Saskatchewan, Canadai
| Regional Level Types | |
|---|---|
| Saskatchewan | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Saskatoon | 198,958 (2016) |
| Regina | 176,183 (2010) |
| Prince Albert | 34,609 (2008) |
| Moose Jaw | 32,166 (2013) |
| North Battleford | 19,440 (2013) |
| Yorkton | 15,669 (2013) |
Mindat Locality ID:
620
Long-form identifier:
mindat:1:2:620:1
GUID (UUID V4):
d287f83d-d463-42a5-814f-e74adb4a6dbd
Other Languages:
French:
Saskatchewan, Canada
German:
Saskatchewan, Kanada
Italian:
Saskatchewan, Canada
Russian:
Саскачеван, Канада
Simplified Chinese:
薩斯喀徹溫省, 加拿大
Spanish:
Saskatchewan, Canadá
Afrikaans:
Saskatchewan, Kanada
Albanian:
Saskatchewan, Kanadaja
Amharic:
ሰስካቸወን, ካናዳ
Anglo-Saxon:
Sascatcewan, Cænada
Arabic:
ساسكاتشوان, كندا
Armenian:
Սասկաչևան, Կանադա
Asturian:
Saskatchewan, Canadá
Azeri:
Saskaçevan, Kanada
Basque:
Saskatchewan, Kanada
Belarusian:
Саскачэван, Канада
Belarusian (Tarashkevitsa):
Саскачэван, Канада
Bengali:
সাসক্যাচুয়ান, কানাডা
Bosnian:
Saskatchewan, Kanada
Breton:
Saskatchewan, Kanada
Bulgarian:
Саскачеван, Канада
Burmese:
ဆက်စကက်ချီဝမ်နယ်, ကနေဒါနိုင်ငံ
Catalan:
Saskatchewan, Canadà
Cebuano:
Saskatchewan, Canada
Cornish:
Saskatchewan, Kanada
Corsican:
Saskatchewan, Canadà
Croatian:
Saskatchewan, Kanada
Czech:
Saskatchewan, Kanada
Danish:
Saskatchewan, Canada
Dutch:
Saskatchewan, Canada
Egyptian Arabic:
ساسكاتشوان, كندا
Esperanto:
Saskaĉevano, Kanado
Estonian:
Saskatchewani provints, Kanada
Faroese:
Saskatchewan, Kanada
Farsi/Persian:
ساسکاچوان, کانادا
Finnish:
Saskatchewan, Kanada
Galician:
Saskatchewan, Canadá
Georgian:
სასკაჩევანი, კანადა
Greek:
Σασκάτσουαν, Καναδάς
Greenlandic:
Saskatchewan, Canada
Hakka:
Saskatchewan-sén, Kâ-nâ-thai
Hebrew:
ססקצ'ואן, קנדה
Hindi:
सस्कैचवन, कनाडा
Hungarian:
Saskatchewan, Kanada
Icelandic:
Saskatchewan, Kanada
Ido:
Saskatchewan, Kanada
Indonesian:
Saskatchewan, Kanada
Irish Gaelic:
Saskatchewan, Ceanada
Japanese:
サスカチュワン州, カナダ
Judaeo-Spanish:
Saskatchewan, Kanada
Kabyle:
Saskatchewan, Kanada
Kapampangan:
Saskatchewan, Canada
Korean:
서스캐처원주, 캐나다
Latin:
Saskatchewan, Canada
Latvian:
Saskačevana, Kanāda
Ligurian:
Saskatchewan, Canada
Lithuanian:
Saskačevanas, Kanada
Luxembourgish:
Saskatchewan, Kanada
Macedonian:
Саскачеван, Канада
Malay:
Saskatchewan, Kanada
Manx:
Saskatchewan, Yn Chanadey
Marathi:
सास्काचेवान, कॅनडा
Min Dong Chinese:
Saskatchewan, Gă-nā-dâi
Mingrelian:
სასკაჩევანი, კანადა
Mongolian:
Саскачеван, Канад
Northern Frisian:
Saskatchewan, Kanada
Norwegian:
Saskatchewan, Canada
Norwegian (Nynorsk):
Saskatchewan, Canada
Occitan:
Saskatchewan, Canadà
Ossetian:
Саскачеван, Канадæ
Papiamento:
Saskatchewan, Canada
Piedmontese:
Saskatchewan, Canadà
Polish:
Saskatchewan, Kanada
Portuguese:
Saskatchewan, Canadá
Punjabi:
ਸਸਕਾਚਵਾਨ, ਕੈਨੇਡਾ
Quechua:
Saskatchewan pruwinsya, Kanada
Romanian:
Saskatchewan, Canada
Russia Buriat:
Саскачеван, Канада
Samogitian:
Saskačevans, Kanada
Sardinian:
Saskatchewan, Canada
Scots:
Saskatchewan, Canadae
Scottish Gaelic:
Saskatchewan, Canada
Serbian:
Саскачеван, Канада
Serbo-Croatian:
Saskatchewan, Kanada
Slovak:
Saskatchewan, Kanada
Slovenian:
Saskatchewan, Kanada
Swahili:
Saskatchewan, Kanada
Swedish:
Saskatchewan, Kanada
Tagalog:
Saskatchewan, Canada
Tamil:
சஸ்காச்சுவான், கனடா
Thai:
รัฐซัสแคตเชวัน, แคนาดา
Traditional Chinese:
沙斯卡寸旺, 加拿大
Turkish:
Saskatchewan, Kanada
Ukrainian:
Саскачеван, Канада
Urdu:
ساسکچیوان, کینیڈا
Uyghur:
Saskachéwan, كانادا
Uzbek (Latin Script):
Saskachevan, Kanada
Venetian:
Saskatchewan, Canada
Vietnamese:
Saskatchewan, Canada
Volapük:
Saskatchewan, Kanadän
Walloon:
Sascatchewane, Canada
Waray:
Saskatchewan, Kanada
Welsh:
Saskatchewan, Canada
West Frisian:
Saskatchewan, Kanada
Western Punjabi:
ساسکاچیوان, کینیڈا
Wu Chinese:
萨斯喀彻温省, 加拿大
Yakut:
Саскачеван, Канаада
Yiddish:
סאסקאטשעווען, קאנאדע
Zazaki:
Saskatchewan, Kanada
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities280 valid minerals. 5 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 23 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: Description: Vermiform, with Na-depressed cpx, in clinopyroxenites. References: |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 Description: Ribbons with quartz in felsic gneisses. |
| ⓘ 'Alkali Feldspar' |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Description: In felsic gneisses. References: |
| ⓘ Altaite Formula: PbTe Localities: References: |
