, Afghanistan - erroneously reported Description: The ID was done by X-ray powder diffraction and it probably represents a line collision with calcite. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 107 localities in this region. |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Localities: |
| ⓘ 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 15 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 150 localities in this region. Habit: Japan-law twin crystal habit. Description: Quartz(Japan-law twin) References: |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Onyx Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 Localities: References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: |
| ⓘ Richterite Formula: Na(NaCa)Mg5(Si8O22)(OH)2 Localities: Habit: Terminated prisms Colour: colourless to yellow brown Fluorescence: none Description: Initially identified as Winchite the gemmy yellow amphibole is Potassian Fluorian Richterite ( Frank Hawthorne Analysis) |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ 'Scapolite' Localities: Pitwak Mine, Sar-e-Sang River, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Ladjuar Medam, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Dara-e-Pech pegmatite field, Dara-e-Pech District, Kunar, Afghanistan Sar-e-Sang River, Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Sar-e-Sang, Kuran wa Munjan District, Badakhshan, Afghanistan Habit: Tetragonal Prisms , pyramidal faces, and pinacoid Colour: white grey, blue Fluorescence: bright yellow if any marialite left Description: Marialite is the only confirmed (PXRD) Scapolite from here. The surviving marialite is bright yellow under long wave UV. However, these scapolites are altering to Orthoclase which does not fluoresce. Some of these orthoclase pseudomorphs after scapolite are quite blue. Because this is from Sar-e-Sang, one immediately thinks this due to a blue feldspathoid. If this feldspathoid exists it is below the detection limits of PXRD and EDS. Apparently tiny Fe impurities can turn feldspar blue http://www.mindat.org/mesg-105-318134.html |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 26 localities in this region. |
| ⓘ Scheelite var. Molybdoscheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 15 localities in this region. |
| ⓘ Scorzalite Formula: Fe2+Al2(PO4)2(OH)2 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 31 localities in this region. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Silver Formula: Ag Localities: |
| ⓘ Skutterudite Formula: CoAs3 Localities: |
| ⓘ Smithsonite Formula: ZnCO3 Localities: |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl Localities: Reported from at least 10 localities in this region. Habit: Dodecahedra to 6 cm Colour: The colours range from colourless , to grey, to yellow, to green, to lilac, to purple. The colorless to lilac and purple are photochromic. Fluorescence: The best fluorescence is under long wave. The grey sodalite has the typical yellow disulfide fluorescence under long wave. Description: The largest and best sodalite xls to 5 cm were found here References: |
| ⓘ 'Sodalite Group' |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: References: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 63 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 Localities: |
| ⓘ Spodumene Formula: LiAlSi2O6 Localities: Reported from at least 64 localities in this region. Colour: green, blue, pink, yellow and colorless Description: Very large crystals has been found |
| ⓘ Formula: LiAlSi2O6 Locality: Laghman, Afghanistan - erroneously reported Habit: Large terminated prisms Colour: green Fluorescence: Pink in LW Description: These lovely green spodumenes are made by irradiation |
| ⓘ Spodumene var. Kunzite Formula: LiAlSi2O6 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: |
| ⓘ Stibiotantalite Formula: Sb(Ta,Nb)O4 Localities: References: |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Taenite Formula: (Fe,Ni) |
| ⓘ Tainiolite Formula: KLiMg2(Si4O10)F2 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ Tetraferriphlogopite Formula: KMg3(Fe3+Si3O10)(OH,F)2 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thénardite Formula: Na2SO4 |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O Habit: alteration product Colour: white Description: Apparently the alteration that produces green Hauynes has continued with the gonnardite to produce mixtures of Gonnardite and Thompsonite. This Thompsonite is only known from the PXRD of Gonnardite with green Hauyne |
| ⓘ 'Thorianite-Uraninite Series' Formula: ThO2 - UO2 Habit: Tiny cubes but usually mm sized grains Colour: Black Fluorescence: none Description: The black dots described in Crawford (2021) were EDXed as Uraninite dominant member of this series.