| ⓘ 'Alum Group' Formula: XAl(SO4)2 · 12H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ 'Alunite Supergroup' Formula: AD3(XO4)2(OH)6 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Anatase Formula: TiO2 Localities: References: |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Andesine-oligoclase' Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Anhydrite Formula: CaSO4 Localities: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Localities: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Localities: Description: In clinopyroxenites. References: |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] Localities: Description: In clinopyroxenites. References: |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Apatite var. Carbonate-rich Apatite' Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ 'Apatite Group' |
| ⓘ Aragonite Formula: CaCO3 Localities: |
| ⓘ Arcanite Formula: K2SO4 |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Arsenoflorencite-(Ce) Formula: CeAl3(AsO4)2(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: References: |
| ⓘ Artinite Formula: Mg2(CO3)(OH)2 · 3H2O |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Athabascaite (TL) Formula: Cu5Se4 Localities: Description: Occurs as inclusions and replacements of umangite and as stringers in carbonate vein material. The mineral is found as lath-shaped grains up to 100μm by 40μm. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Augite var. Fassaite Formula: (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] Description: In clinopyroxenites. |
| ⓘ Augite var. Soda-Augite Description: Associated with labradorite (retrograde after Na-cpx), in clinopyroxenites. |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| ⓘ Baryte Formula: BaSO4 Localities: References: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ Becquerelite Formula: Ca(UO2)6O4(OH)6 · 8H2O Localities: |
| ⓘ Benstonite Formula: Ba6Ca6Mg(CO3)13 |
| ⓘ Berzelianite Formula: Cu2-xSe (x ≈ 0.12) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 18 localities in this region. References: |
| ⓘ Bischofite Formula: MgCl2 · 6H2O |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutohauchecornite Formula: Ni9Bi2S8 Description: Originally reported by Watkinson et al. as Hauchecornitem 5 years before Bismutohauchecornite was defined. Watkinson et al's analysis is given under Bismutohauchecornite in the Handbook of Mineralogy, Vol 1, p 57. |
| ⓘ Blödite Formula: Na2Mg(SO4)2 · 4H2O Localities: |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ Bornhardtite Formula: Co2+Co3+2Se4 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Boussingaultite Formula: (NH4)2Mg(SO4)2 · 6H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Bradleyite Formula: Na3Mg(CO3)(PO4) |
| ⓘ Brannerite Formula: UTi2O6 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: |
| ⓘ Burkeite Formula: Na6(CO3)(SO4)2 Localities: |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 49 localities in this region. References: |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Carnallite Formula: KMgCl3 · 6H2O Localities: |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O Localities: References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O Localities: Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Hal Lake Selenium Occurrence No. 1, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 52 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Localities: |
| ⓘ 'Chevkinite Group' |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Description: In felsic gneisses, with exsolution needles of monazite. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 51 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: |
| ⓘ Clausthalite Formula: PbSe Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ 'Clinochalcomenite' Formula: CuSeO3 · 2H2O |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Cigar Lake Mine, Athabasca Basin, Saskatchewan, Canada Pine Channel Ni/Cu Anomaly, Honsvall Lake, Athabasca Basin, Saskatchewan, Canada Fish Hook Bay property, Black Bay Uranium Mines, Beaverlodge Lake area, Saskatchewan, Canada Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Roughrider deposit, Athabasca Basin, Saskatchewan, Canada |
| ⓘ Coffinite Formula: U(SiO4) · nH2O Localities: Reported from at least 17 localities in this region. |
| ⓘ Copper Formula: Cu Localities: Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Birch Lake Mine, Amisk Lake District, Saskatchewan, Canada Anglo-Rouyn Mine, Lac la Ronge, Saskatchewan, Canada Nemeiben Lake deposit, Lac la Ronge, Saskatchewan, Canada Laird Island Uranium Occurrences 1 2 & 3, Laird Island, Tazin Lake, Saskatchewan, Canada References: |
| ⓘ 'Copper Stain' |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: Reported from at least 10 localities in this region. |
| ⓘ Corundum Formula: Al2O3 Localities: Description: In clinopyroxenites.
In felsic gneisses : Lavender to violet crystals (up to 1-2 cm), replaced by garnet, or inclusions in garnets. Cr2O3 up to 1.02 wt%.
References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 11 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Localities: |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Crookesite Formula: Cu7(Tl, Ag)Se4 |
| ⓘ Cubanite Formula: CuFe2S3 Localities: |
| ⓘ Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ Cuprosklodowskite Formula: Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ D'Ansite Formula: Na21Mg(SO4)10Cl3 Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Dawsonite Formula: NaAlCO3(OH)2 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Despujolsite Formula: Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: |
| ⓘ Diamond Formula: C Locality: Fort à la Corne, Saskatchewan, Canada |
| ⓘ Diaspore Formula: AlO(OH) Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Digenite Formula: Cu9S5 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 9 localities in this region. |
| ⓘ Dypingite Formula: Mg5(CO3)4(OH)2 · 5H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Localities: |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: |
| ⓘ Eskebornite Formula: CuFeSe2 Localities: |
| ⓘ Eucairite Formula: AgCuSe Localities: |
| ⓘ Eugsterite Formula: Na4Ca(SO4)3 · 2H2O |
| ⓘ Fairchildite Formula: K2Ca(CO3)2 |
| ⓘ Farringtonite (TL) Formula: Mg3(PO4)2 Type Locality: |
| ⓘ 'Fayalite-Forsterite Series' Localities: References: |
| ⓘ 'Feldspar Group' Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Description: Orthoclase network in oligoclase host, in felsic gneisses. |
| ⓘ 'Fergusonite' |
| ⓘ Ferro-edenite Formula: NaCa2Fe2+5(Si7Al)O22(OH)2 Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Ferro-pargasite Formula: NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Ferrosilite Formula: Fe2+2Si2O6 Locality: Foster River, Saskatchewan, Canada |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 Localities: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Foggite Formula: CaAl(PO4)(OH)2 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Forsterite Formula: Mg2SiO4 Localities: |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ Freboldite Formula: CoSe |
| ⓘ Froodite Formula: α-PdBi2 |
| ⓘ Gahnite Formula: ZnAl2O4 Localities: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 35 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 15 localities in this region. References: |
| ⓘ Gaylussite Formula: Na2Ca(CO3)2 · 5H2O |
| ⓘ 'Geikielite-Ilmenite Series' Description: Inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. |
| ⓘ Gersdorffite Formula: NiAsS Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Glass' |
| ⓘ Glauberite Formula: Na2Ca(SO4)2 Localities: References: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ 'Glimmerite' Locality: Alces Lake, Saskatchewan, Canada |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Gold Formula: Au Localities: Reported from at least 21 localities in this region. References: |
| ⓘ Gold var. Electrum Formula: (Au,Ag) Localities: |
| ⓘ Görgeyite Formula: K2Ca5(SO4)6 · H2O |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 Localities: |
| ⓘ Graphite Formula: C Localities: Reported from at least 23 localities in this region. |
| ⓘ Guanajuatite Formula: Bi2Se3 |
| ⓘ Gudmundite Formula: FeSbS |
| ⓘ 'Gummite' Localities: Eldorado Mine (Beaverlodge Mine; Beaverlodge Operation), Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada National Explorations mine, Beaverlodge Lake area, Saskatchewan, Canada Smitty mine, Rix-Athabasca Uranium mines, Beaverlodge Lake area, Saskatchewan, Canada McArthur River Mine, Athabasca Basin, Saskatchewan, Canada Rix Mine, Rix-Athabasca Uranium mines, Beaverlodge Lake area, Saskatchewan, Canada References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Haiweeite Formula: Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| ⓘ Halite Formula: NaCl Localities: Reported from at least 8 localities in this region. Habit: massive, cleavages Colour: colourless, white, grey, blue References: |
| ⓘ Hanksite Formula: Na22K(SO4)9(CO3)2Cl |
| ⓘ Hannebachite Formula: CaSO3 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Formula: Ni9BiSbS8 Locality: Zimmer Lake area, Athabasca Basin, Saskatchewan, Canada - erroneously reported Description: Watkinson et al published Hauchecornite in 1975, 5 years before Bismutohauchecornite was defined in 1980. Watkinson's 1975 analysis was reported in the Handbook of Mineralogy, vol 1, pg 57 under Bismutohauchecornite |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Locality: Foster River, Saskatchewan, Canada |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 56 localities in this region. References: |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: References: |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Huntite Formula: CaMg3(CO3)4 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Hydroglauberite Formula: Na10Ca3(SO4)8 · 6H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Hydrohalite Formula: NaCl · 2H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ikaite Formula: CaCO3 · 6H2O Locality: Manito Lake, Saskatchewan, Canada |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Inderborite Formula: CaMg(H3B3O7)2 · 8H2O |
| ⓘ Iron Formula: Fe Localities: |
| ⓘ Iron var. Kamacite Formula: (Fe,Ni) Localities: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: |
| ⓘ Jolliffeite (TL) Formula: NiAsSe Type Locality: |
| ⓘ Jordisite Formula: MoS2 Localities: |
| ⓘ Kainite Formula: KMg(SO4)Cl · 3H2O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O Localities: Eldorado Mine (Beaverlodge Mine; Beaverlodge Operation), Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Lee (Jahala) Lake occurrence, Lac la Ronge, Saskatchewan, Canada Nicholson No. 1 ("No. 1 zone extension" vein), Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada References: |
| ⓘ 'K Feldspar' Localities: Reported from at least 10 localities in this region. Description: Inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. References: |
| ⓘ Kieserite Formula: MgSO4 · H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Klockmannite Formula: CuSe Localities: Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Pinky Fault Uranium Deposit, Saskatchewan, Canada Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Formula: Na4Mg9Al4Cl12(OH)22 Locality: Esterhazy Potash Mines, Esterhazy, Saskatchewan, Canada - erroneously reported |
| ⓘ Korshunovskite Formula: Mg2Cl(OH)3 · 4H2O |
| ⓘ Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Krausite Formula: KFe(SO4)2 · H2O |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O Description: In clinopyroxenites.
In felsic needles : Deep blue to green crystals, with Cr2O3 up to 2.21 wt%. |
| ⓘ Lechatelierite Formula: SiO2 Locality: Lake Athabasca, Saskatchewan, Canada |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ 'Lepidolite' |
| ⓘ 'Leucoxene' |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ 'Limonite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Löllingite Formula: FeAs2 Localities: |
| ⓘ Magnesio-foitite Formula: ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| ⓘ Magnesite Formula: MgCO3 Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 24 localities in this region. References: |