( https://www.mindat.org/mesg-609539.html )
|
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 39 localities in this region. |
| ⓘ 'Tourmaline var. Achroite' Formula: A(D3)G6(T6O18)(BO3)3X3Z References: |
| ⓘ 'Tourmaline var. Rubellite' Formula: A(D3)G6(T6O18)(BO3)3X3Z Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS |
| ⓘ Tungstibite Formula: Sb3+2WO6 |
| ⓘ Uraninite Formula: UO2 Localities: Habit: {100} Colour: black Fluorescence: no Description: Measured hardness is 5.5
Streak is dark gray
Gamma spectra done by Adolf Cortel: https://www.mindat.org/photo-1264230.html
|
| ⓘ 'Ursilite' Formula: (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| ⓘ Uvarovite Formula: Ca3Cr2(SiO4)3 Localities: |
| ⓘ Väyrynenite Formula: BeMn2+(PO4)(OH) |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Viitaniemiite Formula: Na(Ca,Mn2+)Al(PO4)(F,OH)3 Localities: References: |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Localities: |
| ⓘ Formula: ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 Localities: Habit: Terminated prisms Colour: Clourless to yellow brown Fluorescence: bobe Description: The Winchites are all Ricterite with some Potassium and Fluorine.
(Frank Hawthorne Analysis) |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wodginite Formula: Mn2+Sn4+Ta2O8 |
| ⓘ 'Wolframite Group' Localities: Adamkhel Sn-W deposit, Daychopan District, Zabul, Afghanistan Baytamur Sn-W occurrence, Daychopan District, Zabul, Afghanistan Maydan-Ahu W-Be-Sn deposit, Daychopan District, Zabul, Afghanistan Nili W occurrence, Nili District, Daykundi, Afghanistan Unnamed W occurrence [3], Miramor District, Daykundi, Afghanistan |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: |
| ⓘ Wurtzite Formula: (Zn,Fe)S Localities: Colour: orange Description: Some of these may be Rambergites as the analysed material was just shy of the 50/50 mark dividing Wurtzite and Rambergite. |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zircon Formula: Zr(SiO4) Localities: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Locality: Laghman, Afghanistan |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Iron var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | 1.AE.05 | Fe | |
| ⓘ | Taenite | 1.AE.10 | (Fe,Ni) |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Putoranite ? | 2.CB.10b | Cu1.1Fe1.2S2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Isocubanite | 2.CB.55b | CuFe2S3 |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Penfieldite | 3.DC.15 | Pb2Cl3(OH) |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | 'var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Manganosite | 4.AB.25 | MnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | 4.CB.05 | Al2O3 | |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Onyx | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ishikawaite | 4.DB.25 | U4+Fe2+Nb2O8 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Wodginite | 4.DB.40 | Mn2+Sn4+Ta2O8 |
| ⓘ | Tungstibite | 4.DE.15 | Sb3+2WO6 |
| ⓘ | Stibiotantalite | 4.DE.30 | Sb(Ta,Nb)O4 |
| ⓘ | Fluornatromicrolite | 4.DH.15 | (Na1.5Bi0.5)Ta2O6F |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | var. Iceland Spar | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Ankerite var. Manganese-bearing Ankerite | 5.AB.10 | Ca(Fe2+,Mn,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Carbocernaite | 5.AB.50 | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| ⓘ | Burbankite | 5.AC.30 | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| ⓘ | Khanneshite (TL) | 5.AC.30 | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Calkinsite-(Ce) | 5.CC.25 | (Ce,La)2(CO3)3 · 4H2O |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| Group 6 - Borates | |||
| ⓘ | Hambergite | 6.AB.05 | Be2(BO3)(OH) |
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| ⓘ | Boracite | 6.GA.05 | Mg3(B7O13)Cl |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | var. Molybdoscheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beryllonite | 8.AA.10 | NaBePO4 |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Väyrynenite | 8.BA.05 | BeMn2+(PO4)(OH) |
| ⓘ | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Scorzalite | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Viitaniemiite | 8.BL.15 | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | 'Ursilite' | 9.. | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Monticellite | 9.AC.10 | CaMgSiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andradite var. Demantoid | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | var. Hessonite | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Hydroxylclinohumite | 9.AF.55 | Mg9(SiO4)4(OH)2 |
| ⓘ | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | var. Alkali-beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Pezzottaite | 9.CJ.60 | Cs(Be2Li)Al2(Si6O18) |
| ⓘ | Fluor-dravite ? | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Spodumene var. Hiddenite ? | 9.DA.30 | LiAlSi2O6 |
| ⓘ | 9.DA.30 | LiAlSi2O6 | |
| ⓘ | var. Kunzite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(NaCa)Mg5(Si8O22)(OH)2 |
| ⓘ | Potassic-fluoro-richterite ? | 9.DE.20 | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| ⓘ | Fluoro-richterite | 9.DE.20 | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| ⓘ | Winchite ? | 9.DE.20 | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Tainiolite | 9.EC.15 | KLiMg2(Si4O10)F2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Nanpingite | 9.EC.15 | CsAl2(AlSi3O10)(OH,F)2 |
| ⓘ | Tetraferriphlogopite | 9.EC.20 | KMg3(Fe3+Si3O10)(OH,F)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Anorthite ? | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Low Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Cancrinite | 9.FB.05 | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| ⓘ | Afghanite (TL) | 9.FB.05 | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| ⓘ | Haüyne | 9.FB.10 | Na3Ca(Si3Al3)O12(SO4) |
| ⓘ | Nosean | 9.FB.10 | Na8(Al6Si6O24)(SO4) · H2O |
| ⓘ | Lazurite | 9.FB.10 | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| ⓘ | 'Hackmanite' | 9.FB.10 va | Na8Al6Si6O24(Cl2,S) |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Gonnardite | 9.GA.05 | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ | Leucite | 9.GB.05 | K(AlSi2O6) |