| ⓘ Majorite Formula: Mg3(MgSi)(SiO4)3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Masuyite Formula: Pb(UO2)3O3(OH)2 · 3H2O Localities: |
| ⓘ Maucherite Formula: Ni11As8 Localities: |
| ⓘ Mercallite Formula: KHSO4 |
| ⓘ Merrillite Formula: Ca9NaMg(PO4)7 |
| ⓘ Mertieite ? Formula: Pd8Sb2.5As0.5 |
| ⓘ Meta-aluminite Formula: Al2(SO4)(OH)4 · 5H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Metanováčekite Formula: Mg(UO2)2(AsO4)2 · 8H2O |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ 'Meteoritic Iron' |
| ⓘ Michenerite Formula: PdBiTe Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) Localities: |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] Localities: |
| ⓘ Millerite Formula: NiS Localities: |
| ⓘ Mirabilite Formula: Na2SO4 · 10H2O Localities: Description: Occurs in alkaline lakes in the western portions of the Province. |
| ⓘ Mohrite Formula: (NH4)2Fe(SO4)2 · 6H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Molybdomenite Formula: PbSeO3 Localities: |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: Reported from at least 14 localities in this region. Description: In felsic gneisses : High-Th inclusions in garnets . References: |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 30 localities in this region. Description: High-Ti (around 4 wt% TiO2) muscovite, associated with graphite and ilmenite-geikielite series, in felsic gneisses. References: |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Nahcolite Formula: NaHCO3 Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Natron Formula: Na2CO3 · 10H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Nickeline Formula: NiAs Localities: Reported from at least 7 localities in this region. |
| ⓘ Niter Formula: KNO3 |
| ⓘ Nitratine Formula: NaNO3 |
| ⓘ Nitrobarite Formula: Ba(NO3)2 |
| ⓘ Nolanite (TL) Formula: V3+8Fe3+2O14(OH)2 Localities: Ace deposit, Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Pitche Group, Beaverlodge Lake area, Saskatchewan, Canada Fish Hook Bay property, Black Bay Uranium Mines, Beaverlodge Lake area, Saskatchewan, Canada Type Locality: Ace deposit, Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada References: |
| ⓘ Nordstrandite Formula: Al(OH)3 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Northupite Formula: Na3Mg(CO3)2Cl Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Olsacherite Formula: Pb2(Se6+O4)(SO4) |
| ⓘ Oosterboschite Formula: (Pd,Cu)7Se5 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Oxy-dravite Formula: Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| ⓘ Oxy-schorl Formula: Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Paraguanajuatite Formula: Bi2Se3 |
| ⓘ Pararammelsbergite Formula: NiAs2 Localities: References: |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Localities: Description: Retrograde phase in clinopyroxenites. References: |
| ⓘ Pentahydrite Formula: MgSO4 · 5H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: References: |
| ⓘ Perrierite-(Ce) Formula: Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Description: In felsic gneisses : Inclusions in garnets, with rutile and ilmenite exsolutions ; replaced by K-feldspar+Zn/Cr-spinel symplectites ; retrograde, associated with sillimanite/quartz intergrowths, on kyanite or garnet. References: |
| ⓘ 'Pinite' |
| ⓘ Pirssonite Formula: Na2Ca(CO3)2 · 2H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 12 localities in this region. Description: In felsic gneisses : Retrograde aroud garnet or kyanite. References: |
| ⓘ 'Plessite' |
| ⓘ Polyhalite Formula: K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ 'Protodolomite' Formula: (Ca,Mg)CO3 Localities: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 67 localities in this region. References: |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Pyrobitumen' Localities: |
| ⓘ 'Pyrobitumen var. Thucholite' Localities: |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Description: Originally identified as a betafite, but no mention was made of the homegeneity of the sample. |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Description: Replaced by spinel+plagioclase+opx kelyphites, in clinopyroxenites. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 24 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 66 localities in this region. References: |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Blue Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 Localities: |
| ⓘ Rapidcreekite Formula: Ca2(SO4)(CO3) · 4H2O |
| ⓘ Retgersite Formula: NiSO4 · 6H2O |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Ringwoodite Formula: (Mg,Fe2+)2SiO4 |
| ⓘ Rutherfordine Formula: (UO2)CO3 Localities: References: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 8 localities in this region. Description: Exsolution needles in garnets, in clinopyroxenites.
High-Fe exsolution needles in garnets, in felsic gneisses.
Crystals with zircon exsolution needles in felsic gneisses (upper mantle origin). References: |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Description: In felsic gneisses. |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] Description: At the clinopyroxenites/gneisses contacts. |
| ⓘ 'Scapolite' Localities: |
| ⓘ Scarbroite Formula: Al5(CO3)(OH)13 · 5H2O Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Scheelite Formula: Ca(WO4) Localities: References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Selenium Formula: Se Localities: References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Silver Formula: Ag Localities: Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Fish Hook Bay property, Black Bay Uranium Mines, Beaverlodge Lake area, Saskatchewan, Canada Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Nemeiben Lake deposit, Lac la Ronge, Saskatchewan, Canada Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada References: |
| ⓘ Sklodowskite Formula: Mg(UO2)2(SiO3OH)2 · 6H2O Localities: |
| ⓘ Skutterudite Formula: CoAs3 Localities: |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Localities: |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Sperrylite Formula: PtAs2 Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 32 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 Description: In clinopyroxenites.
In felsic gneisses : green to grey-brown, rich in Zn, Cr, V. |
| ⓘ Stanfieldite Formula: Ca4Mg5(PO4)6 |
| ⓘ Starkeyite Formula: MgSO4 · 4H2O |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Sudoite Formula: Mg2Al3(Si3Al)O10)(OH)8 Localities: Reported from at least 9 localities in this region. |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 Localities: |
| ⓘ Sylvite Formula: KCl Localities: Habit: massive, cleavages Colour: milky white, pink, light orange References: |
| ⓘ Syngenite Formula: K2Ca(SO4)2 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Taenite Formula: (Fe,Ni) Localities: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tellurium Formula: Te |
| ⓘ Tellurobismuthite Formula: Bi2Te3 Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Tetradymite Formula: Bi2Te2S Localities: References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: |