| Unclassified | |||
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Alkali amphibole' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Feldspathoid' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Alum Group' | - | XAl(SO4)2 · 12H2O |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Sodalite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Dravite-Uvite Series' | - | |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Hydrogoethite' | - | 3Fe2O3 · 4H2O |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Childrenite-Eosphorite Series' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Mckelveyite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Tourmaline var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Barkevikite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Tourmaline var. Achroite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Amblygonite-Montebrasite Series' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Thorianite-Uraninite Series' | - | ThO2 - UO2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Leucite phonolite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Calkinsite-(Ce) | (Ce,La)2(CO3)3 · 4H2O |
| H | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hambergite | Be2(BO3)(OH) |
| H | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| H | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Penfieldite | Pb2Cl3(OH) |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| H | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| H | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| H | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| H | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Li | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Li | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Alkali-beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryllonite | NaBePO4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Hambergite | Be2(BO3)(OH) |
| Be | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Be | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Boracite | Mg3(B7O13)Cl |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Hambergite | Be2(BO3)(OH) |
| B | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Calkinsite-(Ce) | (Ce,La)2(CO3)3 · 4H2O |
| C | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| C | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Iceland Spar | CaCO3 |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| C | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl var. Alkali-beryl | Be3Al2(Si6O18) |
| O | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beryllonite | NaBePO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Boracite | Mg3(B7O13)Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calkinsite-(Ce) | (Ce,La)2(CO3)3 · 4H2O |
| O | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| O | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| O | ⓘ Hambergite | Be2(BO3)(OH) |
| O | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| O | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| O | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Leucite | K(AlSi2O6) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monticellite | CaMgSiO4 |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Quartz var. Onyx | SiO2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Penfieldite | Pb2Cl3(OH) |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tungstibite | Sb23+WO6 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| O | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Calcite var. Iceland Spar | CaCO3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| O | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| O | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| O | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| O | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Albite var. Low Albite | Na(AlSi3O8) |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| O | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| O | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| F | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| F | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| F | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| F | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| F | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Beryllonite | NaBePO4 |
| Na | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| Na | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Na | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Na | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Na | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| Na | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Na | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Na | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Na | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Na | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Low Albite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Na | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Boracite | Mg3(B7O13)Cl |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Monticellite | CaMgSiO4 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Mg | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Mg | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Mg | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Mg | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| Mg | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| Mg | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl var. Alkali-beryl | Be3Al2(Si6O18) |