| ⓘ Thénardite Formula: Na2SO4 Localities: |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Uranothorite Formula: (Th,U)SiO4 |
| ⓘ Tiemannite Formula: HgSe Localities: |
| ⓘ Tin Formula: Sn |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 12 localities in this region. |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 9 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| ⓘ Troilite Formula: FeS |
| ⓘ Trona Formula: Na3H(CO3)2 · 2H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Tychite Formula: Na6Mg2(CO3)4(SO4) |
| ⓘ Tyrrellite (TL) Formula: Cu(Co3+,Ni3+)2Se4 Localities: Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Hal Lake Selenium Occurrence No. 1, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O Localities: References: |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 Locality: Fort à la Corne, Saskatchewan, Canada |
| ⓘ 'UM1978-10-O:U' Formula: U3O7 |
| ⓘ 'UM1991-19-Se:AsCo' Formula: (Co,Ni)AsSe |
| ⓘ Umangite Formula: Cu3Se2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 54 localities in this region. References: |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Localities: Reported from at least 34 localities in this region. |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: Reported from at least 14 localities in this region. |
| ⓘ Uranopilite Formula: (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Vandendriesscheite Formula: PbU7O22 · 12H2O |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Localities: |
| ⓘ Wattevilleite Formula: Na2Ca(SO4)2 · 4H2O (?) |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) |
| ⓘ Woodhouseite Formula: CaAl3(PO4)(SO4)(OH)6 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ 'Xenotime' Localities: |
| ⓘ Zemkorite Formula: Na2Ca(CO3)2 |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Tin | 1.AC.10 | Sn |
| ⓘ | Iron var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | 1.AE.05 | Fe | |
| ⓘ | Taenite | 1.AE.10 | (Fe,Ni) |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Tellurium | 1.CC.10 | Te |
| ⓘ | Selenium | 1.CC.10 | Se |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Mertieite ? | 2.AC.10b | Pd8Sb2.5As0.5 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Froodite | 2.AC.45a | α-PdBi2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Athabascaite (TL) | 2.BA.25 | Cu5Se4 |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Bismutohauchecornite | 2.BB.10 | Ni9Bi2S8 |
| ⓘ | Hauchecornite ? | 2.BB.10 | Ni9BiSbS8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Oosterboschite | 2.BC.10 | (Pd,Cu)7Se5 |
| ⓘ | Crookesite | 2.BD.50 | Cu7(Tl, Ag)Se4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Eskebornite | 2.CB.10a | CuFeSe2 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Freboldite | 2.CC.05 | CoSe |
| ⓘ | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Tyrrellite (TL) | 2.DA.05 | Cu(Co3+,Ni3+)2Se4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bornhardtite | 2.DA.05 | Co2+Co3+2Se4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Guanajuatite | 2.DB.05 | Bi2Se3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Paraguanajuatite | 2.DC.05 | Bi2Se3 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Jordisite | 2.EA.30 | MoS2 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Michenerite | 2.EB.25 | PdBiTe |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Jolliffeite (TL) | 2.EB.25 | NiAsSe |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| Group 3 - Halides | |||
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrohalite | 3.BA.05 | NaCl · 2H2O |
| ⓘ | Carnallite | 3.BA.10 | KMgCl3 · 6H2O |
| ⓘ | Bischofite | 3.BB.15 | MgCl2 · 6H2O |
| ⓘ | Korshunovskite | 3.BD.15 | Mg2Cl(OH)3 · 4H2O |
| ⓘ | Koenenite ? | 3.BD.25 | Na4Mg9Al4Cl12(OH)22 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Nolanite (TL) | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Lechatelierite | 4.DA.30 | SiO2 |
| ⓘ | Rutile var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Nordstrandite | 4.FE.10 | Al(OH)3 |
| ⓘ | Becquerelite | 4.GB.10 | Ca(UO2)6O4(OH)6 · 8H2O |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ | Masuyite | 4.GB.35 | Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ | Vandendriesscheite | 4.GB.40 | PbU7O22 · 12H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Hannebachite | 4.JE.10 | CaSO3 · H2O |
| ⓘ | Molybdomenite | 4.JF.05 | PbSeO3 |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| ⓘ | 'Clinochalcomenite' | 4.JH.10 | CuSeO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Nahcolite | 5.AA.15 | NaHCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Huntite | 5.AB.25 | CaMg3(CO3)4 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Zemkorite | 5.AC.10 | Na2Ca(CO3)2 |
| ⓘ | Fairchildite | 5.AC.20 | K2Ca(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Dawsonite | 5.BB.10 | NaAlCO3(OH)2 |
| ⓘ | Northupite | 5.BF.05 | Na3Mg(CO3)2Cl |
| ⓘ | Tychite | 5.BF.05 | Na6Mg2(CO3)4(SO4) |
| ⓘ | Bradleyite | 5.BF.10 | Na3Mg(CO3)(PO4) |
| ⓘ | Natron | 5.CB.10 | Na2CO3 · 10H2O |
| ⓘ | Trona | 5.CB.15 | Na3H(CO3)2 · 2H2O |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Ikaite | 5.CB.25 | CaCO3 · 6H2O |
| ⓘ | Pirssonite | 5.CB.30 | Na2Ca(CO3)2 · 2H2O |
| ⓘ | Gaylussite | 5.CB.35 | Na2Ca(CO3)2 · 5H2O |
| ⓘ | Dypingite | 5.DA.05 | Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Artinite | 5.DA.10 | Mg2(CO3)(OH)2 · 3H2O |
| ⓘ | Scarbroite | 5.DA.35 | Al5(CO3)(OH)13 · 5H2O |
| ⓘ | Rutherfordine | 5.EB.05 | (UO2)CO3 |
| ⓘ | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ | Nitratine | 5.NA.05 | NaNO3 |
| ⓘ | Niter | 5.NA.10 | KNO3 |
| ⓘ | Nitrobarite | 5.NA.20 | Ba(NO3)2 |
| Group 6 - Borates | |||
| ⓘ | Inderborite | 6.CA.25 | CaMg(H3B3O7)2 · 8H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Arcanite | 7.AD.05 | K2SO4 |
| ⓘ | Mercallite | 7.AD.10 | KHSO4 |
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Glauberite | 7.AD.25 | Na2Ca(SO4)2 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Olsacherite | 7.AD.35 | Pb2(Se6+O4)(SO4) |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | D'Ansite | 7.BC.05 | Na21Mg(SO4)10Cl3 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Burkeite | 7.BD.25 | Na6(CO3)(SO4)2 |
| ⓘ | Hanksite | 7.BD.30 | Na22K(SO4)9(CO3)2Cl |
| ⓘ | Kieserite | 7.CB.05 | MgSO4 · H2O |
| ⓘ | Starkeyite | 7.CB.15 | MgSO4 · 4H2O |
| ⓘ | Pentahydrite | 7.CB.20 | MgSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Krausite | 7.CC.05 | KFe(SO4)2 · H2O |
| ⓘ | Blödite | 7.CC.50 | Na2Mg(SO4)2 · 4H2O |
| ⓘ | Mohrite | 7.CC.60 | (NH4)2Fe(SO4)2 · 6H2O |
| ⓘ | Boussingaultite | 7.CC.60 | (NH4)2Mg(SO4)2 · 6H2O |
| ⓘ | Polyhalite | 7.CC.65 | K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Wattevilleite | 7.CC.85 | Na2Ca(SO4)2 · 4H2O (?) |
| ⓘ | Mirabilite | 7.CD.10 | Na2SO4 · 10H2O |
| ⓘ | Hydroglauberite | 7.CD.20 | Na10Ca3(SO4)8 · 6H2O |
| ⓘ | Eugsterite | 7.CD.25 | Na4Ca(SO4)3 · 2H2O |
| ⓘ | Görgeyite | 7.CD.30 | K2Ca5(SO4)6 · H2O |
| ⓘ | Syngenite | 7.CD.35 | K2Ca(SO4)2 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Meta-aluminite | 7.DC.05 | Al2(SO4)(OH)4 · 5H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Kainite | 7.DF.10 | KMg(SO4)Cl · 3H2O |
| ⓘ | Despujolsite | 7.DF.25 | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| ⓘ | Rapidcreekite | 7.DG.20 | Ca2(SO4)(CO3) · 4H2O |
| ⓘ | Uranopilite | 7.EA.05 | (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Farringtonite (TL) | 8.AB.05 | Mg3(PO4)2 |
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Stanfieldite | 8.AC.70 | Ca4Mg5(PO4)6 |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Woodhouseite | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Arsenoflorencite-(Ce) | 8.BL.13 | CeAl3(AsO4)2(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Foggite | 8.DL.05 | CaAl(PO4)(OH)2 · H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Metanováčekite | 8.EB.10 | Mg(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Ringwoodite | 9.AC.15 | (Mg,Fe2+)2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Majorite | 9.AD.25 | Mg3(MgSi)(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Cuprosklodowskite | 9.AK.10 | Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Sklodowskite | 9.AK.10 | Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Haiweeite | 9.AK.25 | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| ⓘ | Perrierite-(Ce) | 9.BE.70 | Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Oxy-schorl | 9.CK.05 | Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ | Magnesio-foitite | 9.CK.05 | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Oxy-dravite | 9.CK.05 | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | var. Soda-Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | var. Fassaite | 9.DA.15 | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-pargasite | 9.DE.15 | NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Ferro-edenite | 9.DE.15 | NaCa2Fe2+5(Si7Al)O22(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(Si3Al)O10)(OH)8 |
| ⓘ | Clinochlore var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Plessite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Copper Stain' | - | |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Alum Group' | - | XAl(SO4)2 · 12H2O |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Protodolomite' | - | (Ca,Mg)CO3 |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Alunite Supergroup' | - | AD3(XO4)2(OH)6 |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Apatite var. Carbonate-rich Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'UM1978-10-O:U' | - | U3O7 |
| ⓘ | 'Glimmerite' | - | |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Pyrobitumen var. Thucholite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Geikielite-Ilmenite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Andesine-oligoclase' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'UM1991-19-Se:AsCo' | - | (Co,Ni)AsSe |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| H | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bischofite | MgCl2 · 6H2O |
| H | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Carnallite | KMgCl3 · 6H2O |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Clinochalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Dawsonite | NaAlCO3(OH)2 |
| H | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| H | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| H | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| H | ⓘ Hydrohalite | NaCl · 2H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hannebachite | CaSO3 · H2O |
| H | ⓘ Ikaite | CaCO3 · 6H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kieserite | MgSO4 · H2O |
| H | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| H | ⓘ Krausite | KFe(SO4)2 · H2O |
| H | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| H | ⓘ Mercallite | KHSO4 |
| H | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| H | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mirabilite | Na2SO4 · 10H2O |
| H | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nahcolite | NaHCO3 |
| H | ⓘ Natron | Na2CO3 · 10H2O |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Nordstrandite | Al(OH)3 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pentahydrite | MgSO4 · 5H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| H | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Starkeyite | MgSO4 · 4H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| H | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| H | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| B | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| C | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Dawsonite | NaAlCO3(OH)2 |
| C | ⓘ Diamond | C |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| C | ⓘ Fairchildite | K2Ca(CO3)2 |
| C | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| C | ⓘ Huntite | CaMg3(CO3)4 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Ikaite | CaCO3 · 6H2O |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Nahcolite | NaHCO3 |
| C | ⓘ Natron | Na2CO3 · 10H2O |
| C | ⓘ Northupite | Na3Mg(CO3)2Cl |
| C | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| C | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| C | ⓘ Rutherfordine | (UO2)CO3 |
| C | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| C | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| C | ⓘ Zemkorite | Na2Ca(CO3)2 |
| C | ⓘ Protodolomite | (Ca,Mg)CO3 |
| N | Nitrogen | |
| N | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| N | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| N | ⓘ Nitratine | NaNO3 |
| N | ⓘ Niter | KNO3 |
| N | ⓘ Nitrobarite | Ba(NO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arcanite | K2SO4 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| O | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bischofite | MgCl2 · 6H2O |
| O | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| O | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Carnallite | KMgCl3 · 6H2O |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| O | ⓘ Dawsonite | NaAlCO3(OH)2 |
| O | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| O | ⓘ Fairchildite | K2Ca(CO3)2 |
| O | ⓘ Farringtonite | Mg3(PO4)2 |
| O | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| O | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| O | ⓘ Glauberite | Na2Ca(SO4)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| O | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Huntite | CaMg3(CO3)4 |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| O | ⓘ Hydrohalite | NaCl · 2H2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hannebachite | CaSO3 · H2O |
| O | ⓘ Ikaite | CaCO3 · 6H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kieserite | MgSO4 · H2O |
| O | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| O | ⓘ Krausite | KFe(SO4)2 · H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lechatelierite | SiO2 |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| O | ⓘ Mercallite | KHSO4 |
| O | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| O | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mirabilite | Na2SO4 · 10H2O |
| O | ⓘ Molybdomenite | PbSeO3 |
| O | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nahcolite | NaHCO3 |
| O | ⓘ Natron | Na2CO3 · 10H2O |
| O | ⓘ Nitratine | NaNO3 |
| O | ⓘ Niter | KNO3 |