| Al | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| Al | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Al | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| Al | ⓘ Leucite | K(AlSi2O6) |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Albite var. Low Albite | Na(AlSi3O8) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl var. Alkali-beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| Si | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| Si | ⓘ Leucite | K(AlSi2O6) |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Monticellite | CaMgSiO4 |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Quartz var. Onyx | SiO2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Si | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Si | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| Si | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Albite var. Low Albite | Na(AlSi3O8) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Fluor-dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Beryllonite | NaBePO4 |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| P | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| S | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| S | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| S | ⓘ Isocubanite | CuFe2S3 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nosean | Na8(Al6Si6O24)(SO4) · H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Putoranite | Cu1.1Fe1.2S2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| Cl | Chlorine | |
| Cl | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Boracite | Mg3(B7O13)Cl |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Hackmanite | Na8Al6Si6O24(Cl2,S) |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Cl | ⓘ Penfieldite | Pb2Cl3(OH) |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leucite | K(AlSi2O6) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| K | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| K | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Afghanite | (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Ca | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Ca | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| Ca | ⓘ Lazurite | Na7Ca(Al6Si6O24)(SO4)(S3) · H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Monticellite | CaMgSiO4 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Richterite | Na(NaCa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Calcite var. Iceland Spar | CaCO3 |
| Ca | ⓘ Fluoro-richterite | {Na}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Ca | ⓘ Potassic-fluoro-richterite | {K}{CaNa}{Mg5}(Si8O22)(F,OH)2 |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| Ca | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Mn | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| Mn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Mn | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Andradite var. Demantoid | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Iron | Fe |
| Fe | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Fe | ⓘ Isocubanite | CuFe2S3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Putoranite | Cu1.1Fe1.2S2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Taenite | (Fe,Ni) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tetraferriphlogopite | KMg3(Fe3+Si3O10)(OH,F)2 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Ankerite var. Manganese-bearing Ankerite | Ca(Fe2+,Mn,Mg)(CO3)2 |
| Fe | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| Co | Cobalt | |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Taenite | (Fe,Ni) |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Isocubanite | CuFe2S3 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Putoranite | Cu1.1Fe1.2S2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| Sr | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| Sr | ⓘ Strontianite | SrCO3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tungstibite | Sb23+WO6 |
| Te | Tellurium | |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Cs | Caesium | |
| Cs | ⓘ Nanpingite | CsAl2(AlSi3O10)(OH,F)2 |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Cs | ⓘ Pezzottaite | Cs(Be2Li)Al2(Si6O18) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| Ba | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ba | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| Ba | ⓘ Witherite | BaCO3 |
| La | Lanthanum | |
| La | ⓘ Calkinsite-(Ce) | (Ce,La)2(CO3)3 · 4H2O |
| Ce | Cerium | |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Burbankite | (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 |
| Ce | ⓘ Calkinsite-(Ce) | (Ce,La)2(CO3)3 · 4H2O |
| Ce | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ce | ⓘ Khanneshite | (Na,Ca)3(Ba,Sr,Ce,Ca)3(CO3)5 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Ta | ⓘ Stibiotantalite | Sb(Ta,Nb)O4 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Ta | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstibite | Sb23+WO6 |
| W | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Metacinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Penfieldite | Pb2Cl3(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| U | Uranium | |
| U | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| U | ⓘ Ursilite | (Mg/Ca)4(UO2)4(Si2O5)5.5(OH)5 · 13H2O |
Geochronology
Mineralization age: Cenozoic : 5.332 Ma to 0 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Cenozoic | |||||||
| Quaternary | |||||||
| Pleistocene |
| ||||||
| Neogene | |||||||
| Pliocene |
| ||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Afghanistan |
|---|---|
| Wikidata ID: | Q889 |
| GeoNames ID: | 1149361 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Afghanistan
- Badakhshan
- Kokcha ValleyValley
- Nangarhar
- Spin Ghar rangeMountain Range
Asia
- Hindukush Himalayan RegionGroup of Mountain Ranges
- Pamir MountainsMountain Range
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Orris, G.J., Bliss, J.D. (2002) Mine and mineral occurrences of Afghanistan. Open-File Report 2002-110. US Geological Survey doi:10.3133/ofr02110
Ahmadi, Hemayatullah, Hussaini, Mohammad Reza, Yousufi, Atal, Bekbotayeva, Alma, Baisalova, Akmaral, Amralinova, Bakytzhan, Mataibayeva, Indira, Rahmani, Abdul Baqi, Pekkan, Emrah, Sahak, Naqibullah (2023) Geospatial Insights into Ophiolitic Complexes in the Cimmerian Realm of the Afghan Central Block (Middle Afghanistan) Minerals, 13 (11) doi:10.3390/min13111453
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Afghanistan