| O | ⓘ Nitrobarite | Ba(NO3)2 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Nordstrandite | Al(OH)3 |
| O | ⓘ Northupite | Na3Mg(CO3)2Cl |
| O | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pentahydrite | MgSO4 · 5H2O |
| O | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| O | ⓘ Rutherfordine | (UO2)CO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| O | ⓘ Starkeyite | MgSO4 · 4H2O |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| O | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| O | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zemkorite | Na2Ca(CO3)2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| O | ⓘ Protodolomite | (Ca,Mg)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| O | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ UM1978-10-O:U | U3O7 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| Na | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| Na | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Na | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| Na | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Na | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Na | ⓘ Glauberite | Na2Ca(SO4)2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| Na | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| Na | ⓘ Hydrohalite | NaCl · 2H2O |
| Na | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Mirabilite | Na2SO4 · 10H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nahcolite | NaHCO3 |
| Na | ⓘ Natron | Na2CO3 · 10H2O |
| Na | ⓘ Nitratine | NaNO3 |
| Na | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| Na | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| Na | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| Na | ⓘ Zemkorite | Na2Ca(CO3)2 |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Na | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Na | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Bischofite | MgCl2 · 6H2O |
| Mg | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| Mg | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| Mg | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| Mg | ⓘ Carnallite | KMgCl3 · 6H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Farringtonite | Mg3(PO4)2 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Huntite | CaMg3(CO3)4 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| Mg | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Mg | ⓘ Kieserite | MgSO4 · H2O |
| Mg | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| Mg | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| Mg | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Pentahydrite | MgSO4 · 5H2O |
| Mg | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| Mg | ⓘ Starkeyite | MgSO4 · 4H2O |
| Mg | ⓘ Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Mg | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Mg | ⓘ Protodolomite | (Ca,Mg)CO3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Al | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nordstrandite | Al(OH)3 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Al | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Lechatelierite | SiO2 |
| Si | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Sudoite | Mg2Al3(Si3Al)O10)(OH)8 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Farringtonite | Mg3(PO4)2 |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arcanite | K2SO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| S | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glauberite | Na2Ca(SO4)2 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| S | ⓘ Hauchecornite | Ni9BiSbS8 |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| S | ⓘ Hannebachite | CaSO3 · H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordisite | MoS2 |
| S | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| S | ⓘ Kieserite | MgSO4 · H2O |
| S | ⓘ Krausite | KFe(SO4)2 · H2O |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mercallite | KHSO4 |
| S | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Mirabilite | Na2SO4 · 10H2O |
| S | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| S | ⓘ Pentahydrite | MgSO4 · 5H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Starkeyite | MgSO4 · 4H2O |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| S | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Bischofite | MgCl2 · 6H2O |
| Cl | ⓘ Carnallite | KMgCl3 · 6H2O |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| Cl | ⓘ Hydrohalite | NaCl · 2H2O |
| Cl | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Cl | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| Cl | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Arcanite | K2SO4 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Carnallite | KMgCl3 · 6H2O |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Fairchildite | K2Ca(CO3)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| K | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| K | ⓘ Krausite | KFe(SO4)2 · H2O |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Mercallite | KHSO4 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Niter | KNO3 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| Ca | ⓘ Fairchildite | K2Ca(CO3)2 |
| Ca | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Ca | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Ca | ⓘ Glauberite | Na2Ca(SO4)2 |
| Ca | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Huntite | CaMg3(CO3)4 |
| Ca | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| Ca | ⓘ Hannebachite | CaSO3 · H2O |
| Ca | ⓘ Ikaite | CaCO3 · 6H2O |
| Ca | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| Ca | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Ca | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| Ca | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | ⓘ Zemkorite | Na2Ca(CO3)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Ca | ⓘ Protodolomite | (Ca,Mg)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Eskebornite | CuFeSe2 |
| Fe | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Krausite | KFe(SO4)2 · H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Taenite | (Fe,Ni) |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Fe | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Co | Cobalt | |
| Co | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Freboldite | CoSe |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Co | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Hauchecornite | Ni9BiSbS8 |
| Ni | ⓘ Jolliffeite | NiAsSe |
| Ni | ⓘ Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | ⓘ Taenite | (Fe,Ni) |
| Ni | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Ni | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Athabascaite | Cu5Se4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Clinochalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Eskebornite | CuFeSe2 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Jolliffeite | NiAsSe |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| As | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Se | Selenium | |
| Se | ⓘ Athabascaite | Cu5Se4 |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Clinochalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Se | ⓘ Eskebornite | CuFeSe2 |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Freboldite | CoSe |
| Se | ⓘ Guanajuatite | Bi2Se3 |
| Se | ⓘ Jolliffeite | NiAsSe |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Molybdomenite | PbSeO3 |
| Se | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Se | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Se | ⓘ Paraguanajuatite | Bi2Se3 |
| Se | ⓘ Selenium | Se |
| Se | ⓘ Tiemannite | HgSe |
| Se | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Se | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Jordisite | MoS2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pd | Palladium | |
| Pd | ⓘ Froodite | α-PdBi2 |
| Pd | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Pd | ⓘ Michenerite | PdBiTe |
| Pd | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Tin | Sn |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Hauchecornite | Ni9BiSbS8 |
| Sb | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | ⓘ Michenerite | PdBiTe |
| Te | ⓘ Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Nitrobarite | Ba(NO3)2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Tiemannite | HgSe |
| Tl | Thallium | |
| Tl | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| Pb | ⓘ Molybdomenite | PbSeO3 |
| Pb | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Pb | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Bi | Bismuth | |
| Bi | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Froodite | α-PdBi2 |
| Bi | ⓘ Guanajuatite | Bi2Se3 |
| Bi | ⓘ Hauchecornite | Ni9BiSbS8 |
| Bi | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | ⓘ Michenerite | PdBiTe |
| Bi | ⓘ Paraguanajuatite | Bi2Se3 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| U | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| U | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Rutherfordine | (UO2)CO3 |
| U | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| U | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | ⓘ UM1978-10-O:U | U3O7 |
Fossils
There are 91 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1797 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 501 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 42 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 91 fossil localities |
- Saskatchewan
- Paleogene🐚 "4 miles above east end of Post Office"
- Pleistocene🐚 63rd Street
- Cenozoic🐚 Anxiety Butte
- Late/Upper Cretaceous🐚 Bainbridge River Bonebed
- Late/Upper Cretaceous🐚 Bearpaw Fm
- Paleocene🐚 Big Muddy 2
- Paleogene🐚 Blumenort
- Paleogene🐚 Calf Creek
- Paleogene🐚 Calf Creek bird locality
- Paleogene🐚 Carnagh
- Late/Upper Cretaceous🐚 Carrot River
- Late/Upper Cretaceous🐚 Carrot River Bonebed
- Cambrian🐚 Ceepee Reward Well
- Late/Upper Cretaceous🐚 Eastend "Scotty" site
- Pleistocene🐚 Fort Qu'Appelle
- Miocene🐚 Four Courners
- Phanerozoic🐚 Fr-1
- Paleocene🐚 French Fry
- Late/Upper Cretaceous🐚 Glen McPherson
- Late/Upper Cretaceous🐚 Grasslands National Park
- Late/Upper Cretaceous🐚 Gryde locality
- Late/Upper Cretaceous🐚 GSC Loc. 10374
- Late/Upper Cretaceous🐚 GSC Loc. 10375
- Late/Upper Cretaceous🐚 GSC Loc. 10395
- Late/Upper Cretaceous🐚 GSC Loc. 10407
- Late/Upper Cretaceous🐚 GSC Loc. 10437
- Late/Upper Cretaceous🐚 GSC Loc. 16313
- Late/Upper Cretaceous🐚 GSC Loc. 16325
- Late/Upper Cretaceous🐚 GSC Loc. 16326
- Late/Upper Cretaceous🐚 GSC Loc. 17882
- Late/Upper Cretaceous🐚 GSC Loc. 97990
- Late/Upper Cretaceous🐚 GSC Loc. 97995
- Late/Upper Cretaceous🐚 GSC Loc. 98003
- Paleocene🐚 Harptree 8
- Late/Upper Cretaceous🐚 Herbert Ferry
- Paleogene🐚 Irish Spring
- Paleocene🐚 Joffre Bridge Road Cut Fish Layer
- Late/Upper Cretaceous🐚 kaolin quarry
- Cenozoic🐚 Kealey Springs West
- Late/Upper Cretaceous🐚 Killdeer Badlands
- Late/Upper Cretaceous🐚 KJ87112
- Miocene🐚 Kleinfelder Farm
- Paleocene🐚 Knollys
- Eocene🐚 Lac Pelletier Lower Fauna
- Saskatchewan
- Phanerozoic🐚 Long Fall Horizon
- Late/Upper Cretaceous🐚 Medalta pit
- Late/Upper Cretaceous🐚 Morgan Creek
- Late/Upper Cretaceous🐚 Morgan Creek
- Pleistocene🐚 Muskox Pit
- Late/Upper Cretaceous🐚 Near Herschel
- Late/Upper Cretaceous🐚 north of Stewart Valley
- Late/Upper Cretaceous🐚 north side
- Paleozoic🐚 Northeastern Manitoba
- Late/Upper Cretaceous🐚 Notukeu Creek
- Late/Upper Cretaceous🐚 Notukeu Creek [Bearpaw Fm]
- Late/Upper Cretaceous🐚 Old Man
- Late/Upper Cretaceous🐚 Outlook ["Belly River Fm"]
- Paleocene🐚 Pine Cree Park
- Pleistocene🐚 Riddell
- Paleocene🐚 Roche Percée
- Miocene🐚 Rockglen
- Phanerozoic🐚 Rocky Creek plants
- Devonian🐚 SE EPB EPF
- Paleozoic🐚 Shamattawa Limestone Cephalopods
- Paleogene🐚 Simmie
- Late/Upper Cretaceous🐚 SMNH Frenchman River
- Miocene🐚 South of Fir Mountain
- Late/Upper Cretaceous🐚 south of Shaunavon
- Late/Upper Cretaceous🐚 South Saskatchewan River
- Late/Upper Cretaceous🐚 south side
- Paleocene🐚 Southeast of Montague Lake
- Cretaceous🐚 Southern Saskatchewan
- Paleozoic🐚 Stony Mountain Formation
- Pleistocene🐚 Sutherland Pit
- Eocene🐚 Swift Current Creek
- Miocene🐚 Topham
- Late/Upper Cretaceous🐚 Unity
- Paleocene🐚 US4
- Paleocene🐚 Vicinity of Estevan and Roche Percee
- Miocene🐚 West of Conglomerate Creek
- Paleocene🐚 Willow Bunch
- Late/Upper Cretaceous🐚 Wood Mountain
- Late/Upper Cretaceous🐚 Woodpile Creek
- Census Division 8
- Unity
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Saskatchewan |
|---|---|
| Wikidata ID: | Q1989 |
| GeoNames ID: | 6141242 |
Localities in this Region
- Saskatchewan
- Alces Lake
- ⭔Amisk Lake District
- Athabasca Basin
- Centennial deposit
- Cigar Lake Mine
- Cluff Lake mines
- Dawn Lake Uranium Deposit
- ⭔Honsvall Lake
- Key Lake Mine
- MacAskill occurrence
- McArthur River Mine
- McLean Lake deposit
- Millenium Deposit
- ⭔Moore Lake
- Patterson Lake
- Rabbit Lake Mine
- Roughrider deposit
- Shea Creek Prospect
- Wheeler River Project
- ⭔Zimmer Lake area
- ⭔Beaverlodge Lake area
- Archie Lake
- Beta Gamma Mine
- Black Bay Uranium Mines
- Bolger mine
- Camdeck occurrence
- Cayzor mine (Azor)
- Cenex U deposit
- Eagle Claims U-Cu-Se occurrence
- Eagle Mine (Eagle-Ace)
- Eldorado Mining & Refining Ltd. mines
- ⭔Goldfields District
- Gunnar mine (Gunnar deposit)
- Hal Lake Selenium Occurrence No. 1
- Lake Cinch mine
- Martin Lake mine
- National Explorations mine
- Nesbitt LaBine Uranium mine
- Pitch Ore mine
- Pitche Group
- Rix-Athabasca Uranium mines
- St. Louis fault
- Saskatchewan
- Beaverlodge Lake area
- Buzzard Coulee meteorite
- Catherwood
- ⭔Census Division 8
- Ceylon Lake
- Clover Leaf Mine
- Dominique-Peter Mine
- ⭔Esterhazy
- Fort à la Corne
- Foster River
- Glen Uranium Adit
- ⭔Guernsey
- ⭔Hanson Lake
- ⭔Lac la Ronge
- ⭔Lake Athabasca
- Manito Lake
- Muskiki Lake
- Nisikkatch Lake
- Nistowiack Lake
- North lngebright Lake
- Pinky Fault Uranium Deposit
- Rio Mine
- ?Rocanville
- Rottenstone Mine
- Seabee Gold Operation
- ?Springwater
- Star-Orion South Diamond Project
- ?Swift Current
- ⭔Tazin Lake
- ⭔Unity
- Waldsea Lake
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Athabasca basinBasin
- West Canadian-Alberta basinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
McArthur River Mine, Athabasca Basin, Saskatchewan, Canada